- Name
- Ethanol, 2-methoxy-
- InChI
- InChI=1S/C3H8O2/c1-5-3-2-4/h4H,2-3H2,1H3
- InChI Key
- XNWFRZJHXBZDAG-UHFFFAOYSA-N
- Formula
- C3H8O2
- SMILES
- COCCO
- Mol. Weight (g/mol)
- 76.09
- CAS
- 109-86-4
- Name
- Benzene, 1,3-dimethyl-
- InChI
- InChI=1S/C8H10/c1-7-4-3-5-8(2)6-7/h3-6H,1-2H3
- InChI Key
- IVSZLXZYQVIEFR-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1cccc(C)c1
- Mol. Weight (g/mol)
- 106.17
- CAS
- 108-38-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Activity coefficient (2)
- η - Viscosity, Pa*s (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Activity coefficient of Benzene, 1,3-dimethyl- (2) [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of Benzene, 1,3-dimethyl- (2) - Liquid | Activity coefficient of Benzene, 1,3-dimethyl- (2) - Liquid |
| 298.00 | 238.00 | 0.0000 | 5.2 |
Activity coefficient of Benzene, 1,3-dimethyl- (2) [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of Benzene, 1,3-dimethyl- (2) - Liquid | Activity coefficient of Benzene, 1,3-dimethyl- (2) - Liquid |
| 298.00 | 238.00 | 0.0000 | 5.2 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethanol, 2-methoxy- (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0519 | 0.0006 |
| 298.15 | 0.1498 | 0.0006 |
| 298.15 | 0.2504 | 0.0007 |
| 298.15 | 0.3476 | 0.0007 |
| 298.15 | 0.4520 | 0.0008 |
| 298.15 | 0.4991 | 0.0008 |
| 298.15 | 0.5538 | 0.0009 |
| 298.15 | 0.6476 | 0.0010 |
| 298.15 | 0.7504 | 0.0011 |
| 298.15 | 0.8491 | 0.0013 |
| 298.15 | 0.9558 | 0.0015 |
| 308.15 | 0.0519 | 0.0005 |
| 308.15 | 0.1498 | 0.0005 |
| 308.15 | 0.2504 | 0.0006 |
| 308.15 | 0.3476 | 0.0006 |
| 308.15 | 0.4520 | 0.0007 |
| 308.15 | 0.4991 | 0.0007 |
| 308.15 | 0.5538 | 0.0007 |
| 308.15 | 0.6476 | 0.0008 |
| 308.15 | 0.7504 | 0.0009 |
| 308.15 | 0.8491 | 0.0010 |
| 308.15 | 0.9558 | 0.0012 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethanol, 2-methoxy- (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0519 | 0.0006 |
| 298.15 | 0.1498 | 0.0006 |
| 298.15 | 0.2504 | 0.0007 |
| 298.15 | 0.3476 | 0.0007 |
| 298.15 | 0.4520 | 0.0008 |
| 298.15 | 0.4991 | 0.0008 |
| 298.15 | 0.5538 | 0.0009 |
| 298.15 | 0.6476 | 0.0010 |
| 298.15 | 0.7504 | 0.0011 |
| 298.15 | 0.8491 | 0.0013 |
| 298.15 | 0.9558 | 0.0015 |
| 308.15 | 0.0519 | 0.0005 |
| 308.15 | 0.1498 | 0.0005 |
| 308.15 | 0.2504 | 0.0006 |
| 308.15 | 0.3476 | 0.0006 |
| 308.15 | 0.4520 | 0.0007 |
| 308.15 | 0.4991 | 0.0007 |
| 308.15 | 0.5538 | 0.0007 |
| 308.15 | 0.6476 | 0.0008 |
| 308.15 | 0.7504 | 0.0009 |
| 308.15 | 0.8491 | 0.0010 |
| 308.15 | 0.9558 | 0.0012 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethanol, 2-methoxy- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0519 | 862.4 |
| 298.15 | 0.1498 | 867.96 |
| 298.15 | 0.2504 | 874.92 |
| 298.15 | 0.3476 | 882.7 |
| 298.15 | 0.4520 | 892.1 |
| 298.15 | 0.4991 | 896.68 |
| 298.15 | 0.5538 | 902.24 |
| 298.15 | 0.6476 | 912.44 |
| 298.15 | 0.7504 | 924.64 |
| 298.15 | 0.8491 | 937.54 |
| 298.15 | 0.9558 | 953.14 |
| 303.15 | 0.0519 | 857.98 |
| 303.15 | 0.1498 | 863.28 |
| 303.15 | 0.2504 | 870.13 |
| 303.15 | 0.3476 | 877.91 |
| 303.15 | 0.4520 | 887.36 |
| 303.15 | 0.4991 | 891.97 |
| 303.15 | 0.5538 | 897.57 |
| 303.15 | 0.6476 | 907.82 |
| 303.15 | 0.7504 | 920.03 |
| 303.15 | 0.8491 | 932.9 |
| 303.15 | 0.9558 | 948.47 |
| 308.15 | 0.0519 | 853.64 |
| 308.15 | 0.1498 | 858.88 |
| 308.15 | 0.2504 | 865.82 |
| 308.15 | 0.3476 | 873.78 |
| 308.15 | 0.4520 | 883.47 |
| 308.15 | 0.4991 | 888.19 |
| 308.15 | 0.5538 | 893.92 |
| 308.15 | 0.6476 | 904.38 |
| 308.15 | 0.7504 | 916.84 |
