- Name
- Nitrous oxide
- InChI
- InChI=1S/N2O/c1-2-3
- InChI Key
- GQPLMRYTRLFLPF-UHFFFAOYSA-N
- Formula
- N2O
- SMILES
- [N-]=[N+]=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 10024-97-2
- Name
- Diethanolamine
- InChI
- InChI=1S/C4H11NO2/c6-3-1-5-2-4-7/h5-7H,1-4H2
- InChI Key
- ZBCBWPMODOFKDW-UHFFFAOYSA-N
- Formula
- C4H11NO2
- SMILES
- OCCNCCO
- Mol. Weight (g/mol)
- 105.14
- CAS
- 111-42-2
- Name
- Methyldiethanolamine
- InChI
- InChI=1S/C5H13NO2/c1-6(2-4-7)3-5-8/h7-8H,2-5H2,1H3
- InChI Key
- CRVGTESFCCXCTH-UHFFFAOYSA-N
- Formula
- C5H13NO2
- SMILES
- CN(CCO)CCO
- Mol. Weight (g/mol)
- 119.16
- CAS
- 105-59-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Henry's Law constant (amount concentration scale), kPa*dm3/mol (2)
- Binary diffusion coefficient, m2/s (2)
Henry's Law constant (amount concentration scale), kPa*dm3/mol of Nitrous oxide (1) [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Methyldiethanolamine (3) - Liquid | Mass fraction of Diethanolamine (2) - Liquid | Henry's Law constant (amount concentration scale), kPa*dm3/mol of Nitrous oxide (1) - Liquid |
| 293.00 | 0.0000 | 0.3000 | 4802.0 |
| 293.00 | 0.2100 | 0.0900 | 4675.0 |
| 293.00 | 0.2250 | 0.0750 | 4643.0 |
| 293.00 | 0.2400 | 0.0600 | 4596.0 |
| 293.00 | 0.2550 | 0.0450 | 4547.0 |
| 293.00 | 0.2700 | 0.0300 | 4505.0 |
| 293.00 | 0.2850 | 0.0150 | 4462.0 |
| 293.00 | 0.3000 | 0.0000 | 4423.0 |
| 298.00 | 0.0000 | 0.3000 | 5234.0 |
| 298.00 | 0.2100 | 0.0900 | 5097.0 |
| 298.00 | 0.2250 | 0.0750 | 5045.0 |
| 298.00 | 0.2400 | 0.0600 | 5015.0 |
| 298.00 | 0.2550 | 0.0450 | 4986.0 |
| 298.00 | 0.2700 | 0.0300 | 4945.0 |
| 298.00 | 0.2850 | 0.0150 | 4901.0 |
| 298.00 | 0.3000 | 0.0000 | 4879.0 |
| 303.00 | 0.0000 | 0.3000 | 5701.0 |
| 303.00 | 0.2100 | 0.0900 | 5502.0 |
| 303.00 | 0.2250 | 0.0750 | 5445.0 |
| 303.00 | 0.2400 | 0.0600 | 5399.0 |
| 303.00 | 0.2550 | 0.0450 | 5346.0 |
| 303.00 | 0.2700 | 0.0300 | 5297.0 |
| 303.00 | 0.2850 | 0.0150 | 5247.0 |
| 303.00 | 0.3000 | 0.0000 | 5205.0 |
| 308.00 | 0.0000 | 0.3000 | 6405.0 |
| 308.00 | 0.2100 | 0.0900 | 6015.0 |
| 308.00 | 0.2250 | 0.0750 | 5886.0 |
| 308.00 | 0.2400 | 0.0600 | 5742.0 |
| 308.00 | 0.2550 | 0.0450 | 5662.0 |
| 308.00 | 0.2700 | 0.0300 | 5607.0 |
| 308.00 | 0.2850 | 0.0150 | 5545.0 |
| 308.00 | 0.3000 | 0.0000 | 5498.0 |
| 313.00 | 0.0000 | 0.3000 | 7625.0 |
| 313.00 | 0.2100 | 0.0900 | 6723.0 |
| 313.00 | 0.2250 | 0.0750 | 6545.0 |
| 313.00 | 0.2400 | 0.0600 | 6401.0 |
| 313.00 | 0.2550 | 0.0450 | 6297.0 |
| 313.00 | 0.2700 | 0.0300 | 6145.0 |
| 313.00 | 0.2850 | 0.0150 | 6061.0 |
| 313.00 | 0.3000 | 0.0000 | 5979.0 |
