- Name
- D-Serine
- InChI
- InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1
- InChI Key
- MTCFGRXMJLQNBG-REOHCLBHSA-N
- Formula
- C3H7NO3
- SMILES
- NC(CO)C(=O)O
- Mol. Weight (g/mol)
- 105.09
- CAS
- 312-84-5
- Name
- Isopropyl Alcohol
- InChI
- InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3
- InChI Key
- KFZMGEQAYNKOFK-UHFFFAOYSA-N
- Formula
- C3H8O
- SMILES
- CC(C)O
- Mol. Weight (g/mol)
- 60.09
- CAS
- 67-63-0
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass fraction of D-Serine (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Mass fraction of Isopropyl Alcohol (2) - Liquid | Mass fraction of D-Serine (1) - Liquid |
| 298.15 | 0.2000 | 0.1374 |
| 298.15 | 0.4002 | 0.0523 |
| 298.15 | 0.6000 | 0.0141 |
| 313.15 | 0.2001 | 0.2074 |
| 313.15 | 0.4000 | 0.0947 |
| 313.15 | 0.6000 | 0.0233 |
| 333.15 | 0.7005 | 0.0126 |
Mass fraction of D-Serine (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Mass fraction of Isopropyl Alcohol (2) - Liquid | Mass fraction of D-Serine (1) - Liquid |
| 298.15 | 0.8000 | 0.0016 |
| 298.15 | 1.0000 | 0.0000 |
| 313.15 | 0.8000 | 0.0021 |
| 313.15 | 1.0000 | 0.0000 |
| 333.15 | 0.8000 | 0.0025 |
| 333.15 | 0.8500 | 0.0010 |
| 333.15 | 1.0000 | 0.0000 |
Mole fraction of D-Serine (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Mole fraction of Water (3) - Liquid | Mole fraction of D-Serine (1) - Liquid |
| 278.15 | 0.0000 | 3.0000e-06 |
| 278.15 | 0.4280 | 0.0005 |
| 278.15 | 0.6450 | 0.0007 |
| 278.15 | 0.7760 | 0.0026 |
| 278.15 | 0.8640 | 0.0075 |
| 278.15 | 0.9270 | 0.0170 |
| 278.15 | 0.9740 | 0.0298 |
| 278.15 | 1.0000 | 0.0389 |
| 283.15 | 0.0000 | 3.0000e-06 |
| 283.15 | 0.4280 | 0.0005 |
| 283.15 | 0.6450 | 0.0010 |
| 283.15 | 0.7760 | 0.0032 |
| 283.15 | 0.8640 | 0.0090 |
| 283.15 | 0.9270 | 0.0201 |
| 283.15 | 0.9740 | 0.0343 |
| 283.15 | 1.0000 | 0.0444 |
| 288.15 | 0.0000 | 4.0000e-06 |
| 288.15 | 0.4280 | 0.0006 |
| 288.15 | 0.6450 | 0.0014 |
| 288.15 | 0.7760 | 0.0042 |
| 288.15 | 0.8640 | 0.0109 |
| 288.15 | 0.9270 | 0.0228 |
| 288.15 | 0.9740 | 0.0380 |
| 288.15 | 1.0000 | 0.0498 |
| 293.15 | 0.0000 | 4.0000e-06 |
| 293.15 | 0.4280 | 0.0006 |
| 293.15 | 0.6450 | 0.0019 |
| 293.15 | 0.7760 | 0.0053 |
| 293.15 | 0.8640 | 0.0129 |
| 293.15 | 0.9270 | 0.0262 |
| 293.15 | 0.9740 | 0.0424 |
| 293.15 | 1.0000 | 0.0563 |
| 298.15 | 0.0000 | 5.0000e-06 |
| 298.15 | 0.4280 | 0.0006 |
| 298.15 | 0.6450 | 0.0026 |
| 298.15 | 0.7760 | 0.0067 |
| 298.15 | 0.8640 | 0.0152 |
| 298.15 | 0.9270 | 0.0298 |
| 298.15 | 0.9740 | 0.0481 |
| 298.15 | 1.0000 | 0.0642 |
| 303.15 | 0.0000 | 5.0000e-06 |
| 303.15 | 0.4280 | 0.0007 |
