- Name
- N-Glycylglycine
- InChI
- InChI=1S/C4H8N2O3/c5-1-3(7)6-2-4(8)9/h1-2,5H2,(H,6,7)(H,8,9)
- InChI Key
- YMAWOPBAYDPSLA-UHFFFAOYSA-N
- Formula
- C4H8N2O3
- SMILES
- NCC(=O)NCC(=O)O
- Mol. Weight (g/mol)
- 132.12
- CAS
- 556-50-3
- Name
- Glucose
- InChI
- InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5+,6+/m0/s1
- InChI Key
- GZCGUPFRVQAUEE-SLPGGIOYSA-N
- Formula
- C6H12O6
- SMILES
- O=CC(O)C(O)C(O)C(O)CO
- Mol. Weight (g/mol)
- 180.16
- CAS
- 50-99-7
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Molality, mol/kg = 1.13 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of N-Glycylglycine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0015 |
| 298.15 | 0.1911 | 0.0016 |
| 298.15 | 0.3889 | 0.0017 |
| 298.15 | 0.5941 | 0.0018 |
| 298.15 | 0.8068 | 0.0020 |
| 298.15 | 1.0281 | 0.0022 |
| 298.15 | 1.2576 | 0.0025 |
| 298.15 | 1.4989 | 0.0027 |
| 303.15 | 0.0000 | 0.0012 |
| 303.15 | 0.1911 | 0.0013 |
| 303.15 | 0.3889 | 0.0014 |
| 303.15 | 0.5941 | 0.0015 |
| 303.15 | 0.8068 | 0.0017 |
| 303.15 | 1.0281 | 0.0019 |
| 303.15 | 1.2576 | 0.0021 |
| 303.15 | 1.4989 | 0.0024 |
| 308.15 | 0.0000 | 0.0011 |
| 308.15 | 0.1911 | 0.0012 |
| 308.15 | 0.3889 | 0.0012 |
| 308.15 | 0.5941 | 0.0014 |
| 308.15 | 0.8068 | 0.0015 |
| 308.15 | 1.0281 | 0.0017 |
| 308.15 | 1.2576 | 0.0019 |
| 308.15 | 1.4989 | 0.0021 |
| 313.15 | 0.0000 | 0.0010 |
| 313.15 | 0.1911 | 0.0010 |
| 313.15 | 0.3889 | 0.0011 |
| 313.15 | 0.5941 | 0.0012 |
| 313.15 | 0.8068 | 0.0014 |
| 313.15 | 1.0281 | 0.0015 |
| 313.15 | 1.2576 | 0.0017 |
| 313.15 | 1.4989 | 0.0019 |
| 318.15 | 0.0000 | 0.0009 |
| 318.15 | 0.1911 | 0.0009 |
| 318.15 | 0.3889 | 0.0010 |
| 318.15 | 0.5941 | 0.0011 |
| 318.15 | 0.8068 | 0.0012 |
| 318.15 | 1.0281 | 0.0013 |
| 318.15 | 1.2576 | 0.0015 |
| 318.15 | 1.4989 | 0.0017 |
| 323.15 | 0.0000 | 0.0008 |
| 323.15 | 0.1911 | 0.0009 |
| 323.15 | 0.3889 | 0.0009 |
| 323.15 | 0.5941 | 0.0010 |
| 323.15 | 0.8068 | 0.0011 |
| 323.15 | 1.0281 | 0.0012 |
| 323.15 | 1.2576 | 0.0014 |
| 323.15 | 1.4989 | 0.0016 |
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Molality, mol/kg = 1.13 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of N-Glycylglycine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0015 |
| 298.15 | 0.1911 | 0.0016 |
| 298.15 | 0.3889 | 0.0017 |
| 298.15 | 0.5941 | 0.0018 |
| 298.15 | 0.8068 | 0.0020 |
| 298.15 | 1.0281 | 0.0022 |
| 298.15 | 1.2576 | 0.0025 |
| 298.15 | 1.4989 | 0.0027 |
| 303.15 | 0.0000 | 0.0012 |
| 303.15 | 0.1911 | 0.0013 |
