- InChI
- InChI=1S/C14H22N2O/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4/h7-9H,5-6,10H2,1-4H3,(H,15,17)
- InChI Key
- NNJVILVZKWQKPM-UHFFFAOYSA-N
- Formula
- C14H22N2O
- SMILES
- CCN(CC)CC(=O)Nc1c(C)cccc1C
- Molecular Weight1
- 234.34
- Other Names
-
- 2',6'-Acetoxylidide, 2-(diethylamino)-
- 2-(Diethylamino)-2',6'-acetoxylidide
- 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide
- 2-diethylamino-N-(2,6-dimethylphenyl)acetamide
- Anbesol
- Anestacon
- Cappicaine
- Cito optadren
- Cuivasil
- Dalcaine
- Diethylaminoacet-2,6-xylidide
- Diethylaminoaceto-2,6-xylidide
- Duncaine
- ELA-Max
- Esracaine
- Gravocain
- Isicaina
- Isicaine
- Jetocaine
- L-Caine
- Leostesin
- Lida-Mantle
- Lidoderm
- Lignocaine
- Maricaine
- Remicaine
- Rucaina
- Solarcaine
- Solcain
- Xilina
- Xilocaina
- Xycaine
- Xylestesin
- Xyline
- Xylocain
- Xylocaine
- Xylocitin
- Xyloneural (free base)
- Xylotox
- acetamide, 2-(diethylamino)-N-(2,6-dimethylphenyl)-
- alfa-Dietilamino-2,6-dimetilacetanilide
- lidocaine
- «alpha»-(Diethylamino)-2,6-acetoxylidide
- «alpha»-Diethylamino-2,6-dimethylacetanilide
- «alpha»-Diethylaminoaceto-2,6-xylidide
- «omega»-Diethylamino-2,6-dimethylacetanilide
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Inp : Non-polar retention indices.
- Tboilr : Boiling point at reduced pressure (K).
- Tfus : Normal melting (fusion) point (K).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ΔfusH° | 35.00 | kJ/mol | Joback Calculated Property |
| IE | 7.39 | eV | Relay (1.0) Calculated Property |
| log10WS | [-1.87; -1.77] |
|
|
| log10WS | -1.77 | Aq. Solubility Prediction | |
| log10WS | -1.87 | Aq. Solubility Prediction | |
| logPoct/wat | 2.584 | Crippen Calculated Property | |
| McVol | 205.890 | ml/mol | McGowan Calculated Property |
| Inp | [1838.00; 1924.00] |
|
|
| Inp | 1875.00 | NIST | |
| Inp | 1882.00 | NIST | |
| Inp | 1875.00 | NIST | |
| Inp | 1900.00 | NIST | |
| Inp | 1850.00 | NIST | |
| Inp | 1859.00 | NIST | |
| Inp | 1866.00 | NIST | |
| Inp | 1885.00 | NIST | |
| Inp | 1875.00 | NIST | |
| Inp | 1869.00 | NIST | |
| Inp | 1860.00 | NIST | |
| Inp | 1884.00 | NIST | |
| Inp | 1838.00 | NIST | |
| Inp | 1881.00 | NIST | |
| Inp | 1890.00 | NIST | |
| Inp | 1880.00 | NIST | |
| Inp | 1880.00 | NIST | |
| Inp | 1882.00 | NIST | |
| Inp | 1882.00 | NIST | |
| Inp | 1882.00 | NIST | |
| Inp | 1882.00 | NIST | |
| Inp | 1885.00 | NIST | |
| Inp | 1885.00 | NIST | |
| Inp | 1890.00 | NIST | |
| Inp | 1892.00 | NIST | |
| Inp | 1895.00 | NIST | |
| Inp | 1865.00 | NIST | |
| Inp | 1882.00 | NIST | |
| Inp | 1885.00 | NIST | |
| Inp | 1885.00 | NIST | |
| Inp | 1885.00 | NIST | |
| Inp | 1885.00 | NIST | |
| Inp | 1885.00 | NIST | |
| Inp | 1890.00 | NIST | |
| Inp | 1890.00 | NIST | |
| Inp | 1890.00 | NIST | |
| Inp | 1893.00 | NIST | |
| Inp | 1895.00 | NIST | |
| Inp | 1875.00 | NIST | |
| Inp | 1875.00 | NIST | |
| Inp | 1875.00 | NIST | |
| Inp | 1875.00 | NIST | |
| Inp | 1875.00 | NIST | |
| Inp | 1880.00 | NIST | |
| Inp | 1880.00 | NIST | |
| Inp | 1880.00 | NIST | |
| Inp | 1880.00 | NIST | |
| Inp | 1880.00 | NIST | |
| Inp | 1885.00 | NIST | |
| Inp | 1895.00 | NIST | |
| Inp | 1854.00 | NIST | |
| Inp | 1852.00 | NIST | |
| Inp | 1854.00 | NIST | |
| Inp | 1860.00 | NIST | |
| Inp | 1863.00 | NIST | |
| Inp | 1848.00 | NIST | |
| Inp | 1842.00 | NIST | |
| Inp | 1865.00 | NIST | |
| Inp | 1881.00 | NIST | |
| Inp | 1870.00 | NIST | |
| Inp | 1857.00 | NIST | |
