- InChI
- InChI=1S/C15H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17-2/h3-14H2,1-2H3
- InChI Key
- ZAZKJZBWRNNLDS-UHFFFAOYSA-N
- Formula
- C15H30O2
- SMILES
- CCCCCCCCCCCCCC(=O)OC
- Molecular Weight1
- 242.40
- CAS
- 124-10-7
- Other Names
-
- Acide myristique methyl ester
- Emery 2214
- Metholeneat 2495
- Methyl myristylate
- Methyl n-tetradecanoate
- Uniphat A50
- methyl myristate
- myristic acid, methyl ester
- tetradecanoic acid, methyl ester
- ω : Acentric Factor.
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔsubH : Enthalpy of sublimation at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Ptriple : Triple Point Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- csound,fluid : Speed of sound in fluid (m/s).
- Tboil : Normal Boiling Point Temperature (K).
- Tboilr : Boiling point at reduced pressure (K).
- Tc : Critical Temperature (K).
- λ : Gas thermal conductivity (W/m×K).
- λ : Liquid thermal conductivity (W/m×K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- UQi : UNIQUAC Qi Parameter.
- URi : UNIQUAC Ri Parameter.
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Contents
- Physical Properties
- Temperature Dependent Properties
- Pressure Dependent Properties
- Datasets
- Correlations
- Similar Compounds
- Mixtures
- Sources
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.6979 | ChemSep v8.3 pure component data | |
| ΔcH°liquid | [-9445.60; -9430.70] | kJ/mol |
|
| ΔcH°liquid | -9430.70 ± 0.40 | kJ/mol | NIST |
| ΔcH°liquid | -9445.60 ± 2.10 | kJ/mol | NIST |
| μ | 1.62 | debye | ChemSep v8.3 pure component data |
| ΔfG° | -219.89 | kJ/mol | ChemSep v8.3 pure component data |
| ΔfH°gas | -654.80 | kJ/mol | ChemSep v8.3 pure component data |
| ΔfusH° | 52.01 | kJ/mol | Heat Capacity Measurements of 13 Methyl Esters of n-Carboxylic Acids from Methyloctanoate to Methyleicosanoate between 5 K and 350 K |
| ΔvapH° | [85.90; 87.00] | kJ/mol |
|
| ΔvapH° | 86.98 | kJ/mol | NIST |
| ΔvapH° | 85.90 ± 0.80 | kJ/mol | NIST |
| ΔvapH° | 86.60 | kJ/mol | NIST |
| ΔvapH° | 86.20 ± 1.00 | kJ/mol | NIST |
| ΔvapH° | 86.98 ± 0.94 | kJ/mol | NIST |
| ΔvapH° | 87.00 ± 0.90 | kJ/mol | NIST |
| IE | 9.72 | eV | Relay (1.0) Calculated Property |
| log10WS | -5.48 | Relay (1.0) Calculated Property | |
| logPoct/wat | 4.861 | Crippen Calculated Property | |
| McVol | 229.650 | ml/mol | McGowan Calculated Property |
| Pc | 1421.00 | kPa | ChemSep v8.3 pure component data |
| Ptriple | 1.33e-05 | kPa | ChemSep v8.3 pure component data |
| Inp | [286.80; 1738.00] |
|
|
| Inp | 1710.60 | NIST | |
| Inp | 1710.00 | NIST | |
| Inp | 1718.00 | NIST | |
| Inp | 1712.00 | NIST | |
| Inp | 1713.00 | NIST | |
| Inp | 1713.00 | NIST | |
| Inp | 1707.00 | NIST | |
| Inp | 1726.00 | NIST | |
| Inp | 1706.00 | NIST | |
| Inp | 1726.00 | NIST | |
| Inp | 1726.00 | NIST | |
| Inp | 1727.00 | NIST | |
| Inp | 1713.00 | NIST | |
