- Name
- Triethylamine
- InChI
- InChI=1S/C6H15N/c1-4-7(5-2)6-3/h4-6H2,1-3H3
- InChI Key
- ZMANZCXQSJIPKH-UHFFFAOYSA-N
- Formula
- C6H15N
- SMILES
- CCN(CC)CC
- Mol. Weight (g/mol)
- 101.19
- CAS
- 121-44-8
- Name
- 1,4-Dioxane
- InChI
- InChI=1S/C4H8O2/c1-2-6-4-3-5-1/h1-4H2
- InChI Key
- RYHBNJHYFVUHQT-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- C1COCCO1
- Mol. Weight (g/mol)
- 88.11
- CAS
- 123-91-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (6)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (4)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Temperature, K = 303.15 (Liquid)
| Mole fraction of Triethylamine (1) - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 0.0138 | 0.0011 |
| 0.0232 | 0.0010 |
| 0.0349 | 0.0010 |
| 0.0453 | 0.0010 |
| 0.0551 | 0.0010 |
| 0.0691 | 0.0010 |
| 0.0803 | 0.0009 |
| 0.0909 | 0.0009 |
| 0.1006 | 0.0009 |
| 0.1128 | 0.0009 |
Viscosity, Pa*s [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Molality, mol/kg of Triethylamine (1) - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 0.1590 | 0.0011 |
| 0.2697 | 0.0010 |
| 0.4098 | 0.0010 |
| 0.5388 | 0.0010 |
| 0.6616 | 0.0010 |
| 0.8419 | 0.0010 |
| 0.9909 | 0.0009 |
| 1.135 | 0.0009 |
| 1.2695 | 0.0009 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0004 |
| 298.15 | 0.1104 | 0.0004 |
| 298.15 | 0.2044 | 0.0004 |
| 298.15 | 0.3028 | 0.0005 |
| 298.15 | 0.3980 | 0.0005 |
| 298.15 | 0.4946 | 0.0005 |
| 298.15 | 0.5986 | 0.0006 |
| 298.15 | 0.6952 | 0.0007 |
| 298.15 | 0.7996 | 0.0008 |
| 298.15 | 0.8934 | 0.0010 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0003 |
| 303.15 | 0.1104 | 0.0004 |
| 303.15 | 0.2044 | 0.0004 |
| 303.15 | 0.3028 | 0.0004 |
| 303.15 | 0.3980 | 0.0005 |
| 303.15 | 0.4946 | 0.0005 |
| 303.15 | 0.5986 | 0.0006 |
| 303.15 | 0.6952 | 0.0007 |
| 303.15 | 0.7996 | 0.0008 |
| 303.15 | 0.8934 | 0.0009 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0003 |
| 308.15 | 0.1104 | 0.0004 |
| 308.15 | 0.2044 | 0.0004 |
| 308.15 | 0.3028 | 0.0004 |
| 308.15 | 0.3980 | 0.0004 |
| 308.15 | 0.4946 | 0.0005 |
| 308.15 | 0.5986 | 0.0005 |
| 308.15 | 0.6952 | 0.0006 |
| 308.15 | 0.7996 | 0.0007 |
| 308.15 | 0.8934 | 0.0008 |
| 308.15 | 1.0000 | 0.0010 |
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Temperature, K = 303.15 (Liquid)
| Mole fraction of Triethylamine (1) - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 0.0138 | 0.0011 |
| 0.0232 | 0.0010 |
| 0.0349 | 0.0010 |
| 0.0453 | 0.0010 |
| 0.0551 | 0.0010 |
| 0.0691 | 0.0010 |
| 0.0803 | 0.0009 |
| 0.0909 | 0.0009 |
| 0.1006 | 0.0009 |
| 0.1128 | 0.0009 |
Viscosity, Pa*s [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Molality, mol/kg of Triethylamine (1) - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 0.1590 | 0.0011 |
| 0.2697 | 0.0010 |
| 0.4098 | 0.0010 |
| 0.5388 | 0.0010 |
| 0.6616 | 0.0010 |
| 0.8419 | 0.0010 |
| 0.9909 | 0.0009 |
| 1.135 | 0.0009 |
| 1.2695 | 0.0009 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0004 |
| 298.15 | 0.1104 | 0.0004 |
| 298.15 | 0.2044 | 0.0004 |
| 298.15 | 0.3028 | 0.0005 |
| 298.15 | 0.3980 | 0.0005 |
| 298.15 | 0.4946 | 0.0005 |
| 298.15 | 0.5986 | 0.0006 |
| 298.15 | 0.6952 | 0.0007 |
| 298.15 | 0.7996 | 0.0008 |
