- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
- Name
- 2-Deoxy-D-glucose
- InChI
- InChI=1S/C6H12O5/c7-2-4-6(10)3(8)1-5(9)11-4/h3-10H,1-2H2
- InChI Key
- PMMURAAUARKVCB-UHFFFAOYSA-N
- Formula
- C6H12O5
- SMILES
- OCC1OC(O)CC(O)C1O
- Mol. Weight (g/mol)
- 164.16
- CAS
- 154-17-6
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 2-Deoxy-D-glucose (2) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0400 | 0.0012 |
| 288.15 | 0.0600 | 0.0012 |
| 288.15 | 0.0797 | 0.0012 |
| 288.15 | 0.1001 | 0.0012 |
| 288.15 | 0.1201 | 0.0012 |
| 288.15 | 0.1399 | 0.0012 |
| 298.15 | 0.0400 | 0.0009 |
| 298.15 | 0.0600 | 0.0009 |
| 298.15 | 0.0797 | 0.0009 |
| 298.15 | 0.1001 | 0.0009 |
| 298.15 | 0.1201 | 0.0009 |
| 298.15 | 0.1399 | 0.0009 |
| 308.15 | 0.0400 | 0.0007 |
| 308.15 | 0.0600 | 0.0007 |
| 308.15 | 0.0797 | 0.0007 |
| 308.15 | 0.1001 | 0.0007 |
| 308.15 | 0.1201 | 0.0008 |
| 308.15 | 0.1399 | 0.0008 |
| 318.15 | 0.0400 | 0.0006 |
| 318.15 | 0.0600 | 0.0006 |
| 318.15 | 0.0797 | 0.0006 |
| 318.15 | 0.1001 | 0.0006 |
| 318.15 | 0.1201 | 0.0006 |
| 318.15 | 0.1399 | 0.0006 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 2-Deoxy-D-glucose (2) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0424 | 0.0012 |
| 288.15 | 0.0502 | 0.0012 |
| 288.15 | 0.0584 | 0.0012 |
| 288.15 | 0.0867 | 0.0012 |
| 288.15 | 0.0974 | 0.0012 |
| 288.15 | 0.1223 | 0.0012 |
| 288.15 | 0.1410 | 0.0012 |
| 298.15 | 0.0424 | 0.0009 |
| 298.15 | 0.0502 | 0.0009 |
| 298.15 | 0.0584 | 0.0009 |
| 298.15 | 0.0867 | 0.0009 |
| 298.15 | 0.0974 | 0.0009 |
| 298.15 | 0.1223 | 0.0009 |
| 298.15 | 0.1410 | 0.0009 |
| 308.15 | 0.0424 | 0.0007 |
| 308.15 | 0.0502 | 0.0007 |
| 308.15 | 0.0584 | 0.0007 |
| 308.15 | 0.0867 | 0.0007 |
| 308.15 | 0.0974 | 0.0007 |
| 308.15 | 0.1223 | 0.0008 |
| 308.15 | 0.1410 | 0.0008 |
| 318.15 | 0.0424 | 0.0006 |
| 318.15 | 0.0502 | 0.0006 |
| 318.15 | 0.0584 | 0.0006 |
| 318.15 | 0.0867 | 0.0006 |
| 318.15 | 0.0974 | 0.0006 |
| 318.15 | 0.1223 | 0.0006 |
| 318.15 | 0.1410 | 0.0006 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 2-Deoxy-D-glucose (2) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0400 | 0.0012 |
| 288.15 | 0.0600 | 0.0012 |
| 288.15 | 0.0797 | 0.0012 |
| 288.15 | 0.1001 | 0.0012 |
| 288.15 | 0.1201 | 0.0012 |
| 288.15 | 0.1399 | 0.0012 |
| 298.15 | 0.0400 | 0.0009 |
| 298.15 | 0.0600 | 0.0009 |
| 298.15 | 0.0797 | 0.0009 |
| 298.15 | 0.1001 | 0.0009 |
| 298.15 | 0.1201 | 0.0009 |
| 298.15 | 0.1399 | 0.0009 |
| 308.15 | 0.0400 | 0.0007 |
| 308.15 | 0.0600 | 0.0007 |
| 308.15 | 0.0797 | 0.0007 |
| 308.15 | 0.1001 | 0.0007 |
| 308.15 | 0.1201 | 0.0008 |
| 308.15 | 0.1399 | 0.0008 |
| 318.15 | 0.0400 | 0.0006 |
| 318.15 | 0.0600 | 0.0006 |
| 318.15 | 0.0797 | 0.0006 |
| 318.15 | 0.1001 | 0.0006 |
| 318.15 | 0.1201 | 0.0006 |
