- Name
- 2,2-dimethylpropane-1,3-diyl diacrylate
- InChI
- InChI=1S/C11H16O4/c1-5-9(12)14-7-11(3,4)8-15-10(13)6-2/h5-6H,1-2,7-8H2,3-4H3
- InChI Key
- MXFQRSUWYYSPOC-UHFFFAOYSA-N
- Formula
- C11H16O4
- SMILES
- C=CC(=O)OCC(C)(C)COC(=O)C=C
- Mol. Weight (g/mol)
- 212.25
- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Critical pressure, kPa [ref]
| Mole fraction of 2,2-dimethylpropane-1,3-diyl diacrylate (1) - Liquid | Critical pressure, kPa - Liquid |
|---|---|
| 0.0480 | 24520.00 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2,2-dimethylpropane-1,3-diyl diacrylate (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 313.20 | 0.0480 | 9520.00 |
| 313.20 | 0.0750 | 8830.00 |
| 313.20 | 0.1010 | 8310.00 |
| 313.20 | 0.1500 | 8210.00 |
| 313.20 | 0.1910 | 7410.00 |
| 313.20 | 0.2720 | 6240.00 |
| 313.20 | 0.3270 | 6000.00 |
| 313.20 | 0.4070 | 5000.00 |
| 313.20 | 0.4830 | 3760.00 |
| 313.20 | 0.5860 | 2970.00 |
| 313.20 | 0.6550 | 2550.00 |
| 333.20 | 0.0480 | 14030.00 |
| 333.20 | 0.0750 | 13450.00 |
| 333.20 | 0.1010 | 12720.00 |
| 333.20 | 0.1500 | 11410.00 |
| 333.20 | 0.1910 | 10860.00 |
| 333.20 | 0.2720 | 8520.00 |
| 333.20 | 0.3270 | 7970.00 |
| 333.20 | 0.4070 | 6450.00 |
| 333.20 | 0.4830 | 5550.00 |
| 333.20 | 0.5860 | 3930.00 |
| 333.20 | 0.6550 | 3310.00 |
| 353.20 | 0.0480 | 18660.00 |
| 353.20 | 0.0750 | 17590.00 |
| 353.20 | 0.1010 | 17240.00 |
| 353.20 | 0.1500 | 15550.00 |
| 353.20 | 0.1910 | 13590.00 |
| 353.20 | 0.2720 | 11450.00 |
| 353.20 | 0.3270 | 10100.00 |
| 353.20 | 0.4070 | 8070.00 |
| 353.20 | 0.4830 | 6480.00 |
| 353.20 | 0.5860 | 4720.00 |
| 353.20 | 0.6550 | 4000.00 |
| 373.20 | 0.0480 | 22210.00 |
| 373.20 | 0.0750 | 21350.00 |
| 373.20 | 0.1010 | 21100.00 |
| 373.20 | 0.1500 | 19450.00 |
| 373.20 | 0.1910 | 17590.00 |
| 373.20 | 0.2720 | 13660.00 |
| 373.20 | 0.3270 | 12210.00 |
| 373.20 | 0.4070 | 9790.00 |
| 373.20 | 0.4830 | 7690.00 |
| 373.20 | 0.5860 | 5690.00 |
| 373.20 | 0.6550 | 4720.00 |
| 393.20 | 0.0750 | 24070.00 |
| 393.20 | 0.1010 | 23480.00 |
| 393.20 | 0.1500 | 22450.00 |
| 393.20 | 0.1910 | 20410.00 |
| 393.20 | 0.2720 | 16070.00 |
| 393.20 | 0.3270 | 14310.00 |
| 393.20 | 0.4070 | 11210.00 |
| 393.20 | 0.4830 | 8970.00 |
| 393.20 | 0.5860 | 6520.00 |
| 393.20 | 0.6550 | 5410.00 |
Critical temperature, K [ref]
| Mole fraction of 2,2-dimethylpropane-1,3-diyl diacrylate (1) - Liquid | Critical temperature, K - Liquid |
|---|---|
| 0.0480 | 393.20 |