| 303.15 | 0.3889 | 0.0014 |
| 303.15 | 0.5941 | 0.0015 |
| 303.15 | 0.8068 | 0.0017 |
| 303.15 | 1.0281 | 0.0019 |
| 303.15 | 1.2576 | 0.0021 |
| 303.15 | 1.4989 | 0.0024 |
| 308.15 | 0.0000 | 0.0011 |
| 308.15 | 0.1911 | 0.0012 |
| 308.15 | 0.3889 | 0.0012 |
| 308.15 | 0.5941 | 0.0014 |
| 308.15 | 0.8068 | 0.0015 |
| 308.15 | 1.0281 | 0.0017 |
| 308.15 | 1.2576 | 0.0019 |
| 308.15 | 1.4989 | 0.0021 |
| 313.15 | 0.0000 | 0.0010 |
| 313.15 | 0.1911 | 0.0010 |
| 313.15 | 0.3889 | 0.0011 |
| 313.15 | 0.5941 | 0.0012 |
| 313.15 | 0.8068 | 0.0014 |
| 313.15 | 1.0281 | 0.0015 |
| 313.15 | 1.2576 | 0.0017 |
| 313.15 | 1.4989 | 0.0019 |
| 318.15 | 0.0000 | 0.0009 |
| 318.15 | 0.1911 | 0.0009 |
| 318.15 | 0.3889 | 0.0010 |
| 318.15 | 0.5941 | 0.0011 |
| 318.15 | 0.8068 | 0.0012 |
| 318.15 | 1.0281 | 0.0013 |
| 318.15 | 1.2576 | 0.0015 |
| 318.15 | 1.4989 | 0.0017 |
| 323.15 | 0.0000 | 0.0008 |
| 323.15 | 0.1911 | 0.0009 |
| 323.15 | 0.3889 | 0.0009 |
| 323.15 | 0.5941 | 0.0010 |
| 323.15 | 0.8068 | 0.0011 |
| 323.15 | 1.0281 | 0.0012 |
| 323.15 | 1.2576 | 0.0014 |
| 323.15 | 1.4989 | 0.0016 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 1 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of N-Glycylglycine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1065.068 |
| 298.15 | 0.1911 | 1072.961 |
| 298.15 | 0.3889 | 1081.402 |
| 298.15 | 0.5941 | 1089.27 |
| 298.15 | 0.8068 | 1097.248 |
| 298.15 | 1.0281 | 1104.764 |
| 298.15 | 1.2576 | 1112.18 |
| 298.15 | 1.4989 | 1118.992 |
| 303.15 | 0.0000 | 1063.297 |
| 303.15 | 0.1911 | 1071.084 |
| 303.15 | 0.3889 | 1079.469 |
| 303.15 | 0.5941 | 1087.212 |
| 303.15 | 0.8068 | 1095.305 |
| 303.15 | 1.0281 | 1102.781 |
| 303.15 | 1.2576 | 1109.907 |
| 303.15 | 1.4989 | 1116.941 |
| 308.15 | 0.0000 | 1061.359 |
| 308.15 | 0.1911 | 1069.033 |
| 308.15 | 0.3889 | 1077.373 |
| 308.15 | 0.5941 | 1085.218 |
| 308.15 | 0.8068 | 1093.21 |
| 308.15 | 1.0281 | 1100.65 |
| 308.15 | 1.2576 | 1107.687 |
| 308.15 | 1.4989 | 1114.751 |
| 313.15 | 0.0000 | 1059.245 |
| 313.15 | 0.1911 | 1066.745 |
| 313.15 | 0.3889 | 1074.932 |
| 313.15 | 0.5941 | 1083.146 |
| 313.15 | 0.8068 | 1090.974 |
| 313.15 | 1.0281 | 1098.394 |
| 313.15 | 1.2576 | 1105.29 |
| 313.15 | 1.4989 | 1112.459 |
| 318.15 | 0.0000 | 1056.983 |
| 318.15 | 0.1911 | 1064.212 |
| 318.15 | 0.3889 | 1071.984 |
| 318.15 | 0.5941 | 1080.648 |
| 318.15 | 0.8068 | 1088.602 |
| 318.15 | 1.0281 | 1096.006 |
| 318.15 | 1.2576 | 1102.711 |
| 318.15 | 1.4989 | 1110.035 |
| 323.15 | 0.0000 | 1054.253 |