| Inp | 1870.00 | NIST | |
| Inp | 1842.00 | NIST | |
| Inp | 1844.00 | NIST | |
| Inp | 1842.00 | NIST | |
| Inp | 1854.00 | NIST | |
| Inp | 1852.00 | NIST | |
| Inp | 1860.00 | NIST | |
| Inp | 1865.00 | NIST | |
| Inp | 1865.00 | NIST | |
| Inp | Outlier 1924.00 | NIST | |
| Inp | Outlier 1924.00 | NIST | |
| Inp | 1875.00 | NIST | |
| Inp | 1841.00 | NIST | |
| Inp | 1842.00 | NIST | |
| Inp | 1856.00 | NIST | |
| Inp | 1857.00 | NIST | |
| Inp | 1857.00 | NIST | |
| Inp | 1858.00 | NIST | |
| Inp | 1858.00 | NIST | |
| Inp | 1860.00 | NIST | |
| Inp | 1870.00 | NIST | |
| Inp | 1884.00 | NIST | |
| Inp | 1880.00 | NIST | |
| Inp | 1885.00 | NIST | |
| Inp | 1865.00 | NIST | |
| Inp | 1893.00 | NIST | |
| Inp | 1875.00 | NIST | |
| Inp | 1852.00 | NIST | |
| Inp | 1842.00 | NIST | |
| Inp | 1859.00 | NIST | |
| Tfus | [341.65; 341.65] | K |
|
| Tfus | 341.65 | K | Aq. Solubility Prediction |
| Tfus | 341.65 | K | Aq. Solubility Prediction |
Cheméo can also estimate Normal Boiling Point Temperature, Critical Temperature, Critical Pressure, Critical Volume, Enthalpy of formation at standard conditions, Enthalpy of vaporization at standard conditions, Standard Gibbs free energy of formation, Acentric Factor for this compound, but they fall outside the models' validated range, so they are not shown here. Open the prediction tool to compute them on demand.
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [560.26; 643.32] | J/mol×K | [672.84; 874.39] |
|
| Cp,gas | 560.26 | J/mol×K | 672.84 | Joback Calculated Property |
| Cp,gas | 576.33 | J/mol×K | 706.43 | Joback Calculated Property |
| Cp,gas | 591.46 | J/mol×K | 740.02 | Joback Calculated Property |
| Cp,gas | 605.68 | J/mol×K | 773.61 | Joback Calculated Property |
| Cp,gas | 619.04 | J/mol×K | 807.20 | Joback Calculated Property |
| Cp,gas | 631.58 | J/mol×K | 840.79 | Joback Calculated Property |
| Cp,gas | 643.32 | J/mol×K | 874.39 | Joback Calculated Property |
| ΔfusH | [16.40; 18.80] | kJ/mol | [340.70; 341.00] |
|
| ΔfusH | 16.40 | kJ/mol | 340.70 | NIST |
| ΔfusH | 18.80 | kJ/mol | 341.00 | NIST |
Pressure Dependent Properties
| Property | Value | Unit | Pressure (kPa) | Source |
|---|---|---|---|---|
| Tboilr | 454.20 | K | 0.50 | NIST |
Similar Compounds
Find more compounds similar to 2-DIETHYLAMINO-N-(2,6-XYLYL)ACETAMIDE.
Mixtures
- 2-DIETHYLAMINO-N-(2,6-XYLYL)ACETAMIDE + n-Decanoic acid
- 2-DIETHYLAMINO-N-(2,6-XYLYL)ACETAMIDE + Thymol
- 2-DIETHYLAMINO-N-(2,6-XYLYL)ACETAMIDE + Dodecanoic acid
- 2-DIETHYLAMINO-N-(2,6-XYLYL)ACETAMIDE + 5-Hydroxymethylfurfural + Thymol
- 2-DIETHYLAMINO-N-(2,6-XYLYL)ACETAMIDE + n-Decanoic acid + Water
- 2-DIETHYLAMINO-N-(2,6-XYLYL)ACETAMIDE + Thymol + Water
- 2-DIETHYLAMINO-N-(2,6-XYLYL)ACETAMIDE + Carbon dioxide
Sources
- Cheméo Relay (1.0)
- Cheméo Relay (1.0, beta) Beta: served but experimental, data-limited and below our cross-validation release bar; the Joback value is recommended where available.
- Crippen Method
- Thermodynamic properties of hydrophobic deep eutectic solvents and solubility of water and HMF in them: Measurements and PC-SAFT modeling
- Interpretation of the global heat of melting in eutectic binary systems
- The Solubility of Benzocaine, Lidocaine, and Procaine in Liquid and Supercritical Carbon Dioxide
- Joback Method
- Aqueous Solubility Prediction Method
- Aqueous Solubility Prediction Method
- McGowan Method
- NIST Webbook
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.