- Name
- Trichloromethane
- InChI
- InChI=1S/CHCl3/c2-1(3)4/h1H
- InChI Key
- HEDRZPFGACZZDS-UHFFFAOYSA-N
- Formula
- CHCl3
- SMILES
- ClC(Cl)Cl
- Mol. Weight (g/mol)
- 119.38
- CAS
- 67-66-3
- Name
- 3-Mercaptopropionic acid
- InChI
- InChI=1S/C3H6O2S/c4-3(5)1-2-6/h6H,1-2H2,(H,4,5)
- InChI Key
- DKIDEFUBRARXTE-UHFFFAOYSA-N
- Formula
- C3H6O2S
- SMILES
- O=C(O)CCS
- Mol. Weight (g/mol)
- 106.14
- CAS
- 107-96-0
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Temperature, K x Mass fraction [ref]
Operational condition: Pressure, kPa = 99.2 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of 3-Mercaptopropionic acid (2) - Liquid mixture 2 | Mass fraction of Trichloromethane (1) - Liquid mixture 2 | Mass fraction of Trichloromethane (1) - Liquid mixture 1 | Mass fraction of 3-Mercaptopropionic acid (2) - Liquid mixture 1 |
| 303.20 | 0.0538 | 0.0046 | 0.9468 | 0.0508 |
| 323.20 | 0.2558 | 0.0139 | 0.6846 | 0.2571 |
| 323.20 | 0.3120 | 0.0225 | 0.6185 | 0.3107 |
| 323.20 | 0.3728 | 0.0476 | 0.5528 | 0.3587 |
| 303.20 | 0.0920 | 0.0056 | 0.8890 | 0.1067 |
| 303.20 | 0.1323 | 0.0063 | 0.8224 | 0.1705 |
| 303.20 | 0.2042 | 0.0113 | 0.6796 | 0.2909 |
| 303.20 | 0.2420 | 0.0168 | 0.6086 | 0.3506 |
| 303.20 | 0.2763 | 0.0243 | 0.5117 | 0.4005 |
| 313.20 | 0.0554 | 0.0046 | 0.9471 | 0.0452 |
| 313.20 | 0.1014 | 0.0058 | 0.8899 | 0.1005 |
| 313.20 | 0.1493 | 0.0072 | 0.8094 | 0.1688 |
| 313.20 | 0.2309 | 0.0141 | 0.6879 | 0.2779 |
| 313.20 | 0.2781 | 0.0331 | 0.6048 | 0.3362 |
| 313.20 | 0.3252 | 0.0412 | 0.5220 | 0.3850 |
| 323.20 | 0.0606 | 0.0034 | 0.9440 | 0.0424 |
| 323.20 | 0.1111 | 0.0049 | 0.8851 | 0.0934 |
| 323.20 | 0.1582 | 0.0055 | 0.8160 | 0.1490 |
Temperature, K x Mass fraction [ref]
Operational condition: Pressure, kPa = 99.2 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of 3-Mercaptopropionic acid (2) - Liquid mixture 2 | Mass fraction of Trichloromethane (1) - Liquid mixture 2 | Mass fraction of Trichloromethane (1) - Liquid mixture 1 | Mass fraction of 3-Mercaptopropionic acid (2) - Liquid mixture 1 |
| 303.20 | 0.0538 | 0.0046 | 0.9468 | 0.0508 |
| 323.20 | 0.2558 | 0.0139 | 0.6846 | 0.2571 |
| 323.20 | 0.3120 | 0.0225 | 0.6185 | 0.3107 |
| 323.20 | 0.3728 | 0.0476 | 0.5528 | 0.3587 |
| 303.20 | 0.0920 | 0.0056 | 0.8890 | 0.1067 |
| 303.20 | 0.1323 | 0.0063 | 0.8224 | 0.1705 |
| 303.20 | 0.2042 | 0.0113 | 0.6796 | 0.2909 |
| 303.20 | 0.2420 | 0.0168 | 0.6086 | 0.3506 |
| 303.20 | 0.2763 | 0.0243 | 0.5117 | 0.4005 |
| 313.20 | 0.0554 | 0.0046 | 0.9471 | 0.0452 |
| 313.20 | 0.1014 | 0.0058 | 0.8899 | 0.1005 |
| 313.20 | 0.1493 | 0.0072 | 0.8094 | 0.1688 |
| 313.20 | 0.2309 | 0.0141 | 0.6879 | 0.2779 |
| 313.20 | 0.2781 | 0.0331 | 0.6048 | 0.3362 |
| 313.20 | 0.3252 | 0.0412 | 0.5220 | 0.3850 |
| 323.20 | 0.0606 | 0.0034 | 0.9440 | 0.0424 |
| 323.20 | 0.1111 | 0.0049 | 0.8851 | 0.0934 |
| 323.20 | 0.1582 | 0.0055 | 0.8160 | 0.1490 |