- Name
- Hydroquinone
- InChI
- InChI=1S/C6H6O2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H
- InChI Key
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N
- Formula
- C6H6O2
- SMILES
- Oc1ccc(O)cc1
- Mol. Weight (g/mol)
- 110.11
- CAS
- 123-31-9
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
- Tfus - Solid-liquid equilibrium temperature, K (2)
Mole fraction of Hydroquinone (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Hydroquinone (1) - Liquid |
|---|---|
| 280.50 | 0.0066 |
| 286.00 | 0.0080 |
| 291.05 | 0.0095 |
| 296.95 | 0.0114 |
| 303.45 | 0.0150 |
| 310.85 | 0.0204 |
Mole fraction of Hydroquinone (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Hydroquinone (1) - Liquid |
|---|---|
| 280.50 | 0.0066 |
| 286.00 | 0.0080 |
| 291.05 | 0.0095 |
| 296.95 | 0.0114 |
| 303.45 | 0.0150 |
| 310.85 | 0.0204 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Amount concentration (molarity), mol/dm3 of Hydroquinone (1) - Liquid | Mass density, kg/m3 - Liquid |
| 283.15 | 0.0110 | 1000.002 |
| 283.15 | 0.0342 | 1000.533 |
| 283.15 | 0.0554 | 1001.016 |
| 283.15 | 0.1035 | 1002.105 |
| 283.15 | 0.2010 | 1004.281 |
| 283.15 | 0.2996 | 1006.438 |
| 283.15 | 0.4022 | 1008.641 |
| 293.15 | 0.0110 | 998.494 |
| 293.15 | 0.0342 | 999.001 |
| 293.15 | 0.0554 | 999.463 |
| 293.15 | 0.1035 | 1000.503 |
| 293.15 | 0.2010 | 1002.581 |
| 293.15 | 0.2996 | 1004.646 |
| 293.15 | 0.4022 | 1006.751 |
| 298.15 | 0.0110 | 997.334 |
| 298.15 | 0.0342 | 997.84 |
| 298.15 | 0.0554 | 998.3 |
| 298.15 | 0.1035 | 999.338 |
| 298.15 | 0.2010 | 1001.414 |
| 298.15 | 0.2996 | 1003.479 |
| 298.15 | 0.4022 | 1005.588 |
| 303.15 | 0.0110 | 995.934 |
| 303.15 | 0.0342 | 996.428 |
| 303.15 | 0.0554 | 996.878 |
| 303.15 | 0.1035 | 997.892 |
| 303.15 | 0.2010 | 999.925 |
| 303.15 | 0.2996 | 1001.95 |
| 303.15 | 0.4022 | 1004.022 |
| 313.15 | 0.0110 | 992.505 |
| 313.15 | 0.0342 | 992.992 |
| 313.15 | 0.0554 | 993.436 |
| 313.15 | 0.1035 | 994.437 |
| 313.15 | 0.2010 | 996.443 |
| 313.15 | 0.2996 | 998.439 |
| 313.15 | 0.4022 | 1000.489 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Amount concentration (molarity), mol/dm3 of Hydroquinone (1) - Liquid | Mass density, kg/m3 - Liquid |
| 283.15 | 0.0110 | 1000.002 |
| 283.15 | 0.0342 | 1000.533 |
| 283.15 | 0.0554 | 1001.016 |
| 283.15 | 0.1035 | 1002.105 |
| 283.15 | 0.2010 | 1004.281 |
| 283.15 | 0.2996 | 1006.438 |
| 283.15 | 0.4022 | 1008.641 |
| 293.15 | 0.0110 | 998.494 |
| 293.15 | 0.0342 | 999.001 |
| 293.15 | 0.0554 | 999.463 |
| 293.15 | 0.1035 | 1000.503 |
| 293.15 | 0.2010 | 1002.581 |
| 293.15 | 0.2996 | 1004.646 |
| 293.15 | 0.4022 | 1006.751 |
| 298.15 | 0.0110 | 997.334 |
| 298.15 | 0.0342 | 997.84 |
| 298.15 | 0.0554 | 998.3 |
| 298.15 | 0.1035 | 999.338 |
| 298.15 | 0.2010 | 1001.414 |
| 298.15 | 0.2996 | 1003.479 |
| 298.15 | 0.4022 | 1005.588 |
| 303.15 | 0.0110 | 995.934 |
| 303.15 | 0.0342 | 996.428 |
| 303.15 | 0.0554 | 996.878 |
| 303.15 | 0.1035 | 997.892 |
| 303.15 | 0.2010 | 999.925 |
| 303.15 | 0.2996 | 1001.95 |
| 303.15 | 0.4022 | 1004.022 |
| 313.15 | 0.0110 | 992.505 |
| 313.15 | 0.0342 | 992.992 |
| 313.15 | 0.0554 | 993.436 |
| 313.15 | 0.1035 | 994.437 |
| 313.15 | 0.2010 | 996.443 |
| 313.15 | 0.2996 | 998.439 |
| 313.15 | 0.4022 | 1000.489 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Amount concentration (molarity), mol/dm3 of Hydroquinone (1) - Liquid | Speed of sound, m/s - Liquid |
