- Name
- sulfamethizole
- InChI
- InChI=1S/C9H10N4O2S2/c1-6-11-12-9(16-6)13-17(14,15)8-4-2-7(10)3-5-8/h2-5H,10H2,1H3,(H,12,13)
- InChI Key
- VACCAVUAMIDAGB-UHFFFAOYSA-N
- Formula
- C9H10N4O2S2
- SMILES
-
Cc1nnc(NS(=O)(=O)c2ccc(N)cc2)s
1 - Mol. Weight (g/mol)
- 270.34
- Name
- Propylene Glycol
- InChI
- InChI=1S/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3
- InChI Key
- DNIAPMSPPWPWGF-UHFFFAOYSA-N
- Formula
- C3H8O2
- SMILES
- CC(O)CO
- Mol. Weight (g/mol)
- 76.09
- CAS
- 4254-16-4
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Activity coefficient of sulfamethizole (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Mass fraction of Propylene Glycol (2) - Liquid | Activity coefficient of sulfamethizole (1) - Liquid |
| 293.15 | 0.0000 | 124.1 |
| 293.15 | 0.1000 | 81.0 |
| 293.15 | 0.2000 | 50.1 |
| 293.15 | 0.3000 | 27.38 |
| 293.15 | 0.4000 | 13.56 |
| 293.15 | 0.5000 | 6.67 |
| 293.15 | 0.6000 | 3.58 |
| 293.15 | 0.7000 | 2.288 |
| 293.15 | 0.8000 | 1.386 |
| 293.15 | 0.9000 | 0.9330 |
| 293.15 | 1.0000 | 0.6410 |
| 298.15 | 0.0000 | 118.3 |
| 298.15 | 0.1000 | 80.5 |
| 298.15 | 0.2000 | 49.1 |
| 298.15 | 0.3000 | 25.4 |
| 298.15 | 0.4000 | 13.76 |
| 298.15 | 0.5000 | 6.89 |
| 298.15 | 0.6000 | 3.68 |
| 298.15 | 0.7000 | 2.2 |
| 298.15 | 0.8000 | 1.38 |
| 298.15 | 0.9000 | 0.9780 |
| 298.15 | 1.0000 | 0.6730 |
| 303.15 | 0.0000 | 119.2 |
| 303.15 | 0.1000 | 73.3 |
| 303.15 | 0.2000 | 44.2 |
| 303.15 | 0.3000 | 23.7 |
| 303.15 | 0.4000 | 12.7 |
| 303.15 | 0.5000 | 6.29 |
| 303.15 | 0.6000 | 3.53 |
| 303.15 | 0.7000 | 2.29 |
| 303.15 | 0.8000 | 1.411 |
| 303.15 | 0.9000 | 1.006 |
| 303.15 | 1.0000 | 0.7190 |
| 308.15 | 0.0000 | 123.5 |
| 308.15 | 0.1000 | 73.9 |
| 308.15 | 0.2000 | 42.9 |
| 308.15 | 0.3000 | 22.9 |
| 308.15 | 0.4000 | 12.7 |
| 308.15 | 0.5000 | 6.41 |
| 308.15 | 0.6000 | 3.67 |
| 308.15 | 0.7000 | 2.37 |
| 308.15 | 0.8000 | 1.51 |
| 308.15 | 0.9000 | 1.041 |
| 308.15 | 1.0000 | 0.7540 |
| 313.15 | 0.0000 | 120.0 |
| 313.15 | 0.1000 | 69.0 |
| 313.15 | 0.2000 | 39.9 |
| 313.15 | 0.3000 | 21.7 |
| 313.15 | 0.4000 | 11.16 |
| 313.15 | 0.5000 | 6.04 |
| 313.15 | 0.6000 | 3.46 |
| 313.15 | 0.7000 | 2.27 |
| 313.15 | 0.8000 | 1.455 |
| 313.15 | 0.9000 | 1.05 |
| 313.15 | 1.0000 | 0.7640 |
Activity coefficient of sulfamethizole (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Mass fraction of Propylene Glycol (2) - Liquid | Activity coefficient of sulfamethizole (1) - Liquid |
| 293.15 | 0.0000 | 124.1 |
| 293.15 | 0.1000 | 81.0 |
| 293.15 | 0.2000 | 50.1 |
