- Name
- Ethanol
- InChI
- InChI=1S/C2H6O/c1-2-3/h3H,2H2,1H3
- InChI Key
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N
- Formula
- C2H6O
- SMILES
- CCO
- Mol. Weight (g/mol)
- 46.07
- CAS
- 64-17-5
- Name
- Acetone
- InChI
- InChI=1S/C3H6O/c1-3(2)4/h1-2H3
- InChI Key
- CSCPPACGZOOCGX-UHFFFAOYSA-N
- Formula
- C3H6O
- SMILES
- CC(C)=O
- Mol. Weight (g/mol)
- 58.08
- CAS
- 67-64-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (3)
- η - Viscosity, Pa*s
- Excess molar enthalpy (molar enthalpy
- n0 - Refractive index (Na D-line)
- ρl - Mass density, kg/m3
- Tboil - Boiling temperature at pressure P, K (3)
- Vapor Liquid Equilibrium at Constant Pressure
- Vapor Liquid Equilibrium at Constant Temperature (2)
Mole fraction of Acetone (2) [ref]
Operational condition: Pressure, kPa = 101.32 (Liquid)
| Mole fraction of Acetone (2) - Liquid | Mole fraction of Acetone (2) - Gas |
|---|---|
| 0.0000 | 0.0000 |
| 0.0440 | 0.1290 |
| 0.0850 | 0.2320 |
| 0.1320 | 0.3250 |
| 0.1750 | 0.4030 |
| 0.2270 | 0.4630 |
| 0.2760 | 0.5170 |
| 0.3280 | 0.5710 |
| 0.3800 | 0.6090 |
| 0.4330 | 0.6510 |
| 0.4810 | 0.6850 |
| 0.5380 | 0.7190 |
| 0.5860 | 0.7490 |
| 0.6390 | 0.7770 |
| 0.6880 | 0.8030 |
| 0.7450 | 0.8350 |
| 0.7960 | 0.8670 |
| 0.8490 | 0.8980 |
| 0.9010 | 0.9290 |
| 0.9510 | 0.9650 |
| 1.0000 | 1.0000 |
Mole fraction of Acetone (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Acetone (2) - Liquid | Mole fraction of Acetone (2) - Gas |
|---|---|
| 1.0000 | 1.0000 |
| 0.8910 | 0.9330 |
| 0.7430 | 0.8420 |
| 0.6590 | 0.7900 |
| 0.5640 | 0.7350 |
| 0.4950 | 0.6800 |
| 0.4020 | 0.6240 |
| 0.3260 | 0.5600 |
| 0.2400 | 0.4740 |
| 0.1660 | 0.3910 |
| 0.1100 | 0.2910 |
| 0.0760 | 0.2270 |
| 0.0000 | 0.0000 |
Mole fraction of Acetone (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Acetone (2) - Liquid | Temperature, K - Liquid | Mole fraction of Acetone (2) - Gas |
| 0.0000 | 351.55 | 0.0000 |
| 0.0714 | 348.20 | 0.2086 |
| 0.1480 | 345.35 | 0.3438 |
| 0.2107 | 343.25 | 0.4312 |
| 0.3242 | 339.90 | 0.5504 |
| 0.3928 | 338.35 | 0.6107 |
| 0.5016 | 336.05 | 0.6872 |
| 0.6343 | 333.80 | 0.7699 |
| 0.7779 | 331.80 | 0.8571 |
| 0.8977 | 330.30 | 0.9346 |
| 1.0000 | 329.35 | 1.0000 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 100.8 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetone (2) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0000 | 0.0013 |
| 288.15 | 0.0500 | 0.0011 |
| 288.15 | 0.1000 | 0.0010 |
