Chemical Properties of sodium benzoate (CAS 532-32-1)

sodium benzoate

InChI
InChI=1S/C7H6O2.Na/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H,8,9);/q;+1/p-1
InChI Key
WXMKPNITSTVMEF-UHFFFAOYSA-M
Formula
C7H5NaO2
SMILES
O=C([O][Na])c1ccccc1
Molecular Weight1
144.10
CAS
532-32-1
Other Names
  • benzoic acid, sodium salt
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry. Do not hesitate to contact us for your projects.

Physical Properties

Property Value Unit Source
ω 0.4682 Relay (1.0) Calculated Property
ΔfG° -118.42 kJ/mol Relay (1.0-beta) Calculated Property
ΔfH°gas -171.67 kJ/mol Relay (1.0) Calculated Property
ΔvapH° 59.13 kJ/mol Relay (1.0) Calculated Property
IE 9.17 eV Relay (1.0) Calculated Property
log10WS -2.19 Relay (1.0) Calculated Property
Pc 3905.59 kPa Relay (1.0-beta) Calculated Property
Tboil 471.53 K Relay (1.0) Calculated Property
Tc 770.84 K Relay (1.0) Calculated Property
Tfus 260.32 K Relay (1.0) Calculated Property
Vc 0.376 m3/kmol Relay (1.0) Calculated Property

Temperature Dependent Properties

Property Value Unit Temperature (K) Source
Cp,solid [74.66; 225.75] J/mol×K [78.86; 397.91] Show Hide
Cp,solid 74.66 J/mol×K 78.86 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 75.06 J/mol×K 80.43 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 76.58 J/mol×K 82.62 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 77.94 J/mol×K 84.79 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 79.00 J/mol×K 87.06 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 80.34 J/mol×K 89.08 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 81.60 J/mol×K 91.16 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 82.94 J/mol×K 93.24 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 83.73 J/mol×K 95.32 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 84.83 J/mol×K 97.26 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 86.09 J/mol×K 99.20 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 87.27 J/mol×K 101.14 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 88.20 J/mol×K 103.01 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 89.11 J/mol×K 104.89 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 89.81 J/mol×K 106.30 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 90.52 J/mol×K 107.72 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 91.63 J/mol×K 109.44 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 92.54 J/mol×K 111.32 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 93.55 J/mol×K 113.05 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 94.67 J/mol×K 114.93 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 95.37 J/mol×K 116.50 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 95.98 J/mol×K 118.38 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 97.43 J/mol×K 120.05 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 98.90 J/mol×K 122.61 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 100.57 J/mol×K 126.31 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 102.54 J/mol×K 129.87 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 104.11 J/mol×K 133.42 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 105.58 J/mol×K 137.05 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 107.64 J/mol×K 140.25 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 109.31 J/mol×K 143.52 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 111.38 J/mol×K 146.93 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 112.85 J/mol×K 150.20 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 114.42 J/mol×K 153.61 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 115.80 J/mol×K 156.74 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 117.10 J/mol×K 159.94 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 118.62 J/mol×K 163.08 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 120.71 J/mol×K 166.41 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 122.29 J/mol×K 169.54 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 124.15 J/mol×K 172.67 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 125.53 J/mol×K 175.80 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 127.20 J/mol×K 178.78 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 128.48 J/mol×K 182.05 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 130.74 J/mol×K 186.18 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 133.09 J/mol×K 190.73 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 134.96 J/mol×K 194.71 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 136.73 J/mol×K 198.69 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 138.89 J/mol×K 202.67 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 140.95 J/mol×K 206.65 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 143.02 J/mol×K 210.78 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 144.69 J/mol×K 214.62 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 147.24 J/mol×K 218.60 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 148.91 J/mol×K 222.72 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 150.78 J/mol×K 226.56 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 152.55 J/mol×K 230.54 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 154.30 J/mol×K 234.67 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 156.48 J/mol×K 238.65 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 158.35 J/mol×K 242.63 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 160.90 J/mol×K 247.75 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 162.99 J/mol×K 252.79 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 164.60 J/mol×K 256.71 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 166.70 J/mol×K 260.69 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 168.34 J/mol×K 264.71 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 170.63 J/mol×K 268.80 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 172.89 J/mol×K 272.92 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 174.76 J/mol×K 276.90 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 176.43 J/mol×K 280.74 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 178.39 J/mol×K 284.72 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 179.87 J/mol×K 288.70 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 181.54 J/mol×K 292.69 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 182.91 J/mol×K 295.10 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 184.58 J/mol×K 298.37 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 185.56 J/mol×K 301.36 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 186.94 J/mol×K 304.35 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 188.32 J/mol×K 307.33 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 189.49 J/mol×K 310.32 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 190.87 J/mol×K 313.30 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 191.75 J/mol×K 316.29 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 192.93 J/mol×K 319.28 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 194.21 J/mol×K 322.12 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 195.49 J/mol×K 325.11 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 196.77 J/mol×K 327.81 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 197.36 J/mol×K 329.51 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 198.63 J/mol×K 332.93 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 199.91 J/mol×K 335.35 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 200.79 J/mol×K 338.05 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 202.17 J/mol×K 340.89 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 202.96 J/mol×K 343.88 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 204.33 J/mol×K 346.72 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 205.02 J/mol×K 349.42 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 206.20 J/mol×K 352.27 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 207.28 J/mol×K 355.25 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 208.56 J/mol×K 358.10 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 209.38 J/mol×K 360.85 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 210.82 J/mol×K 363.79 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 212.19 J/mol×K 366.63 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 213.57 J/mol×K 369.62 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 214.53 J/mol×K 372.46 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 215.93 J/mol×K 375.30 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 217.20 J/mol×K 378.15 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 218.09 J/mol×K 380.99 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 219.66 J/mol×K 383.98 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 220.45 J/mol×K 386.68 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 221.82 J/mol×K 389.52 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 223.20 J/mol×K 392.37 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 224.18 J/mol×K 395.21 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid 225.75 J/mol×K 397.91 Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)

Similar Compounds

benzoate anion. Terephthalic acid, disodium salt. Benzoic acid. perbenzoic acid. Benzoic acid, methyl ester. dibenzoyl peroxide. Benzoic acid, anhydride. Benzoic acid, p-amino-, sodium salt. Terephthalic acid. 1,3-Benzenedicarboxylic acid. poly(ethylene terephthalate). 2-Naphthalenecarboxylic acid. 1,4-Benzenedicarboxylic acid, dimethyl ester. 2-Anthracenecarboxylic acid. Benzoic acid trimethylsilyl ester.

Find more compounds similar to sodium benzoate.

Mixtures

Sources

Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more. Take the time to validate and double check the source of the data.
These property values are available through the Cheméo API. A free account gives you an access key.