| 323.15 | 0.1911 | 1061.48 |
| 323.15 | 0.3889 | 1069.71 |
| 323.15 | 0.5941 | 1078.087 |
| 323.15 | 0.8068 | 1086.006 |
| 323.15 | 1.0281 | 1093.477 |
| 323.15 | 1.2576 | 1099.932 |
| 323.15 | 1.4989 | 1107.514 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 1 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of N-Glycylglycine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1065.068 |
| 298.15 | 0.1911 | 1072.961 |
| 298.15 | 0.3889 | 1081.402 |
| 298.15 | 0.5941 | 1089.27 |
| 298.15 | 0.8068 | 1097.248 |
| 298.15 | 1.0281 | 1104.764 |
| 298.15 | 1.2576 | 1112.18 |
| 298.15 | 1.4989 | 1118.992 |
| 303.15 | 0.0000 | 1063.297 |
| 303.15 | 0.1911 | 1071.084 |
| 303.15 | 0.3889 | 1079.469 |
| 303.15 | 0.5941 | 1087.212 |
| 303.15 | 0.8068 | 1095.305 |
| 303.15 | 1.0281 | 1102.781 |
| 303.15 | 1.2576 | 1109.907 |
| 303.15 | 1.4989 | 1116.941 |
| 308.15 | 0.0000 | 1061.359 |
| 308.15 | 0.1911 | 1069.033 |
| 308.15 | 0.3889 | 1077.373 |
| 308.15 | 0.5941 | 1085.218 |
| 308.15 | 0.8068 | 1093.21 |
| 308.15 | 1.0281 | 1100.65 |
| 308.15 | 1.2576 | 1107.687 |
| 308.15 | 1.4989 | 1114.751 |
| 313.15 | 0.0000 | 1059.245 |
| 313.15 | 0.1911 | 1066.745 |
| 313.15 | 0.3889 | 1074.932 |
| 313.15 | 0.5941 | 1083.146 |
| 313.15 | 0.8068 | 1090.974 |
| 313.15 | 1.0281 | 1098.394 |
| 313.15 | 1.2576 | 1105.29 |
| 313.15 | 1.4989 | 1112.459 |
| 318.15 | 0.0000 | 1056.983 |
| 318.15 | 0.1911 | 1064.212 |
| 318.15 | 0.3889 | 1071.984 |
| 318.15 | 0.5941 | 1080.648 |
| 318.15 | 0.8068 | 1088.602 |
| 318.15 | 1.0281 | 1096.006 |
| 318.15 | 1.2576 | 1102.711 |
| 318.15 | 1.4989 | 1110.035 |
| 323.15 | 0.0000 | 1054.253 |
| 323.15 | 0.1911 | 1061.48 |
| 323.15 | 0.3889 | 1069.71 |
| 323.15 | 0.5941 | 1078.087 |
| 323.15 | 0.8068 | 1086.006 |
| 323.15 | 1.0281 | 1093.477 |
| 323.15 | 1.2576 | 1099.932 |
| 323.15 | 1.4989 | 1107.514 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 1 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of N-Glycylglycine (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1564.8 |
| 298.15 | 0.1911 | 1578.78 |
| 298.15 | 0.3889 | 1593.25 |
| 298.15 | 0.5941 | 1607.13 |
| 298.15 | 0.8068 | 1621.06 |
| 298.15 | 1.0281 | 1634.0 |
| 298.15 | 1.2576 | 1646.5 |
| 298.15 | 1.4989 | 1658.99 |
| 303.15 | 0.0000 | 1574.3 |
| 303.15 | 0.1911 | 1587.92 |
| 303.15 | 0.3889 | 1601.88 |
| 303.15 | 0.5941 | 1615.41 |
| 303.15 | 0.8068 | 1628.95 |
| 303.15 | 1.0281 | 1641.49 |
| 303.15 | 1.2576 | 1653.52 |
| 303.15 | 1.4989 | 1665.72 |
| 308.15 | 0.0000 | 1582.38 |
