- Name
- Cyclooctane
- InChI
- InChI=1S/C8H16/c1-2-4-6-8-7-5-3-1/h1-8H2
- InChI Key
- WJTCGQSWYFHTAC-UHFFFAOYSA-N
- Formula
- C8H16
- SMILES
- C1CCCCCCC1
- Mol. Weight (g/mol)
- 112.21
- CAS
- 292-64-8
- Name
- Benzene, 1,3-dimethyl-
- InChI
- InChI=1S/C8H10/c1-7-4-3-5-8(2)6-7/h3-6H,1-2H3
- InChI Key
- IVSZLXZYQVIEFR-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1cccc(C)c1
- Mol. Weight (g/mol)
- 106.17
- CAS
- 108-38-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4947 |
| 298.15 | 0.0545 | 1.4919 |
| 298.15 | 0.0993 | 1.4896 |
| 298.15 | 0.2059 | 1.4845 |
| 298.15 | 0.3074 | 1.4799 |
| 298.15 | 0.3933 | 1.4762 |
| 298.15 | 0.5031 | 1.4718 |
| 298.15 | 0.6002 | 1.4681 |
| 298.15 | 0.6993 | 1.4646 |
| 298.15 | 0.8198 | 1.4607 |
| 298.15 | 0.8909 | 1.4587 |
| 298.15 | 0.9503 | 1.4571 |
| 298.15 | 1.0000 | 1.456 |
| 313.15 | 0.0000 | 1.4865 |
| 313.15 | 0.0506 | 1.4842 |
| 313.15 | 0.0888 | 1.4824 |
| 313.15 | 0.1861 | 1.4778 |
| 313.15 | 0.2924 | 1.4731 |
| 313.15 | 0.3795 | 1.4694 |
| 313.15 | 0.4870 | 1.4652 |
| 313.15 | 0.5832 | 1.4616 |
| 313.15 | 0.6823 | 1.4581 |
| 313.15 | 0.7874 | 1.4547 |
| 313.15 | 0.8879 | 1.4517 |
| 313.15 | 0.9389 | 1.4505 |
| 313.15 | 1.0000 | 1.4488 |
| 313.15 | 0.0000 | 1.4865 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4947 |
| 298.15 | 0.0545 | 1.4919 |
| 298.15 | 0.0993 | 1.4896 |
| 298.15 | 0.2059 | 1.4845 |
| 298.15 | 0.3074 | 1.4799 |
| 298.15 | 0.3933 | 1.4762 |
| 298.15 | 0.5031 | 1.4718 |
| 298.15 | 0.6002 | 1.4681 |
| 298.15 | 0.6993 | 1.4646 |
| 298.15 | 0.8198 | 1.4607 |
| 298.15 | 0.8909 | 1.4587 |
| 298.15 | 0.9503 | 1.4571 |
| 298.15 | 1.0000 | 1.456 |
| 313.15 | 0.0000 | 1.4865 |
| 313.15 | 0.0506 | 1.4842 |
| 313.15 | 0.0888 | 1.4824 |
| 313.15 | 0.1861 | 1.4778 |
| 313.15 | 0.2924 | 1.4731 |
| 313.15 | 0.3795 | 1.4694 |
| 313.15 | 0.4870 | 1.4652 |
| 313.15 | 0.5832 | 1.4616 |
| 313.15 | 0.6823 | 1.4581 |
| 313.15 | 0.7874 | 1.4547 |
| 313.15 | 0.8879 | 1.4517 |
| 313.15 | 0.9389 | 1.4505 |
| 313.15 | 1.0000 | 1.4488 |
| 313.15 | 0.0000 | 1.4865 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 859.8 |
| 298.15 | 0.0545 | 857.4 |
| 298.15 | 0.0993 | 855.5 |
| 298.15 | 0.2059 | 851.1 |
| 298.15 | 0.3074 | 847.4 |
| 298.15 | 0.3933 | 844.4 |
| 298.15 | 0.5031 | 841.0 |
| 298.15 | 0.6002 | 838.2 |
| 298.15 | 0.6993 | 835.9 |
| 298.15 | 0.8198 | 833.5 |
| 298.15 | 0.8909 | 832.4 |
| 298.15 | 0.9503 | 831.8 |
| 298.15 | 1.0000 | 831.5 |
| 313.15 | 0.0000 | 846.9 |
| 313.15 | 0.0506 | 844.7 |
| 313.15 | 0.0888 | 843.1 |
| 313.15 | 0.1861 | 839.3 |
| 313.15 | 0.2924 | 835.4 |
| 313.15 | 0.3795 | 832.4 |