| 293.15 | 0.3000 | 27.38 |
| 293.15 | 0.4000 | 13.56 |
| 293.15 | 0.5000 | 6.67 |
| 293.15 | 0.6000 | 3.58 |
| 293.15 | 0.7000 | 2.288 |
| 293.15 | 0.8000 | 1.386 |
| 293.15 | 0.9000 | 0.9330 |
| 293.15 | 1.0000 | 0.6410 |
| 298.15 | 0.0000 | 118.3 |
| 298.15 | 0.1000 | 80.5 |
| 298.15 | 0.2000 | 49.1 |
| 298.15 | 0.3000 | 25.4 |
| 298.15 | 0.4000 | 13.76 |
| 298.15 | 0.5000 | 6.89 |
| 298.15 | 0.6000 | 3.68 |
| 298.15 | 0.7000 | 2.2 |
| 298.15 | 0.8000 | 1.38 |
| 298.15 | 0.9000 | 0.9780 |
| 298.15 | 1.0000 | 0.6730 |
| 303.15 | 0.0000 | 119.2 |
| 303.15 | 0.1000 | 73.3 |
| 303.15 | 0.2000 | 44.2 |
| 303.15 | 0.3000 | 23.7 |
| 303.15 | 0.4000 | 12.7 |
| 303.15 | 0.5000 | 6.29 |
| 303.15 | 0.6000 | 3.53 |
| 303.15 | 0.7000 | 2.29 |
| 303.15 | 0.8000 | 1.411 |
| 303.15 | 0.9000 | 1.006 |
| 303.15 | 1.0000 | 0.7190 |
| 308.15 | 0.0000 | 123.5 |
| 308.15 | 0.1000 | 73.9 |
| 308.15 | 0.2000 | 42.9 |
| 308.15 | 0.3000 | 22.9 |
| 308.15 | 0.4000 | 12.7 |
| 308.15 | 0.5000 | 6.41 |
| 308.15 | 0.6000 | 3.67 |
| 308.15 | 0.7000 | 2.37 |
| 308.15 | 0.8000 | 1.51 |
| 308.15 | 0.9000 | 1.041 |
| 308.15 | 1.0000 | 0.7540 |
| 313.15 | 0.0000 | 120.0 |
| 313.15 | 0.1000 | 69.0 |
| 313.15 | 0.2000 | 39.9 |
| 313.15 | 0.3000 | 21.7 |
| 313.15 | 0.4000 | 11.16 |
| 313.15 | 0.5000 | 6.04 |
| 313.15 | 0.6000 | 3.46 |
| 313.15 | 0.7000 | 2.27 |
| 313.15 | 0.8000 | 1.455 |
| 313.15 | 0.9000 | 1.05 |
| 313.15 | 1.0000 | 0.7640 |
Mole fraction of sulfamethizole (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Mass fraction of Propylene Glycol (2) - Liquid | Mole fraction of sulfamethizole (1) - Liquid |
| 293.15 | 0.0000 | 0.0000 |
| 293.15 | 0.1000 | 0.0000 |
| 293.15 | 0.2000 | 0.0001 |
| 293.15 | 0.3000 | 0.0001 |
| 293.15 | 0.4000 | 0.0002 |
| 293.15 | 0.5000 | 0.0005 |
| 293.15 | 0.6000 | 0.0009 |
| 293.15 | 0.7000 | 0.0014 |
| 293.15 | 0.8000 | 0.0023 |
| 293.15 | 0.9000 | 0.0034 |
| 293.15 | 1.0000 | 0.0050 |
| 298.15 | 0.0000 | 0.0000 |
| 298.15 | 0.1000 | 0.0000 |
| 298.15 | 0.2000 | 0.0001 |
| 298.15 | 0.3000 | 0.0002 |
| 298.15 | 0.4000 | 0.0003 |
| 298.15 | 0.5000 | 0.0006 |
| 298.15 | 0.6000 | 0.0011 |
| 298.15 | 0.7000 | 0.0018 |
| 298.15 | 0.8000 | 0.0028 |
| 298.15 | 0.9000 | 0.0040 |
| 298.15 | 1.0000 | 0.0058 |
| 303.15 | 0.0000 | 0.0000 |
| 303.15 | 0.1000 | 0.0001 |
| 303.15 | 0.2000 | 0.0001 |
| 303.15 | 0.3000 | 0.0002 |
| 303.15 | 0.4000 | 0.0004 |
| 303.15 | 0.5000 | 0.0008 |
| 303.15 | 0.6000 | 0.0013 |
| 303.15 | 0.7000 | 0.0021 |
| 303.15 | 0.8000 | 0.0034 |
