Chemical Properties of 13,14-Dihydro-15-keto-PGE2, EO-TMS, isomer # 3

13,14-Dihydro-15-keto-PGE2, EO-TMS, isomer # 3

InChI
InChI=1S/C30H58N2O5Si2/c1-10-13-16-19-25(31-34-11-2)22-23-27-26(20-17-14-15-18-21-30(33)37-39(7,8)9)28(32-35-12-3)24-29(27)36-38(4,5)6/h14,17,26-27,29H,10-13,15-16,18-24H2,1-9H3/b17-14-,31-25?,32-28?/t26-,27-,29-/m0/s1
InChI Key
UWXDFULQJFGIIN-OPNXPFFOSA-N
Formula
C30H58N2O5Si2
SMILES
CCCCCC(CCC1C(O[Si](C)(C)C)CC(=NOCC)C1CC=CCCCC(=O)O[Si](C)(C)C)=NOCC
Molecular Weight1
582.96
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry. Do not hesitate to contact us for your projects.

Physical Properties

Property Value Unit Source
ω 1.1780 Relay (1.0) Calculated Property
Δf -70.10 kJ/mol Relay (1.0-beta) Calculated Property
Δfgas -1094.86 kJ/mol Relay (1.0) Calculated Property
Δvap 117.01 kJ/mol Relay (1.0) Calculated Property
IE 8.06 eV Relay (1.0) Calculated Property
log10WS -5.39 Relay (1.0) Calculated Property
logPoct/wat 8.483 Crippen Calculated Property
Inp 2825.00 NIST
Tboil 700.79 K Relay (1.0) Calculated Property
Tc 877.33 K Relay (1.0) Calculated Property
Tfus 291.37 K Relay (1.0) Calculated Property
Vc 1.830 m3/kmol Relay (1.0) Calculated Property

Similar Compounds

13,14-Dihydro-15-keto-PGE2, EO-TMS, isomer # 2. 13,14-Dihydro-15-keto-PGE2, EO-TMS, isomer # 1. 13,14-Dihydro-15-keto-PGE2, EO-TMS, isomer # 4. 13,14-Dihydro-PGE2, EO-TMS, isomer # 1. 13,14-Dihydro-PGE2, EO-TMS, isomer # 2. 13,14-Dihydro-15-keto-PGE2, BO-TMS, isomer # 4. 13,14-Dihydro-15-keto-PGE2, BO-TMS, isomer # 2. 13,14-Dihydro-15-keto-PGE2, BO-TMS, isomer # 1. 13,14-Dihydro-15-keto-PGE2, BO-TMS, isomer # 3. 13,14-Dihydro-15-keto-PGE2, MO-TMS, isomer # 1. 13,14-Dihydro-15-keto-PGE2, MO-TMS, isomer # 2. 13,14-Dihydro-PGE2, BO-TMS, isomer # 2. 13,14-Dihydro-PGE2, BO-TMS, isomer # 1. 13,14-Dihydro-PGE2, MO-TMS, isomer # 2. 13,14-Dihydro-PGE2, MO-TMS, isomer # 1.

Find more compounds similar to 13,14-Dihydro-15-keto-PGE2, EO-TMS, isomer # 3.

Sources

Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more. Take the time to validate and double check the source of the data.