- Name
- Trichloromethane
- InChI
- InChI=1S/CHCl3/c2-1(3)4/h1H
- InChI Key
- HEDRZPFGACZZDS-UHFFFAOYSA-N
- Formula
- CHCl3
- SMILES
- ClC(Cl)Cl
- Mol. Weight (g/mol)
- 119.38
- CAS
- 67-66-3
- Name
- o-Toluidine
- InChI
- InChI=1S/C7H9N/c1-6-4-2-3-5-7(6)8/h2-5H,8H2,1H3
- InChI Key
- RNVCVTLRINQCPJ-UHFFFAOYSA-N
- Formula
- C7H9N
- SMILES
- Cc1ccccc1N
- Mol. Weight (g/mol)
- 107.15
- CAS
- 95-53-4
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Excess molar enthalpy (molar enthalpy (2)
- csound,fluid - Speed of Sound, m/s (2)
- Excess molar volume, m3/mol (2)
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 308.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Trichloromethane (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0666 | -0.0734 |
| 0.1233 | -0.1316 |
| 0.1888 | -0.1924 |
| 0.2447 | -0.2382 |
| 0.2988 | -0.2762 |
| 0.3490 | -0.3054 |
| 0.4007 | -0.3290 |
| 0.4593 | -0.3471 |
| 0.5006 | -0.3541 |
| 0.6161 | -0.3462 |
| 0.6889 | -0.3194 |
| 0.7661 | -0.2717 |
| 0.8208 | -0.2254 |
| 0.9307 | -0.1007 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 308.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Trichloromethane (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0666 | -0.0734 |
| 0.1233 | -0.1316 |
| 0.1888 | -0.1924 |
| 0.2447 | -0.2382 |
| 0.2988 | -0.2762 |
| 0.3490 | -0.3054 |
| 0.4007 | -0.3290 |
| 0.4593 | -0.3471 |
| 0.5006 | -0.3541 |
| 0.6161 | -0.3462 |
| 0.6889 | -0.3194 |
| 0.7661 | -0.2717 |
| 0.8208 | -0.2254 |
| 0.9307 | -0.1007 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 308.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Trichloromethane (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0446 | 1575.0 |
| 0.1017 | 1537.0 |
| 0.1723 | 1487.0 |
| 0.2354 | 1440.0 |
| 0.2997 | 1391.0 |
| 0.3781 | 1332.0 |
| 0.4465 | 1281.0 |
| 0.5069 | 1237.0 |
| 0.5783 | 1188.0 |
| 0.6347 | 1151.0 |
| 0.7003 | 1111.0 |
| 0.7767 | 1067.0 |
| 0.8645 | 1022.0 |
| 0.9279 | 992.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 308.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Trichloromethane (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0446 | 1575.0 |
| 0.1017 | 1537.0 |
| 0.1723 | 1487.0 |
| 0.2354 | 1440.0 |
| 0.2997 | 1391.0 |
| 0.3781 | 1332.0 |
| 0.4465 | 1281.0 |
| 0.5069 | 1237.0 |
| 0.5783 | 1188.0 |
| 0.6347 | 1151.0 |
| 0.7003 | 1111.0 |
| 0.7767 | 1067.0 |
| 0.8645 | 1022.0 |
| 0.9279 | 992.0 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Temperature, K = 308.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Trichloromethane (1) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.0774 | -2.1000e-08 |
| 0.1494 | -3.9000e-08 |
| 0.2070 | -4.8000e-08 |
| 0.2874 | -6.4000e-08 |
| 0.3423 | -7.1000e-08 |
| 0.4150 | -7.6000e-08 |
| 0.4891 | -7.7000e-08 |
| 0.5657 | -7.3000e-08 |
| 0.6192 | -6.8000e-08 |
| 0.6904 | -5.8000e-08 |
| 0.7454 | -4.9000e-08 |
| 0.8001 | -3.9000e-08 |
| 0.8647 | -2.6000e-08 |
| 0.9324 | -1.3000e-08 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Temperature, K = 308.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Trichloromethane (1) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.0774 | -2.1000e-08 |
| 0.1494 | -3.9000e-08 |
| 0.2070 | -4.8000e-08 |
| 0.2874 | -6.4000e-08 |
| 0.3423 | -7.1000e-08 |
| 0.4150 | -7.6000e-08 |
| 0.4891 | -7.7000e-08 |
| 0.5657 | -7.3000e-08 |
| 0.6192 | -6.8000e-08 |
| 0.6904 | -5.8000e-08 |
| 0.7454 | -4.9000e-08 |
| 0.8001 | -3.9000e-08 |
| 0.8647 | -2.6000e-08 |
| 0.9324 | -1.3000e-08 |