- Name
- Hexanedioic acid
- InChI
- InChI=1S/C6H10O4/c7-5(8)3-1-2-4-6(9)10/h1-4H2,(H,7,8)(H,9,10)
- InChI Key
- WNLRTRBMVRJNCN-UHFFFAOYSA-N
- Formula
- C6H10O4
- SMILES
- O=C(O)CCCCC(=O)O
- Mol. Weight (g/mol)
- 146.14
- CAS
- 124-04-9
- Name
- Urea
- InChI
- InChI=1S/CH4N2O/c2-1(3)4/h(H4,2,3,4)
- InChI Key
- XSQUKJJJFZCRTK-UHFFFAOYSA-N
- Formula
- CH4N2O
- SMILES
- NC(N)=O
- Mol. Weight (g/mol)
- 60.06
- CAS
- 57-13-6
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Datasets
Mass fraction of Urea (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Hexanedioic acid (1) - Liquid | Mass fraction of Urea (2) - Liquid |
| 303.15 | 0.0392 | 0.1008 |
| 303.15 | 0.0349 | 0.0458 |
| 303.15 | 0.0333 | 0.0000 |
| 288.15 | 0.0201 | 0.0916 |
| 288.15 | 0.0167 | 0.0543 |
| 288.15 | 0.0142 | 0.0000 |
Mass fraction of Urea (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Hexanedioic acid (1) - Liquid | Mass fraction of Urea (2) - Liquid |
| 303.15 | 0.0000 | 0.5999 |
| 303.15 | 0.0085 | 0.5544 |
| 303.15 | 0.0126 | 0.5181 |
| 288.15 | 0.0000 | 0.5101 |
| 288.15 | 0.0055 | 0.5040 |
| 288.15 | 0.0071 | 0.4990 |
Mass fraction of Urea (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Hexanedioic acid (1) - Liquid | Mass fraction of Urea (2) - Liquid |
| 303.15 | 0.0184 | 0.4279 |
| 303.15 | 0.0214 | 0.3683 |
| 303.15 | 0.0255 | 0.3030 |
| 303.15 | 0.0351 | 0.2181 |
| 288.15 | 0.0087 | 0.4545 |
| 288.15 | 0.0112 | 0.4104 |
| 288.15 | 0.0149 | 0.3137 |
| 288.15 | 0.0203 | 0.2272 |
Mass fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mass fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 303.15 | 0.0161 |
| 288.15 | 0.0075 |
Mass fraction of Urea (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mass fraction of Urea (2) - Liquid |
|---|---|
| 303.15 | 0.4879 |
| 288.15 | 0.4950 |
Mass fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mass fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 303.15 | 0.0451 |
| 288.15 | 0.0257 |
Mass fraction of Urea (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mass fraction of Urea (2) - Liquid |
|---|---|
| 303.15 | 0.1596 |
| 288.15 | 0.1377 |
Mass fraction of Urea (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Hexanedioic acid (1) - Liquid | Mass fraction of Urea (2) - Liquid |
| 303.15 | 0.0392 | 0.1008 |
| 303.15 | 0.0349 | 0.0458 |
| 303.15 | 0.0333 | 0.0000 |
| 288.15 | 0.0201 | 0.0916 |
| 288.15 | 0.0167 | 0.0543 |
| 288.15 | 0.0142 | 0.0000 |
Mass fraction of Urea (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Hexanedioic acid (1) - Liquid | Mass fraction of Urea (2) - Liquid |
| 303.15 | 0.0000 | 0.5999 |
| 303.15 | 0.0085 | 0.5544 |
| 303.15 | 0.0126 | 0.5181 |
| 288.15 | 0.0000 | 0.5101 |
| 288.15 | 0.0055 | 0.5040 |
| 288.15 | 0.0071 | 0.4990 |
Mass fraction of Urea (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Hexanedioic acid (1) - Liquid | Mass fraction of Urea (2) - Liquid |
| 303.15 | 0.0184 | 0.4279 |
| 303.15 | 0.0214 | 0.3683 |
| 303.15 | 0.0255 | 0.3030 |
| 303.15 | 0.0351 | 0.2181 |
| 288.15 | 0.0087 | 0.4545 |
| 288.15 | 0.0112 | 0.4104 |
| 288.15 | 0.0149 | 0.3137 |
| 288.15 | 0.0203 | 0.2272 |
Mass fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mass fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 303.15 | 0.0161 |
| 288.15 | 0.0075 |
Mass fraction of Urea (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mass fraction of Urea (2) - Liquid |
|---|---|
| 303.15 | 0.4879 |
| 288.15 | 0.4950 |
Mass fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mass fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 303.15 | 0.0451 |
| 288.15 | 0.0257 |
Mass fraction of Urea (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mass fraction of Urea (2) - Liquid |
|---|---|
| 303.15 | 0.1596 |
| 288.15 | 0.1377 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Hexanedioic acid (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0392 | 1010.4 |
| 303.15 | 0.0349 | 1007.6 |
| 303.15 | 0.0333 | 1005.1 |
| 288.15 | 0.0201 | 1012.7 |
| 288.15 | 0.0167 | 1011.5 |
| 288.15 | 0.0142 | 1001.1 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Hexanedioic acid (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 1047.5 |
| 303.15 | 0.0085 | 1070.8 |
| 303.15 | 0.0126 | 1077.1 |
| 288.15 | 0.0000 | 1036.4 |
| 288.15 | 0.0055 | 1042.1 |
| 288.15 | 0.0071 | 1058.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Hexanedioic acid (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0184 | 1064.5 |
| 303.15 | 0.0214 | 1050.1 |
| 303.15 | 0.0255 | 1041.1 |
| 303.15 | 0.0351 | 1021.3 |
| 288.15 | 0.0087 | 1066.3 |
| 288.15 | 0.0112 | 1047.3 |
| 288.15 | 0.0149 | 1044.1 |
| 288.15 | 0.0203 | 1021.9 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 303.15 | 1090.4 |
| 288.15 | 1067.2 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 303.15 | 1011.0 |
| 288.15 | 1020.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Hexanedioic acid (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0392 | 1010.4 |
| 303.15 | 0.0349 | 1007.6 |
| 303.15 | 0.0333 | 1005.1 |
| 288.15 | 0.0201 | 1012.7 |
| 288.15 | 0.0167 | 1011.5 |
| 288.15 | 0.0142 | 1001.1 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Hexanedioic acid (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 1047.5 |
| 303.15 | 0.0085 | 1070.8 |
| 303.15 | 0.0126 | 1077.1 |
| 288.15 | 0.0000 | 1036.4 |
| 288.15 | 0.0055 | 1042.1 |
| 288.15 | 0.0071 | 1058.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Hexanedioic acid (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0184 | 1064.5 |
| 303.15 | 0.0214 | 1050.1 |
| 303.15 | 0.0255 | 1041.1 |
| 303.15 | 0.0351 | 1021.3 |
| 288.15 | 0.0087 | 1066.3 |
| 288.15 | 0.0112 | 1047.3 |
| 288.15 | 0.0149 | 1044.1 |
| 288.15 | 0.0203 | 1021.9 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 303.15 | 1090.4 |
| 288.15 | 1067.2 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 303.15 | 1011.0 |
| 288.15 | 1020.0 |