Chemical Properties of sodium benzoate (CAS 532-32-1)

InChI

InChI=1S/C7H6O2.Na/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H,8,9);/q;+1/p-1

InChI Key

WXMKPNITSTVMEF-UHFFFAOYSA-M

Formula

C7H5NaO2

SMILES

O=C(O[Na])c1ccccc1

Molecular Weight¹

144.10

CAS

532-32-1

Other Names

• benzoic acid, sodium salt

• C_p,solid : Solid phase heat capacity (J/mol×K).
• ¹: Molecular weight from the IUPAC atomic weights tables.

Temperature Dependent Properties

Property	Value	Unit	Temperature (K)	Source
Cp,solid	[74.66; 225.75]	J/mol×K	[78.86; 397.91]
Cp,solid	74.66	J/mol×K	78.86	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	75.06	J/mol×K	80.43	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	76.58	J/mol×K	82.62	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	77.94	J/mol×K	84.79	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	79.00	J/mol×K	87.06	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	80.34	J/mol×K	89.08	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	81.60	J/mol×K	91.16	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	82.94	J/mol×K	93.24	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	83.73	J/mol×K	95.32	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	84.83	J/mol×K	97.26	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	86.09	J/mol×K	99.20	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	87.27	J/mol×K	101.14	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	88.20	J/mol×K	103.01	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	89.11	J/mol×K	104.89	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	89.81	J/mol×K	106.30	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	90.52	J/mol×K	107.72	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	91.63	J/mol×K	109.44	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	92.54	J/mol×K	111.32	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	93.55	J/mol×K	113.05	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	94.67	J/mol×K	114.93	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	95.37	J/mol×K	116.50	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	95.98	J/mol×K	118.38	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	97.43	J/mol×K	120.05	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	98.90	J/mol×K	122.61	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	100.57	J/mol×K	126.31	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	102.54	J/mol×K	129.87	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	104.11	J/mol×K	133.42	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	105.58	J/mol×K	137.05	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	107.64	J/mol×K	140.25	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	109.31	J/mol×K	143.52	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	111.38	J/mol×K	146.93	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	112.85	J/mol×K	150.20	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	114.42	J/mol×K	153.61	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	115.80	J/mol×K	156.74	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	117.10	J/mol×K	159.94	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	118.62	J/mol×K	163.08	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	120.71	J/mol×K	166.41	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	122.29	J/mol×K	169.54	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	124.15	J/mol×K	172.67	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	125.53	J/mol×K	175.80	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	127.20	J/mol×K	178.78	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	128.48	J/mol×K	182.05	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	130.74	J/mol×K	186.18	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	133.09	J/mol×K	190.73	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	134.96	J/mol×K	194.71	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	136.73	J/mol×K	198.69	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	138.89	J/mol×K	202.67	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	140.95	J/mol×K	206.65	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	143.02	J/mol×K	210.78	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	144.69	J/mol×K	214.62	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	147.24	J/mol×K	218.60	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	148.91	J/mol×K	222.72	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	150.78	J/mol×K	226.56	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	152.55	J/mol×K	230.54	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	154.30	J/mol×K	234.67	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	156.48	J/mol×K	238.65	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	158.35	J/mol×K	242.63	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	160.90	J/mol×K	247.75	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	162.99	J/mol×K	252.79	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	164.60	J/mol×K	256.71	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	166.70	J/mol×K	260.69	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	168.34	J/mol×K	264.71	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	170.63	J/mol×K	268.80	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	172.89	J/mol×K	272.92	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	174.76	J/mol×K	276.90	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	176.43	J/mol×K	280.74	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	178.39	J/mol×K	284.72	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	179.87	J/mol×K	288.70	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	181.54	J/mol×K	292.69	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	182.91	J/mol×K	295.10	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	184.58	J/mol×K	298.37	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	185.56	J/mol×K	301.36	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	186.94	J/mol×K	304.35	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	188.32	J/mol×K	307.33	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	189.49	J/mol×K	310.32	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	190.87	J/mol×K	313.30	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	191.75	J/mol×K	316.29	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	192.93	J/mol×K	319.28	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	194.21	J/mol×K	322.12	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	195.49	J/mol×K	325.11	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	196.77	J/mol×K	327.81	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	197.36	J/mol×K	329.51	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	198.63	J/mol×K	332.93	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	199.91	J/mol×K	335.35	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	200.79	J/mol×K	338.05	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	202.17	J/mol×K	340.89	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	202.96	J/mol×K	343.88	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	204.33	J/mol×K	346.72	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	205.02	J/mol×K	349.42	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	206.20	J/mol×K	352.27	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	207.28	J/mol×K	355.25	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	208.56	J/mol×K	358.10	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	209.38	J/mol×K	360.85	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	210.82	J/mol×K	363.79	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	212.19	J/mol×K	366.63	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	213.57	J/mol×K	369.62	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	214.53	J/mol×K	372.46	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	215.93	J/mol×K	375.30	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	217.20	J/mol×K	378.15	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	218.09	J/mol×K	380.99	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	219.66	J/mol×K	383.98	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	220.45	J/mol×K	386.68	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	221.82	J/mol×K	389.52	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	223.20	J/mol×K	392.37	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	224.18	J/mol×K	395.21	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
Cp,solid	225.75	J/mol×K	397.91	Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)

Similar Compounds

Find more compounds similar to sodium benzoate.

Mixtures

• sodium benzoate + Glycine + Water
• D-Alanine + sodium benzoate + Water
• D-Valine + sodium benzoate + Water
• sodium benzoate + Water
• Acetic acid, phenylmethyl ester + sodium benzoate + Water
• Benzyl Benzoate + sodium benzoate + Water
• Octadecanoic acid + sodium benzoate + Water

Sources

• Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
• Density and Viscosity Study of Interactions of Some Amino Acids in Aqueous Solutions of Sodium Benzoate
• Solubility and Mass Transfer Coefficient Enhancement of Benzyl Acetate in Water through Hydrotropy
• Effect of Hydrotropes on the Solubility and Mass Transfer Coefficient of Benzyl Benzoate in Water
• Mixing Behavior of Anionic Hydrotropes with Cationic Gemini Surfactants
• Sodium Salts of Benzoic, m-Salicylic, and p-Salicylic Acid: A Conductivity Study of Diluted Aqueous Solutions
• Solubility and Mass Transfer Coefficient Enhancement of Stearic Acid through Hydrotropy
• NIST Webbook

Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more. Take the time to validate and double check the source of the data.