- Name
- Betaine
- InChI
- InChI=1S/C5H11NO2/c1-6(2,3)4-5(7)8/h4H2,1-3H3
- InChI Key
- KWIUHFFTVRNATP-UHFFFAOYSA-N
- Formula
- C5H11NO2
- SMILES
- C[N+](C)(C)CC(=O)[O-]
- Mol. Weight (g/mol)
- 117.15
- CAS
- 107-43-7
- Name
- Pentanoic acid, 4-oxo-
- InChI
- InChI=1S/C5H8O3/c1-4(6)2-3-5(7)8/h2-3H2,1H3,(H,7,8)
- InChI Key
- JOOXCMJARBKPKM-UHFFFAOYSA-N
- Formula
- C5H8O3
- SMILES
- CC(=O)CCC(=O)O
- Mol. Weight (g/mol)
- 116.12
- CAS
- 123-76-2
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (4)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.667 (Liquid)
| Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 298.15 | 1.342 |
| 303.15 | 0.8573 |
| 308.15 | 0.5723 |
| 313.15 | 0.3936 |
| 318.15 | 0.2689 |
| 323.15 | 0.1942 |
| 328.15 | 0.1457 |
| 333.15 | 0.1111 |
| 338.15 | 0.0848 |
| 343.15 | 0.0670 |
Viscosity, Pa*s [ref]
Operational conditions:
- Amount ratio of solute to solvent = 2 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 303.15 | 0.8380 |
| 323.15 | 0.2210 |
| 353.15 | 0.0560 |
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.667 (Liquid)
| Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 298.15 | 1.342 |
| 303.15 | 0.8573 |
| 308.15 | 0.5723 |
| 313.15 | 0.3936 |
| 318.15 | 0.2689 |
| 323.15 | 0.1942 |
| 328.15 | 0.1457 |
| 333.15 | 0.1111 |
| 338.15 | 0.0848 |
| 343.15 | 0.0670 |
Viscosity, Pa*s [ref]
Operational conditions:
- Amount ratio of solute to solvent = 2 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 303.15 | 0.8380 |
| 323.15 | 0.2210 |
| 353.15 | 0.0560 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.667 (Liquid)
| Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 293.15 | 1.4662 |
| 298.15 | 1.4648 |
| 303.15 | 1.4633 |
| 308.15 | 1.4618 |
| 313.15 | 1.4604 |
| 318.15 | 1.4589 |
| 323.15 | 1.4574 |
| 328.15 | 1.456 |
| 333.15 | 1.4545 |
| 338.15 | 1.4531 |
| 343.15 | 1.4516 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.667 (Liquid)
| Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 293.15 | 1.4662 |
| 298.15 | 1.4648 |
| 303.15 | 1.4633 |
| 308.15 | 1.4618 |
| 313.15 | 1.4604 |
| 318.15 | 1.4589 |
| 323.15 | 1.4574 |
| 328.15 | 1.456 |
| 333.15 | 1.4545 |
| 338.15 | 1.4531 |
| 343.15 | 1.4516 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.667 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 293.15 | 1161.9 |
| 298.15 | 1158.32 |
| 303.15 | 1154.74 |
| 308.15 | 1151.16 |
| 313.15 | 1147.62 |
| 318.15 | 1144.1 |
| 323.15 | 1140.59 |
| 328.15 | 1137.07 |
| 333.15 | 1133.56 |
| 338.15 | 1130.06 |
| 343.15 | 1126.57 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.667 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 293.15 | 1161.9 |
| 298.15 | 1158.32 |
| 303.15 | 1154.74 |
| 308.15 | 1151.16 |
| 313.15 | 1147.62 |
| 318.15 | 1144.1 |
| 323.15 | 1140.59 |
| 328.15 | 1137.07 |
| 333.15 | 1133.56 |
| 338.15 | 1130.06 |
| 343.15 | 1126.57 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.667 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Temperature, K - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 293.15 | 1745.5 |
| 298.15 | 1724.2 |
| 303.15 | 1705.5 |
| 308.15 | 1688.5 |
| 313.15 | 1672.7 |
| 318.15 | 1657.7 |
| 323.15 | 1642.1 |
| 328.15 | 1628.7 |
| 333.15 | 1614.4 |
| 338.15 | 1600.6 |
| 343.15 | 1587.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.667 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Temperature, K - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 293.15 | 1745.5 |
| 298.15 | 1724.2 |
| 303.15 | 1705.5 |
| 308.15 | 1688.5 |
| 313.15 | 1672.7 |
| 318.15 | 1657.7 |
| 323.15 | 1642.1 |
| 328.15 | 1628.7 |
| 333.15 | 1614.4 |
| 338.15 | 1600.6 |
| 343.15 | 1587.0 |