- InChI
- InChI=1S/C6H4Cl2/c7-5-3-1-2-4-6(5)8/h1-4H
- InChI Key
- RFFLAFLAYFXFSW-UHFFFAOYSA-N
- Formula
- C6H4Cl2
- SMILES
- Clc1ccccc1Cl
- Molecular Weight1
- 147.00
- CAS
- 95-50-1
- Other Names
-
- 1,2-Dichlorbenzene
- 1,2-dichlorobenzene
- Benzene, o-dichloro-
- Chloroben
- Chloroden
- Cloroben
- DCB
- Dichlorobenzene, o-
- Dichlorobenzene, ortho
- Dilantin DB
- Dilatin db
- Dizene
- Dowtherm E
- NCI-C54944
- NSC 60644
- ODB
- ODCB
- Orthodichlorobenzol
- Special termite fluid
- Termitkil
- UN 1591
- o-Dichlorbenzene
- o-Dichlorbenzol
- o-Dichlorobenzol
- o-dichlorobenzene
- ortho-Dichlorobenzene
- ω : Acentric Factor.
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- EA : Electron affinity (eV).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°(+) ion : Enthalpy of formation of positive ion at standard conditions (kJ/mol).
- ΔfH(+) ion,0K : Enthalpy of formation of positive ion at 0K (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- NFPA Health : NFPA Health Rating.
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- ΔfusS : Entropy of fusion at a given temperature (J/mol×K).
- Tboil : Normal Boiling Point Temperature (K).
- Tboilr : Boiling point at reduced pressure (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.2720 | KDB | |
| ΔcH°liquid | [-2964.70; -2957.80] | kJ/mol |
|
| ΔcH°liquid | -2964.70 | kJ/mol | NIST |
| ΔcH°liquid | -2962.60 ± 1.30 | kJ/mol | NIST |
| ΔcH°liquid | -2963.00 ± 2.00 | kJ/mol | NIST |
| ΔcH°liquid | -2958.60 ± 0.71 | kJ/mol | NIST |
| ΔcH°liquid | -2963.90 ± 2.50 | kJ/mol | NIST |
| ΔcH°liquid | -2957.80 ± 1.20 | kJ/mol | NIST |
| μ | 2.30 | debye | KDB |
| EA | 0.09 | eV | NIST |
| ΔfG° | 82.73 | kJ/mol | KDB |
| ΔfH°gas | [30.00; 33.00] | kJ/mol |
|
| ΔfH°gas | 30.00 | kJ/mol | KDB |
| ΔfH°gas | 33.00 | kJ/mol | NIST |
| ΔfH°liquid | [-17.60; -16.00] | kJ/mol |
|
| ΔfH°liquid | -17.40 ± 1.30 | kJ/mol | NIST |
| ΔfH°liquid | -16.00 ± 2.00 | kJ/mol | NIST |
| ΔfH°liquid | -17.60 ± 0.71 | kJ/mol | NIST |
| ΔfH°(+) ion | 904.20 | kJ/mol | NIST |
| ΔfH(+) ion,0K | 916.70 | kJ/mol | NIST |
| ΔfusH° | 13.34 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [48.50; 50.90] | kJ/mol |
|
| ΔvapH° | 50.90 | kJ/mol | NIST |
| ΔvapH° | 48.50 ± 0.10 | kJ/mol | NIST |
| ΔvapH° | 49.90 | kJ/mol | NIST |
| IE | [9.06; 9.24] | eV |
|
| IE | 9.06 ± 0.02 | eV | NIST |
| IE | 9.06 ± 0.02 | eV | NIST |
| IE | 9.08 ± 0.03 | eV | NIST |
| IE | 9.06 ± 0.02 | eV | NIST |
| IE | 9.08 ± 0.01 | eV | NIST |
| IE | 9.07 ± 0.01 | eV | NIST |
| IE | 9.06 | eV | NIST |
| IE | Outlier 9.24 | eV | NIST |
| IE | 9.23 | eV | NIST |
| IE | 9.08 | eV | NIST |
| log10WS | [-3.05; -3.03] |
|
|
| log10WS | -3.03 | Aq. Solubility Prediction | |
| log10WS | -3.05 | Estimated Solubility | |
| logPoct/wat | 2.993 | Crippen Calculated Property | |
| McVol | 96.120 | ml/mol | McGowan Calculated Property |
| NFPA Fire | 2 | KDB | |
| NFPA Health | 2 | KDB | |
| Pc | 4100.00 | kPa | KDB |