| Inp | 1725.00 | NIST | |
| Inp | 1714.00 | NIST | |
| Inp | 1727.00 | NIST | |
| Inp | 1738.00 | NIST | |
| Inp | 1719.00 | NIST | |
| Inp | 1706.00 | NIST | |
| Inp | 1706.00 | NIST | |
| Inp | 1707.00 | NIST | |
| Inp | 1707.44 | NIST | |
| Inp | 1708.00 | NIST | |
| Inp | 1707.00 | NIST | |
| Inp | 1715.00 | NIST | |
| Inp | 1725.00 | NIST | |
| Inp | 1714.00 | NIST | |
| Inp | 1722.20 | NIST | |
| Inp | 1728.00 | NIST | |
| Inp | 1726.00 | NIST | |
| Inp | 1728.00 | NIST | |
| Inp | 1699.00 | NIST | |
| Inp | 1699.00 | NIST | |
| Inp | 1708.00 | NIST | |
| Inp | 1727.00 | NIST | |
| Inp | 1724.00 | NIST | |
| Inp | 1725.00 | NIST | |
| Inp | 1723.00 | NIST | |
| Inp | 1738.00 | NIST | |
| Inp | 1723.00 | NIST | |
| Inp | 1726.00 | NIST | |
| Inp | 1723.00 | NIST | |
| Inp | 1727.40 | NIST | |
| Inp | 1725.00 | NIST | |
| Inp | 1723.00 | NIST | |
| Inp | 1727.00 | NIST | |
| Inp | 1706.00 | NIST | |
| Inp | 1722.00 | NIST | |
| Inp | 1710.00 | NIST | |
| Inp | 1724.00 | NIST | |
| Inp | 1725.00 | NIST | |
| Inp | 1709.00 | NIST | |
| Inp | 1729.00 | NIST | |
| Inp | 1707.00 | NIST | |
| Inp | 1727.00 | NIST | |
| Inp | 1707.00 | NIST | |
| Inp | 1705.00 | NIST | |
| Inp | 1708.00 | NIST | |
| Inp | 1708.00 | NIST | |
| Inp | 1707.00 | NIST | |
| Inp | 1712.00 | NIST | |
| Inp | 1722.00 | NIST | |
| Inp | 1726.00 | NIST | |
| Inp | 1735.00 | NIST | |
| Inp | 1684.00 | NIST | |
| Inp | 1735.00 | NIST | |
| Inp | 1708.00 | NIST | |
| Inp | 1727.00 | NIST | |
| Inp | 1727.00 | NIST | |
| Inp | 1707.00 | NIST | |
| Inp | 1707.00 | NIST | |
| Inp | 1723.00 | NIST | |
| Inp | 1707.00 | NIST | |
| Inp | 1725.00 | NIST | |
| Inp | 1717.00 | NIST | |
| Inp | 1706.00 | NIST | |
| Inp | 1725.00 | NIST | |
| Inp | 1707.00 | NIST | |
| Inp | 1708.00 | NIST | |
| Inp | 1714.00 | NIST | |
| Inp | 1715.00 | NIST | |
| Inp | Outlier 288.78 | NIST | |
| Inp | Outlier 291.18 | NIST | |
| Inp | Outlier 297.60 | NIST | |
| Inp | Outlier 297.60 | NIST | |
| Inp | Outlier 297.70 | NIST | |
| Inp | Outlier 286.80 | NIST | |
| Inp | Outlier 290.52 | NIST | |
| Inp | Outlier 290.32 | NIST | |
| Inp | Outlier 290.32 | NIST | |
| Inp | Outlier 290.32 | NIST | |
| Inp | 1722.20 | NIST | |
| Inp | 1708.00 | NIST | |
| Inp | 1738.00 | NIST | |
| Inp | 1725.00 | NIST | |
| Inp | 1710.00 | NIST | |
| Inp | 1707.00 | NIST | |
| I | [1978.00; 2037.00] |
|
|
| I | 2005.00 | NIST | |
| I | 2037.00 | NIST | |
| I | 1990.00 | NIST | |
| I | 1990.00 | NIST | |
| I | 1990.00 | NIST | |
| I | 1998.00 | NIST | |
| I | 1990.00 | NIST | |
| I | 2006.00 | NIST | |
| I | 2034.00 | NIST | |
| I | 1988.00 | NIST | |
| I | 2028.00 | NIST | |
| I | 2008.00 | NIST | |
| I | 2008.00 | NIST | |
| I | 2000.00 | NIST | |
| I | 1998.00 | NIST | |
| I | 2032.00 | NIST | |
| I | 2036.00 | NIST | |
| I | 2014.00 | NIST | |
| I | 2006.00 | NIST | |
| I | 1987.00 | NIST | |
| I | 2021.00 | NIST | |
