- Name
- Benzene, 1,3-dimethyl-
- InChI
- InChI=1S/C8H10/c1-7-4-3-5-8(2)6-7/h3-6H,1-2H3
- InChI Key
- IVSZLXZYQVIEFR-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1cccc(C)c1
- Mol. Weight (g/mol)
- 106.17
- CAS
- 108-38-3
- Name
- Triethylene glycol
- InChI
- InChI=1S/C6H14O4/c7-1-3-9-5-6-10-4-2-8/h7-8H,1-6H2
- InChI Key
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N
- Formula
- C6H14O4
- SMILES
- OCCOCCOCCO
- Mol. Weight (g/mol)
- 150.17
- CAS
- 112-27-6
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Triethylene glycol (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mole fraction of Triethylene glycol (2) - Liquid mixture 1 |
|---|---|
| 320.95 | 0.0110 |
| 320.95 | 0.0110 |
| 325.35 | 0.0150 |
| 330.45 | 0.0180 |
| 336.55 | 0.0230 |
| 340.95 | 0.0260 |
| 345.65 | 0.0310 |
| 351.15 | 0.0390 |
| 360.95 | 0.0510 |
| 373.15 | 0.0750 |
| 378.95 | 0.0920 |
| 386.15 | 0.1190 |
| 392.15 | 0.1690 |
| 395.45 | 0.2130 |
| 397.95 | 0.2890 |
| 393.15 | 0.4480 |
| 384.85 | 0.5330 |
| 378.75 | 0.6030 |
| 360.95 | 0.6950 |
| 293.15 | 0.8200 |
Mole fraction of Triethylene glycol (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mole fraction of Triethylene glycol (2) - Liquid mixture 1 |
|---|---|
| 320.95 | 0.0110 |
| 320.95 | 0.0110 |
| 325.35 | 0.0150 |
| 330.45 | 0.0180 |
| 336.55 | 0.0230 |
| 340.95 | 0.0260 |
| 345.65 | 0.0310 |
| 351.15 | 0.0390 |
| 360.95 | 0.0510 |
| 373.15 | 0.0750 |
| 378.95 | 0.0920 |
| 386.15 | 0.1190 |
| 392.15 | 0.1690 |
| 395.45 | 0.2130 |
| 397.95 | 0.2890 |
| 393.15 | 0.4480 |
| 384.85 | 0.5330 |
| 378.75 | 0.6030 |
| 360.95 | 0.6950 |
| 293.15 | 0.8200 |