- Name
- Methane
- InChI
- InChI=1S/CH4/h1H4
- InChI Key
- VNWKTOKETHGBQD-UHFFFAOYSA-N
- Formula
- CH4
- SMILES
- C
- Mol. Weight (g/mol)
- 16.04
- CAS
- 74-82-8
- Name
- Methyldiethanolamine
- InChI
- InChI=1S/C5H13NO2/c1-6(2-4-7)3-5-8/h7-8H,2-5H2,1H3
- InChI Key
- CRVGTESFCCXCTH-UHFFFAOYSA-N
- Formula
- C5H13NO2
- SMILES
- CN(CCO)CCO
- Mol. Weight (g/mol)
- 119.16
- CAS
- 105-59-9
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Methane (1) [ref]
Operational condition: Solvent: Mass fraction = 0.5 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of Methane (1) - Liquid |
| 298.15 | 104.30 | 0.0000 |
| 298.15 | 300.00 | 0.0001 |
| 313.15 | 117.00 | 0.0000 |
| 313.15 | 170.00 | 0.0001 |
| 313.15 | 300.00 | 0.0001 |
| 343.15 | 126.00 | 0.0000 |
| 343.15 | 300.00 | 0.0001 |
| 373.15 | 189.30 | 0.0000 |
| 373.15 | 400.00 | 0.0001 |
| 423.15 | 522.00 | 0.0001 |
| 423.15 | 700.00 | 0.0002 |
Mole fraction of Methane (1) [ref]
Operational condition: Solvent: Mass fraction = 0.5 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of Methane (1) - Liquid |
| 298.15 | 1000.00 | 0.0004 |
| 298.15 | 3000.00 | 0.0011 |
| 298.15 | 6000.00 | 0.0019 |
| 298.15 | 10000.00 | 0.0030 |
| 298.15 | 15000.00 | 0.0039 |
| 298.15 | 20000.00 | 0.0046 |
| 313.15 | 1000.00 | 0.0004 |
| 313.15 | 3000.00 | 0.0011 |
| 313.15 | 6000.00 | 0.0020 |
| 313.15 | 10000.00 | 0.0030 |
| 313.15 | 15000.00 | 0.0042 |
| 313.15 | 20000.00 | 0.0051 |
| 343.15 | 1000.00 | 0.0004 |
| 343.15 | 3000.00 | 0.0012 |
| 343.15 | 6000.00 | 0.0021 |
| 343.15 | 10000.00 | 0.0032 |
| 343.15 | 15000.00 | 0.0046 |
| 343.15 | 19000.00 | 0.0053 |
| 373.15 | 1000.00 | 0.0004 |
| 373.15 | 3000.00 | 0.0013 |
| 373.15 | 6000.00 | 0.0025 |
| 373.15 | 10000.00 | 0.0039 |
| 373.15 | 15000.00 | 0.0055 |
| 373.15 | 19000.00 | 0.0065 |
| 423.15 | 1300.00 | 0.0006 |
| 423.15 | 3000.00 | 0.0017 |
| 423.15 | 6890.00 | 0.0039 |
| 423.15 | 10320.00 | 0.0058 |
| 423.15 | 14000.00 | 0.0072 |
| 423.15 | 18000.00 | 0.0086 |
Mole fraction of Methane (1) [ref]
Operational condition: Solvent: Mass fraction = 0.5 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of Methane (1) - Liquid |
| 298.15 | 104.30 | 0.0000 |
| 298.15 | 300.00 | 0.0001 |
| 313.15 | 117.00 | 0.0000 |
| 313.15 | 170.00 | 0.0001 |
| 313.15 | 300.00 | 0.0001 |
| 343.15 | 126.00 | 0.0000 |
| 343.15 | 300.00 | 0.0001 |
| 373.15 | 189.30 | 0.0000 |
| 373.15 | 400.00 | 0.0001 |
| 423.15 | 522.00 | 0.0001 |
| 423.15 | 700.00 | 0.0002 |
Mole fraction of Methane (1) [ref]
Operational condition: Solvent: Mass fraction = 0.5 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of Methane (1) - Liquid |
| 298.15 | 1000.00 | 0.0004 |
| 298.15 | 3000.00 | 0.0011 |
| 298.15 | 6000.00 | 0.0019 |
| 298.15 | 10000.00 | 0.0030 |
| 298.15 | 15000.00 | 0.0039 |
| 298.15 | 20000.00 | 0.0046 |
| 313.15 | 1000.00 | 0.0004 |
| 313.15 | 3000.00 | 0.0011 |
| 313.15 | 6000.00 | 0.0020 |
| 313.15 | 10000.00 | 0.0030 |
| 313.15 | 15000.00 | 0.0042 |
| 313.15 | 20000.00 | 0.0051 |
| 343.15 | 1000.00 | 0.0004 |
| 343.15 | 3000.00 | 0.0012 |
| 343.15 | 6000.00 | 0.0021 |
| 343.15 | 10000.00 | 0.0032 |
| 343.15 | 15000.00 | 0.0046 |
| 343.15 | 19000.00 | 0.0053 |
| 373.15 | 1000.00 | 0.0004 |
| 373.15 | 3000.00 | 0.0013 |
| 373.15 | 6000.00 | 0.0025 |
| 373.15 | 10000.00 | 0.0039 |
| 373.15 | 15000.00 | 0.0055 |
| 373.15 | 19000.00 | 0.0065 |
| 423.15 | 1300.00 | 0.0006 |
| 423.15 | 3000.00 | 0.0017 |
| 423.15 | 6890.00 | 0.0039 |
| 423.15 | 10320.00 | 0.0058 |
| 423.15 | 14000.00 | 0.0072 |
| 423.15 | 18000.00 | 0.0086 |