| I | 2034.00 | NIST | |
| I | 2014.00 | NIST | |
| I | 2009.00 | NIST | |
| I | 1999.00 | NIST | |
| I | 1990.00 | NIST | |
| I | 1990.00 | NIST | |
| I | 2020.00 | NIST | |
| I | 1978.00 | NIST | |
| I | 2000.00 | NIST | |
| I | 1990.00 | NIST | |
| I | 1998.00 | NIST | |
| I | 2028.00 | NIST | |
| Tboil | [596.15; 596.20] | K |
|
| Tboil | 596.15 | K | ChemSep v8.3 pure component data |
| Tboil | 596.20 | K | NIST |
| Tc | [730.00; 741.20] | K |
|
| Tc | 730.00 | K | Vapor-liquid critical point measurements of fifteen compounds by the pulse-heating method |
| Tc | 741.20 | K | ChemSep v8.3 pure component data |
| Tfus | [290.00; 292.00] | K |
|
| Tfus | 291.05 | K | ChemSep v8.3 pure component data |
| Tfus | 290.00 ± 1.00 | K | NIST |
| Tfus | 291.85 ± 0.30 | K | NIST |
| Tfus | 292.00 ± 2.00 | K | NIST |
| Ttriple | 291.05 | K | ChemSep v8.3 pure component data |
| UQi | 9.06 | ChemSep v8.3 pure component data | |
| URi | 10.90 | ChemSep v8.3 pure component data | |
| Vc | 0.993 | m3/kmol | ChemSep v8.3 pure component data |
| Zc | 0.2290000 | ChemSep v8.3 pure component data |
Temperature Dependent Properties
Pressure Dependent Properties
| Property | Value | Unit | Pressure (kPa) | Source |
|---|---|---|---|---|
| Tboilr | 429.20 | K | 0.90 | NIST |
Datasets
Viscosity, Pa*s
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Viscosity, Pa*s - Liquid |
| 303.15 | 101.30 | 0.0035 |
| 303.15 | 20000.00 | 0.0044 |
| 303.15 | 40000.00 | 0.0055 |
| 313.15 | 101.30 | 0.0028 |
| 313.15 | 20000.00 | 0.0035 |
| 313.15 | 40000.00 | 0.0043 |
| 313.15 | 60000.00 | 0.0052 |
| 313.15 | 80000.00 | 0.0063 |
| 313.15 | 100000.00 | 0.0075 |
| 333.15 | 101.30 | 0.0019 |
| 333.15 | 20000.00 | 0.0024 |
| 333.15 | 40000.00 | 0.0029 |
| 333.15 | 60000.00 | 0.0035 |
| 333.15 | 80000.00 | 0.0041 |
| 333.15 | 100000.00 | 0.0048 |
| 353.15 | 101.30 | 0.0014 |
| 353.15 | 20000.00 | 0.0017 |
| 353.15 | 40000.00 | 0.0021 |
| 353.15 | 60000.00 | 0.0025 |
| 353.15 | 80000.00 | 0.0029 |
| 353.15 | 100000.00 | 0.0034 |
| Reference | ||
Speed of sound, m/s
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Temperature, K - Liquid | Speed of sound, m/s - Liquid |
| 100.00 | 303.15 | 1335.8 |
| 10000.00 | 303.15 | 1382.9 |
| 20000.00 | 303.15 | 1426.9 |
| 30000.00 | 303.15 | 1468.1 |
| 40000.00 | 303.15 | 1507.6 |
| 50000.00 | 303.15 | 1544.9 |
| 60000.00 | 303.15 | 1580.2 |
| 70000.00 | 303.15 | 1614.2 |
| 100.00 | 323.15 | 1264.0 |
| 10000.00 | 323.15 | 1316.4 |
| 20000.00 | 323.15 | 1364.8 |
| 30000.00 | 323.15 | 1409.6 |
| 40000.00 | 323.15 | 1451.9 |
| 50000.00 | 323.15 | 1492.5 |
| 60000.00 | 323.15 | 1530.5 |
| 70000.00 | 323.15 | 1566.8 |
| 80000.00 | 323.15 | 1601.2 |
| 100.00 | 343.15 | 1195.7 |
| 10000.00 | 343.15 | 1251.2 |
| 20000.00 | 343.15 | 1302.9 |
| 30000.00 | 343.15 | 1350.8 |
| 40000.00 | 343.15 | 1396.0 |
| 50000.00 | 343.15 | 1437.4 |
