- Name
- Tetrahydropyran
- InChI
- InChI=1S/C5H10O/c1-2-4-6-5-3-1/h1-5H2
- InChI Key
- DHXVGJBLRPWPCS-UHFFFAOYSA-N
- Formula
- C5H10O
- SMILES
- C1CCOCC1
- Mol. Weight (g/mol)
- 86.13
- CAS
- 142-68-7
- Name
- Benzene, 1,3-dimethyl-
- InChI
- InChI=1S/C8H10/c1-7-4-3-5-8(2)6-7/h3-6H,1-2H3
- InChI Key
- IVSZLXZYQVIEFR-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1cccc(C)c1
- Mol. Weight (g/mol)
- 106.17
- CAS
- 108-38-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Excess molar enthalpy (molar enthalpy (2)
- csound,fluid - Speed of Sound, m/s (2)
- Excess molar volume, m3/mol (2)
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 308.15 (Liquid)
| Mole fraction of Tetrahydropyran (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0474 | -0.0183 |
| 0.0860 | -0.0297 |
| 0.1141 | -0.0361 |
| 0.1754 | -0.0448 |
| 0.2600 | -0.0462 |
| 0.3488 | -0.0365 |
| 0.4432 | -0.0174 |
| 0.4765 | -0.0092 |
| 0.5624 | 0.0130 |
| 0.6834 | 0.0409 |
| 0.7603 | 0.0512 |
| 0.8001 | 0.0527 |
| 0.8744 | 0.0467 |
| 0.9453 | 0.0269 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 308.15 (Liquid)
| Mole fraction of Tetrahydropyran (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0474 | -0.0183 |
| 0.0860 | -0.0297 |
| 0.1141 | -0.0361 |
| 0.1754 | -0.0448 |
| 0.2600 | -0.0462 |
| 0.3488 | -0.0365 |
| 0.4432 | -0.0174 |
| 0.4765 | -0.0092 |
| 0.5624 | 0.0130 |
| 0.6834 | 0.0409 |
| 0.7603 | 0.0512 |
| 0.8001 | 0.0527 |
| 0.8744 | 0.0467 |
| 0.9453 | 0.0269 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 308.15 (Liquid)
| Mole fraction of Tetrahydropyran (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0923 | 1277.0 |
| 0.1515 | 1273.0 |
| 0.2161 | 1269.0 |
| 0.2850 | 1264.0 |
| 0.3278 | 1261.0 |
| 0.3611 | 1259.0 |
| 0.4081 | 1256.0 |
| 0.4621 | 1253.0 |
| 0.5179 | 1250.0 |
| 0.5568 | 1248.0 |
| 0.6179 | 1244.0 |
| 0.7078 | 1239.0 |
| 0.7889 | 1235.0 |
| 0.8646 | 1231.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 308.15 (Liquid)
| Mole fraction of Tetrahydropyran (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0923 | 1277.0 |
| 0.1515 | 1273.0 |
| 0.2161 | 1269.0 |
| 0.2850 | 1264.0 |
| 0.3278 | 1261.0 |
| 0.3611 | 1259.0 |
| 0.4081 | 1256.0 |
| 0.4621 | 1253.0 |
| 0.5179 | 1250.0 |
| 0.5568 | 1248.0 |
| 0.6179 | 1244.0 |
| 0.7078 | 1239.0 |
| 0.7889 | 1235.0 |
| 0.8646 | 1231.0 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 308.15 (Liquid)
| Mole fraction of Tetrahydropyran (1) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.0626 | -0.0000 |
| 0.1258 | -1.2000e-08 |
| 0.1731 | -1.7000e-08 |
| 0.2459 | -2.2000e-08 |
| 0.3452 | -2.8000e-08 |
| 0.4411 | -3.2000e-08 |
| 0.4801 | -3.2000e-08 |
| 0.5413 | -3.2000e-08 |
| 0.6033 | -3.2000e-08 |
| 0.6541 | -3.0000e-08 |
| 0.7113 | -2.7000e-08 |
| 0.7852 | -2.2000e-08 |
| 0.8934 | -1.2000e-08 |
| 0.9229 | -0.0000 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 308.15 (Liquid)
| Mole fraction of Tetrahydropyran (1) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.0626 | -0.0000 |
| 0.1258 | -1.2000e-08 |
| 0.1731 | -1.7000e-08 |
| 0.2459 | -2.2000e-08 |
| 0.3452 | -2.8000e-08 |
| 0.4411 | -3.2000e-08 |
| 0.4801 | -3.2000e-08 |
| 0.5413 | -3.2000e-08 |
| 0.6033 | -3.2000e-08 |
| 0.6541 | -3.0000e-08 |
| 0.7113 | -2.7000e-08 |
| 0.7852 | -2.2000e-08 |
| 0.8934 | -1.2000e-08 |
| 0.9229 | -0.0000 |