| 303.15 | 0.6450 | 0.0032 |
| 303.15 | 0.7760 | 0.0082 |
| 303.15 | 0.8640 | 0.0180 |
| 303.15 | 0.9270 | 0.0338 |
| 303.15 | 0.9740 | 0.0541 |
| 303.15 | 1.0000 | 0.0717 |
| 308.15 | 0.0000 | 6.0000e-06 |
| 308.15 | 0.4280 | 0.0008 |
| 308.15 | 0.6450 | 0.0038 |
| 308.15 | 0.7760 | 0.0096 |
| 308.15 | 0.8640 | 0.0208 |
| 308.15 | 0.9270 | 0.0384 |
| 308.15 | 0.9740 | 0.0597 |
| 308.15 | 1.0000 | 0.0794 |
| 313.15 | 0.0000 | 7.0000e-06 |
| 313.15 | 0.4280 | 0.0008 |
| 313.15 | 0.6450 | 0.0046 |
| 313.15 | 0.7760 | 0.0116 |
| 313.15 | 0.8640 | 0.0236 |
| 313.15 | 0.9270 | 0.0428 |
| 313.15 | 0.9740 | 0.0658 |
| 313.15 | 1.0000 | 0.0877 |
| 318.15 | 0.0000 | 8.0000e-06 |
| 318.15 | 0.4280 | 0.0009 |
| 318.15 | 0.6450 | 0.0053 |
| 318.15 | 0.7760 | 0.0129 |
| 318.15 | 0.8640 | 0.0263 |
| 318.15 | 0.9270 | 0.0469 |
| 318.15 | 0.9740 | 0.0723 |
| 318.15 | 1.0000 | 0.0960 |
| 323.15 | 0.0000 | 9.0000e-06 |
| 323.15 | 0.4280 | 0.0009 |
| 323.15 | 0.6450 | 0.0063 |
| 323.15 | 0.7760 | 0.0152 |
| 323.15 | 0.8640 | 0.0287 |
| 323.15 | 0.9270 | 0.0516 |
| 323.15 | 0.9740 | 0.0773 |
| 323.15 | 1.0000 | 0.1041 |
| 328.15 | 0.0000 | 0.0000 |
| 328.15 | 0.4280 | 0.0010 |
| 328.15 | 0.6450 | 0.0070 |
| 328.15 | 0.7760 | 0.0173 |
| 328.15 | 0.8640 | 0.0330 |
| 328.15 | 0.9270 | 0.0564 |
| 328.15 | 0.9740 | 0.0858 |
| 328.15 | 1.0000 | 0.1135 |
| 333.15 | 0.0000 | 0.0000 |
| 333.15 | 0.4280 | 0.0011 |
| 333.15 | 0.6450 | 0.0084 |
| 333.15 | 0.7760 | 0.0203 |
| 333.15 | 0.8640 | 0.0367 |
| 333.15 | 0.9270 | 0.0614 |
| 333.15 | 0.9740 | 0.0928 |
| 333.15 | 1.0000 | 0.1235 |
Mass fraction of D-Serine (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Mass fraction of Isopropyl Alcohol (2) - Liquid | Mass fraction of D-Serine (1) - Liquid |
| 298.15 | 0.2000 | 0.1374 |
| 298.15 | 0.4002 | 0.0523 |
| 298.15 | 0.6000 | 0.0141 |
| 313.15 | 0.2001 | 0.2074 |
| 313.15 | 0.4000 | 0.0947 |
| 313.15 | 0.6000 | 0.0233 |
| 333.15 | 0.7005 | 0.0126 |
Mass fraction of D-Serine (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Mass fraction of Isopropyl Alcohol (2) - Liquid | Mass fraction of D-Serine (1) - Liquid |
| 298.15 | 0.8000 | 0.0016 |
| 298.15 | 1.0000 | 0.0000 |
| 313.15 | 0.8000 | 0.0021 |
| 313.15 | 1.0000 | 0.0000 |
| 333.15 | 0.8000 | 0.0025 |
| 333.15 | 0.8500 | 0.0010 |
| 333.15 | 1.0000 | 0.0000 |
Mole fraction of D-Serine (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Mole fraction of Water (3) - Liquid | Mole fraction of D-Serine (1) - Liquid |
| 278.15 | 0.0000 | 3.0000e-06 |
| 278.15 | 0.4280 | 0.0005 |
| 278.15 | 0.6450 | 0.0007 |
| 278.15 | 0.7760 | 0.0026 |
| 278.15 | 0.8640 | 0.0075 |
| 278.15 | 0.9270 | 0.0170 |