| 60000.00 | 343.15 | 1477.5 |
| 70000.00 | 343.15 | 1515.0 |
| 80000.00 | 343.15 | 1550.8 |
| 100.00 | 363.15 | 1130.9 |
| 10000.00 | 363.15 | 1190.4 |
| 20000.00 | 363.15 | 1245.2 |
| 30000.00 | 363.15 | 1295.9 |
| 40000.00 | 363.15 | 1342.5 |
| 50000.00 | 363.15 | 1385.7 |
| 60000.00 | 363.15 | 1426.7 |
| 70000.00 | 363.15 | 1465.5 |
| 80000.00 | 363.15 | 1502.6 |
| 100.00 | 383.15 | 1066.7 |
| 10000.00 | 383.15 | 1131.3 |
| 20000.00 | 383.15 | 1189.6 |
| 30000.00 | 383.15 | 1242.9 |
| 40000.00 | 383.15 | 1291.7 |
| 50000.00 | 383.15 | 1338.0 |
| 60000.00 | 383.15 | 1380.3 |
| 70000.00 | 383.15 | 1420.4 |
| 80000.00 | 383.15 | 1457.6 |
| 100.00 | 393.15 | 1036.2 |
| 10000.00 | 393.15 | 1103.6 |
| 20000.00 | 393.15 | 1163.5 |
| 30000.00 | 393.15 | 1217.8 |
| 40000.00 | 393.15 | 1267.7 |
| 50000.00 | 393.15 | 1314.4 |
| 60000.00 | 393.15 | 1357.8 |
| 70000.00 | 393.15 | 1397.8 |
| 80000.00 | 393.15 | 1436.8 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [366.16; 926.17] | J/mol×K | [298.15; 1500.00] |
ChemSep v8.3 pure component data
|
| Equation | Y = A + B·((C/T)/sinh(C/T))² + D·((E/T)/cosh(E/T))² Y is Cp,gas in J/mol×K, T in K | |||
| Coefficient A | 2.90830e+02 | |||
| Coefficient B | 5.57130e+02 | |||
| Coefficient C | 8.01000e+02 | |||
| Coefficient D | 3.39360e+02 | |||
| Coefficient E | 2.44740e+03 | |||
| Comment | ChemSep eq 107, IdealGasHeatCapacityCp | |||
| Temperature range, min. | 298.15 | |||
| Temperature range, max. | 1500.00 | |||
| Cp,gas | 366.16 | J/mol×K | 298.15 | Calculated Property |
| Cp,gas | 488.49 | J/mol×K | 431.69 | Calculated Property |
| Cp,gas | 592.09 | J/mol×K | 565.23 | Calculated Property |
| Cp,gas | 671.87 | J/mol×K | 698.77 | Calculated Property |
| Cp,gas | 736.26 | J/mol×K | 832.31 | Calculated Property |
| Cp,gas | 790.24 | J/mol×K | 965.84 | Calculated Property |
| Cp,gas | 835.61 | J/mol×K | 1099.38 | Calculated Property |
| Cp,gas | 873.01 | J/mol×K | 1232.92 | Calculated Property |
| Cp,gas | 902.97 | J/mol×K | 1366.46 | Calculated Property |
| Cp,gas | 926.17 | J/mol×K | 1500.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,liquid | [498.07; 651.99] | J/mol×K | [297.85; 569.90] |
ChemSep v8.3 pure component data
|
| Equation | Y = A + B·T + C·T² + D·T³ + E·T⁴ Y is Cp,liquid in J/mol×K, T in K | |||
| Coefficient A | 3.29560e+02 | |||
| Coefficient B | 5.65770e-01 | |||
| Coefficient C | 0.00000e+00 | |||
| Coefficient D | 0.00000e+00 | |||
| Coefficient E | 0.00000e+00 | |||
| Comment | ChemSep eq 100, LiquidHeatCapacityCp | |||
| Temperature range, min. | 297.85 | |||
| Temperature range, max. | 569.90 | |||
| Cp,liquid | 498.07 | J/mol×K | 297.85 | Calculated Property |
| Cp,liquid | 515.18 | J/mol×K | 328.08 | Calculated Property |
| Cp,liquid | 532.28 | J/mol×K | 358.31 | Calculated Property |
| Cp,liquid | 549.38 | J/mol×K | 388.53 | Calculated Property |