| 288.15 | 0.1500 | 0.0009 |
| 288.15 | 0.2000 | 0.0008 |
| 288.15 | 0.2500 | 0.0007 |
| 288.15 | 0.3000 | 0.0006 |
| 288.15 | 0.3500 | 0.0006 |
| 288.15 | 0.4000 | 0.0006 |
| 288.15 | 0.4500 | 0.0005 |
| 288.15 | 0.4999 | 0.0005 |
| 288.15 | 0.5500 | 0.0005 |
| 288.15 | 0.6000 | 0.0004 |
| 288.15 | 0.6500 | 0.0004 |
| 288.15 | 0.7000 | 0.0004 |
| 288.15 | 0.7500 | 0.0004 |
| 288.15 | 0.8000 | 0.0004 |
| 288.15 | 0.8501 | 0.0004 |
| 288.15 | 0.9000 | 0.0004 |
| 288.15 | 0.9500 | 0.0003 |
| 288.15 | 1.0000 | 0.0003 |
| 298.15 | 0.0000 | 0.0011 |
| 298.15 | 0.0500 | 0.0009 |
| 298.15 | 0.1000 | 0.0008 |
| 298.15 | 0.1500 | 0.0007 |
| 298.15 | 0.2000 | 0.0007 |
| 298.15 | 0.2500 | 0.0006 |
| 298.15 | 0.3000 | 0.0006 |
| 298.15 | 0.3500 | 0.0005 |
| 298.15 | 0.4000 | 0.0005 |
| 298.15 | 0.4500 | 0.0005 |
| 298.15 | 0.4999 | 0.0004 |
| 298.15 | 0.5500 | 0.0004 |
| 298.15 | 0.6000 | 0.0004 |
| 298.15 | 0.6500 | 0.0004 |
| 298.15 | 0.7000 | 0.0004 |
| 298.15 | 0.7500 | 0.0003 |
| 298.15 | 0.8000 | 0.0003 |
| 298.15 | 0.8501 | 0.0003 |
| 298.15 | 0.9000 | 0.0003 |
| 298.15 | 0.9500 | 0.0003 |
| 298.15 | 1.0000 | 0.0003 |
| 308.15 | 0.0000 | 0.0009 |
| 308.15 | 0.0500 | 0.0008 |
| 308.15 | 0.1000 | 0.0007 |
| 308.15 | 0.1500 | 0.0006 |
| 308.15 | 0.2000 | 0.0006 |
| 308.15 | 0.2500 | 0.0005 |
| 308.15 | 0.3000 | 0.0005 |
| 308.15 | 0.3500 | 0.0005 |
| 308.15 | 0.4000 | 0.0004 |
| 308.15 | 0.4500 | 0.0004 |
| 308.15 | 0.4999 | 0.0004 |
| 308.15 | 0.5500 | 0.0004 |
| 308.15 | 0.6000 | 0.0003 |
| 308.15 | 0.6500 | 0.0003 |
| 308.15 | 0.7000 | 0.0003 |
| 308.15 | 0.7500 | 0.0003 |
| 308.15 | 0.8000 | 0.0003 |
| 308.15 | 0.8501 | 0.0003 |
| 308.15 | 0.9000 | 0.0003 |
| 308.15 | 0.9500 | 0.0003 |
| 308.15 | 1.0000 | 0.0003 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 323.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Ethanol (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0500 | 0.2550 |
| 0.1020 | 0.4830 |
| 0.1500 | 0.6520 |
| 0.2000 | 0.8050 |
| 0.2520 | 0.9280 |
| 0.3000 | 1.018 |
| 0.3520 | 1.085 |
| 0.4000 | 1.124 |
| 0.4520 | 1.144 |
| 0.5010 | 1.139 |
| 0.5510 | 1.109 |
| 0.6000 | 1.066 |
| 0.6500 | 1.005 |
| 0.7020 | 0.9190 |
| 0.7520 | 0.8180 |
| 0.8000 | 0.7010 |
| 0.8500 | 0.5600 |
| 0.9010 | 0.3920 |
| 0.9500 | 0.2110 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 100.8 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetone (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 288.15 | 0.0000 | 1.3634 |
