- Name
- Propane, 1,1'-sulfinylbis-
- InChI
- InChI=1S/C6H14OS/c1-3-5-8(7)6-4-2/h3-6H2,1-2H3
- InChI Key
- BQCCJWMQESHLIT-UHFFFAOYSA-N
- Formula
- C6H14OS
- SMILES
- CCCS(=O)CCC
- Mol. Weight (g/mol)
- 134.24
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Propane, 1,1'-sulfinylbis- (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0105 | 1.344 |
| 298.15 | 0.0198 | 1.3516 |
| 298.15 | 0.0469 | 1.374 |
| 298.15 | 0.0998 | 1.4009 |
| 298.15 | 0.2019 | 1.4305 |
| 298.15 | 0.2809 | 1.4395 |
| 298.15 | 0.3975 | 1.446 |
| 298.15 | 0.5049 | 1.4502 |
| 298.15 | 0.6818 | 1.455 |
| 298.15 | 0.9002 | 1.458 |
| 303.15 | 0.0105 | 1.343 |
| 303.15 | 0.0198 | 1.351 |
| 303.15 | 0.0469 | 1.3725 |
| 303.15 | 0.0998 | 1.399 |
| 303.15 | 0.2019 | 1.4285 |
| 303.15 | 0.2809 | 1.4375 |
| 303.15 | 0.3975 | 1.4455 |
| 303.15 | 0.5049 | 1.4495 |
| 303.15 | 0.6818 | 1.454 |
| 303.15 | 0.9002 | 1.4555 |
| 308.15 | 0.0105 | 1.342 |
| 308.15 | 0.0198 | 1.3506 |
| 308.15 | 0.0469 | 1.3711 |
| 308.15 | 0.0998 | 1.398 |
| 308.15 | 0.2019 | 1.4245 |
| 308.15 | 0.2809 | 1.435 |
| 308.15 | 0.3975 | 1.4445 |
| 308.15 | 0.5049 | 1.4486 |
| 308.15 | 0.6818 | 1.452 |
| 308.15 | 0.9002 | 1.454 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Propane, 1,1'-sulfinylbis- (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 298.15 | 0.0105 | 0.0523 |
| 298.15 | 0.0199 | 0.0474 |
| 298.15 | 0.0469 | 0.0422 |
| 298.15 | 0.0998 | 0.0396 |
| 298.15 | 0.2019 | 0.0375 |
| 298.15 | 0.2809 | 0.0372 |
| 298.15 | 0.3975 | 0.0358 |
| 298.15 | 0.5001 | 0.0354 |
| 298.15 | 0.6818 | 0.0343 |
| 303.15 | 0.0105 | 0.0511 |
| 303.15 | 0.0199 | 0.0464 |
| 303.15 | 0.0469 | 0.0415 |
| 303.15 | 0.0998 | 0.0389 |
| 303.15 | 0.2019 | 0.0370 |
| 303.15 | 0.2809 | 0.0365 |
| 303.15 | 0.3975 | 0.0352 |
| 303.15 | 0.5001 | 0.0349 |
| 303.15 | 0.6818 | 0.0342 |
| 308.15 | 0.0105 | 0.0499 |
| 308.15 | 0.0199 | 0.0453 |
| 308.15 | 0.0469 | 0.0407 |
| 308.15 | 0.0998 | 0.0381 |
| 308.15 | 0.2019 | 0.0365 |
| 308.15 | 0.2809 | 0.0360 |
| 308.15 | 0.3975 | 0.0345 |
| 308.15 | 0.5001 | 0.0343 |
| 308.15 | 0.6818 | 0.0335 |
| 313.15 | 0.0105 | 0.0488 |
| 313.15 | 0.0199 | 0.0444 |
| 313.15 | 0.0469 | 0.0400 |
| 313.15 | 0.0998 | 0.0373 |
| 313.15 | 0.2019 | 0.0359 |
| 313.15 | 0.2809 | 0.0350 |
| 313.15 | 0.3975 | 0.0341 |
| 313.15 | 0.5001 | 0.0338 |
| 313.15 | 0.6818 | 0.0329 |
| 318.15 | 0.0105 | 0.0476 |
| 318.15 | 0.0199 | 0.0443 |
| 318.15 | 0.0469 | 0.0393 |
| 318.15 | 0.0998 | 0.0366 |
| 318.15 | 0.2019 | 0.0350 |
| 318.15 | 0.2809 | 0.0344 |
| 318.15 | 0.3975 | 0.0334 |
| 318.15 | 0.5001 | 0.0333 |
| 318.15 | 0.6818 | 0.0322 |
| 323.15 | 0.0105 | 0.0466 |
| 323.15 | 0.0199 | 0.0432 |
| 323.15 | 0.0469 | 0.0385 |
| 323.15 | 0.0998 | 0.0357 |
| 323.15 | 0.2019 | 0.0344 |
| 323.15 | 0.2809 | 0.0338 |
| 323.15 | 0.3975 | 0.0328 |
| 323.15 | 0.5001 | 0.0327 |
| 323.15 | 0.6818 | 0.0316 |
| 328.15 | 0.0105 | 0.0456 |
| 328.15 | 0.0199 | 0.0422 |
| 328.15 | 0.0469 | 0.0378 |
| 328.15 | 0.0998 | 0.0350 |
| 328.15 | 0.2019 | 0.0337 |
| 328.15 | 0.2809 | 0.0331 |
| 328.15 | 0.3975 | 0.0322 |
| 328.15 | 0.5001 | 0.0321 |
| 328.15 | 0.6818 | 0.0308 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.