- Name
- n-Hexane
- InChI
- InChI=1S/C6H14/c1-3-5-6-4-2/h3-6H2,1-2H3
- InChI Key
- VLKZOEOYAKHREP-UHFFFAOYSA-N
- Formula
- C6H14
- SMILES
- CCCCCC
- Mol. Weight (g/mol)
- 86.18
- CAS
- 110-54-3
- Name
- Methyldiethanolamine
- InChI
- InChI=1S/C5H13NO2/c1-6(2-4-7)3-5-8/h7-8H,2-5H2,1H3
- InChI Key
- CRVGTESFCCXCTH-UHFFFAOYSA-N
- Formula
- C5H13NO2
- SMILES
- CN(CCO)CCO
- Mol. Weight (g/mol)
- 119.16
- CAS
- 105-59-9
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of n-Hexane (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Solvent: Mass fraction of Methyldiethanolamine (2) - Liquid mixture 1 | Temperature, K - Liquid mixture 1 | Mole fraction of n-Hexane (1) - Liquid mixture 1 |
| 0.4020 | 298.15 | 0.0000 |
| 0.4020 | 308.15 | 0.0000 |
| 0.4020 | 318.15 | 0.0000 |
| 0.4020 | 328.15 | 0.0000 |
| 0.4499 | 298.15 | 0.0000 |
| 0.4499 | 308.15 | 0.0000 |
| 0.4499 | 318.15 | 0.0000 |
| 0.4499 | 328.15 | 0.0001 |
| 0.4999 | 298.15 | 0.0000 |
| 0.4999 | 308.15 | 0.0001 |
| 0.4999 | 318.15 | 0.0001 |
| 0.4999 | 328.15 | 0.0001 |
Mole fraction of n-Hexane (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Mass fraction of Methyldiethanolamine (2) - Liquid mixture 1 | Temperature, K - Liquid mixture 1 | Mole fraction of n-Hexane (1) - Liquid mixture 1 |
| 0.2500 | 298.17 | 9.0000e-06 |
| 0.2500 | 313.13 | 0.0000 |
| 0.2500 | 333.14 | 0.0000 |
| 0.2500 | 353.18 | 0.0000 |
| 0.5000 | 298.21 | 0.0000 |
| 0.5000 | 313.17 | 0.0001 |
| 0.5000 | 333.24 | 0.0001 |
| 0.5000 | 353.17 | 0.0002 |
Mole fraction of n-Hexane (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Solvent: Mass fraction of Methyldiethanolamine (2) - Liquid mixture 1 | Temperature, K - Liquid mixture 1 | Mole fraction of n-Hexane (1) - Liquid mixture 1 |
| 0.4020 | 298.15 | 0.0000 |
| 0.4020 | 308.15 | 0.0000 |
| 0.4020 | 318.15 | 0.0000 |
| 0.4020 | 328.15 | 0.0000 |
| 0.4499 | 298.15 | 0.0000 |
| 0.4499 | 308.15 | 0.0000 |
| 0.4499 | 318.15 | 0.0000 |
| 0.4499 | 328.15 | 0.0001 |
| 0.4999 | 298.15 | 0.0000 |
| 0.4999 | 308.15 | 0.0001 |
| 0.4999 | 318.15 | 0.0001 |
| 0.4999 | 328.15 | 0.0001 |
Mole fraction of n-Hexane (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Mass fraction of Methyldiethanolamine (2) - Liquid mixture 1 | Temperature, K - Liquid mixture 1 | Mole fraction of n-Hexane (1) - Liquid mixture 1 |
| 0.2500 | 298.17 | 9.0000e-06 |
| 0.2500 | 313.13 | 0.0000 |
| 0.2500 | 333.14 | 0.0000 |
| 0.2500 | 353.18 | 0.0000 |
| 0.5000 | 298.21 | 0.0000 |
| 0.5000 | 313.17 | 0.0001 |
| 0.5000 | 333.24 | 0.0001 |