Henry's Law constant (amount concentration scale), kPa*dm3/mol of Nitrous oxide (1) [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Methyldiethanolamine (3) - Liquid | Mass fraction of Diethanolamine (2) - Liquid | Henry's Law constant (amount concentration scale), kPa*dm3/mol of Nitrous oxide (1) - Liquid |
| 293.00 | 0.0000 | 0.3000 | 4802.0 |
| 293.00 | 0.2100 | 0.0900 | 4675.0 |
| 293.00 | 0.2250 | 0.0750 | 4643.0 |
| 293.00 | 0.2400 | 0.0600 | 4596.0 |
| 293.00 | 0.2550 | 0.0450 | 4547.0 |
| 293.00 | 0.2700 | 0.0300 | 4505.0 |
| 293.00 | 0.2850 | 0.0150 | 4462.0 |
| 293.00 | 0.3000 | 0.0000 | 4423.0 |
| 298.00 | 0.0000 | 0.3000 | 5234.0 |
| 298.00 | 0.2100 | 0.0900 | 5097.0 |
| 298.00 | 0.2250 | 0.0750 | 5045.0 |
| 298.00 | 0.2400 | 0.0600 | 5015.0 |
| 298.00 | 0.2550 | 0.0450 | 4986.0 |
| 298.00 | 0.2700 | 0.0300 | 4945.0 |
| 298.00 | 0.2850 | 0.0150 | 4901.0 |
| 298.00 | 0.3000 | 0.0000 | 4879.0 |
| 303.00 | 0.0000 | 0.3000 | 5701.0 |
| 303.00 | 0.2100 | 0.0900 | 5502.0 |
| 303.00 | 0.2250 | 0.0750 | 5445.0 |
| 303.00 | 0.2400 | 0.0600 | 5399.0 |
| 303.00 | 0.2550 | 0.0450 | 5346.0 |
| 303.00 | 0.2700 | 0.0300 | 5297.0 |
| 303.00 | 0.2850 | 0.0150 | 5247.0 |
| 303.00 | 0.3000 | 0.0000 | 5205.0 |
| 308.00 | 0.0000 | 0.3000 | 6405.0 |
| 308.00 | 0.2100 | 0.0900 | 6015.0 |
| 308.00 | 0.2250 | 0.0750 | 5886.0 |
| 308.00 | 0.2400 | 0.0600 | 5742.0 |
| 308.00 | 0.2550 | 0.0450 | 5662.0 |
| 308.00 | 0.2700 | 0.0300 | 5607.0 |
| 308.00 | 0.2850 | 0.0150 | 5545.0 |
| 308.00 | 0.3000 | 0.0000 | 5498.0 |
| 313.00 | 0.0000 | 0.3000 | 7625.0 |
| 313.00 | 0.2100 | 0.0900 | 6723.0 |
| 313.00 | 0.2250 | 0.0750 | 6545.0 |
| 313.00 | 0.2400 | 0.0600 | 6401.0 |
| 313.00 | 0.2550 | 0.0450 | 6297.0 |
| 313.00 | 0.2700 | 0.0300 | 6145.0 |
| 313.00 | 0.2850 | 0.0150 | 6061.0 |
| 313.00 | 0.3000 | 0.0000 | 5979.0 |
Binary diffusion coefficient, m2/s [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Methyldiethanolamine (3) - Liquid | Mass fraction of Diethanolamine (2) - Liquid | Binary diffusion coefficient, m2/s - Liquid |
| 293.00 | 0.0000 | 0.3000 | 0.0000 |
| 293.00 | 0.2100 | 0.0900 | 0.0000 |
| 293.00 | 0.2250 | 0.0750 | 0.0000 |
| 293.00 | 0.2400 | 0.0600 | 0.0000 |
| 293.00 | 0.2550 | 0.0450 | 0.0000 |
| 293.00 | 0.2700 | 0.0300 | 0.0000 |
| 293.00 | 0.2850 | 0.0150 | 0.0000 |
| 293.00 | 0.3000 | 0.0000 | 0.0000 |
| 298.00 | 0.0000 | 0.3000 | 0.0000 |
| 298.00 | 0.2100 | 0.0900 | 0.0000 |
| 298.00 | 0.2250 | 0.0750 | 0.0000 |
| 298.00 | 0.2400 | 0.0600 | 0.0000 |
| 298.00 | 0.2550 | 0.0450 | 0.0000 |
| 298.00 | 0.2700 | 0.0300 | 0.0000 |
| 298.00 | 0.2850 | 0.0150 | 0.0000 |
| 298.00 | 0.3000 | 0.0000 | 0.0000 |