| Cp,liquid | 566.48 | J/mol×K | 418.76 | Calculated Property |
| Cp,liquid | 583.58 | J/mol×K | 448.99 | Calculated Property |
| Cp,liquid | 600.69 | J/mol×K | 479.22 | Calculated Property |
| Cp,liquid | 617.79 | J/mol×K | 509.44 | Calculated Property |
| Cp,liquid | 634.89 | J/mol×K | 539.67 | Calculated Property |
| Cp,liquid | 651.99 | J/mol×K | 569.90 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| η | [0.0046878; 0.0001820] | Pa×s | [291.85; 569.90] |
ChemSep v8.3 pure component data
|
| Equation | Y = exp(A + B/T + C·ln(T) + D·T^E) Y is η in Pa×s, T in K | |||
| Coefficient A | -1.20210e+01 | |||
| Coefficient B | 1.94320e+03 | |||
| Coefficient C | 0.00000e+00 | |||
| Coefficient D | 0.00000e+00 | |||
| Coefficient E | 0.00000e+00 | |||
| Comment | ChemSep eq 101, LiquidViscosity | |||
| Temperature range, min. | 291.85 | |||
| Temperature range, max. | 569.90 | |||
| η | 0.0046878 | Pa×s | 291.85 | Calculated Property |
| η | 0.0024784 | Pa×s | 322.74 | Calculated Property |
| η | 0.0014647 | Pa×s | 353.64 | Calculated Property |
| η | 0.0009419 | Pa×s | 384.53 | Calculated Property |
| η | 0.0006468 | Pa×s | 415.43 | Calculated Property |
| η | 0.0004679 | Pa×s | 446.32 | Calculated Property |
| η | 0.0003530 | Pa×s | 477.22 | Calculated Property |
| η | 0.0002756 | Pa×s | 508.11 | Calculated Property |
| η | 0.0002213 | Pa×s | 539.01 | Calculated Property |
| η | 0.0001820 | Pa×s | 569.90 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| ΔvapH | [82.90; 0.00] | kJ/mol | [291.85; 741.20] |
ChemSep v8.3 pure component data
|
| Equation | Y = A·(1 − Tr)^(B + C·Tr + D·Tr² + E·Tr³), Tr = T/Tc Y is ΔvapH in kJ/mol, T in K | |||
| Coefficient A | 1.15120e+02 | |||
| Coefficient B | 9.83000e-01 | |||
| Coefficient C | -1.05800e+00 | |||
| Coefficient D | 5.78000e-01 | |||
| Coefficient E | 0.00000e+00 | |||
| Critical temperature, Tc (K) | 7.41200e+02 | |||
| Comment | ChemSep eq 106, HeatOfVaporization | |||
| Temperature range, min. | 291.85 | |||
| Temperature range, max. | 741.20 | |||
| ΔvapH | 82.90 | kJ/mol | 291.85 | Calculated Property |
| ΔvapH | 78.56 | kJ/mol | 341.78 | Calculated Property |
| ΔvapH | 74.14 | kJ/mol | 391.71 | Calculated Property |
| ΔvapH | 69.45 | kJ/mol | 441.63 | Calculated Property |
| ΔvapH | 64.27 | kJ/mol | 491.56 | Calculated Property |
| ΔvapH | 58.32 | kJ/mol | 541.49 | Calculated Property |
| ΔvapH | 51.19 | kJ/mol | 591.42 | Calculated Property |
| ΔvapH | 42.23 | kJ/mol | 641.34 | Calculated Property |
| ΔvapH | 29.96 | kJ/mol | 691.27 | Calculated Property |
| ΔvapH | 0.00 | kJ/mol | 741.20 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [3.97e-05; 1428.54] | kPa | [291.85; 741.20] |
ChemSep v8.3 pure component data
|
| Equation | Y = exp(A + B/T + C·ln(T) + D·T^E) Y is Pvap in kPa, T in K | |||
| Coefficient A | 9.70922e+01 | |||
| Coefficient B | -1.31790e+04 | |||
| Coefficient C | -1.09350e+01 | |||
