- Name
- Morpholine
- InChI
- InChI=1S/C4H9NO/c1-3-6-4-2-5-1/h5H,1-4H2
- InChI Key
- YNAVUWVOSKDBBP-UHFFFAOYSA-N
- Formula
- C4H9NO
- SMILES
- C1COCCN1
- Mol. Weight (g/mol)
- 87.12
- CAS
- 110-91-8
- Name
- 1-Butanol, 3-methyl-
- InChI
- InChI=1S/C5H12O/c1-5(2)3-4-6/h5-6H,3-4H2,1-2H3
- InChI Key
- PHTQWCKDNZKARW-UHFFFAOYSA-N
- Formula
- C5H12O
- SMILES
- CC(C)CCO
- Mol. Weight (g/mol)
- 88.15
- CAS
- 123-51-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Vapor or sublimation pressure, kPa [ref]
Operational condition: Temperature, K = 343.15 (Liquid)
| Mole fraction of Morpholine (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
|---|---|
| 0.0000 | 7.73 |
| 0.0351 | 7.99 |
| 0.0923 | 8.39 |
| 0.1071 | 8.66 |
| 0.2037 | 9.06 |
| 0.3026 | 9.59 |
| 0.3880 | 9.86 |
| 0.4839 | 10.13 |
| 0.5102 | 10.39 |
| 0.5632 | 10.66 |
| 0.6427 | 11.19 |
| 0.7198 | 11.59 |
| 0.7936 | 11.99 |
| 0.8679 | 12.39 |
| 0.9293 | 12.66 |
| 0.9876 | 12.93 |
| 1.0000 | 13.06 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Morpholine (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 386.05 | 0.0000 | 53.33 |
| 385.95 | 0.0351 | 53.33 |
| 385.85 | 0.0923 | 53.33 |
| 385.75 | 0.1071 | 53.33 |
| 385.45 | 0.2037 | 53.33 |
| 384.95 | 0.3026 | 53.33 |
| 384.55 | 0.3880 | 53.33 |
| 384.05 | 0.4839 | 53.33 |
| 383.85 | 0.5102 | 53.33 |
| 383.55 | 0.5632 | 53.33 |
| 383.05 | 0.6427 | 53.33 |
| 382.65 | 0.7198 | 53.33 |
| 382.15 | 0.7936 | 53.33 |
| 381.65 | 0.8679 | 53.33 |
| 381.15 | 0.9293 | 53.33 |
| 380.75 | 0.9876 | 53.33 |
| 380.75 | 1.0000 | 53.33 |
| 392.15 | 0.0000 | 66.66 |
| 391.95 | 0.0351 | 66.66 |
| 391.85 | 0.0923 | 66.66 |
| 391.75 | 0.1071 | 66.66 |
| 391.45 | 0.2037 | 66.66 |
| 391.05 | 0.3026 | 66.66 |
| 390.75 | 0.3880 | 66.66 |
| 390.35 | 0.4839 | 66.66 |
| 390.15 | 0.5102 | 66.66 |
| 389.95 | 0.5632 | 66.66 |
| 389.55 | 0.6427 | 66.66 |
| 389.15 | 0.7198 | 66.66 |
| 388.75 | 0.7936 | 66.66 |
| 388.35 | 0.8679 | 66.66 |
| 388.05 | 0.9293 | 66.66 |
| 387.65 | 0.9876 | 66.66 |
| 387.55 | 1.0000 | 66.66 |
| 397.15 | 0.0000 | 79.99 |
| 397.05 | 0.0351 | 79.99 |
| 396.95 | 0.0923 | 79.99 |
| 396.85 | 0.1071 | 79.99 |
| 396.75 | 0.2037 | 79.99 |
| 396.55 | 0.3026 | 79.99 |
| 396.35 | 0.3880 | 79.99 |
| 396.15 | 0.4839 | 79.99 |
| 396.05 | 0.5102 | 79.99 |
| 395.85 | 0.5632 | 79.99 |
| 395.65 | 0.6427 | 79.99 |
| 395.25 | 0.7198 | 79.99 |
| 394.85 | 0.7936 | 79.99 |
| 394.45 | 0.8679 | 79.99 |
| 393.95 | 0.9293 | 79.99 |
| 393.55 | 0.9876 | 79.99 |
| 393.45 | 1.0000 | 79.99 |
| 403.95 | 0.0000 | 101.05 |
| 403.85 | 0.0351 | 101.05 |
| 403.75 | 0.0923 | 101.05 |
| 403.65 | 0.1071 | 101.05 |
| 403.55 | 0.2037 | 101.05 |
| 403.25 | 0.3026 | 101.05 |
| 403.05 | 0.3880 | 101.05 |
| 402.85 | 0.4839 | 101.05 |
| 402.75 | 0.5102 | 101.05 |
