- Name
- Cyclopentane
- InChI
- InChI=1S/C5H10/c1-2-4-5-3-1/h1-5H2
- InChI Key
- RGSFGYAAUTVSQA-UHFFFAOYSA-N
- Formula
- C5H10
- SMILES
- C1CCCC1
- Mol. Weight (g/mol)
- 70.13
- CAS
- 287-92-3
- Name
- Benzene, 1,3-dimethyl-
- InChI
- InChI=1S/C8H10/c1-7-4-3-5-8(2)6-7/h3-6H,1-2H3
- InChI Key
- IVSZLXZYQVIEFR-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1cccc(C)c1
- Mol. Weight (g/mol)
- 106.17
- CAS
- 108-38-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclopentane (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4947 |
| 298.15 | 0.0391 | 1.4918 |
| 298.15 | 0.0908 | 1.4882 |
| 298.15 | 0.1894 | 1.4807 |
| 298.15 | 0.2859 | 1.4734 |
| 298.15 | 0.3868 | 1.465 |
| 298.15 | 0.4808 | 1.4574 |
| 298.15 | 0.6394 | 1.4424 |
| 298.15 | 0.6923 | 1.4367 |
| 298.15 | 0.7909 | 1.4269 |
| 298.15 | 0.8952 | 1.415 |
| 298.15 | 0.9514 | 1.4089 |
| 298.15 | 1.0000 | 1.4029 |
| 313.15 | 0.0000 | 1.4865 |
| 313.15 | 0.0431 | 1.4839 |
| 313.15 | 0.0812 | 1.481 |
| 313.15 | 0.1859 | 1.473 |
| 313.15 | 0.2864 | 1.4652 |
| 313.15 | 0.3348 | 1.4613 |
| 313.15 | 0.4741 | 1.4489 |
| 313.15 | 0.5747 | 1.4399 |
| 313.15 | 0.6933 | 1.4283 |
| 313.15 | 0.7932 | 1.4181 |
| 313.15 | 0.8961 | 1.4067 |
| 313.15 | 0.9472 | 1.4012 |
| 313.15 | 1.0000 | 1.3946 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclopentane (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4947 |
| 298.15 | 0.0391 | 1.4918 |
| 298.15 | 0.0908 | 1.4882 |
| 298.15 | 0.1894 | 1.4807 |
| 298.15 | 0.2859 | 1.4734 |
| 298.15 | 0.3868 | 1.465 |
| 298.15 | 0.4808 | 1.4574 |
| 298.15 | 0.6394 | 1.4424 |
| 298.15 | 0.6923 | 1.4367 |
| 298.15 | 0.7909 | 1.4269 |
| 298.15 | 0.8952 | 1.415 |
| 298.15 | 0.9514 | 1.4089 |
| 298.15 | 1.0000 | 1.4029 |
| 313.15 | 0.0000 | 1.4865 |
| 313.15 | 0.0431 | 1.4839 |
| 313.15 | 0.0812 | 1.481 |
| 313.15 | 0.1859 | 1.473 |
| 313.15 | 0.2864 | 1.4652 |
| 313.15 | 0.3348 | 1.4613 |
| 313.15 | 0.4741 | 1.4489 |
| 313.15 | 0.5747 | 1.4399 |
| 313.15 | 0.6933 | 1.4283 |
| 313.15 | 0.7932 | 1.4181 |
| 313.15 | 0.8961 | 1.4067 |
| 313.15 | 0.9472 | 1.4012 |
| 313.15 | 1.0000 | 1.3946 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclopentane (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 859.8 |
| 298.15 | 0.0391 | 856.1 |
| 298.15 | 0.0908 | 851.1 |
| 298.15 | 0.1894 | 841.2 |
| 298.15 | 0.2859 | 831.2 |
| 298.15 | 0.3868 | 820.1 |
| 298.15 | 0.4808 | 809.2 |
| 298.15 | 0.6394 | 789.8 |
| 298.15 | 0.6923 | 782.9 |
| 298.15 | 0.7909 | 769.7 |
| 298.15 | 0.8952 | 755.0 |
| 298.15 | 0.9514 | 746.9 |
| 298.15 | 1.0000 | 740.0 |
| 313.15 | 0.0000 | 846.9 |
| 313.15 | 0.0431 | 842.9 |
| 313.15 | 0.0812 | 839.2 |
| 313.15 | 0.1859 | 828.6 |
| 313.15 | 0.2864 | 818.0 |
| 313.15 | 0.3348 | 812.6 |
