- Name
- 1,3-Dioxolane
- InChI
- InChI=1S/C3H6O2/c1-2-5-3-4-1/h1-3H2
- InChI Key
- WNXJIVFYUVYPPR-UHFFFAOYSA-N
- Formula
- C3H6O2
- SMILES
- C1COCO1
- Mol. Weight (g/mol)
- 74.08
- CAS
- 646-06-0
- Name
- Dimethyl Sulfoxide
- InChI
- InChI=1S/C2H6OS/c1-4(2)3/h1-2H3
- InChI Key
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N
- Formula
- C2H6OS
- SMILES
- CS(C)=O
- Mol. Weight (g/mol)
- 78.13
- CAS
- 67-68-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Cp,liquid - Molar heat capacity at constant pressure, J/K/mol (2)
- Excess molar enthalpy (molar enthalpy (2)
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational conditions:
- Temperature, K = 308.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Dimethyl Sulfoxide (2) - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
|---|---|
| 0.0532 | 125.20 |
| 0.1036 | 126.20 |
| 0.1897 | 128.20 |
| 0.3044 | 131.30 |
| 0.3922 | 133.90 |
| 0.5058 | 137.30 |
| 0.5455 | 138.50 |
| 0.5936 | 139.90 |
| 0.7053 | 143.40 |
| 0.7810 | 145.90 |
| 0.9015 | 150.30 |
| 0.9431 | 152.00 |
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational conditions:
- Temperature, K = 308.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Dimethyl Sulfoxide (2) - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
|---|---|
| 0.0532 | 125.20 |
| 0.1036 | 126.20 |
| 0.1897 | 128.20 |
| 0.3044 | 131.30 |
| 0.3922 | 133.90 |
| 0.5058 | 137.30 |
| 0.5455 | 138.50 |
| 0.5936 | 139.90 |
| 0.7053 | 143.40 |
| 0.7810 | 145.90 |
| 0.9015 | 150.30 |
| 0.9431 | 152.00 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 308.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Dimethyl Sulfoxide (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0394 | 0.0610 |
| 0.0757 | 0.1070 |
| 0.1095 | 0.1400 |
| 0.1408 | 0.1710 |
| 0.1974 | 0.2000 |
| 0.2469 | 0.2260 |
| 0.3297 | 0.2500 |
| 0.3959 | 0.2630 |
| 0.4959 | 0.2710 |
| 0.5961 | 0.2640 |
| 0.6630 | 0.2550 |
| 0.7469 | 0.2350 |
| 0.7973 | 0.2170 |
| 0.8551 | 0.1790 |
| 0.8872 | 0.1480 |
| 0.9219 | 0.1120 |
| 0.9594 | 0.0650 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 308.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Dimethyl Sulfoxide (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0394 | 0.0610 |
| 0.0757 | 0.1070 |
| 0.1095 | 0.1400 |
| 0.1408 | 0.1710 |
| 0.1974 | 0.2000 |
| 0.2469 | 0.2260 |
| 0.3297 | 0.2500 |
| 0.3959 | 0.2630 |
| 0.4959 | 0.2710 |
| 0.5961 | 0.2640 |
| 0.6630 | 0.2550 |
| 0.7469 | 0.2350 |
| 0.7973 | 0.2170 |
| 0.8551 | 0.1790 |
| 0.8872 | 0.1480 |
| 0.9219 | 0.1120 |
| 0.9594 | 0.0650 |