- Name
- 2-Pentanone
- InChI
- InChI=1S/C5H10O/c1-3-4-5(2)6/h3-4H2,1-2H3
- InChI Key
- XNLICIUVMPYHGG-UHFFFAOYSA-N
- Formula
- C5H10O
- SMILES
- CCCC(C)=O
- Mol. Weight (g/mol)
- 86.13
- CAS
- 107-87-9
- Name
- Tetrahydropyran
- InChI
- InChI=1S/C5H10O/c1-2-4-6-5-3-1/h1-5H2
- InChI Key
- DHXVGJBLRPWPCS-UHFFFAOYSA-N
- Formula
- C5H10O
- SMILES
- C1CCOCC1
- Mol. Weight (g/mol)
- 86.13
- CAS
- 142-68-7
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Cp/V - Heat capacity at constant pressure per volume, J/K/m3 (2)
- Excess molar enthalpy (molar enthalpy (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
Heat capacity at constant pressure per volume, J/K/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Tetrahydropyran (2) - Liquid | Heat capacity at constant pressure per volume, J/K/m3 - Liquid |
|---|---|
| 0.0611 | 1698200.00 |
| 0.1398 | 1685200.00 |
| 0.2219 | 1670700.00 |
| 0.3029 | 1656100.00 |
| 0.3789 | 1641900.00 |
| 0.4570 | 1627300.00 |
| 0.5376 | 1611700.00 |
| 0.6153 | 1596800.00 |
| 0.6980 | 1580600.00 |
| 0.7772 | 1565100.00 |
| 0.8503 | 1550300.00 |
| 0.9311 | 1533300.00 |
Heat capacity at constant pressure per volume, J/K/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Tetrahydropyran (2) - Liquid | Heat capacity at constant pressure per volume, J/K/m3 - Liquid |
|---|---|
| 0.0611 | 1698200.00 |
| 0.1398 | 1685200.00 |
| 0.2219 | 1670700.00 |
| 0.3029 | 1656100.00 |
| 0.3789 | 1641900.00 |
| 0.4570 | 1627300.00 |
| 0.5376 | 1611700.00 |
| 0.6153 | 1596800.00 |
| 0.6980 | 1580600.00 |
| 0.7772 | 1565100.00 |
| 0.8503 | 1550300.00 |
| 0.9311 | 1533300.00 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Tetrahydropyran (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.1000 | 0.0266 |
| 0.1500 | 0.0385 |
| 0.2000 | 0.0497 |
| 0.2500 | 0.0601 |
| 0.3000 | 0.0687 |
| 0.3500 | 0.0760 |
| 0.4000 | 0.0826 |
| 0.4500 | 0.0875 |
| 0.5000 | 0.0913 |
| 0.5500 | 0.0931 |
| 0.6000 | 0.0931 |
| 0.6500 | 0.0916 |
| 0.7000 | 0.0889 |
| 0.7500 | 0.0824 |
| 0.8000 | 0.0727 |
| 0.8500 | 0.0608 |
| 0.9000 | 0.0449 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Tetrahydropyran (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.1000 | 0.0266 |
| 0.1500 | 0.0385 |
| 0.2000 | 0.0497 |
| 0.2500 | 0.0601 |
| 0.3000 | 0.0687 |
| 0.3500 | 0.0760 |
| 0.4000 | 0.0826 |
| 0.4500 | 0.0875 |
| 0.5000 | 0.0913 |
| 0.5500 | 0.0931 |
| 0.6000 | 0.0931 |
| 0.6500 | 0.0916 |
| 0.7000 | 0.0889 |
| 0.7500 | 0.0824 |
| 0.8000 | 0.0727 |
| 0.8500 | 0.0608 |
| 0.9000 | 0.0449 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Tetrahydropyran (2) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.0811 | 1.3901 |
| 0.1565 | 1.3922 |
| 0.2425 | 1.3947 |
| 0.3122 | 1.3967 |
| 0.3557 | 1.398 |
| 0.4037 | 1.3994 |
| 0.4406 | 1.4005 |
| 0.4757 | 1.4015 |
| 0.5107 | 1.4026 |
| 0.5449 | 1.4036 |
| 0.5933 | 1.4051 |
| 0.6252 | 1.4061 |
| 0.6681 | 1.4075 |
| 0.7080 | 1.4088 |
| 0.7915 | 1.4115 |
| 0.8776 | 1.4144 |
| 0.9411 | 1.4166 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Tetrahydropyran (2) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.0811 | 1.3901 |
| 0.1565 | 1.3922 |
| 0.2425 | 1.3947 |
| 0.3122 | 1.3967 |
| 0.3557 | 1.398 |
| 0.4037 | 1.3994 |
| 0.4406 | 1.4005 |
| 0.4757 | 1.4015 |
| 0.5107 | 1.4026 |
| 0.5449 | 1.4036 |
| 0.5933 | 1.4051 |
| 0.6252 | 1.4061 |
| 0.6681 | 1.4075 |
| 0.7080 | 1.4088 |
| 0.7915 | 1.4115 |
| 0.8776 | 1.4144 |
| 0.9411 | 1.4166 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Tetrahydropyran (2) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0708 | 806.39 |
| 0.1523 | 812.26 |
| 0.2361 | 818.39 |
| 0.3015 | 823.22 |
| 0.3529 | 827.06 |
| 0.3858 | 829.54 |
| 0.4384 | 833.53 |
| 0.4683 | 835.82 |
| 0.5046 | 838.6 |
| 0.5548 | 842.49 |
| 0.5825 | 844.66 |
| 0.6397 | 849.17 |
| 0.6747 | 851.95 |
| 0.7079 | 854.61 |
| 0.7776 | 860.26 |
| 0.8646 | 867.44 |
| 0.9428 | 874.02 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Tetrahydropyran (2) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0708 | 806.39 |
| 0.1523 | 812.26 |
| 0.2361 | 818.39 |
| 0.3015 | 823.22 |
| 0.3529 | 827.06 |
| 0.3858 | 829.54 |
| 0.4384 | 833.53 |
| 0.4683 | 835.82 |
| 0.5046 | 838.6 |
| 0.5548 | 842.49 |
| 0.5825 | 844.66 |
| 0.6397 | 849.17 |
| 0.6747 | 851.95 |
| 0.7079 | 854.61 |
| 0.7776 | 860.26 |
| 0.8646 | 867.44 |
| 0.9428 | 874.02 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.