| 303.00 | 0.0000 | 0.3000 | 0.0000 |
| 303.00 | 0.2100 | 0.0900 | 0.0000 |
| 303.00 | 0.2250 | 0.0750 | 0.0000 |
| 303.00 | 0.2400 | 0.0600 | 0.0000 |
| 303.00 | 0.2550 | 0.0450 | 0.0000 |
| 303.00 | 0.2700 | 0.0300 | 0.0000 |
| 303.00 | 0.2850 | 0.0150 | 0.0000 |
| 303.00 | 0.3000 | 0.0000 | 0.0000 |
| 308.00 | 0.0000 | 0.3000 | 0.0000 |
| 308.00 | 0.2100 | 0.0900 | 0.0000 |
| 308.00 | 0.2250 | 0.0750 | 0.0000 |
| 308.00 | 0.2400 | 0.0600 | 0.0000 |
| 308.00 | 0.2550 | 0.0450 | 0.0000 |
| 308.00 | 0.2700 | 0.0300 | 0.0000 |
| 308.00 | 0.2850 | 0.0150 | 0.0000 |
| 308.00 | 0.3000 | 0.0000 | 0.0000 |
| 313.00 | 0.0000 | 0.3000 | 0.0000 |
| 313.00 | 0.2100 | 0.0900 | 0.0000 |
| 313.00 | 0.2250 | 0.0750 | 0.0000 |
| 313.00 | 0.2400 | 0.0600 | 0.0000 |
| 313.00 | 0.2550 | 0.0450 | 0.0000 |
| 313.00 | 0.2700 | 0.0300 | 0.0000 |
| 313.00 | 0.2850 | 0.0150 | 0.0000 |
| 313.00 | 0.3000 | 0.0000 | 0.0000 |
Binary diffusion coefficient, m2/s [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Methyldiethanolamine (3) - Liquid | Mass fraction of Diethanolamine (2) - Liquid | Binary diffusion coefficient, m2/s - Liquid |
| 293.00 | 0.0000 | 0.3000 | 0.0000 |
| 293.00 | 0.2100 | 0.0900 | 0.0000 |
| 293.00 | 0.2250 | 0.0750 | 0.0000 |
| 293.00 | 0.2400 | 0.0600 | 0.0000 |
| 293.00 | 0.2550 | 0.0450 | 0.0000 |
| 293.00 | 0.2700 | 0.0300 | 0.0000 |
| 293.00 | 0.2850 | 0.0150 | 0.0000 |
| 293.00 | 0.3000 | 0.0000 | 0.0000 |
| 298.00 | 0.0000 | 0.3000 | 0.0000 |
| 298.00 | 0.2100 | 0.0900 | 0.0000 |
| 298.00 | 0.2250 | 0.0750 | 0.0000 |
| 298.00 | 0.2400 | 0.0600 | 0.0000 |
| 298.00 | 0.2550 | 0.0450 | 0.0000 |
| 298.00 | 0.2700 | 0.0300 | 0.0000 |
| 298.00 | 0.2850 | 0.0150 | 0.0000 |
| 298.00 | 0.3000 | 0.0000 | 0.0000 |
| 303.00 | 0.0000 | 0.3000 | 0.0000 |
| 303.00 | 0.2100 | 0.0900 | 0.0000 |
| 303.00 | 0.2250 | 0.0750 | 0.0000 |
| 303.00 | 0.2400 | 0.0600 | 0.0000 |
| 303.00 | 0.2550 | 0.0450 | 0.0000 |
| 303.00 | 0.2700 | 0.0300 | 0.0000 |
| 303.00 | 0.2850 | 0.0150 | 0.0000 |
| 303.00 | 0.3000 | 0.0000 | 0.0000 |
| 308.00 | 0.0000 | 0.3000 | 0.0000 |
| 308.00 | 0.2100 | 0.0900 | 0.0000 |
| 308.00 | 0.2250 | 0.0750 | 0.0000 |
| 308.00 | 0.2400 | 0.0600 | 0.0000 |
| 308.00 | 0.2550 | 0.0450 | 0.0000 |
| 308.00 | 0.2700 | 0.0300 | 0.0000 |
| 308.00 | 0.2850 | 0.0150 | 0.0000 |
| 308.00 | 0.3000 | 0.0000 | 0.0000 |
| 313.00 | 0.0000 | 0.3000 | 0.0000 |
| 313.00 | 0.2100 | 0.0900 | 0.0000 |
| 313.00 | 0.2250 | 0.0750 | 0.0000 |
| 313.00 | 0.2400 | 0.0600 | 0.0000 |
| 313.00 | 0.2550 | 0.0450 | 0.0000 |
| 313.00 | 0.2700 | 0.0300 | 0.0000 |
| 313.00 | 0.2850 | 0.0150 | 0.0000 |
| 313.00 | 0.3000 | 0.0000 | 0.0000 |