| 318.15 | 0.1399 | 0.0006 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 2-Deoxy-D-glucose (2) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0424 | 0.0012 |
| 288.15 | 0.0502 | 0.0012 |
| 288.15 | 0.0584 | 0.0012 |
| 288.15 | 0.0867 | 0.0012 |
| 288.15 | 0.0974 | 0.0012 |
| 288.15 | 0.1223 | 0.0012 |
| 288.15 | 0.1410 | 0.0012 |
| 298.15 | 0.0424 | 0.0009 |
| 298.15 | 0.0502 | 0.0009 |
| 298.15 | 0.0584 | 0.0009 |
| 298.15 | 0.0867 | 0.0009 |
| 298.15 | 0.0974 | 0.0009 |
| 298.15 | 0.1223 | 0.0009 |
| 298.15 | 0.1410 | 0.0009 |
| 308.15 | 0.0424 | 0.0007 |
| 308.15 | 0.0502 | 0.0007 |
| 308.15 | 0.0584 | 0.0007 |
| 308.15 | 0.0867 | 0.0007 |
| 308.15 | 0.0974 | 0.0007 |
| 308.15 | 0.1223 | 0.0008 |
| 308.15 | 0.1410 | 0.0008 |
| 318.15 | 0.0424 | 0.0006 |
| 318.15 | 0.0502 | 0.0006 |
| 318.15 | 0.0584 | 0.0006 |
| 318.15 | 0.0867 | 0.0006 |
| 318.15 | 0.0974 | 0.0006 |
| 318.15 | 0.1223 | 0.0006 |
| 318.15 | 0.1410 | 0.0006 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational conditions:
- Initial molality of solute, mol/kg = 0.25 (Liquid)
- Pressure, kPa = 101.3 (Liquid)
- Final molality of solute, mol/kg = 0.0048705 (Liquid)
| Temperature, K - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
|---|---|
| 288.15 | -0.1562 |
| 298.15 | -0.1418 |
| 308.15 | -0.1192 |
| 318.15 | -0.1015 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational conditions:
- Initial molality of solute, mol/kg = 0.25 (Liquid)
- Pressure, kPa = 100 (Liquid)
- Final molality of solute, mol/kg = 0 (Liquid)
| Temperature, K - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
|---|---|
| 288.15 | -0.1598 |
| 298.15 | -0.1454 |
| 308.15 | -0.1223 |
| 318.15 | -0.1050 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational conditions:
- Initial molality of solute, mol/kg = 0.5 (Liquid)
- Pressure, kPa = 100 (Liquid)
- Final molality of solute, mol/kg = 0 (Liquid)
| Temperature, K - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
|---|---|
| 288.15 | -0.2850 |
| 298.15 | -0.2780 |
| 308.15 | -0.2290 |
| 318.15 | -0.2170 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational conditions:
- Initial molality of solute, mol/kg = 0.25 (Liquid)
- Pressure, kPa = 101.3 (Liquid)
- Final molality of solute, mol/kg = 0.0048705 (Liquid)
| Temperature, K - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
|---|---|
| 288.15 | -0.1562 |
| 298.15 | -0.1418 |
| 308.15 | -0.1192 |
| 318.15 | -0.1015 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational conditions:
- Initial molality of solute, mol/kg = 0.25 (Liquid)
- Pressure, kPa = 100 (Liquid)
- Final molality of solute, mol/kg = 0 (Liquid)
| Temperature, K - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
|---|---|
| 288.15 | -0.1598 |
| 298.15 | -0.1454 |
| 308.15 | -0.1223 |
