- Name
- Betaine
- InChI
- InChI=1S/C5H11NO2/c1-6(2,3)4-5(7)8/h4H2,1-3H3
- InChI Key
- KWIUHFFTVRNATP-UHFFFAOYSA-N
- Formula
- C5H11NO2
- SMILES
- C[N+](C)(C)CC(=O)[O-]
- Mol. Weight (g/mol)
- 117.15
- CAS
- 107-43-7
- Name
- Citric acid
- InChI
- InChI=1S/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)
- InChI Key
- KRKNYBCHXYNGOX-UHFFFAOYSA-N
- Formula
- C6H8O7
- SMILES
- O=C(O)CC(O)(CC(=O)O)C(=O)O
- Mol. Weight (g/mol)
- 192.12
- CAS
- 77-92-9
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.222 (Liquid)
- Mole fraction = 0.667 (Liquid)
| Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 303.15 | 1.057 |
| 308.15 | 0.7260 |
| 313.15 | 0.5101 |
| 318.15 | 0.3634 |
| 323.15 | 0.2589 |
| 328.15 | 0.1960 |
| 333.15 | 0.1481 |
| 338.15 | 0.1146 |
| 343.15 | 0.0909 |
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.222 (Liquid)
- Mole fraction = 0.667 (Liquid)
| Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 303.15 | 1.057 |
| 308.15 | 0.7260 |
| 313.15 | 0.5101 |
| 318.15 | 0.3634 |
| 323.15 | 0.2589 |
| 328.15 | 0.1960 |
| 333.15 | 0.1481 |
| 338.15 | 0.1146 |
| 343.15 | 0.0909 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.222 (Liquid)
- Mole fraction = 0.667 (Liquid)
| Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 293.15 | 1.4684 |
| 298.15 | 1.4671 |
| 303.15 | 1.4659 |
| 308.15 | 1.4646 |
| 313.15 | 1.4633 |
| 318.15 | 1.462 |
| 323.15 | 1.4608 |
| 328.15 | 1.4595 |
| 333.15 | 1.4582 |
| 338.15 | 1.4569 |
| 343.15 | 1.4556 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.222 (Liquid)
- Mole fraction = 0.667 (Liquid)
| Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 293.15 | 1.4684 |
| 298.15 | 1.4671 |
| 303.15 | 1.4659 |
| 308.15 | 1.4646 |
| 313.15 | 1.4633 |
| 318.15 | 1.462 |
| 323.15 | 1.4608 |
| 328.15 | 1.4595 |
| 333.15 | 1.4582 |
| 338.15 | 1.4569 |
| 343.15 | 1.4556 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.222 (Liquid)
- Mole fraction = 0.667 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 293.15 | 1263.07 |
| 298.15 | 1259.85 |
| 303.15 | 1256.62 |
| 308.15 | 1253.37 |
| 313.15 | 1250.12 |
| 318.15 | 1246.91 |
| 323.15 | 1243.69 |
| 328.15 | 1240.46 |
| 333.15 | 1237.21 |
| 338.15 | 1233.95 |
| 343.15 | 1230.68 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.222 (Liquid)
- Mole fraction = 0.667 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 293.15 | 1263.07 |
| 298.15 | 1259.85 |
| 303.15 | 1256.62 |
| 308.15 | 1253.37 |
| 313.15 | 1250.12 |
| 318.15 | 1246.91 |
| 323.15 | 1243.69 |
| 328.15 | 1240.46 |
| 333.15 | 1237.21 |
| 338.15 | 1233.95 |
| 343.15 | 1230.68 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.222 (Liquid)
- Mole fraction = 0.667 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Temperature, K - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 293.15 | 2007.3 |
| 298.15 | 1989.4 |
| 303.15 | 1973.8 |
| 308.15 | 1959.9 |
| 313.15 | 1947.1 |
| 318.15 | 1934.9 |
| 323.15 | 1923.1 |
| 328.15 | 1911.4 |
| 333.15 | 1900.0 |
| 338.15 | 1888.6 |
| 343.15 | 1877.1 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0.222 (Liquid)
- Mole fraction = 0.667 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Temperature, K - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 293.15 | 2007.3 |
| 298.15 | 1989.4 |
| 303.15 | 1973.8 |
| 308.15 | 1959.9 |
| 313.15 | 1947.1 |
| 318.15 | 1934.9 |
| 323.15 | 1923.1 |
| 328.15 | 1911.4 |
| 333.15 | 1900.0 |
| 338.15 | 1888.6 |
| 343.15 | 1877.1 |