- Name
- Cyclooctane
- InChI
- InChI=1S/C8H16/c1-2-4-6-8-7-5-3-1/h1-8H2
- InChI Key
- WJTCGQSWYFHTAC-UHFFFAOYSA-N
- Formula
- C8H16
- SMILES
- C1CCCCCCC1
- Mol. Weight (g/mol)
- 112.21
- CAS
- 292-64-8
- Name
- Mesitylene
- InChI
- InChI=1S/C9H12/c1-7-4-8(2)6-9(3)5-7/h4-6H,1-3H3
- InChI Key
- AUHZEENZYGFFBQ-UHFFFAOYSA-N
- Formula
- C9H12
- SMILES
- Cc1cc(C)cc(C)c1
- Mol. Weight (g/mol)
- 120.19
- CAS
- 108-67-8
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4969 |
| 298.15 | 0.0496 | 1.4945 |
| 298.15 | 0.1026 | 1.492 |
| 298.15 | 0.2035 | 1.4872 |
| 298.15 | 0.3070 | 1.4825 |
| 298.15 | 0.4062 | 1.4781 |
| 298.15 | 0.5042 | 1.4738 |
| 298.15 | 0.5980 | 1.47 |
| 298.15 | 0.6960 | 1.4661 |
| 298.15 | 0.8308 | 1.4611 |
| 298.15 | 0.8926 | 1.459 |
| 298.15 | 0.9484 | 1.4574 |
| 298.15 | 1.0000 | 1.456 |
| 313.15 | 0.0000 | 1.4892 |
| 313.15 | 0.0517 | 1.4869 |
| 313.15 | 0.0872 | 1.4853 |
| 313.15 | 0.1842 | 1.4808 |
| 313.15 | 0.2935 | 1.4759 |
| 313.15 | 0.3891 | 1.4717 |
| 313.15 | 0.4882 | 1.4674 |
| 313.15 | 0.5857 | 1.4634 |
| 313.15 | 0.6847 | 1.4595 |
| 313.15 | 0.7910 | 1.4556 |
| 313.15 | 0.8911 | 1.4521 |
| 313.15 | 0.9390 | 1.4505 |
| 313.15 | 1.0000 | 1.4488 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4969 |
| 298.15 | 0.0496 | 1.4945 |
| 298.15 | 0.1026 | 1.492 |
| 298.15 | 0.2035 | 1.4872 |
| 298.15 | 0.3070 | 1.4825 |
| 298.15 | 0.4062 | 1.4781 |
| 298.15 | 0.5042 | 1.4738 |
| 298.15 | 0.5980 | 1.47 |
| 298.15 | 0.6960 | 1.4661 |
| 298.15 | 0.8308 | 1.4611 |
| 298.15 | 0.8926 | 1.459 |
| 298.15 | 0.9484 | 1.4574 |
| 298.15 | 1.0000 | 1.456 |
| 313.15 | 0.0000 | 1.4892 |
| 313.15 | 0.0517 | 1.4869 |
| 313.15 | 0.0872 | 1.4853 |
| 313.15 | 0.1842 | 1.4808 |
| 313.15 | 0.2935 | 1.4759 |
| 313.15 | 0.3891 | 1.4717 |
| 313.15 | 0.4882 | 1.4674 |
| 313.15 | 0.5857 | 1.4634 |
| 313.15 | 0.6847 | 1.4595 |
| 313.15 | 0.7910 | 1.4556 |
| 313.15 | 0.8911 | 1.4521 |
| 313.15 | 0.9390 | 1.4505 |
| 313.15 | 1.0000 | 1.4488 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 861.1 |
| 298.15 | 0.0496 | 858.9 |
| 298.15 | 0.1026 | 856.8 |
| 298.15 | 0.2035 | 852.7 |
| 298.15 | 0.3070 | 848.8 |
| 298.15 | 0.4062 | 845.2 |
| 298.15 | 0.5042 | 841.9 |
| 298.15 | 0.5980 | 839.0 |
| 298.15 | 0.6960 | 836.2 |
| 298.15 | 0.8308 | 833.3 |
| 298.15 | 0.8926 | 832.3 |
| 298.15 | 0.9484 | 831.7 |
| 298.15 | 1.0000 | 831.5 |
| 313.15 | 0.0000 | 848.8 |
| 313.15 | 0.0517 | 846.6 |
| 313.15 | 0.0872 | 845.2 |
| 313.15 | 0.1842 | 841.3 |
| 313.15 | 0.2935 | 837.2 |
| 313.15 | 0.3891 | 833.8 |