| 303.15 | 0.9000 | 0.0047 |
| 303.15 | 1.0000 | 0.0066 |
| 308.15 | 0.0000 | 0.0000 |
| 308.15 | 0.1000 | 0.0001 |
| 308.15 | 0.2000 | 0.0001 |
| 308.15 | 0.3000 | 0.0002 |
| 308.15 | 0.4000 | 0.0005 |
| 308.15 | 0.5000 | 0.0009 |
| 308.15 | 0.6000 | 0.0016 |
| 308.15 | 0.7000 | 0.0024 |
| 308.15 | 0.8000 | 0.0038 |
| 308.15 | 0.9000 | 0.0055 |
| 308.15 | 1.0000 | 0.0076 |
| 313.15 | 0.0000 | 0.0001 |
| 313.15 | 0.1000 | 0.0001 |
| 313.15 | 0.2000 | 0.0002 |
| 313.15 | 0.3000 | 0.0003 |
| 313.15 | 0.4000 | 0.0006 |
| 313.15 | 0.5000 | 0.0011 |
| 313.15 | 0.6000 | 0.0020 |
| 313.15 | 0.7000 | 0.0030 |
| 313.15 | 0.8000 | 0.0047 |
| 313.15 | 0.9000 | 0.0066 |
| 313.15 | 1.0000 | 0.0090 |
Mole fraction of sulfamethizole (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Mass fraction of Propylene Glycol (2) - Liquid | Mole fraction of sulfamethizole (1) - Liquid |
| 293.15 | 0.0000 | 0.0000 |
| 293.15 | 0.1000 | 0.0000 |
| 293.15 | 0.2000 | 0.0001 |
| 293.15 | 0.3000 | 0.0001 |
| 293.15 | 0.4000 | 0.0002 |
| 293.15 | 0.5000 | 0.0005 |
| 293.15 | 0.6000 | 0.0009 |
| 293.15 | 0.7000 | 0.0014 |
| 293.15 | 0.8000 | 0.0023 |
| 293.15 | 0.9000 | 0.0034 |
| 293.15 | 1.0000 | 0.0050 |
| 298.15 | 0.0000 | 0.0000 |
| 298.15 | 0.1000 | 0.0000 |
| 298.15 | 0.2000 | 0.0001 |
| 298.15 | 0.3000 | 0.0002 |
| 298.15 | 0.4000 | 0.0003 |
| 298.15 | 0.5000 | 0.0006 |
| 298.15 | 0.6000 | 0.0011 |
| 298.15 | 0.7000 | 0.0018 |
| 298.15 | 0.8000 | 0.0028 |
| 298.15 | 0.9000 | 0.0040 |
| 298.15 | 1.0000 | 0.0058 |
| 303.15 | 0.0000 | 0.0000 |
| 303.15 | 0.1000 | 0.0001 |
| 303.15 | 0.2000 | 0.0001 |
| 303.15 | 0.3000 | 0.0002 |
| 303.15 | 0.4000 | 0.0004 |
| 303.15 | 0.5000 | 0.0008 |
| 303.15 | 0.6000 | 0.0013 |
| 303.15 | 0.7000 | 0.0021 |
| 303.15 | 0.8000 | 0.0034 |
| 303.15 | 0.9000 | 0.0047 |
| 303.15 | 1.0000 | 0.0066 |
| 308.15 | 0.0000 | 0.0000 |
| 308.15 | 0.1000 | 0.0001 |
| 308.15 | 0.2000 | 0.0001 |
| 308.15 | 0.3000 | 0.0002 |
| 308.15 | 0.4000 | 0.0005 |
| 308.15 | 0.5000 | 0.0009 |
| 308.15 | 0.6000 | 0.0016 |
| 308.15 | 0.7000 | 0.0024 |
| 308.15 | 0.8000 | 0.0038 |
| 308.15 | 0.9000 | 0.0055 |
| 308.15 | 1.0000 | 0.0076 |
| 313.15 | 0.0000 | 0.0001 |
| 313.15 | 0.1000 | 0.0001 |
| 313.15 | 0.2000 | 0.0002 |
| 313.15 | 0.3000 | 0.0003 |
| 313.15 | 0.4000 | 0.0006 |
| 313.15 | 0.5000 | 0.0011 |
| 313.15 | 0.6000 | 0.0020 |
| 313.15 | 0.7000 | 0.0030 |
| 313.15 | 0.8000 | 0.0047 |
| 313.15 | 0.9000 | 0.0066 |
| 313.15 | 1.0000 | 0.0090 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.