| Coefficient D | 1.29200e-18 | |||
| Coefficient E | 6.00000e+00 | |||
| Comment | ChemSep eq 101, VaporPressure | |||
| Temperature range, min. | 291.85 | |||
| Temperature range, max. | 741.20 | |||
| Pvap | 3.97e-05 | kPa | 291.85 | Calculated Property |
| Pvap | 5.18e-03 | kPa | 341.78 | Calculated Property |
| Pvap | 0.16 | kPa | 391.71 | Calculated Property |
| Pvap | 1.94 | kPa | 441.63 | Calculated Property |
| Pvap | 12.55 | kPa | 491.56 | Calculated Property |
| Pvap | 52.35 | kPa | 541.49 | Calculated Property |
| Pvap | 159.32 | kPa | 591.42 | Calculated Property |
| Pvap | 385.30 | kPa | 641.34 | Calculated Property |
| Pvap | 788.01 | kPa | 691.27 | Calculated Property |
| Pvap | 1428.54 | kPa | 741.20 | Calculated Property |
| Pvap | [1.67; 21.91] | kPa | [439.00; 511.00] |
NIST
|
| Equation | ln(Y) = A + B/(T + C) Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.29551e+01 | |||
| Coefficient B | -3.43732e+03 | |||
| Coefficient C | -1.62674e+02 | |||
| Reference | Rose and Supina, 1961 | |||
| Comment | Coefficents calculated by NIST from author's data. | |||
| Temperature range, min. | 439.00 | |||
| Temperature range, max. | 511.00 | |||
| Pvap | 1.67 | kPa | 439.00 | Calculated Property |
| Pvap | 2.38 | kPa | 447.00 | Calculated Property |
| Pvap | 3.31 | kPa | 455.00 | Calculated Property |
| Pvap | 4.53 | kPa | 463.00 | Calculated Property |
| Pvap | 6.09 | kPa | 471.00 | Calculated Property |
| Pvap | 8.07 | kPa | 479.00 | Calculated Property |
| Pvap | 10.56 | kPa | 487.00 | Calculated Property |
| Pvap | 13.62 | kPa | 495.00 | Calculated Property |
| Pvap | 17.37 | kPa | 503.00 | Calculated Property |
| Pvap | 21.91 | kPa | 511.00 | Calculated Property |
| Pvap | [0.27; 8.05] | kPa | [400.30; 481.40] |
NIST
|
| Equation | ln(Y) = A + B/(T + C) Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.91997e+01 | |||
| Coefficient B | -8.36135e+03 | |||
| Coefficient C | 7.15300e+00 | |||
| Reference | Bonhorst, Althouse, et al., 1948 | |||
| Comment | Coefficents calculated by NIST from author's data. | |||
| Temperature range, min. | 400.30 | |||
| Temperature range, max. | 481.40 | |||
| Pvap | 0.27 | kPa | 400.30 | Calculated Property |
| Pvap | 0.42 | kPa | 409.31 | Calculated Property |
| Pvap | 0.64 | kPa | 418.32 | Calculated Property |
| Pvap | 0.96 | kPa | 427.33 | Calculated Property |
| Pvap | 1.41 | kPa | 436.34 | Calculated Property |
| Pvap | 2.06 | kPa | 445.36 | Calculated Property |
| Pvap | 2.95 | kPa | 454.37 | Calculated Property |
| Pvap | 4.18 | kPa | 463.38 | Calculated Property |
| Pvap | 5.83 | kPa | 472.39 | Calculated Property |
| Pvap | 8.05 | kPa | 481.40 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| ρl | [867.80; 244.35] | kg/m3 | [291.85; 741.20] |
ChemSep v8.3 pure component data
|
| Equation | Y = A / B^(1 + (1 − T/C)^D) Y is ρl in kg/m3, T in K | |||
| Coefficient A | 5.58921e+01 | |||