| 313.15 | 0.4741 | 796.4 |
| 313.15 | 0.5747 | 784.1 |
| 313.15 | 0.6933 | 768.8 |
| 313.15 | 0.7932 | 755.2 |
| 313.15 | 0.8961 | 740.5 |
| 313.15 | 0.9472 | 733.0 |
| 313.15 | 1.0000 | 725.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclopentane (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 859.8 |
| 298.15 | 0.0391 | 856.1 |
| 298.15 | 0.0908 | 851.1 |
| 298.15 | 0.1894 | 841.2 |
| 298.15 | 0.2859 | 831.2 |
| 298.15 | 0.3868 | 820.1 |
| 298.15 | 0.4808 | 809.2 |
| 298.15 | 0.6394 | 789.8 |
| 298.15 | 0.6923 | 782.9 |
| 298.15 | 0.7909 | 769.7 |
| 298.15 | 0.8952 | 755.0 |
| 298.15 | 0.9514 | 746.9 |
| 298.15 | 1.0000 | 740.0 |
| 313.15 | 0.0000 | 846.9 |
| 313.15 | 0.0431 | 842.9 |
| 313.15 | 0.0812 | 839.2 |
| 313.15 | 0.1859 | 828.6 |
| 313.15 | 0.2864 | 818.0 |
| 313.15 | 0.3348 | 812.6 |
| 313.15 | 0.4741 | 796.4 |
| 313.15 | 0.5747 | 784.1 |
| 313.15 | 0.6933 | 768.8 |
| 313.15 | 0.7932 | 755.2 |
| 313.15 | 0.8961 | 740.5 |
| 313.15 | 0.9472 | 733.0 |
| 313.15 | 1.0000 | 725.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclopentane (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1321.0 |
| 298.15 | 0.0391 | 1315.0 |
| 298.15 | 0.0908 | 1308.0 |
| 298.15 | 0.1894 | 1296.0 |
| 298.15 | 0.2859 | 1284.0 |
| 298.15 | 0.3868 | 1272.0 |
| 298.15 | 0.4808 | 1260.0 |
| 298.15 | 0.6394 | 1241.0 |
| 298.15 | 0.6923 | 1235.0 |
| 298.15 | 0.7909 | 1224.0 |
| 298.15 | 0.8952 | 1214.0 |
| 298.15 | 0.9514 | 1208.0 |
| 298.15 | 1.0000 | 1204.0 |
| 313.15 | 0.0000 | 1259.0 |
| 313.15 | 0.0431 | 1253.0 |
| 313.15 | 0.0812 | 1248.0 |
| 313.15 | 0.1859 | 1234.0 |
| 313.15 | 0.2864 | 1220.0 |
| 313.15 | 0.3348 | 1213.0 |
| 313.15 | 0.4741 | 1194.0 |
| 313.15 | 0.5747 | 1181.0 |
| 313.15 | 0.6933 | 1166.0 |
| 313.15 | 0.7932 | 1153.0 |
| 313.15 | 0.8961 | 1141.0 |
| 313.15 | 0.9472 | 1135.0 |
| 313.15 | 1.0000 | 1130.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclopentane (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1321.0 |
| 298.15 | 0.0391 | 1315.0 |
| 298.15 | 0.0908 | 1308.0 |
| 298.15 | 0.1894 | 1296.0 |
| 298.15 | 0.2859 | 1284.0 |
| 298.15 | 0.3868 | 1272.0 |
| 298.15 | 0.4808 | 1260.0 |
| 298.15 | 0.6394 | 1241.0 |
| 298.15 | 0.6923 | 1235.0 |
| 298.15 | 0.7909 | 1224.0 |
| 298.15 | 0.8952 | 1214.0 |
| 298.15 | 0.9514 | 1208.0 |
| 298.15 | 1.0000 | 1204.0 |
| 313.15 | 0.0000 | 1259.0 |
| 313.15 | 0.0431 | 1253.0 |
| 313.15 | 0.0812 | 1248.0 |
| 313.15 | 0.1859 | 1234.0 |
| 313.15 | 0.2864 | 1220.0 |
| 313.15 | 0.3348 | 1213.0 |
| 313.15 | 0.4741 | 1194.0 |
| 313.15 | 0.5747 | 1181.0 |
| 313.15 | 0.6933 | 1166.0 |
| 313.15 | 0.7932 | 1153.0 |
| 313.15 | 0.8961 | 1141.0 |
| 313.15 | 0.9472 | 1135.0 |
| 313.15 | 1.0000 | 1130.0 |