- Name
- Acetic acid, calcium salt
- InChI
- InChI=1S/2C2H4O2.Ca/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2
- InChI Key
- VSGNNIFQASZAOI-UHFFFAOYSA-L
- Formula
- C4H6CaO4
- SMILES
- CC(=O)[O-].CC(=O)[O-].[Ca+2]
- Mol. Weight (g/mol)
- 158.17
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Viscosity, Pa*s [ref]
Operational conditions:
- Molality, mol/kg = 1 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 303.15 | 0.0015 |
| 303.15 | 0.0016 |
| 308.15 | 0.0014 |
| 313.15 | 0.0013 |
| 318.15 | 0.0011 |
| 323.15 | 0.0010 |
Viscosity, Pa*s [ref]
Operational conditions:
- Molality, mol/kg = 1 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 303.15 | 0.0015 |
| 303.15 | 0.0016 |
| 308.15 | 0.0014 |
| 313.15 | 0.0013 |
| 318.15 | 0.0011 |
| 323.15 | 0.0010 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Molality, mol/kg = 1 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 303.15 | 1075.1 |
| 308.15 | 1073.2 |
| 313.15 | 1071.6 |
| 318.15 | 1069.3 |
| 323.15 | 1067.1 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Acetic acid, calcium salt (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0137 | 1000.272 |
| 288.15 | 0.0340 | 1001.979 |
| 288.15 | 0.0667 | 1004.705 |
| 288.15 | 0.0891 | 1006.529 |
| 288.15 | 0.1257 | 1009.492 |
| 288.15 | 0.1528 | 1011.628 |
| 288.15 | 0.2464 | 1018.94 |
| 288.15 | 0.3985 | 1030.466 |
| 288.15 | 0.6075 | 1045.206 |
| 298.15 | 0.0454 | 1000.837 |
| 298.15 | 0.0985 | 1005.162 |
| 298.15 | 0.1165 | 1006.609 |
| 298.15 | 0.1807 | 1011.675 |
| 298.15 | 0.2107 | 1013.967 |
| 298.15 | 0.2404 | 1016.193 |
| 298.15 | 0.2585 | 1017.603 |
| 298.15 | 0.4004 | 1028.087 |
| 298.15 | 0.4655 | 1032.821 |
| 308.15 | 0.0558 | 998.626 |
| 308.15 | 0.1003 | 1002.189 |
| 308.15 | 0.1384 | 1005.209 |
| 308.15 | 0.2255 | 1011.902 |
| 308.15 | 0.2340 | 1012.495 |
| 308.15 | 0.2684 | 1015.16 |
| 308.15 | 0.3464 | 1020.876 |
| 308.15 | 0.5890 | 1037.99 |
| 318.15 | 0.0632 | 995.38 |
| 318.15 | 0.1136 | 999.391 |
| 318.15 | 0.2160 | 1007.335 |
| 318.15 | 0.2934 | 1013.192 |
| 318.15 | 0.3474 | 1017.171 |
| 318.15 | 0.4813 | 1026.852 |
| 318.15 | 0.5610 | 1032.274 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Molality, mol/kg = 1 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 303.15 | 1075.1 |
| 308.15 | 1073.2 |
| 313.15 | 1071.6 |
| 318.15 | 1069.3 |
| 323.15 | 1067.1 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Acetic acid, calcium salt (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0137 | 1000.272 |
| 288.15 | 0.0340 | 1001.979 |
| 288.15 | 0.0667 | 1004.705 |
| 288.15 | 0.0891 | 1006.529 |
| 288.15 | 0.1257 | 1009.492 |
| 288.15 | 0.1528 | 1011.628 |
| 288.15 | 0.2464 | 1018.94 |
| 288.15 | 0.3985 | 1030.466 |
| 288.15 | 0.6075 | 1045.206 |
| 298.15 | 0.0454 | 1000.837 |
| 298.15 | 0.0985 | 1005.162 |
| 298.15 | 0.1165 | 1006.609 |
| 298.15 | 0.1807 | 1011.675 |
| 298.15 | 0.2107 | 1013.967 |
| 298.15 | 0.2404 | 1016.193 |
| 298.15 | 0.2585 | 1017.603 |
| 298.15 | 0.4004 | 1028.087 |
| 298.15 | 0.4655 | 1032.821 |
| 308.15 | 0.0558 | 998.626 |
| 308.15 | 0.1003 | 1002.189 |
| 308.15 | 0.1384 | 1005.209 |
| 308.15 | 0.2255 | 1011.902 |
| 308.15 | 0.2340 | 1012.495 |
| 308.15 | 0.2684 | 1015.16 |
| 308.15 | 0.3464 | 1020.876 |
| 308.15 | 0.5890 | 1037.99 |
| 318.15 | 0.0632 | 995.38 |
| 318.15 | 0.1136 | 999.391 |
| 318.15 | 0.2160 | 1007.335 |
| 318.15 | 0.2934 | 1013.192 |
| 318.15 | 0.3474 | 1017.171 |
| 318.15 | 0.4813 | 1026.852 |
| 318.15 | 0.5610 | 1032.274 |
Sources
- Viscosity Behavior of alpha-Amino Acids in Acetate Salt Solutions at Temperatures (303.15 to 323.15) K
- Volumetric Behavior on Interactions of a-Amino Acids with Sodium Acetate, Potassium Acetate, and Calcium Acetate in Aqueous Solutions
- Volumetric and Viscometric Studies of Some Metal Acetates in Aqueous Solutions at T ) (288.15 to 318.15) K
Note: These property values are available through the Cheméo API. A free account gives you an access key.