| 402.55 | 0.5632 | 101.05 |
| 402.35 | 0.6427 | 101.05 |
| 402.15 | 0.7198 | 101.05 |
| 401.95 | 0.7936 | 101.05 |
| 401.75 | 0.8679 | 101.05 |
| 401.45 | 0.9293 | 101.05 |
| 401.35 | 0.9876 | 101.05 |
| 401.15 | 1.0000 | 101.05 |
Vapor or sublimation pressure, kPa [ref]
Operational condition: Temperature, K = 343.15 (Liquid)
| Mole fraction of Morpholine (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
|---|---|
| 0.0000 | 7.73 |
| 0.0351 | 7.99 |
| 0.0923 | 8.39 |
| 0.1071 | 8.66 |
| 0.2037 | 9.06 |
| 0.3026 | 9.59 |
| 0.3880 | 9.86 |
| 0.4839 | 10.13 |
| 0.5102 | 10.39 |
| 0.5632 | 10.66 |
| 0.6427 | 11.19 |
| 0.7198 | 11.59 |
| 0.7936 | 11.99 |
| 0.8679 | 12.39 |
| 0.9293 | 12.66 |
| 0.9876 | 12.93 |
| 1.0000 | 13.06 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Morpholine (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 386.05 | 0.0000 | 53.33 |
| 385.95 | 0.0351 | 53.33 |
| 385.85 | 0.0923 | 53.33 |
| 385.75 | 0.1071 | 53.33 |
| 385.45 | 0.2037 | 53.33 |
| 384.95 | 0.3026 | 53.33 |
| 384.55 | 0.3880 | 53.33 |
| 384.05 | 0.4839 | 53.33 |
| 383.85 | 0.5102 | 53.33 |
| 383.55 | 0.5632 | 53.33 |
| 383.05 | 0.6427 | 53.33 |
| 382.65 | 0.7198 | 53.33 |
| 382.15 | 0.7936 | 53.33 |
| 381.65 | 0.8679 | 53.33 |
| 381.15 | 0.9293 | 53.33 |
| 380.75 | 0.9876 | 53.33 |
| 380.75 | 1.0000 | 53.33 |
| 392.15 | 0.0000 | 66.66 |
| 391.95 | 0.0351 | 66.66 |
| 391.85 | 0.0923 | 66.66 |
| 391.75 | 0.1071 | 66.66 |
| 391.45 | 0.2037 | 66.66 |
| 391.05 | 0.3026 | 66.66 |
| 390.75 | 0.3880 | 66.66 |
| 390.35 | 0.4839 | 66.66 |
| 390.15 | 0.5102 | 66.66 |
| 389.95 | 0.5632 | 66.66 |
| 389.55 | 0.6427 | 66.66 |
| 389.15 | 0.7198 | 66.66 |
| 388.75 | 0.7936 | 66.66 |
| 388.35 | 0.8679 | 66.66 |
| 388.05 | 0.9293 | 66.66 |
| 387.65 | 0.9876 | 66.66 |
| 387.55 | 1.0000 | 66.66 |
| 397.15 | 0.0000 | 79.99 |
| 397.05 | 0.0351 | 79.99 |
| 396.95 | 0.0923 | 79.99 |
| 396.85 | 0.1071 | 79.99 |
| 396.75 | 0.2037 | 79.99 |
| 396.55 | 0.3026 | 79.99 |
| 396.35 | 0.3880 | 79.99 |
| 396.15 | 0.4839 | 79.99 |
| 396.05 | 0.5102 | 79.99 |
| 395.85 | 0.5632 | 79.99 |
| 395.65 | 0.6427 | 79.99 |
| 395.25 | 0.7198 | 79.99 |
| 394.85 | 0.7936 | 79.99 |
| 394.45 | 0.8679 | 79.99 |
| 393.95 | 0.9293 | 79.99 |
| 393.55 | 0.9876 | 79.99 |
| 393.45 | 1.0000 | 79.99 |
| 403.95 | 0.0000 | 101.05 |
| 403.85 | 0.0351 | 101.05 |
| 403.75 | 0.0923 | 101.05 |
| 403.65 | 0.1071 | 101.05 |
| 403.55 | 0.2037 | 101.05 |
| 403.25 | 0.3026 | 101.05 |
| 403.05 | 0.3880 | 101.05 |
| 402.85 | 0.4839 | 101.05 |
| 402.75 | 0.5102 | 101.05 |
| 402.55 | 0.5632 | 101.05 |
| 402.35 | 0.6427 | 101.05 |
| 402.15 | 0.7198 | 101.05 |
| 401.95 | 0.7936 | 101.05 |
| 401.75 | 0.8679 | 101.05 |
| 401.45 | 0.9293 | 101.05 |
| 401.35 | 0.9876 | 101.05 |
| 401.15 | 1.0000 | 101.05 |