| 308.15 | 0.8491 | 930.02 |
| 308.15 | 0.9558 | 946.12 |
| 313.15 | 0.0519 | 848.65 |
| 313.15 | 0.1498 | 853.65 |
| 313.15 | 0.2504 | 860.3 |
| 313.15 | 0.3476 | 867.96 |
| 313.15 | 0.4520 | 877.33 |
| 313.15 | 0.4991 | 881.91 |
| 313.15 | 0.5538 | 887.49 |
| 313.15 | 0.6476 | 897.71 |
| 313.15 | 0.7504 | 909.96 |
| 313.15 | 0.8491 | 922.98 |
| 313.15 | 0.9558 | 938.95 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethanol, 2-methoxy- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0519 | 862.4 |
| 298.15 | 0.1498 | 867.96 |
| 298.15 | 0.2504 | 874.92 |
| 298.15 | 0.3476 | 882.7 |
| 298.15 | 0.4520 | 892.1 |
| 298.15 | 0.4991 | 896.68 |
| 298.15 | 0.5538 | 902.24 |
| 298.15 | 0.6476 | 912.44 |
| 298.15 | 0.7504 | 924.64 |
| 298.15 | 0.8491 | 937.54 |
| 298.15 | 0.9558 | 953.14 |
| 303.15 | 0.0519 | 857.98 |
| 303.15 | 0.1498 | 863.28 |
| 303.15 | 0.2504 | 870.13 |
| 303.15 | 0.3476 | 877.91 |
| 303.15 | 0.4520 | 887.36 |
| 303.15 | 0.4991 | 891.97 |
| 303.15 | 0.5538 | 897.57 |
| 303.15 | 0.6476 | 907.82 |
| 303.15 | 0.7504 | 920.03 |
| 303.15 | 0.8491 | 932.9 |
| 303.15 | 0.9558 | 948.47 |
| 308.15 | 0.0519 | 853.64 |
| 308.15 | 0.1498 | 858.88 |
| 308.15 | 0.2504 | 865.82 |
| 308.15 | 0.3476 | 873.78 |
| 308.15 | 0.4520 | 883.47 |
| 308.15 | 0.4991 | 888.19 |
| 308.15 | 0.5538 | 893.92 |
| 308.15 | 0.6476 | 904.38 |
| 308.15 | 0.7504 | 916.84 |
| 308.15 | 0.8491 | 930.02 |
| 308.15 | 0.9558 | 946.12 |
| 313.15 | 0.0519 | 848.65 |
| 313.15 | 0.1498 | 853.65 |
| 313.15 | 0.2504 | 860.3 |
| 313.15 | 0.3476 | 867.96 |
| 313.15 | 0.4520 | 877.33 |
| 313.15 | 0.4991 | 881.91 |
| 313.15 | 0.5538 | 887.49 |
| 313.15 | 0.6476 | 897.71 |
| 313.15 | 0.7504 | 909.96 |
| 313.15 | 0.8491 | 922.98 |
| 313.15 | 0.9558 | 938.95 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethanol, 2-methoxy- (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0519 | 1317.0 |
| 298.15 | 0.1498 | 1312.0 |
| 298.15 | 0.2504 | 1309.0 |
| 298.15 | 0.3476 | 1309.0 |
| 298.15 | 0.4520 | 1310.0 |
| 298.15 | 0.4991 | 1311.0 |
| 298.15 | 0.5538 | 1312.0 |
| 298.15 | 0.6476 | 1316.0 |
| 298.15 | 0.7504 | 1321.0 |
| 298.15 | 0.8491 | 1327.0 |
| 298.15 | 0.9558 | 1335.0 |
| 308.15 | 0.0519 | 1279.0 |
| 308.15 | 0.1498 | 1275.0 |
| 308.15 | 0.2504 | 1273.0 |
| 308.15 | 0.3476 | 1273.0 |
| 308.15 | 0.4520 | 1275.0 |
| 308.15 | 0.4991 | 1277.0 |
| 308.15 | 0.5538 | 1279.0 |
| 308.15 | 0.6476 | 1285.0 |
| 308.15 | 0.7504 | 1293.0 |
| 308.15 | 0.8491 | 1304.0 |
| 308.15 | 0.9558 | 1320.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethanol, 2-methoxy- (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0519 | 1317.0 |
| 298.15 | 0.1498 | 1312.0 |
| 298.15 | 0.2504 | 1309.0 |
| 298.15 | 0.3476 | 1309.0 |
| 298.15 | 0.4520 | 1310.0 |
| 298.15 | 0.4991 | 1311.0 |
| 298.15 | 0.5538 | 1312.0 |
| 298.15 | 0.6476 | 1316.0 |
| 298.15 | 0.7504 | 1321.0 |
| 298.15 | 0.8491 | 1327.0 |
| 298.15 | 0.9558 | 1335.0 |
| 308.15 | 0.0519 | 1279.0 |
| 308.15 | 0.1498 | 1275.0 |
| 308.15 | 0.2504 | 1273.0 |
| 308.15 | 0.3476 | 1273.0 |
| 308.15 | 0.4520 | 1275.0 |
| 308.15 | 0.4991 | 1277.0 |
| 308.15 | 0.5538 | 1279.0 |
| 308.15 | 0.6476 | 1285.0 |
| 308.15 | 0.7504 | 1293.0 |
| 308.15 | 0.8491 | 1304.0 |
| 308.15 | 0.9558 | 1320.0 |
Sources
- Thermodynamics of solvation in propylene glycol and methyl cellosolve
- Densities, Excess Molar Volumes, Viscosities, Speeds of Sound, Excess Isentropic Compressibilities, and Relative Permittivities for CmH2m+1(OCH2CH2)nOH (m ) 1 or 2 or 4 andn ) 1) + Benzene, + Toluene, + (o-, m-, and p-) Xylenes, + Ethylbenzene, and + Cyclohexane