| Inp | [167.40; 1076.00] |
|
|
| Inp | 1013.00 | NIST | |
| Inp | 1028.00 | NIST | |
| Inp | 1046.17 | NIST | |
| Inp | 1046.22 | NIST | |
| Inp | 1056.93 | NIST | |
| Inp | 1057.07 | NIST | |
| Inp | 1050.00 | NIST | |
| Inp | 1063.80 | NIST | |
| Inp | 1063.80 | NIST | |
| Inp | 1074.00 | NIST | |
| Inp | 1035.00 | NIST | |
| Inp | 1052.48 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1040.29 | NIST | |
| Inp | 1005.00 | NIST | |
| Inp | 1050.00 | NIST | |
| Inp | 1045.00 | NIST | |
| Inp | 1005.00 | NIST | |
| Inp | 1038.00 | NIST | |
| Inp | 1050.00 | NIST | |
| Inp | 1021.00 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1013.00 | NIST | |
| Inp | 1019.00 | NIST | |
| Inp | 1024.00 | NIST | |
| Inp | 1045.72 | NIST | |
| Inp | 1046.00 | NIST | |
| Inp | 1049.02 | NIST | |
| Inp | 1049.74 | NIST | |
| Inp | 1002.80 | NIST | |
| Inp | 1022.40 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1012.20 | NIST | |
| Inp | 1021.95 | NIST | |
| Inp | 1025.52 | NIST | |
| Inp | 1029.19 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1025.00 | NIST | |
| Inp | 1016.00 | NIST | |
| Inp | 1016.00 | NIST | |
| Inp | 1009.00 | NIST | |
| Inp | 1028.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1015.00 | NIST | |
| Inp | 1033.00 | NIST | |
| Inp | 1012.00 | NIST | |
| Inp | 1010.00 | NIST | |
| Inp | 1013.00 | NIST | |
| Inp | 1014.40 | NIST | |
| Inp | 1003.00 | NIST | |
| Inp | 1027.00 | NIST | |
| Inp | 992.00 | NIST | |
| Inp | 995.00 | NIST | |
| Inp | 1013.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 986.00 | NIST | |
| Inp | 984.00 | NIST | |
| Inp | 1007.00 | NIST | |
| Inp | 1005.00 | NIST | |
| Inp | 1006.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1007.00 | NIST | |
| Inp | 1008.00 | NIST | |
| Inp | 1067.00 | NIST | |
| Inp | 1055.00 | NIST | |
| Inp | 1007.00 | NIST | |
| Inp | 1009.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | Outlier 168.00 | NIST | |
| Inp | Outlier 167.40 | NIST | |
| Inp | 1007.00 | NIST | |
| Inp | 1008.00 | NIST | |
| Inp | 1009.00 | NIST | |
| Inp | 995.00 | NIST | |
| Inp | Outlier 168.00 | NIST | |
| I | [1445.00; 1529.80] |
|
|
| I | 1452.00 | NIST | |
| I | 1529.80 | NIST | |
| I | 1445.00 | NIST | |
| I | 1447.00 | NIST | |
| I | 1514.00 | NIST | |
| I | 1486.00 | NIST | |
| I | 1455.00 | NIST | |
| I | 1459.00 | NIST | |
| I | 1492.00 | NIST | |
| I | 1492.00 | NIST | |
| I | 1519.77 | NIST | |
| I | 1511.85 | NIST | |
| I | 1488.07 | NIST | |
| I | 1495.00 | NIST | |
| I | 1497.00 | NIST | |
| I | 1452.00 | NIST | |
| I | 1486.00 | NIST | |
| I | 1529.80 | NIST | |
| Tboil | [452.65; 453.70] | K |
|
| Tboil | 453.60 | K | KDB |
| Tboil | 453.70 | K | NIST |
| Tboil | 453.40 ± 0.50 | K | NIST |
| Tboil | 453.00 ± 1.50 | K | NIST |
| Tboil | 453.63 ± 0.07 | K | NIST |
| Tboil | 452.65 ± 0.35 | K | NIST |
| Tc | [698.80; 729.00] | K |
|