| 298.15 | 0.8934 | 0.0010 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0003 |
| 303.15 | 0.1104 | 0.0004 |
| 303.15 | 0.2044 | 0.0004 |
| 303.15 | 0.3028 | 0.0004 |
| 303.15 | 0.3980 | 0.0005 |
| 303.15 | 0.4946 | 0.0005 |
| 303.15 | 0.5986 | 0.0006 |
| 303.15 | 0.6952 | 0.0007 |
| 303.15 | 0.7996 | 0.0008 |
| 303.15 | 0.8934 | 0.0009 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0003 |
| 308.15 | 0.1104 | 0.0004 |
| 308.15 | 0.2044 | 0.0004 |
| 308.15 | 0.3028 | 0.0004 |
| 308.15 | 0.3980 | 0.0004 |
| 308.15 | 0.4946 | 0.0005 |
| 308.15 | 0.5986 | 0.0005 |
| 308.15 | 0.6952 | 0.0006 |
| 308.15 | 0.7996 | 0.0007 |
| 308.15 | 0.8934 | 0.0008 |
| 308.15 | 1.0000 | 0.0010 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.3983 |
| 298.15 | 0.1104 | 1.3996 |
| 298.15 | 0.2044 | 1.4014 |
| 298.15 | 0.3028 | 1.4032 |
| 298.15 | 0.3980 | 1.4048 |
| 298.15 | 0.4946 | 1.4068 |
| 298.15 | 0.5986 | 1.4095 |
| 298.15 | 0.6952 | 1.4117 |
| 298.15 | 0.7996 | 1.4147 |
| 298.15 | 0.8934 | 1.4176 |
| 298.15 | 1.0000 | 1.4201 |
| 303.15 | 0.0000 | 1.3955 |
| 303.15 | 0.1104 | 1.3969 |
| 303.15 | 0.2044 | 1.3985 |
| 303.15 | 0.3028 | 1.4002 |
| 303.15 | 0.3980 | 1.402 |
| 303.15 | 0.4946 | 1.404 |
| 303.15 | 0.5986 | 1.4067 |
| 303.15 | 0.6952 | 1.409 |
| 303.15 | 0.7996 | 1.412 |
| 303.15 | 0.8934 | 1.4148 |
| 303.15 | 1.0000 | 1.417 |
| 308.15 | 0.0000 | 1.3926 |
| 308.15 | 0.1104 | 1.3942 |
| 308.15 | 0.2044 | 1.3956 |
| 308.15 | 0.3028 | 1.3972 |
| 308.15 | 0.3980 | 1.3994 |
| 308.15 | 0.4946 | 1.4013 |
| 308.15 | 0.5986 | 1.4041 |
| 308.15 | 0.6952 | 1.4062 |
| 308.15 | 0.7996 | 1.4093 |
| 308.15 | 0.8934 | 1.4121 |
| 308.15 | 1.0000 | 1.4143 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.3983 |
| 298.15 | 0.1104 | 1.3996 |
| 298.15 | 0.2044 | 1.4014 |
| 298.15 | 0.3028 | 1.4032 |
| 298.15 | 0.3980 | 1.4048 |
| 298.15 | 0.4946 | 1.4068 |
| 298.15 | 0.5986 | 1.4095 |
| 298.15 | 0.6952 | 1.4117 |
| 298.15 | 0.7996 | 1.4147 |
| 298.15 | 0.8934 | 1.4176 |
| 298.15 | 1.0000 | 1.4201 |
| 303.15 | 0.0000 | 1.3955 |
| 303.15 | 0.1104 | 1.3969 |
| 303.15 | 0.2044 | 1.3985 |
| 303.15 | 0.3028 | 1.4002 |
| 303.15 | 0.3980 | 1.402 |
| 303.15 | 0.4946 | 1.404 |
| 303.15 | 0.5986 | 1.4067 |
| 303.15 | 0.6952 | 1.409 |
| 303.15 | 0.7996 | 1.412 |
| 303.15 | 0.8934 | 1.4148 |
| 303.15 | 1.0000 | 1.417 |
| 308.15 | 0.0000 | 1.3926 |
| 308.15 | 0.1104 | 1.3942 |
| 308.15 | 0.2044 | 1.3956 |
| 308.15 | 0.3028 | 1.3972 |
| 308.15 | 0.3980 | 1.3994 |
| 308.15 | 0.4946 | 1.4013 |
| 308.15 | 0.5986 | 1.4041 |
| 308.15 | 0.6952 | 1.4062 |
| 308.15 | 0.7996 | 1.4093 |
| 308.15 | 0.8934 | 1.4121 |
| 308.15 | 1.0000 | 1.4143 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Temperature, K = 303.15 (Liquid)
| Mole fraction of Triethylamine (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0138 | 1015.32 |
| 0.0232 | 1010.65 |
| 0.0349 | 1004.86 |
| 0.0453 | 999.87 |
| 0.0551 | 995.17 |
| 0.0691 | 988.57 |
| 0.0803 | 983.41 |
| 0.0909 | 978.57 |
| 0.1006 | 974.22 |
| 0.1128 | 968.78 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 723.1 |
| 298.15 | 0.1104 | 744.6 |
| 298.15 | 0.2044 | 764.5 |
| 298.15 | 0.3028 | 787.3 |
| 298.15 | 0.3980 | 811.3 |
| 298.15 | 0.4946 | 838.0 |
