- Name
- Benzene, 1,3-dimethyl-
- InChI
- InChI=1S/C8H10/c1-7-4-3-5-8(2)6-7/h3-6H,1-2H3
- InChI Key
- IVSZLXZYQVIEFR-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1cccc(C)c1
- Mol. Weight (g/mol)
- 106.17
- CAS
- 108-38-3
- Name
- Cyclohexane, methyl-
- InChI
- InChI=1S/C7H14/c1-7-5-3-2-4-6-7/h7H,2-6H2,1H3
- InChI Key
- UAEPNZWRGJTJPN-UHFFFAOYSA-N
- Formula
- C7H14
- SMILES
- CC1CCCCC1
- Mol. Weight (g/mol)
- 98.19
- CAS
- 108-87-2
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4947 |
| 298.15 | 0.0514 | 1.4905 |
| 298.15 | 0.0975 | 1.4867 |
| 298.15 | 0.1590 | 1.4817 |
| 298.15 | 0.2977 | 1.4707 |
| 298.15 | 0.3990 | 1.4629 |
| 298.15 | 0.4954 | 1.4557 |
| 298.15 | 0.5965 | 1.4483 |
| 298.15 | 0.6974 | 1.4411 |
| 298.15 | 0.7948 | 1.4343 |
| 298.15 | 0.8933 | 1.4276 |
| 298.15 | 0.9495 | 1.4239 |
| 298.15 | 1.0000 | 1.4206 |
| 313.15 | 0.0000 | 1.4865 |
| 313.15 | 0.0457 | 1.4829 |
| 313.15 | 0.0933 | 1.4791 |
| 313.15 | 0.1938 | 1.471 |
| 313.15 | 0.2886 | 1.4636 |
| 313.15 | 0.3966 | 1.4553 |
| 313.15 | 0.5077 | 1.447 |
| 313.15 | 0.5950 | 1.4406 |
| 313.15 | 0.6933 | 1.4336 |
| 313.15 | 0.7987 | 1.4262 |
| 313.15 | 0.8973 | 1.4195 |
| 313.15 | 0.9504 | 1.4161 |
| 313.15 | 1.0000 | 1.4127 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4947 |
| 298.15 | 0.0514 | 1.4905 |
| 298.15 | 0.0975 | 1.4867 |
| 298.15 | 0.1590 | 1.4817 |
| 298.15 | 0.2977 | 1.4707 |
| 298.15 | 0.3990 | 1.4629 |
| 298.15 | 0.4954 | 1.4557 |
| 298.15 | 0.5965 | 1.4483 |
| 298.15 | 0.6974 | 1.4411 |
| 298.15 | 0.7948 | 1.4343 |
| 298.15 | 0.8933 | 1.4276 |
| 298.15 | 0.9495 | 1.4239 |
| 298.15 | 1.0000 | 1.4206 |
| 313.15 | 0.0000 | 1.4865 |
| 313.15 | 0.0457 | 1.4829 |
| 313.15 | 0.0933 | 1.4791 |
| 313.15 | 0.1938 | 1.471 |
| 313.15 | 0.2886 | 1.4636 |
| 313.15 | 0.3966 | 1.4553 |
| 313.15 | 0.5077 | 1.447 |
| 313.15 | 0.5950 | 1.4406 |
| 313.15 | 0.6933 | 1.4336 |
| 313.15 | 0.7987 | 1.4262 |
| 313.15 | 0.8973 | 1.4195 |
| 313.15 | 0.9504 | 1.4161 |
| 313.15 | 1.0000 | 1.4127 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 859.8 |
| 298.15 | 0.0514 | 854.4 |
| 298.15 | 0.0975 | 849.6 |
| 298.15 | 0.1590 | 843.2 |
| 298.15 | 0.2977 | 829.1 |
| 298.15 | 0.3990 | 819.1 |
| 298.15 | 0.4954 | 809.7 |
| 298.15 | 0.5965 | 800.2 |
| 298.15 | 0.6974 | 791.0 |
| 298.15 | 0.7948 | 782.3 |
| 298.15 | 0.8933 | 773.8 |
| 298.15 | 0.9495 | 769.1 |
| 298.15 | 1.0000 | 765.0 |
| 313.15 | 0.0000 | 846.9 |
| 313.15 | 0.0457 | 842.1 |
| 313.15 | 0.0933 | 837.1 |
| 313.15 | 0.1938 | 826.7 |
| 313.15 | 0.2886 | 817.0 |
| 313.15 | 0.3966 | 806.3 |