| 318.15 | -0.1050 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational conditions:
- Initial molality of solute, mol/kg = 0.5 (Liquid)
- Pressure, kPa = 100 (Liquid)
- Final molality of solute, mol/kg = 0 (Liquid)
| Temperature, K - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
|---|---|
| 288.15 | -0.2850 |
| 298.15 | -0.2780 |
| 308.15 | -0.2290 |
| 318.15 | -0.2170 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Frequency, MHz = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 2-Deoxy-D-glucose (2) - Liquid | Speed of sound, m/s - Liquid |
| 288.15 | 0.0445 | 1468.52 |
| 288.15 | 0.0626 | 1469.57 |
| 288.15 | 0.0892 | 1471.09 |
| 288.15 | 0.0980 | 1471.6 |
| 288.15 | 0.1031 | 1471.87 |
| 288.15 | 0.1275 | 1473.24 |
| 298.15 | 0.0445 | 1499.15 |
| 298.15 | 0.0626 | 1500.08 |
| 298.15 | 0.0892 | 1501.44 |
| 298.15 | 0.0980 | 1501.89 |
| 298.15 | 0.1031 | 1502.13 |
| 298.15 | 0.1275 | 1503.34 |
| 308.15 | 0.0445 | 1522.09 |
| 308.15 | 0.0626 | 1522.97 |
| 308.15 | 0.0892 | 1524.26 |
| 308.15 | 0.0980 | 1524.69 |
| 308.15 | 0.1031 | 1524.93 |
| 308.15 | 0.1275 | 1526.1 |
| 318.15 | 0.0445 | 1538.24 |
| 318.15 | 0.0626 | 1538.99 |
| 318.15 | 0.0892 | 1540.08 |
| 318.15 | 0.0980 | 1540.45 |
| 318.15 | 0.1031 | 1540.65 |
| 318.15 | 0.1275 | 1541.64 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Frequency, MHz = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 2-Deoxy-D-glucose (2) - Liquid | Speed of sound, m/s - Liquid |
| 288.15 | 0.0445 | 1468.52 |
| 288.15 | 0.0626 | 1469.57 |
| 288.15 | 0.0892 | 1471.09 |
| 288.15 | 0.0980 | 1471.6 |
| 288.15 | 0.1031 | 1471.87 |
| 288.15 | 0.1275 | 1473.24 |
| 298.15 | 0.0445 | 1499.15 |
| 298.15 | 0.0626 | 1500.08 |
| 298.15 | 0.0892 | 1501.44 |
| 298.15 | 0.0980 | 1501.89 |
| 298.15 | 0.1031 | 1502.13 |
| 298.15 | 0.1275 | 1503.34 |
| 308.15 | 0.0445 | 1522.09 |
| 308.15 | 0.0626 | 1522.97 |
| 308.15 | 0.0892 | 1524.26 |
| 308.15 | 0.0980 | 1524.69 |
| 308.15 | 0.1031 | 1524.93 |
| 308.15 | 0.1275 | 1526.1 |
| 318.15 | 0.0445 | 1538.24 |
| 318.15 | 0.0626 | 1538.99 |
| 318.15 | 0.0892 | 1540.08 |
| 318.15 | 0.0980 | 1540.45 |
| 318.15 | 0.1031 | 1540.65 |
| 318.15 | 0.1275 | 1541.64 |
Sources
- Investigations to explore interactions in (polyhydroxy solute + L-ascorbic acid + H2O) solutions at different temperatures: Calorimetric and viscometric approach
- Viscosities of Some Saccharides in Aqueous Solutions of Phosphate-Based Inorganic Salts
- Molecular Interactions of Saccharides and Their Derivatives with Thiamine HCl and Pyridoxine HCl Vitamins in Aqueous Solutions: Calorimetric, Viscometric, and NMR Spectroscopic Studies
- Influence of Phosphate-Based Salts on Enthalpy of Dilution and Isentropic Compressibility Properties of Saccharides and Their Derivatives in Aqueous Solutions