| 308.15 | 0.1911 | 1595.97 |
| 308.15 | 0.3889 | 1609.25 |
| 308.15 | 0.5941 | 1622.41 |
| 308.15 | 0.8068 | 1635.46 |
| 308.15 | 1.0281 | 1647.78 |
| 308.15 | 1.2576 | 1659.46 |
| 308.15 | 1.4989 | 1671.28 |
| 313.15 | 0.0000 | 1589.06 |
| 313.15 | 0.1911 | 1602.08 |
| 313.15 | 0.3889 | 1615.3 |
| 313.15 | 0.5941 | 1628.01 |
| 313.15 | 0.8068 | 1640.81 |
| 313.15 | 1.0281 | 1652.84 |
| 313.15 | 1.2576 | 1664.16 |
| 313.15 | 1.4989 | 1675.69 |
| 318.15 | 0.0000 | 1594.42 |
| 318.15 | 0.1911 | 1607.07 |
| 318.15 | 0.3889 | 1620.07 |
| 318.15 | 0.5941 | 1632.48 |
| 318.15 | 0.8068 | 1644.95 |
| 318.15 | 1.0281 | 1656.74 |
| 318.15 | 1.2576 | 1667.74 |
| 318.15 | 1.4989 | 1679.0 |
| 323.15 | 0.0000 | 1598.53 |
| 323.15 | 0.1911 | 1610.95 |
| 323.15 | 0.3889 | 1623.66 |
| 323.15 | 0.5941 | 1635.71 |
| 323.15 | 0.8068 | 1647.96 |
| 323.15 | 1.0281 | 1659.53 |
| 323.15 | 1.2576 | 1670.26 |
| 323.15 | 1.4989 | 1681.26 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 1 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of N-Glycylglycine (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1564.8 |
| 298.15 | 0.1911 | 1578.78 |
| 298.15 | 0.3889 | 1593.25 |
| 298.15 | 0.5941 | 1607.13 |
| 298.15 | 0.8068 | 1621.06 |
| 298.15 | 1.0281 | 1634.0 |
| 298.15 | 1.2576 | 1646.5 |
| 298.15 | 1.4989 | 1658.99 |
| 303.15 | 0.0000 | 1574.3 |
| 303.15 | 0.1911 | 1587.92 |
| 303.15 | 0.3889 | 1601.88 |
| 303.15 | 0.5941 | 1615.41 |
| 303.15 | 0.8068 | 1628.95 |
| 303.15 | 1.0281 | 1641.49 |
| 303.15 | 1.2576 | 1653.52 |
| 303.15 | 1.4989 | 1665.72 |
| 308.15 | 0.0000 | 1582.38 |
| 308.15 | 0.1911 | 1595.97 |
| 308.15 | 0.3889 | 1609.25 |
| 308.15 | 0.5941 | 1622.41 |
| 308.15 | 0.8068 | 1635.46 |
| 308.15 | 1.0281 | 1647.78 |
| 308.15 | 1.2576 | 1659.46 |
| 308.15 | 1.4989 | 1671.28 |
| 313.15 | 0.0000 | 1589.06 |
| 313.15 | 0.1911 | 1602.08 |
| 313.15 | 0.3889 | 1615.3 |
| 313.15 | 0.5941 | 1628.01 |
| 313.15 | 0.8068 | 1640.81 |
| 313.15 | 1.0281 | 1652.84 |
| 313.15 | 1.2576 | 1664.16 |
| 313.15 | 1.4989 | 1675.69 |
| 318.15 | 0.0000 | 1594.42 |
| 318.15 | 0.1911 | 1607.07 |
| 318.15 | 0.3889 | 1620.07 |
| 318.15 | 0.5941 | 1632.48 |
| 318.15 | 0.8068 | 1644.95 |
| 318.15 | 1.0281 | 1656.74 |
| 318.15 | 1.2576 | 1667.74 |
| 318.15 | 1.4989 | 1679.0 |
| 323.15 | 0.0000 | 1598.53 |
| 323.15 | 0.1911 | 1610.95 |
| 323.15 | 0.3889 | 1623.66 |
| 323.15 | 0.5941 | 1635.71 |
| 323.15 | 0.8068 | 1647.96 |
| 323.15 | 1.0281 | 1659.53 |
| 323.15 | 1.2576 | 1670.26 |
| 323.15 | 1.4989 | 1681.26 |