| 313.15 | 0.4882 | 830.4 |
| 313.15 | 0.5857 | 827.5 |
| 313.15 | 0.6847 | 824.6 |
| 313.15 | 0.7910 | 822.1 |
| 313.15 | 0.8911 | 820.3 |
| 313.15 | 0.9390 | 819.7 |
| 313.15 | 1.0000 | 819.2 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 861.1 |
| 298.15 | 0.0496 | 858.9 |
| 298.15 | 0.1026 | 856.8 |
| 298.15 | 0.2035 | 852.7 |
| 298.15 | 0.3070 | 848.8 |
| 298.15 | 0.4062 | 845.2 |
| 298.15 | 0.5042 | 841.9 |
| 298.15 | 0.5980 | 839.0 |
| 298.15 | 0.6960 | 836.2 |
| 298.15 | 0.8308 | 833.3 |
| 298.15 | 0.8926 | 832.3 |
| 298.15 | 0.9484 | 831.7 |
| 298.15 | 1.0000 | 831.5 |
| 313.15 | 0.0000 | 848.8 |
| 313.15 | 0.0517 | 846.6 |
| 313.15 | 0.0872 | 845.2 |
| 313.15 | 0.1842 | 841.3 |
| 313.15 | 0.2935 | 837.2 |
| 313.15 | 0.3891 | 833.8 |
| 313.15 | 0.4882 | 830.4 |
| 313.15 | 0.5857 | 827.5 |
| 313.15 | 0.6847 | 824.6 |
| 313.15 | 0.7910 | 822.1 |
| 313.15 | 0.8911 | 820.3 |
| 313.15 | 0.9390 | 819.7 |
| 313.15 | 1.0000 | 819.2 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1336.0 |
| 298.15 | 0.0496 | 1338.0 |
| 298.15 | 0.1026 | 1339.0 |
| 298.15 | 0.2035 | 1341.0 |
| 298.15 | 0.3070 | 1345.0 |
| 298.15 | 0.4062 | 1349.0 |
| 298.15 | 0.5042 | 1354.0 |
| 298.15 | 0.5980 | 1359.0 |
| 298.15 | 0.6960 | 1366.0 |
| 298.15 | 0.8308 | 1376.0 |
| 298.15 | 0.8926 | 1381.0 |
| 298.15 | 0.9484 | 1386.0 |
| 298.15 | 1.0000 | 1391.0 |
| 313.15 | 0.0000 | 1277.0 |
| 313.15 | 0.0517 | 1277.0 |
| 313.15 | 0.0872 | 1278.0 |
| 313.15 | 0.1842 | 1280.0 |
| 313.15 | 0.2935 | 1283.0 |
| 313.15 | 0.3891 | 1287.0 |
| 313.15 | 0.4882 | 1291.0 |
| 313.15 | 0.5857 | 1296.0 |
| 313.15 | 0.6847 | 1302.0 |
| 313.15 | 0.7910 | 1309.0 |
| 313.15 | 0.8911 | 1317.0 |
| 313.15 | 0.9390 | 1321.0 |
| 313.15 | 1.0000 | 1325.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1336.0 |
| 298.15 | 0.0496 | 1338.0 |
| 298.15 | 0.1026 | 1339.0 |
| 298.15 | 0.2035 | 1341.0 |
| 298.15 | 0.3070 | 1345.0 |
| 298.15 | 0.4062 | 1349.0 |
| 298.15 | 0.5042 | 1354.0 |
| 298.15 | 0.5980 | 1359.0 |
| 298.15 | 0.6960 | 1366.0 |
| 298.15 | 0.8308 | 1376.0 |
| 298.15 | 0.8926 | 1381.0 |
| 298.15 | 0.9484 | 1386.0 |
| 298.15 | 1.0000 | 1391.0 |
| 313.15 | 0.0000 | 1277.0 |
| 313.15 | 0.0517 | 1277.0 |
| 313.15 | 0.0872 | 1278.0 |
| 313.15 | 0.1842 | 1280.0 |
| 313.15 | 0.2935 | 1283.0 |
| 313.15 | 0.3891 | 1287.0 |
| 313.15 | 0.4882 | 1291.0 |
| 313.15 | 0.5857 | 1296.0 |
| 313.15 | 0.6847 | 1302.0 |
| 313.15 | 0.7910 | 1309.0 |
| 313.15 | 0.8911 | 1317.0 |
| 313.15 | 0.9390 | 1321.0 |
| 313.15 | 1.0000 | 1325.0 |