| 313.15 | 0.5077 | 795.5 |
| 313.15 | 0.5950 | 787.3 |
| 313.15 | 0.6933 | 778.3 |
| 313.15 | 0.7987 | 768.8 |
| 313.15 | 0.8973 | 760.3 |
| 313.15 | 0.9504 | 756.1 |
| 313.15 | 1.0000 | 751.9 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 859.8 |
| 298.15 | 0.0514 | 854.4 |
| 298.15 | 0.0975 | 849.6 |
| 298.15 | 0.1590 | 843.2 |
| 298.15 | 0.2977 | 829.1 |
| 298.15 | 0.3990 | 819.1 |
| 298.15 | 0.4954 | 809.7 |
| 298.15 | 0.5965 | 800.2 |
| 298.15 | 0.6974 | 791.0 |
| 298.15 | 0.7948 | 782.3 |
| 298.15 | 0.8933 | 773.8 |
| 298.15 | 0.9495 | 769.1 |
| 298.15 | 1.0000 | 765.0 |
| 313.15 | 0.0000 | 846.9 |
| 313.15 | 0.0457 | 842.1 |
| 313.15 | 0.0933 | 837.1 |
| 313.15 | 0.1938 | 826.7 |
| 313.15 | 0.2886 | 817.0 |
| 313.15 | 0.3966 | 806.3 |
| 313.15 | 0.5077 | 795.5 |
| 313.15 | 0.5950 | 787.3 |
| 313.15 | 0.6933 | 778.3 |
| 313.15 | 0.7987 | 768.8 |
| 313.15 | 0.8973 | 760.3 |
| 313.15 | 0.9504 | 756.1 |
| 313.15 | 1.0000 | 751.9 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1321.0 |
| 298.15 | 0.0514 | 1313.0 |
| 298.15 | 0.0975 | 1307.0 |
| 298.15 | 0.1590 | 1298.0 |
| 298.15 | 0.2977 | 1281.0 |
| 298.15 | 0.3990 | 1269.0 |
| 298.15 | 0.4954 | 1258.0 |
| 298.15 | 0.5965 | 1248.0 |
| 298.15 | 0.6974 | 1238.0 |
| 298.15 | 0.7948 | 1230.0 |
| 298.15 | 0.8933 | 1222.0 |
| 298.15 | 0.9495 | 1218.0 |
| 298.15 | 1.0000 | 1215.0 |
| 313.15 | 0.0000 | 1259.0 |
| 313.15 | 0.0457 | 1252.0 |
| 313.15 | 0.0933 | 1246.0 |
| 313.15 | 0.1938 | 1232.0 |
| 313.15 | 0.2886 | 1219.0 |
| 313.15 | 0.3966 | 1206.0 |
| 313.15 | 0.5077 | 1194.0 |
| 313.15 | 0.5950 | 1184.0 |
| 313.15 | 0.6933 | 1175.0 |
| 313.15 | 0.7987 | 1165.0 |
| 313.15 | 0.8973 | 1157.0 |
| 313.15 | 0.9504 | 1153.0 |
| 313.15 | 1.0000 | 1150.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclohexane, methyl- (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1321.0 |
| 298.15 | 0.0514 | 1313.0 |
| 298.15 | 0.0975 | 1307.0 |
| 298.15 | 0.1590 | 1298.0 |
| 298.15 | 0.2977 | 1281.0 |
| 298.15 | 0.3990 | 1269.0 |
| 298.15 | 0.4954 | 1258.0 |
| 298.15 | 0.5965 | 1248.0 |
| 298.15 | 0.6974 | 1238.0 |
| 298.15 | 0.7948 | 1230.0 |
| 298.15 | 0.8933 | 1222.0 |
| 298.15 | 0.9495 | 1218.0 |
| 298.15 | 1.0000 | 1215.0 |
| 313.15 | 0.0000 | 1259.0 |
| 313.15 | 0.0457 | 1252.0 |
| 313.15 | 0.0933 | 1246.0 |
| 313.15 | 0.1938 | 1232.0 |
| 313.15 | 0.2886 | 1219.0 |
| 313.15 | 0.3966 | 1206.0 |
| 313.15 | 0.5077 | 1194.0 |
| 313.15 | 0.5950 | 1184.0 |
| 313.15 | 0.6933 | 1175.0 |
| 313.15 | 0.7987 | 1165.0 |
| 313.15 | 0.8973 | 1157.0 |
| 313.15 | 0.9504 | 1153.0 |
| 313.15 | 1.0000 | 1150.0 |