| 288.15 | 0.0500 | 1.3635 |
| 288.15 | 0.1000 | 1.3636 |
| 288.15 | 0.1500 | 1.3637 |
| 288.15 | 0.2000 | 1.3636 |
| 288.15 | 0.2500 | 1.3636 |
| 288.15 | 0.3000 | 1.3635 |
| 288.15 | 0.3500 | 1.3634 |
| 288.15 | 0.4000 | 1.3633 |
| 288.15 | 0.4500 | 1.3632 |
| 288.15 | 0.4999 | 1.3631 |
| 288.15 | 0.5500 | 1.363 |
| 288.15 | 0.6000 | 1.3629 |
| 288.15 | 0.6500 | 1.3627 |
| 288.15 | 0.7000 | 1.3626 |
| 288.15 | 0.7500 | 1.3625 |
| 288.15 | 0.8000 | 1.3623 |
| 288.15 | 0.8501 | 1.3621 |
| 288.15 | 0.9000 | 1.362 |
| 288.15 | 0.9500 | 1.3618 |
| 288.15 | 1.0000 | 1.3615 |
| 298.15 | 0.0000 | 1.3592 |
| 298.15 | 0.0500 | 1.3592 |
| 298.15 | 0.1000 | 1.3592 |
| 298.15 | 0.1500 | 1.3591 |
| 298.15 | 0.2000 | 1.359 |
| 298.15 | 0.2500 | 1.3589 |
| 298.15 | 0.3000 | 1.3587 |
| 298.15 | 0.3500 | 1.3586 |
| 298.15 | 0.4000 | 1.3584 |
| 298.15 | 0.4500 | 1.3583 |
| 298.15 | 0.4999 | 1.3581 |
| 298.15 | 0.5500 | 1.3579 |
| 298.15 | 0.6000 | 1.3577 |
| 298.15 | 0.6500 | 1.3575 |
| 298.15 | 0.7000 | 1.3573 |
| 298.15 | 0.7500 | 1.3571 |
| 298.15 | 0.8000 | 1.3569 |
| 298.15 | 0.8501 | 1.3567 |
| 298.15 | 0.9000 | 1.3565 |
| 298.15 | 0.9500 | 1.3563 |
| 298.15 | 1.0000 | 1.356 |
| 308.15 | 0.0000 | 1.355 |
| 308.15 | 0.0500 | 1.3549 |
| 308.15 | 0.1000 | 1.3547 |
| 308.15 | 0.1500 | 1.3545 |
| 308.15 | 0.2000 | 1.3543 |
| 308.15 | 0.2500 | 1.3541 |
| 308.15 | 0.3000 | 1.3539 |
| 308.15 | 0.3500 | 1.3537 |
| 308.15 | 0.4000 | 1.3535 |
| 308.15 | 0.4500 | 1.3532 |
| 308.15 | 0.4999 | 1.353 |
| 308.15 | 0.5500 | 1.3528 |
| 308.15 | 0.6000 | 1.3525 |
| 308.15 | 0.6500 | 1.3523 |
| 308.15 | 0.7000 | 1.352 |
| 308.15 | 0.7500 | 1.3518 |
| 308.15 | 0.8000 | 1.3515 |
| 308.15 | 0.8501 | 1.3513 |
| 308.15 | 0.9000 | 1.351 |
| 308.15 | 0.9500 | 1.3508 |
| 308.15 | 1.0000 | 1.3506 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100.8 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetone (2) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 793.74 |
| 288.15 | 0.0500 | 794.4 |
| 288.15 | 0.1000 | 794.86 |
| 288.15 | 0.1500 | 795.23 |
| 288.15 | 0.2000 | 795.5 |
| 288.15 | 0.2500 | 795.75 |
| 288.15 | 0.3000 | 795.99 |
| 288.15 | 0.3500 | 796.18 |
| 288.15 | 0.4000 | 796.34 |
| 288.15 | 0.4500 | 796.46 |
| 288.15 | 0.4999 | 796.57 |
| 288.15 | 0.5500 | 796.68 |
| 288.15 | 0.6000 | 796.77 |
| 288.15 | 0.6500 | 796.84 |
| 288.15 | 0.7000 | 796.86 |
| 288.15 | 0.7500 | 796.88 |