| 298.15 | 0.5986 | 869.7 |
| 298.15 | 0.6952 | 902.3 |
| 298.15 | 0.7996 | 941.2 |
| 298.15 | 0.8934 | 979.8 |
| 298.15 | 1.0000 | 1027.6 |
| 303.15 | 0.0000 | 718.5 |
| 303.15 | 0.1104 | 739.7 |
| 303.15 | 0.2044 | 759.5 |
| 303.15 | 0.3028 | 782.2 |
| 303.15 | 0.3980 | 806.1 |
| 303.15 | 0.4946 | 832.8 |
| 303.15 | 0.5986 | 864.3 |
| 303.15 | 0.6952 | 896.8 |
| 303.15 | 0.7996 | 935.6 |
| 303.15 | 0.8934 | 974.2 |
| 303.15 | 1.0000 | 1021.9 |
| 308.15 | 0.0000 | 713.6 |
| 308.15 | 0.1104 | 734.8 |
| 308.15 | 0.2044 | 754.6 |
| 308.15 | 0.3028 | 777.1 |
| 308.15 | 0.3980 | 800.9 |
| 308.15 | 0.4946 | 827.5 |
| 308.15 | 0.5986 | 859.0 |
| 308.15 | 0.6952 | 891.5 |
| 308.15 | 0.7996 | 930.0 |
| 308.15 | 0.8934 | 968.5 |
| 308.15 | 1.0000 | 1016.2 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Temperature, K = 303.15 (Liquid)
| Mole fraction of Triethylamine (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0138 | 1015.32 |
| 0.0232 | 1010.65 |
| 0.0349 | 1004.86 |
| 0.0453 | 999.87 |
| 0.0551 | 995.17 |
| 0.0691 | 988.57 |
| 0.0803 | 983.41 |
| 0.0909 | 978.57 |
| 0.1006 | 974.22 |
| 0.1128 | 968.78 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 723.1 |
| 298.15 | 0.1104 | 744.6 |
| 298.15 | 0.2044 | 764.5 |
| 298.15 | 0.3028 | 787.3 |
| 298.15 | 0.3980 | 811.3 |
| 298.15 | 0.4946 | 838.0 |
| 298.15 | 0.5986 | 869.7 |
| 298.15 | 0.6952 | 902.3 |
| 298.15 | 0.7996 | 941.2 |
| 298.15 | 0.8934 | 979.8 |
| 298.15 | 1.0000 | 1027.6 |
| 303.15 | 0.0000 | 718.5 |
| 303.15 | 0.1104 | 739.7 |
| 303.15 | 0.2044 | 759.5 |
| 303.15 | 0.3028 | 782.2 |
| 303.15 | 0.3980 | 806.1 |
| 303.15 | 0.4946 | 832.8 |
| 303.15 | 0.5986 | 864.3 |
| 303.15 | 0.6952 | 896.8 |
| 303.15 | 0.7996 | 935.6 |
| 303.15 | 0.8934 | 974.2 |
| 303.15 | 1.0000 | 1021.9 |
| 308.15 | 0.0000 | 713.6 |
| 308.15 | 0.1104 | 734.8 |
| 308.15 | 0.2044 | 754.6 |
| 308.15 | 0.3028 | 777.1 |
| 308.15 | 0.3980 | 800.9 |
| 308.15 | 0.4946 | 827.5 |
| 308.15 | 0.5986 | 859.0 |
| 308.15 | 0.6952 | 891.5 |
| 308.15 | 0.7996 | 930.0 |
| 308.15 | 0.8934 | 968.5 |
| 308.15 | 1.0000 | 1016.2 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of 1,4-Dioxane (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1127.0 |
| 0.1104 | 1139.0 |
| 0.2044 | 1155.0 |
| 0.3028 | 1172.0 |
| 0.3980 | 1189.0 |
| 0.4946 | 1210.0 |
| 0.5986 | 1234.0 |
| 0.6952 | 1260.0 |
| 0.7996 | 1290.0 |
| 0.8934 | 1318.0 |
| 1.0000 | 1343.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of 1,4-Dioxane (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1127.0 |
| 0.1104 | 1139.0 |
| 0.2044 | 1155.0 |
| 0.3028 | 1172.0 |
| 0.3980 | 1189.0 |
| 0.4946 | 1210.0 |
| 0.5986 | 1234.0 |
| 0.6952 | 1260.0 |
| 0.7996 | 1290.0 |
| 0.8934 | 1318.0 |
| 1.0000 | 1343.0 |
Sources
- Studies of viscosities of dilute solutions of alkylamine in non-electrolyte solvents. II. Haloalkanes and other polar solvents
- Studies of viscosities of dilute solutions of alkylamines in non-electrolyte solvents: IV. Alkylamines in 1,4-dioxane and oxolane at 303.15K
- Density, Viscosity, Refractive Index, and Speed of Sound in the Binary Mixtures of 1,4-Dioxane + Ethanediol, + Hexane, + Tributylamine, or + Triethylamine at (298.15, 303.15, and 308.15) K