- Name
- Ethanol, 2-propoxy-
- InChI
- InChI=1S/C5H12O2/c1-2-4-7-5-3-6/h6H,2-5H2,1H3
- InChI Key
- YEYKMVJDLWJFOA-UHFFFAOYSA-N
- Formula
- C5H12O2
- SMILES
- CCCOCCO
- Mol. Weight (g/mol)
- 104.15
- CAS
- 2807-30-9
- Name
- 2-Butanol
- InChI
- InChI=1S/C4H10O/c1-3-4(2)5/h4-5H,3H2,1-2H3
- InChI Key
- BTANRVKWQNVYAZ-UHFFFAOYSA-N
- Formula
- C4H10O
- SMILES
- CCC(C)O
- Mol. Weight (g/mol)
- 74.12
- CAS
- 78-92-2
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of 2-Butanol (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of 2-Butanol (2) - Liquid | Pressure, kPa - Liquid | Mole fraction of 2-Butanol (2) - Gas |
| 0.0000 | 60.00 | 0.0000 |
| 0.0000 | 80.00 | 0.0000 |
| 0.0000 | 100.00 | 0.0000 |
| 0.0110 | 60.00 | 0.0650 |
| 0.0110 | 80.00 | 0.0630 |
| 0.0110 | 100.00 | 0.0620 |
| 0.0300 | 60.00 | 0.1540 |
| 0.0310 | 80.00 | 0.1480 |
| 0.0320 | 100.00 | 0.1460 |
| 0.0640 | 60.00 | 0.2820 |
| 0.0640 | 80.00 | 0.2730 |
| 0.0640 | 100.00 | 0.2630 |
| 0.0930 | 60.00 | 0.3770 |
| 0.0960 | 80.00 | 0.3700 |
| 0.0960 | 100.00 | 0.3620 |
| 0.1440 | 60.00 | 0.5030 |
| 0.1450 | 100.00 | 0.4750 |
| 0.1480 | 80.00 | 0.4870 |
| 0.1940 | 60.00 | 0.5900 |
| 0.1940 | 80.00 | 0.5820 |
| 0.1950 | 100.00 | 0.5730 |
| 0.2610 | 80.00 | 0.6810 |
| 0.2620 | 100.00 | 0.6710 |
| 0.2640 | 60.00 | 0.6930 |
| 0.3600 | 60.00 | 0.7930 |
| 0.3600 | 100.00 | 0.7740 |
| 0.3620 | 80.00 | 0.7880 |
| 0.4670 | 100.00 | 0.8540 |
| 0.4700 | 60.00 | 0.8690 |
| 0.4710 | 80.00 | 0.8640 |
| 0.5810 | 80.00 | 0.9150 |
| 0.5820 | 60.00 | 0.9200 |
| 0.5820 | 100.00 | 0.9140 |
| 0.6890 | 100.00 | 0.9460 |
| 0.6920 | 60.00 | 0.9490 |
| 0.6920 | 80.00 | 0.9480 |
| 0.7970 | 80.00 | 0.9740 |
| 0.7980 | 100.00 | 0.9720 |
| 0.7990 | 60.00 | 0.9740 |
| 0.9020 | 80.00 | 0.9900 |
| 0.9020 | 100.00 | 0.9890 |
| 0.9040 | 60.00 | 0.9900 |
| 1.0000 | 60.00 | 1.0000 |
| 1.0000 | 80.00 | 1.0000 |
| 1.0000 | 100.00 | 1.0000 |
Boiling temperature at pressure P, K [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of 2-Butanol (2) - Liquid | Pressure, kPa - Liquid | Boiling temperature at pressure P, K - Liquid |
| 0.0000 | 60.00 | 406.13 |
| 0.0000 | 80.00 | 415.28 |
| 0.0000 | 100.00 | 422.73 |
| 0.0110 | 60.00 | 404.49 |
| 0.0110 | 80.00 | 413.59 |
| 0.0110 | 100.00 | 421.20 |
| 0.0300 | 60.00 | 402.01 |
| 0.0310 | 80.00 | 411.02 |
| 0.0320 | 100.00 | 418.50 |
| 0.0640 | 60.00 | 398.78 |
| 0.0640 | 80.00 | 407.77 |
| 0.0640 | 100.00 | 415.27 |
| 0.0930 | 60.00 | 395.84 |
| 0.0960 | 80.00 | 404.58 |
| 0.0960 | 100.00 | 411.93 |
| 0.1440 | 60.00 | 391.75 |
| 0.1450 | 100.00 | 408.17 |
| 0.1480 | 80.00 | 400.41 |
| 0.1940 | 60.00 | 388.26 |
| 0.1940 | 80.00 | 396.98 |
| 0.1950 | 100.00 | 404.20 |
| 0.2610 | 80.00 | 392.09 |
| 0.2620 | 100.00 | 399.18 |
| 0.2640 | 60.00 | 383.53 |
| 0.3600 | 60.00 | 378.22 |
| 0.3600 | 100.00 | 393.31 |
| 0.3620 | 80.00 | 386.25 |
| 0.4670 | 100.00 | 388.10 |
| 0.4700 | 60.00 | 373.48 |
| 0.4710 | 80.00 | 381.33 |
| 0.5810 | 80.00 | 377.09 |
| 0.5820 | 60.00 | 369.43 |
| 0.5820 | 100.00 | 383.54 |
| 0.6890 | 100.00 | 379.96 |
| 0.6920 | 60.00 | 366.14 |
| 0.6920 | 80.00 | 373.61 |
| 0.7970 | 80.00 | 370.50 |
| 0.7980 | 100.00 | 376.47 |
| 0.7990 | 60.00 | 363.39 |
| 0.9020 | 80.00 | 368.03 |
| 0.9020 | 100.00 | 373.87 |
| 0.9040 | 60.00 | 360.97 |
| 1.0000 | 60.00 | 359.26 |
| 1.0000 | 80.00 | 366.45 |
| 1.0000 | 100.00 | 372.21 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.