| 313.15 | 0.4870 | 829.1 |
| 313.15 | 0.5832 | 826.4 |
| 313.15 | 0.6823 | 824.0 |
| 313.15 | 0.7874 | 821.9 |
| 313.15 | 0.8879 | 820.3 |
| 313.15 | 0.9389 | 819.7 |
| 313.15 | 1.0000 | 819.2 |
| 313.15 | 0.0000 | 846.9 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 859.8 |
| 298.15 | 0.0545 | 857.4 |
| 298.15 | 0.0993 | 855.5 |
| 298.15 | 0.2059 | 851.1 |
| 298.15 | 0.3074 | 847.4 |
| 298.15 | 0.3933 | 844.4 |
| 298.15 | 0.5031 | 841.0 |
| 298.15 | 0.6002 | 838.2 |
| 298.15 | 0.6993 | 835.9 |
| 298.15 | 0.8198 | 833.5 |
| 298.15 | 0.8909 | 832.4 |
| 298.15 | 0.9503 | 831.8 |
| 298.15 | 1.0000 | 831.5 |
| 313.15 | 0.0000 | 846.9 |
| 313.15 | 0.0506 | 844.7 |
| 313.15 | 0.0888 | 843.1 |
| 313.15 | 0.1861 | 839.3 |
| 313.15 | 0.2924 | 835.4 |
| 313.15 | 0.3795 | 832.4 |
| 313.15 | 0.4870 | 829.1 |
| 313.15 | 0.5832 | 826.4 |
| 313.15 | 0.6823 | 824.0 |
| 313.15 | 0.7874 | 821.9 |
| 313.15 | 0.8879 | 820.3 |
| 313.15 | 0.9389 | 819.7 |
| 313.15 | 1.0000 | 819.2 |
| 313.15 | 0.0000 | 846.9 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1321.0 |
| 298.15 | 0.0545 | 1322.0 |
| 298.15 | 0.0993 | 1324.0 |
| 298.15 | 0.2059 | 1328.0 |
| 298.15 | 0.3074 | 1333.0 |
| 298.15 | 0.3933 | 1338.0 |
| 298.15 | 0.5031 | 1346.0 |
| 298.15 | 0.6002 | 1353.0 |
| 298.15 | 0.6993 | 1361.0 |
| 298.15 | 0.8198 | 1372.0 |
| 298.15 | 0.8909 | 1379.0 |
| 298.15 | 0.9503 | 1385.0 |
| 298.15 | 1.0000 | 1391.0 |
| 313.15 | 0.0000 | 1259.0 |
| 313.15 | 0.0506 | 1260.0 |
| 313.15 | 0.0888 | 1262.0 |
| 313.15 | 0.1861 | 1265.0 |
| 313.15 | 0.2924 | 1270.0 |
| 313.15 | 0.3795 | 1275.0 |
| 313.15 | 0.4870 | 1282.0 |
| 313.15 | 0.5832 | 1289.0 |
| 313.15 | 0.6823 | 1296.0 |
| 313.15 | 0.7874 | 1305.0 |
| 313.15 | 0.8879 | 1315.0 |
| 313.15 | 0.9389 | 1320.0 |
| 313.15 | 1.0000 | 1326.0 |
| 313.15 | 0.0000 | 1259.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1321.0 |
| 298.15 | 0.0545 | 1322.0 |
| 298.15 | 0.0993 | 1324.0 |
| 298.15 | 0.2059 | 1328.0 |
| 298.15 | 0.3074 | 1333.0 |
| 298.15 | 0.3933 | 1338.0 |
| 298.15 | 0.5031 | 1346.0 |
| 298.15 | 0.6002 | 1353.0 |
| 298.15 | 0.6993 | 1361.0 |
| 298.15 | 0.8198 | 1372.0 |
| 298.15 | 0.8909 | 1379.0 |
| 298.15 | 0.9503 | 1385.0 |
| 298.15 | 1.0000 | 1391.0 |
| 313.15 | 0.0000 | 1259.0 |
| 313.15 | 0.0506 | 1260.0 |
| 313.15 | 0.0888 | 1262.0 |
| 313.15 | 0.1861 | 1265.0 |
| 313.15 | 0.2924 | 1270.0 |
| 313.15 | 0.3795 | 1275.0 |
| 313.15 | 0.4870 | 1282.0 |
| 313.15 | 0.5832 | 1289.0 |
| 313.15 | 0.6823 | 1296.0 |
| 313.15 | 0.7874 | 1305.0 |
| 313.15 | 0.8879 | 1315.0 |
| 313.15 | 0.9389 | 1320.0 |
| 313.15 | 1.0000 | 1326.0 |
| 313.15 | 0.0000 | 1259.0 |