| Tc | 698.80 | K | The Critical Temperatures of a Number of (i) (Chloroalkane (C3 C4) + Hydrocarbon (C6 C7)) Binary Mixtures and (ii) (Aromatic Halocarbon (Chlorobenzene, Fluorobenzene, 1,2-Dichlorobenzene, or 1,3-Dichlorobenzene) + Alkane (C8)) Binary Mixtures |
| Tc | 729.00 | K | KDB |
| Tfus | [255.20; 256.15] | K |
|
| Tfus | 256.10 | K | KDB |
| Tfus | 255.92 | K | Aq. Solubility Prediction |
| Tfus | Outlier 255.20 ± 0.20 | K | NIST |
| Tfus | 256.15 ± 0.05 | K | NIST |
| Tfus | 256.00 ± 0.10 | K | NIST |
| Tfus | 256.13 ± 0.10 | K | NIST |
| Tfus | 256.14 ± 0.05 | K | NIST |
| Tfus | 256.12 ± 0.05 | K | NIST |
| Tfus | 256.00 ± 2.00 | K | NIST |
| Tfus | 256.00 ± 0.50 | K | NIST |
| Vc | 0.360 | m3/kmol | KDB |
| Zc | 0.2435130 | KDB |
Temperature Dependent Properties
Pressure Dependent Properties
| Property | Value | Unit | Pressure (kPa) | Source |
|---|---|---|---|---|
| Tboilr | 451.20 | K | 102.00 | NIST |
Datasets
Viscosity, Pa*s
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
| 101.00 | 303.15 | 0.0013 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.66] | kPa | [330.74; 484.72] |
The Yaws Handbook of Vapor Pressure
|
| Equation | ln(Y) = A + B/(T + C) Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.40308e+01 | |||
| Coefficient B | -3.67273e+03 | |||
| Coefficient C | -6.35030e+01 | |||
| Temperature range, min. | 330.74 | |||
| Temperature range, max. | 484.72 | |||
| Pvap | 1.33 | kPa | 330.74 | Calculated Property |
| Pvap | 3.05 | kPa | 347.85 | Calculated Property |
| Pvap | 6.34 | kPa | 364.96 | Calculated Property |
| Pvap | 12.20 | kPa | 382.07 | Calculated Property |
| Pvap | 21.96 | kPa | 399.18 | Calculated Property |
| Pvap | 37.34 | kPa | 416.28 | Calculated Property |
| Pvap | 60.44 | kPa | 433.39 | Calculated Property |
| Pvap | 93.74 | kPa | 450.50 | Calculated Property |
| Pvap | 140.10 | kPa | 467.61 | Calculated Property |
| Pvap | 202.66 | kPa | 484.72 | Calculated Property |
| Pvap | [6.43e-03; 4105.80] | kPa | [256.15; 729.00] |
KDB Vapor Pressure Data
|
| Equation | ln(Y) = A + B/T + C·ln(T) + D·T² + E/T² Y is Pvap in kPa, T in K | |||
| Coefficient A | 6.74184e+01 | |||
| Coefficient B | -8.04769e+03 | |||
| Coefficient C | -7.42072e+00 | |||
| Coefficient D | 1.61077e-06 | |||
| Coefficient E | 0.00000e+00 | |||
| Temperature range, min. | 256.15 | |||
| Temperature range, max. | 729.00 | |||
| Pvap | 6.43e-03 | kPa | 256.15 | Calculated Property |
| Pvap | 0.35 | kPa | 308.69 | Calculated Property |
| Pvap | 5.18 | kPa | 361.23 | Calculated Property |
| Pvap | 34.20 | kPa | 413.77 | Calculated Property |
| Pvap | 135.79 | kPa | 466.31 | Calculated Property |
| Pvap | 383.70 | kPa | 518.84 | Calculated Property |
| Pvap | 856.26 | kPa | 571.38 | Calculated Property |
| Pvap | 1614.84 | kPa | 623.92 | Calculated Property |
| Pvap | 2694.26 | kPa | 676.46 | Calculated Property |
| Pvap | 4105.80 | kPa | 729.00 | Calculated Property |
Similar Compounds
Find more compounds similar to Benzene, 1,2-dichloro-.