| 278.15 | 0.9740 | 0.0298 |
| 278.15 | 1.0000 | 0.0389 |
| 283.15 | 0.0000 | 3.0000e-06 |
| 283.15 | 0.4280 | 0.0005 |
| 283.15 | 0.6450 | 0.0010 |
| 283.15 | 0.7760 | 0.0032 |
| 283.15 | 0.8640 | 0.0090 |
| 283.15 | 0.9270 | 0.0201 |
| 283.15 | 0.9740 | 0.0343 |
| 283.15 | 1.0000 | 0.0444 |
| 288.15 | 0.0000 | 4.0000e-06 |
| 288.15 | 0.4280 | 0.0006 |
| 288.15 | 0.6450 | 0.0014 |
| 288.15 | 0.7760 | 0.0042 |
| 288.15 | 0.8640 | 0.0109 |
| 288.15 | 0.9270 | 0.0228 |
| 288.15 | 0.9740 | 0.0380 |
| 288.15 | 1.0000 | 0.0498 |
| 293.15 | 0.0000 | 4.0000e-06 |
| 293.15 | 0.4280 | 0.0006 |
| 293.15 | 0.6450 | 0.0019 |
| 293.15 | 0.7760 | 0.0053 |
| 293.15 | 0.8640 | 0.0129 |
| 293.15 | 0.9270 | 0.0262 |
| 293.15 | 0.9740 | 0.0424 |
| 293.15 | 1.0000 | 0.0563 |
| 298.15 | 0.0000 | 5.0000e-06 |
| 298.15 | 0.4280 | 0.0006 |
| 298.15 | 0.6450 | 0.0026 |
| 298.15 | 0.7760 | 0.0067 |
| 298.15 | 0.8640 | 0.0152 |
| 298.15 | 0.9270 | 0.0298 |
| 298.15 | 0.9740 | 0.0481 |
| 298.15 | 1.0000 | 0.0642 |
| 303.15 | 0.0000 | 5.0000e-06 |
| 303.15 | 0.4280 | 0.0007 |
| 303.15 | 0.6450 | 0.0032 |
| 303.15 | 0.7760 | 0.0082 |
| 303.15 | 0.8640 | 0.0180 |
| 303.15 | 0.9270 | 0.0338 |
| 303.15 | 0.9740 | 0.0541 |
| 303.15 | 1.0000 | 0.0717 |
| 308.15 | 0.0000 | 6.0000e-06 |
| 308.15 | 0.4280 | 0.0008 |
| 308.15 | 0.6450 | 0.0038 |
| 308.15 | 0.7760 | 0.0096 |
| 308.15 | 0.8640 | 0.0208 |
| 308.15 | 0.9270 | 0.0384 |
| 308.15 | 0.9740 | 0.0597 |
| 308.15 | 1.0000 | 0.0794 |
| 313.15 | 0.0000 | 7.0000e-06 |
| 313.15 | 0.4280 | 0.0008 |
| 313.15 | 0.6450 | 0.0046 |
| 313.15 | 0.7760 | 0.0116 |
| 313.15 | 0.8640 | 0.0236 |
| 313.15 | 0.9270 | 0.0428 |
| 313.15 | 0.9740 | 0.0658 |
| 313.15 | 1.0000 | 0.0877 |
| 318.15 | 0.0000 | 8.0000e-06 |
| 318.15 | 0.4280 | 0.0009 |
| 318.15 | 0.6450 | 0.0053 |
| 318.15 | 0.7760 | 0.0129 |
| 318.15 | 0.8640 | 0.0263 |
| 318.15 | 0.9270 | 0.0469 |
| 318.15 | 0.9740 | 0.0723 |
| 318.15 | 1.0000 | 0.0960 |
| 323.15 | 0.0000 | 9.0000e-06 |
| 323.15 | 0.4280 | 0.0009 |
| 323.15 | 0.6450 | 0.0063 |
| 323.15 | 0.7760 | 0.0152 |
| 323.15 | 0.8640 | 0.0287 |
| 323.15 | 0.9270 | 0.0516 |
| 323.15 | 0.9740 | 0.0773 |
| 323.15 | 1.0000 | 0.1041 |
| 328.15 | 0.0000 | 0.0000 |
| 328.15 | 0.4280 | 0.0010 |
| 328.15 | 0.6450 | 0.0070 |
| 328.15 | 0.7760 | 0.0173 |
| 328.15 | 0.8640 | 0.0330 |
| 328.15 | 0.9270 | 0.0564 |
| 328.15 | 0.9740 | 0.0858 |
| 328.15 | 1.0000 | 0.1135 |
| 333.15 | 0.0000 | 0.0000 |
| 333.15 | 0.4280 | 0.0011 |
| 333.15 | 0.6450 | 0.0084 |
| 333.15 | 0.7760 | 0.0203 |
| 333.15 | 0.8640 | 0.0367 |
| 333.15 | 0.9270 | 0.0614 |
| 333.15 | 0.9740 | 0.0928 |
| 333.15 | 1.0000 | 0.1235 |