- Name
- Methane
- InChI
- InChI=1S/CH4/h1H4
- InChI Key
- VNWKTOKETHGBQD-UHFFFAOYSA-N
- Formula
- CH4
- SMILES
- C
- Mol. Weight (g/mol)
- 16.04
- CAS
- 74-82-8
- Name
- Methyldiethanolamine
- InChI
- InChI=1S/C5H13NO2/c1-6(2-4-7)3-5-8/h7-8H,2-5H2,1H3
- InChI Key
- CRVGTESFCCXCTH-UHFFFAOYSA-N
- Formula
- C5H13NO2
- SMILES
- CN(CCO)CCO
- Mol. Weight (g/mol)
- 119.16
- CAS
- 105-59-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Henry's Law constant (mole fraction scale), kPa of Methane (1) [ref]
Operational condition: Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Henry's Law constant (mole fraction scale), kPa of Methane (1) - Liquid |
|---|---|
| 298.15 | 158700.0 |
| 313.15 | 161300.0 |
| 343.15 | 168700.0 |
| 373.15 | 166500.0 |
| 403.15 | 160900.0 |
Mole fraction of Methane (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of Methane (1) - Liquid |
| 298.15 | 118.00 | 0.0007 |
| 298.15 | 175.00 | 0.0011 |
| 298.15 | 631.00 | 0.0039 |
| 298.15 | 1720.00 | 0.0104 |
| 298.15 | 3260.00 | 0.0187 |
| 298.15 | 5250.00 | 0.0278 |
| 298.15 | 7190.00 | 0.0364 |
| 298.15 | 12000.00 | 0.0543 |
| 298.15 | 16060.00 | 0.0653 |
| 298.15 | 20300.00 | 0.0743 |
| 313.15 | 126.00 | 0.0008 |
| 313.15 | 484.00 | 0.0030 |
| 313.15 | 1574.00 | 0.0092 |
| 313.15 | 3500.00 | 0.0200 |
| 313.15 | 5100.00 | 0.0276 |
| 313.15 | 7080.00 | 0.0356 |
| 313.15 | 11720.00 | 0.0547 |
| 313.15 | 16000.00 | 0.0675 |
| 313.15 | 19460.00 | 0.0748 |
| 343.15 | 100.00 | 0.0006 |
| 343.15 | 246.00 | 0.0014 |
| 343.15 | 800.00 | 0.0047 |
| 343.15 | 1610.00 | 0.0092 |
| 343.15 | 3410.00 | 0.0190 |
| 343.15 | 5390.00 | 0.0280 |
| 343.15 | 6750.00 | 0.0349 |
| 343.15 | 9440.00 | 0.0467 |
| 343.15 | 13820.00 | 0.0631 |
| 343.15 | 19040.00 | 0.0797 |
| 373.15 | 147.00 | 0.0009 |
| 373.15 | 230.00 | 0.0014 |
| 373.15 | 770.00 | 0.0046 |
| 373.15 | 940.00 | 0.0055 |
| 373.15 | 2640.00 | 0.0154 |
| 373.15 | 4390.00 | 0.0246 |
| 373.15 | 7400.00 | 0.0397 |
| 373.15 | 10490.00 | 0.0535 |
| 373.15 | 14930.00 | 0.0718 |
| 373.15 | 18600.00 | 0.0838 |
| 403.15 | 190.00 | 0.0012 |
| 403.15 | 534.00 | 0.0033 |
| 403.15 | 2780.00 | 0.0166 |
| 403.15 | 4710.00 | 0.0277 |
| 403.15 | 6350.00 | 0.0353 |
| 403.15 | 10250.00 | 0.0542 |
| 403.15 | 14290.00 | 0.0738 |
| 403.15 | 17650.00 | 0.0859 |
Henry's Law constant (mole fraction scale), kPa of Methane (1) [ref]
Operational condition: Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Henry's Law constant (mole fraction scale), kPa of Methane (1) - Liquid |
|---|---|
| 298.15 | 158700.0 |
| 313.15 | 161300.0 |
| 343.15 | 168700.0 |
| 373.15 | 166500.0 |
| 403.15 | 160900.0 |
Mole fraction of Methane (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of Methane (1) - Liquid |
| 298.15 | 118.00 | 0.0007 |
| 298.15 | 175.00 | 0.0011 |
| 298.15 | 631.00 | 0.0039 |
| 298.15 | 1720.00 | 0.0104 |
| 298.15 | 3260.00 | 0.0187 |
| 298.15 | 5250.00 | 0.0278 |
| 298.15 | 7190.00 | 0.0364 |
| 298.15 | 12000.00 | 0.0543 |
| 298.15 | 16060.00 | 0.0653 |
| 298.15 | 20300.00 | 0.0743 |
| 313.15 | 126.00 | 0.0008 |
| 313.15 | 484.00 | 0.0030 |
| 313.15 | 1574.00 | 0.0092 |
| 313.15 | 3500.00 | 0.0200 |
| 313.15 | 5100.00 | 0.0276 |
| 313.15 | 7080.00 | 0.0356 |
| 313.15 | 11720.00 | 0.0547 |
| 313.15 | 16000.00 | 0.0675 |
| 313.15 | 19460.00 | 0.0748 |
| 343.15 | 100.00 | 0.0006 |
| 343.15 | 246.00 | 0.0014 |
| 343.15 | 800.00 | 0.0047 |
| 343.15 | 1610.00 | 0.0092 |
| 343.15 | 3410.00 | 0.0190 |
| 343.15 | 5390.00 | 0.0280 |
| 343.15 | 6750.00 | 0.0349 |
| 343.15 | 9440.00 | 0.0467 |
| 343.15 | 13820.00 | 0.0631 |
| 343.15 | 19040.00 | 0.0797 |
| 373.15 | 147.00 | 0.0009 |
| 373.15 | 230.00 | 0.0014 |
| 373.15 | 770.00 | 0.0046 |
| 373.15 | 940.00 | 0.0055 |
| 373.15 | 2640.00 | 0.0154 |
| 373.15 | 4390.00 | 0.0246 |
| 373.15 | 7400.00 | 0.0397 |
| 373.15 | 10490.00 | 0.0535 |
| 373.15 | 14930.00 | 0.0718 |
| 373.15 | 18600.00 | 0.0838 |
| 403.15 | 190.00 | 0.0012 |
| 403.15 | 534.00 | 0.0033 |
| 403.15 | 2780.00 | 0.0166 |
| 403.15 | 4710.00 | 0.0277 |
| 403.15 | 6350.00 | 0.0353 |
| 403.15 | 10250.00 | 0.0542 |
| 403.15 | 14290.00 | 0.0738 |
| 403.15 | 17650.00 | 0.0859 |