| Coefficient B | 2.28740e-01 | |||
| Coefficient C | 7.41200e+02 | |||
| Coefficient D | 3.03370e-01 | |||
| Comment | ChemSep eq 105, LiquidDensity | |||
| Temperature range, min. | 291.85 | |||
| Temperature range, max. | 741.20 | |||
| ρl | 867.80 | kg/m3 | 291.85 | Calculated Property |
| ρl | 830.04 | kg/m3 | 341.78 | Calculated Property |
| ρl | 790.71 | kg/m3 | 391.71 | Calculated Property |
| ρl | 749.40 | kg/m3 | 441.63 | Calculated Property |
| ρl | 705.55 | kg/m3 | 491.56 | Calculated Property |
| ρl | 658.24 | kg/m3 | 541.49 | Calculated Property |
| ρl | 605.92 | kg/m3 | 591.42 | Calculated Property |
| ρl | 545.46 | kg/m3 | 641.34 | Calculated Property |
| ρl | 468.41 | kg/m3 | 691.27 | Calculated Property |
| ρl | 244.35 | kg/m3 | 741.20 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| λ | [0.02; 0.05] | W/m×K | [569.90; 1000.00] |
ChemSep v8.3 pure component data
|
| Equation | Y = A·T^B / (1 + C/T + D/T²) Y is λ in W/m×K, T in K | |||
| Coefficient A | 2.29680e-06 | |||
| Coefficient B | 1.45620e+00 | |||
| Coefficient C | 0.00000e+00 | |||
| Coefficient D | 0.00000e+00 | |||
| Comment | ChemSep eq 102, VaporThermalConductivity | |||
| Temperature range, min. | 569.90 | |||
| Temperature range, max. | 1000.00 | |||
| λ | 0.02 | W/m×K | 569.90 | Calculated Property |
| λ | 0.03 | W/m×K | 617.69 | Calculated Property |
| λ | 0.03 | W/m×K | 665.48 | Calculated Property |
| λ | 0.03 | W/m×K | 713.27 | Calculated Property |
| λ | 0.04 | W/m×K | 761.06 | Calculated Property |
| λ | 0.04 | W/m×K | 808.84 | Calculated Property |
| λ | 0.04 | W/m×K | 856.63 | Calculated Property |
| λ | 0.05 | W/m×K | 904.42 | Calculated Property |
| λ | 0.05 | W/m×K | 952.21 | Calculated Property |
| λ | 0.05 | W/m×K | 1000.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| λ | [0.14; 0.09] | W/m×K | [291.85; 569.90] |
ChemSep v8.3 pure component data
|
| Equation | Y = A + B·T + C·T² + D·T³ + E·T⁴ Y is λ in W/m×K, T in K | |||
| Coefficient A | 1.99060e-01 | |||
| Coefficient B | -1.96900e-04 | |||
| Coefficient C | 0.00000e+00 | |||
| Coefficient D | 0.00000e+00 | |||
| Coefficient E | 0.00000e+00 | |||
| Comment | ChemSep eq 100, LiquidThermalConductivity | |||
| Temperature range, min. | 291.85 | |||
| Temperature range, max. | 569.90 | |||
| λ | 0.14 | W/m×K | 291.85 | Calculated Property |
| λ | 0.14 | W/m×K | 322.74 | Calculated Property |
| λ | 0.13 | W/m×K | 353.64 | Calculated Property |
| λ | 0.12 | W/m×K | 384.53 | Calculated Property |
| λ | 0.12 | W/m×K | 415.43 | Calculated Property |
| λ | 0.11 | W/m×K | 446.32 | Calculated Property |
| λ | 0.11 | W/m×K | 477.22 | Calculated Property |
| λ | 0.10 | W/m×K | 508.11 | Calculated Property |
| λ | 0.09 | W/m×K | 539.01 | Calculated Property |
| λ | 0.09 | W/m×K | 569.90 | Calculated Property |
Similar Compounds
Find more compounds similar to Methyl tetradecanoate.