| 283.15 | 0.0110 | 1448.21 |
| 283.15 | 0.0342 | 1449.16 |
| 283.15 | 0.0554 | 1450.02 |
| 283.15 | 0.1035 | 1451.91 |
| 283.15 | 0.2010 | 1455.49 |
| 283.15 | 0.2996 | 1458.87 |
| 283.15 | 0.4022 | 1462.24 |
| 293.15 | 0.0110 | 1482.64 |
| 293.15 | 0.0342 | 1483.31 |
| 293.15 | 0.0554 | 1483.9 |
| 293.15 | 0.1035 | 1485.21 |
| 293.15 | 0.2010 | 1487.59 |
| 293.15 | 0.2996 | 1489.85 |
| 293.15 | 0.4022 | 1492.01 |
| 298.15 | 0.0110 | 1496.93 |
| 298.15 | 0.0342 | 1497.54 |
| 298.15 | 0.0554 | 1498.09 |
| 298.15 | 0.1035 | 1499.32 |
| 298.15 | 0.2010 | 1501.75 |
| 298.15 | 0.2996 | 1504.09 |
| 298.15 | 0.4022 | 1506.41 |
| 303.15 | 0.0110 | 1509.31 |
| 303.15 | 0.0342 | 1509.86 |
| 303.15 | 0.0554 | 1510.35 |
| 303.15 | 0.1035 | 1511.46 |
| 303.15 | 0.2010 | 1513.65 |
| 303.15 | 0.2996 | 1515.72 |
| 303.15 | 0.4022 | 1517.78 |
| 313.15 | 0.0110 | 1529.0 |
| 313.15 | 0.0342 | 1529.4 |
| 313.15 | 0.0554 | 1529.76 |
| 313.15 | 0.1035 | 1530.57 |
| 313.15 | 0.2010 | 1532.18 |
| 313.15 | 0.2996 | 1533.71 |
| 313.15 | 0.4022 | 1535.18 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Amount concentration (molarity), mol/dm3 of Hydroquinone (1) - Liquid | Speed of sound, m/s - Liquid |
| 283.15 | 0.0110 | 1448.21 |
| 283.15 | 0.0342 | 1449.16 |
| 283.15 | 0.0554 | 1450.02 |
| 283.15 | 0.1035 | 1451.91 |
| 283.15 | 0.2010 | 1455.49 |
| 283.15 | 0.2996 | 1458.87 |
| 283.15 | 0.4022 | 1462.24 |
| 293.15 | 0.0110 | 1482.64 |
| 293.15 | 0.0342 | 1483.31 |
| 293.15 | 0.0554 | 1483.9 |
| 293.15 | 0.1035 | 1485.21 |
| 293.15 | 0.2010 | 1487.59 |
| 293.15 | 0.2996 | 1489.85 |
| 293.15 | 0.4022 | 1492.01 |
| 298.15 | 0.0110 | 1496.93 |
| 298.15 | 0.0342 | 1497.54 |
| 298.15 | 0.0554 | 1498.09 |
| 298.15 | 0.1035 | 1499.32 |
| 298.15 | 0.2010 | 1501.75 |
| 298.15 | 0.2996 | 1504.09 |
| 298.15 | 0.4022 | 1506.41 |
| 303.15 | 0.0110 | 1509.31 |
| 303.15 | 0.0342 | 1509.86 |
| 303.15 | 0.0554 | 1510.35 |
| 303.15 | 0.1035 | 1511.46 |
| 303.15 | 0.2010 | 1513.65 |
| 303.15 | 0.2996 | 1515.72 |
| 303.15 | 0.4022 | 1517.78 |
| 313.15 | 0.0110 | 1529.0 |
| 313.15 | 0.0342 | 1529.4 |
| 313.15 | 0.0554 | 1529.76 |
| 313.15 | 0.1035 | 1530.57 |
| 313.15 | 0.2010 | 1532.18 |
| 313.15 | 0.2996 | 1533.71 |
| 313.15 | 0.4022 | 1535.18 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Hydroquinone (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0066 | 280.50 |
| 0.0080 | 286.00 |
| 0.0097 | 291.05 |
| 0.0116 | 296.95 |
| 0.0152 | 303.45 |
| 0.0200 | 310.85 |
| 0.0252 | 316.85 |
| 0.0347 | 323.50 |
| 0.0498 | 332.00 |
| 0.0665 | 337.70 |
| 0.0831 | 342.10 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Hydroquinone (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0066 | 280.50 |
| 0.0080 | 286.00 |
| 0.0097 | 291.05 |
| 0.0116 | 296.95 |
| 0.0152 | 303.45 |
| 0.0200 | 310.85 |
| 0.0252 | 316.85 |
| 0.0347 | 323.50 |
| 0.0498 | 332.00 |
| 0.0665 | 337.70 |
| 0.0831 | 342.10 |
Sources
- Effects of structural isomerism on solution behaviour of solutes: Apparent molar volumes and isentropic compression of catechol, resorcinal, and hydroquinone in aqueous solution at T = (283.15, 293.15, 298.15, 303.15, and 313.15) K
- Solubility of 3,7,9,11-Tetraoxo-2,4,6,8,10-pentaaza[3.3.3] Propellane (TOPAP) in Different Pure Solvents at Temperatures between 273.15 and 318.15 K
- Solubility of Hydroquinone in Different Solvents from 276.65 K to 345.10 K