Mixtures
- Benzene, 1,2-dichloro- + Dimethyl Sulfoxide
- Benzene, 1,2-dichloro- + N,N-Dimethylacetamide
- Benzene, 1,2-dichloro- + Tetrahydrofuran
- Benzene, 1,2-dichloro- + Formamide
- Benzene, 1,2-dichloro- + 1,2-Ethanediol
- Benzene, 1,2-dichloro- + Propylene Glycol
- n-Hexane + Benzene, 1,2-dichloro- + Furfural
- Benzene, 1,2-dichloro- + Furfural + Hexadecane
- Benzene, 1,2-dichloro- + Water
- Benzene, 1,2-dichloro- + Pentane, 2,2,4-trimethyl-
- Benzene, 1,2-dichloro- + Cyclooctane
- Benzene, 1,2-dichloro- + Octane
- Azacyclotridecan-2-one + Benzene, 1,2-dichloro-
- Benzene, 1,2-dichloro- + 1,4-Dioxane
- Benzene, 1,2-dichloro- + Sulfur, mol. (S8) + Benzene, chloro-
- Benzene, 1,2-dichloro- + Buckminsterfullerene
- Benzene + Benzene, 1,2-dichloro- + Hexane, 1-chloro-
- Benzene, 1,2-dichloro- + Naphthalene
- Benzene, 1,2-dichloro- + Pentanenitrile
Sources
- KDB Vapor Pressure Data
- Crippen Method
- Densities, Viscosities, Speeds of Sound, and Refractive Indices of Binary Mixtures of 2-Octanol with Chlorobenzenes
- Densities and ultrasonic studies for binary mixtures of tetrahydrofuran with chlorobenzenes, chlorotoluenes and nitrotoluenes at 298.15 K
- Liquid-liquid equilibrium data for binary systems containing o-dichlorobenzene and nitrobenzene
- Effect of various substituents on benzene ring and their impact on volumetric, acoustic and transport properties of binary liquid mixtures with dimethylacetamide
- Solubility of 1-methyl-4-nitropyrazole in seventeen pure solvents at temperatures from 283.15 K to 323.15 K
- Volumetric, ultrasonic and viscometric studies of binary mixtures of dimethyl sulphoxide with chloro and nitro substituted aromatic hydrocarbons at T = 303.15 K
- Thermodynamics of solvation and solvophobic effect in formamide
- S6 Isomer of C60(CF3)12: Synthesis, properties and thermodynamic functions
- Phase behavior of ionic liquids 1-alkyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imides with halogenated benzenes
- Effect of halogen substitution on the enthalpies of solvation and hydrogen bonding of organic solutes in chlorobenzene and 1,2-dichlorobenzene derived using multi-parameter correlations
- Enthalpies of solution and enthalpies of solvation of chloro- and nitro-substituted benzenes in 1-butyl-3-methyl imidazolium based ionic liquids at 298.15 K: Additivity of group contributions
- Solution and solvation enthalpies of aromatic derivitives in binary mixtures. Dipole moment and dielectric properties
- Mass Diffusion Coefficient and Soret Coefficient of o-Dichlorobenzene Solutions of PCBM and [60]Fullerene by the Soret Forced Rayleigh Scattering Method
- The Critical Temperatures of a Number of (i) (Chloroalkane (C3 C4) + Hydrocarbon (C6 C7)) Binary Mixtures and (ii) (Aromatic Halocarbon (Chlorobenzene, Fluorobenzene, 1,2-Dichlorobenzene, or 1,3-Dichlorobenzene) + Alkane (C8)) Binary Mixtures
- Measurement and Correlation of the Solubilities of Sulfur S8 in 10 Solvents
- Physico-Chemical Properties of LiFSI Solutions I. LiFSI with Valeronitrile, Dichloromethane, 1,2-Dichloroethane, and 1,2-Dichlorobenzene
- Solid-Liquid Equilibrium of Azacyclotridecan-2-one in 15 Pure Solvents from T = 273.15 to 323.15 K: Experimental Determination and Thermodynamic Modeling
- Thermodynamic Studies of Solubility for Naphthalene in 12 Solvents from 279 to 330 K
- Liquid-Liquid Equilibria for Mixtures of (Furfural + a Chlorinated Aromatic Compound + an Alkane) at T = 298.15 K
- Excess Molar Enthalpies and Excess Molar Volumes of the Ternary System 1,2-Dichlorobenzene + Benzene +1-Chlorohexane at 298.15 K
- The Effects of Temperature and Inorganic Salts on the Aqueous Solubility of Selected Chlorobenzenes
- Density, Viscosity, Refractive Index, and Speed of Sound for Binary Mixtures of 1,4-Dioxane with Different Organic Liquids at (298.15, 303.15, and 308.15) K
- Determination of Partitioning Coefficients of Numerous Organic Solutes between a Long-Chain Aliphatic Alcohol and the Gas Phase as a Function of Temperature
- Determination of Henry's Law Constants Using Internal Standards with Benchmark Values
- Heat Capacities and Densities of Some Liquid Chloro-, Bromo-, and Bromochloro-Substituted Benzenes
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.
These property values are available through the Cheméo API. A free account gives you an access key.