| 288.15 | 0.8000 | 796.91 |
| 288.15 | 0.8501 | 796.9 |
| 288.15 | 0.9000 | 796.92 |
| 288.15 | 0.9500 | 796.91 |
| 288.15 | 1.0000 | 796.87 |
| 298.15 | 0.0000 | 785.17 |
| 298.15 | 0.0500 | 785.59 |
| 298.15 | 0.1000 | 785.84 |
| 298.15 | 0.1500 | 786.0 |
| 298.15 | 0.2000 | 786.08 |
| 298.15 | 0.2500 | 786.16 |
| 298.15 | 0.3000 | 786.23 |
| 298.15 | 0.3500 | 786.24 |
| 298.15 | 0.4000 | 786.23 |
| 298.15 | 0.4500 | 786.21 |
| 298.15 | 0.4999 | 786.19 |
| 298.15 | 0.5500 | 786.17 |
| 298.15 | 0.6000 | 786.13 |
| 298.15 | 0.6500 | 786.07 |
| 298.15 | 0.7000 | 786.0 |
| 298.15 | 0.7500 | 785.9 |
| 298.15 | 0.8000 | 785.84 |
| 298.15 | 0.8501 | 785.73 |
| 298.15 | 0.9000 | 785.66 |
| 298.15 | 0.9500 | 785.57 |
| 298.15 | 1.0000 | 785.47 |
| 308.15 | 0.0000 | 776.49 |
| 308.15 | 0.0500 | 776.66 |
| 308.15 | 0.1000 | 776.66 |
| 308.15 | 0.1500 | 776.61 |
| 308.15 | 0.2000 | 776.53 |
| 308.15 | 0.2500 | 776.41 |
| 308.15 | 0.3000 | 776.28 |
| 308.15 | 0.3500 | 776.12 |
| 308.15 | 0.4000 | 775.96 |
| 308.15 | 0.4500 | 775.79 |
| 308.15 | 0.4999 | 775.63 |
| 308.15 | 0.5500 | 775.47 |
| 308.15 | 0.6000 | 775.3 |
| 308.15 | 0.6500 | 775.13 |
| 308.15 | 0.7000 | 774.96 |
| 308.15 | 0.7500 | 774.77 |
| 308.15 | 0.8000 | 774.59 |
| 308.15 | 0.8501 | 774.4 |
| 308.15 | 0.9000 | 774.23 |
| 308.15 | 0.9500 | 774.08 |
| 308.15 | 1.0000 | 773.91 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.32 (Liquid)
| Mole fraction of Acetone (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 351.44 |
| 0.0440 | 348.91 |
| 0.0850 | 346.65 |
| 0.1320 | 344.53 |
| 0.1750 | 342.69 |
| 0.2270 | 341.17 |
| 0.2760 | 339.81 |
| 0.3280 | 338.39 |
| 0.3800 | 337.32 |
| 0.4330 | 336.24 |
| 0.4810 | 335.37 |
| 0.5380 | 334.51 |
| 0.5860 | 333.78 |
| 0.6390 | 333.06 |
| 0.6880 | 332.43 |
| 0.7450 | 331.81 |
| 0.7960 | 331.20 |
| 0.8490 | 330.66 |
| 0.9010 | 330.17 |
| 0.9510 | 329.69 |
| 1.0000 | 329.26 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Acetone (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 1.0000 | 329.37 |
| 0.8910 | 330.15 |
| 0.7430 | 331.71 |
| 0.6590 | 332.80 |
| 0.5640 | 334.09 |
| 0.4950 | 335.31 |
| 0.4020 | 336.88 |
| 0.3260 | 338.49 |
| 0.2400 | 340.68 |
| 0.1660 | 343.14 |
| 0.1100 | 345.41 |
| 0.0760 | 346.97 |
| 0.0000 | 351.45 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Acetone (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 351.55 |
| 0.0714 | 348.20 |
| 0.1480 | 345.35 |
| 0.2107 | 343.25 |
