- Name
- Benzene, 1,3-dimethyl-
- InChI
- InChI=1S/C8H10/c1-7-4-3-5-8(2)6-7/h3-6H,1-2H3
- InChI Key
- IVSZLXZYQVIEFR-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1cccc(C)c1
- Mol. Weight (g/mol)
- 106.17
- CAS
- 108-38-3
- Name
- Acetone
- InChI
- InChI=1S/C3H6O/c1-3(2)4/h1-2H3
- InChI Key
- CSCPPACGZOOCGX-UHFFFAOYSA-N
- Formula
- C3H6O
- SMILES
- CC(C)=O
- Mol. Weight (g/mol)
- 58.08
- CAS
- 67-64-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Surface tension liquid-gas, N/m [ref]
Operational condition: Temperature, K = 298.15 (Liquid)
| Mole fraction of Acetone (2) - Liquid | Surface tension liquid-gas, N/m - Liquid |
|---|---|
| 0.1027 | 0.0282 |
| 0.1996 | 0.0279 |
| 0.3049 | 0.0277 |
| 0.4029 | 0.0273 |
| 0.4993 | 0.0269 |
| 0.6024 | 0.0264 |
| 0.7002 | 0.0259 |
| 0.8010 | 0.0253 |
| 0.9014 | 0.0247 |
Surface tension liquid-gas, N/m [ref]
Operational condition: Temperature, K = 298.15 (Liquid)
| Mole fraction of Acetone (2) - Liquid | Surface tension liquid-gas, N/m - Liquid |
|---|---|
| 0.1027 | 0.0282 |
| 0.1996 | 0.0279 |
| 0.3049 | 0.0277 |
| 0.4029 | 0.0273 |
| 0.4993 | 0.0269 |
| 0.6024 | 0.0264 |
| 0.7002 | 0.0259 |
| 0.8010 | 0.0253 |
| 0.9014 | 0.0247 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Acetone (2) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.0520 | -1.8000e-08 |
| 0.0991 | -3.0000e-08 |
| 0.1503 | -4.2000e-08 |
| 0.2003 | -5.1000e-08 |
| 0.2488 | -6.2000e-08 |
| 0.2998 | -6.7000e-08 |
| 0.3550 | -7.1000e-08 |
| 0.4006 | -7.3000e-08 |
| 0.4493 | -7.5000e-08 |
| 0.5000 | -7.4000e-08 |
| 0.5498 | -7.0000e-08 |
| 0.6005 | -6.5000e-08 |
| 0.6500 | -6.0000e-08 |
| 0.7000 | -5.1000e-08 |
| 0.7504 | -4.5000e-08 |
| 0.8000 | -3.6000e-08 |
| 0.8507 | -2.9000e-08 |
| 0.9002 | -2.0000e-08 |
| 0.9498 | -1.1000e-08 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Acetone (2) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.0520 | -1.8000e-08 |
| 0.0991 | -3.0000e-08 |
| 0.1503 | -4.2000e-08 |
| 0.2003 | -5.1000e-08 |
| 0.2488 | -6.2000e-08 |
| 0.2998 | -6.7000e-08 |
| 0.3550 | -7.1000e-08 |
| 0.4006 | -7.3000e-08 |
| 0.4493 | -7.5000e-08 |
| 0.5000 | -7.4000e-08 |
| 0.5498 | -7.0000e-08 |
| 0.6005 | -6.5000e-08 |
| 0.6500 | -6.0000e-08 |
| 0.7000 | -5.1000e-08 |
| 0.7504 | -4.5000e-08 |
| 0.8000 | -3.6000e-08 |
| 0.8507 | -2.9000e-08 |
| 0.9002 | -2.0000e-08 |
| 0.9498 | -1.1000e-08 |