| 0.5000 | 353.17 | 0.0002 |
Vapor or sublimation pressure, kPa [ref]
Operational condition: Mass fraction = 0.5 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Vapor or sublimation pressure, kPa - Liquid mixture 1 |
|---|---|
| 293.24 | 24.00 |
| 295.53 | 27.00 |
| 297.45 | 30.00 |
| 299.39 | 32.00 |
| 301.35 | 34.00 |
| 303.39 | 36.00 |
| 305.33 | 40.00 |
| 307.37 | 42.00 |
| 309.33 | 45.00 |
| 311.31 | 46.00 |
| 313.27 | 50.00 |
| 315.26 | 53.00 |
| 317.26 | 56.00 |
| 319.26 | 60.00 |
| 321.19 | 65.00 |
| 323.18 | 70.00 |
| 325.29 | 75.00 |
| 327.19 | 79.00 |
| 329.19 | 85.00 |
| 331.18 | 91.00 |
| 333.22 | 98.00 |
| 335.19 | 104.00 |
| 337.15 | 112.00 |
| 339.22 | 120.00 |
| 341.15 | 127.00 |
| 343.15 | 135.00 |
| 345.14 | 143.00 |
| 347.16 | 153.00 |
| 349.13 | 162.00 |
| 351.04 | 172.00 |
| 353.17 | 184.00 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Mass fraction of Methyldiethanolamine (2) - Liquid mixture 1 | Temperature, K - Liquid mixture 1 | Vapor or sublimation pressure, kPa - Liquid mixture 1 |
| 0.2500 | 298.17 | 501.00 |
| 0.2500 | 313.13 | 514.00 |
| 0.2500 | 333.14 | 503.00 |
| 0.2500 | 353.18 | 513.00 |
| 0.5000 | 298.21 | 503.00 |
| 0.5000 | 313.17 | 505.00 |
| 0.5000 | 333.24 | 503.00 |
| 0.5000 | 353.17 | 518.00 |
Vapor or sublimation pressure, kPa [ref]
Operational condition: Mass fraction = 0.5 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Vapor or sublimation pressure, kPa - Liquid mixture 1 |
|---|---|
| 293.24 | 24.00 |
| 295.53 | 27.00 |
| 297.45 | 30.00 |
| 299.39 | 32.00 |
| 301.35 | 34.00 |
| 303.39 | 36.00 |
| 305.33 | 40.00 |
| 307.37 | 42.00 |
| 309.33 | 45.00 |
| 311.31 | 46.00 |
| 313.27 | 50.00 |
| 315.26 | 53.00 |
| 317.26 | 56.00 |
| 319.26 | 60.00 |
| 321.19 | 65.00 |
| 323.18 | 70.00 |
| 325.29 | 75.00 |
| 327.19 | 79.00 |
| 329.19 | 85.00 |
| 331.18 | 91.00 |
| 333.22 | 98.00 |
| 335.19 | 104.00 |
| 337.15 | 112.00 |
| 339.22 | 120.00 |
| 341.15 | 127.00 |
| 343.15 | 135.00 |
| 345.14 | 143.00 |
| 347.16 | 153.00 |
| 349.13 | 162.00 |
| 351.04 | 172.00 |
| 353.17 | 184.00 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Mass fraction of Methyldiethanolamine (2) - Liquid mixture 1 | Temperature, K - Liquid mixture 1 | Vapor or sublimation pressure, kPa - Liquid mixture 1 |
| 0.2500 | 298.17 | 501.00 |
| 0.2500 | 313.13 | 514.00 |
| 0.2500 | 333.14 | 503.00 |
| 0.2500 | 353.18 | 513.00 |
| 0.5000 | 298.21 | 503.00 |
| 0.5000 | 313.17 | 505.00 |
| 0.5000 | 333.24 | 503.00 |
| 0.5000 | 353.17 | 518.00 |