| 0.3242 | 339.90 |
| 0.3928 | 338.35 |
| 0.5016 | 336.05 |
| 0.6343 | 333.80 |
| 0.7779 | 331.80 |
| 0.8977 | 330.30 |
| 1.0000 | 329.35 |
Vapor Liquid Equilibrium at Constant Pressure [ref]
Operational condition: Pressure, kPa = 101.33 (VLE)
| Fixed | Measured | |
|---|---|---|
| T [K] - VLE | x1[mol/mol] of Acetone (2) - Liquid | y1[mol/mol] of Acetone (2) - Vapour |
| 351.45 | 0.0000 | 0.0000 |
| 349.55 | 0.0330 | 0.1110 |
| 347.15 | 0.0780 | 0.2160 |
| 343.95 | 0.1490 | 0.3450 |
| 342.25 | 0.1950 | 0.4100 |
| 338.75 | 0.3160 | 0.5340 |
| 336.55 | 0.4140 | 0.6140 |
| 334.45 | 0.5320 | 0.6970 |
| 332.15 | 0.6910 | 0.7960 |
| 330.45 | 0.8520 | 0.8960 |
| 329.25 | 1.0000 | 1.0000 |
Vapor Liquid Equilibrium at Constant Temperature [ref]
Operational condition: Temperature, K = 305.15 (VLE)
| P [kPa] - VLE | x1[mol/mol] of Acetone (2) - Liquid |
|---|---|
| 11.679 | 0.0000 |
| 14.999 | 0.0422 |
| 16.585 | 0.0673 |
| 19.358 | 0.1130 |
| 22.571 | 0.1787 |
| 24.811 | 0.2361 |
| 25.585 | 0.2665 |
| 27.384 | 0.3128 |
| 28.371 | 0.3470 |
| 31.037 | 0.4458 |
| 33.037 | 0.5372 |
| 35.37 | 0.6548 |
| 37.584 | 0.7721 |
| 38.89 | 0.8474 |
| 40.13 | 0.9252 |
| 41.317 | 1.0000 |
Vapor Liquid Equilibrium at Constant Temperature [ref]
Operational condition: Temperature, K = 313.15 (VLE)
| P [kPa] - VLE | x1[mol/mol] of Acetone (2) - Liquid |
|---|---|
| 17.892 | 0.0000 |
| 21.612 | 0.0389 |
| 22.012 | 0.0446 |
| 24.531 | 0.0765 |
| 29.211 | 0.1409 |
| 32.011 | 0.1883 |
| 36.037 | 0.2683 |
| 39.037 | 0.3406 |
| 42.463 | 0.4355 |
| 45.41 | 0.5315 |
| 48.796 | 0.6528 |
| 51.729 | 0.7727 |
| 53.716 | 0.8593 |
| 54.689 | 0.9038 |
| 56.649 | 1.0000 |
Sources
- Dortmund Data Bank Vapor-Liquid Equilibrium Data
- Isobaric vapor liquid equilibria for mixtures of acetone, ethanol, and 2,2,4-trimethylpentane at 101.3 kPa
- Isobaric Vapor Liquid Equilibrium for Nine Binary Systems of Cracking C5 Fraction at 250 kPa
- Excess Molar Enthalpies for Binary Mixtures of Ethanol + Acetone, + Octane, + Cyclohexane and 1-Propanol + Acetone, + Octane, + Heptane at 323.15
- Densities, Refractive indices and Viscosities for Binary and Ternary Mixtures of Acetone, Ethanol and 2,2,4-Trimethylpentane at T = (288.15, 298.15, and 308.15) K
- Vapor Liquid Equilibrium for the 1,1,1-Trifluorotrichloroethane + Sulfuryl Chloride System at 101.3 kPa
Note: These property values are available through the Cheméo API. A free account gives you an access key.