Mixtures
- Glycerin + Methyl tetradecanoate + Methyl Alcohol
- Methyl tetradecanoate + Methyl Alcohol
- Hexadecanoic acid, methyl ester + Methyl tetradecanoate
- Tetradecane + Methyl tetradecanoate
- Pentadecane + Methyl tetradecanoate
- Hexadecane + Methyl tetradecanoate
- Cyclohexane, methyl- + Methyl tetradecanoate
- Ethane + Methyl tetradecanoate
- Glycerin + Methyl tetradecanoate + Water
- 1-Hexadecanol + Methyl tetradecanoate
- 9-Octadecenoic acid (Z)-, methyl ester + Hexadecanoic acid, methyl ester + Methyl tetradecanoate
- Ethanol + Glycerin + Methyl tetradecanoate
Sources
- Cheméo Relay (1.0)
- ChemSep v8.3 pure component data Converted from ChemSep v8.3 pure component data, H. Kooijman and R. Taylor (2021, 2022), Artistic License 2.0; see how the values differ.
- Crippen Method
- Crippen Method
- Measurement and correlation of vapor liquid equilibria for methanol + methyl laurate and methanol + methyl myristate systems near critical temperature of methanol
- Phase behaviour of high molecular mass methyl esters in supercritical ethane
- Vapor-liquid critical point measurements of fifteen compounds by the pulse-heating method
- Isobaric vapor liquid equilibrium for binary system of methyl myristate + methyl palmitate at 0.5, 1.0 and 1.4 kPa
- Isobaric vapor-liquid equilibrium for the three binary systems of C14 - C16 n-alkane + methyl myristate at 5.00 kPa
- Measurement and correlation of ternary vapor-liquid equilibria for methanol + glycerol + fatty acid methyl ester (methyl laurate, methyl myristate, methyl palmitate) systems at elevated temperatures and pressures
- Experimental vapor pressures (from 1 Pa to 100 kPa) of six saturated Fatty Acid Methyl Esters (FAMEs): Methyl hexanoate, methyl octanoate, methyl decanoate, methyl dodecanoate, methyl tetradecanoate and methyl hexadecanoate
- Experimental studies on the liquid thermal conductivity of three saturated fatty acid methyl esters components of biodiesel
- Fatty acids methyl esters: Complementary measurements and comprehensive analysis of vaporization thermodynamics
- Thermophysical properties of fatty acid methyl and ethyl esters
- Measurement and correlation of density and viscosity of binary mixtures of fatty acid (methyl esters + methylcyclohexane)
- the vaporization enthaplies and vapor pressures of a series of unstaurated fatty acid methyl esters by correlation gas chromatography
- Vapor liquid equilibrium of fatty acid ethyl esters determined using DSC
- Viscosities of Fatty Acid Methyl and Ethyl Esters under High Pressure: Methyl Myristate and Ethyl Myristate
- Liquid Liquid Equilibrium for the Ternary System of Methyl Laurate/Methyl Myristate + Ethanol + Glycerol at 318.15 and 333.15 K
- Isothermal Vapor Pressures of Three Binary Systems: n-Tetradecane + Methyl Dodecanoate, Methyl Tetradecanoate, or Methyl Hexadecanoate between 353.15 and 453.15 K
- Vapor-Liquid Equilibria of Binary Systems with Long-Chain Organic Compounds (Fatty Alcohol, Fatty Ester, Acylglycerol, and n-Paraffin) at Subatmospheric Pressures
- Liquid-Liquid Equilibria for Ternary Mixtures of gamma-Valerolactone + n-Tetradecane + (Butanoic Acid or Hexanoic Acid or Methyl Myristate) at 298.15 K
- Heat Capacity Measurements of 13 Methyl Esters of n-Carboxylic Acids from Methyloctanoate to Methyleicosanoate between 5 K and 350 K
- Densities and Viscosities of Fatty Acid Methyl and Ethyl Esters
- Isobaric Vapor Liquid Equilibrium of the Mixture of Methyl Palmitate and Methyl Stearate at 0.1 kPa, 1 kPa, 5 kPa, and 10 kPa
- Article Ternary Liquid Liquid Equilibrium of Biodiesel Compounds for Systems Consisting of a Methyl Ester + Glycerin + Water
- Speed of Sound, Density, and Derivative Properties of Ethyl Myristate, Methyl Myristate, and Methyl Palmitate under High Pressure
- Group Contribution Model for Predicting Viscosity of Fatty Compounds
- Viscosities of Fatty Mixtures: Experimental Data and Prediction
- McGowan Method
- NIST Webbook
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.
These property values are available through the Cheméo API. A free account gives you an access key.