- Name
- 2-Propanol
- InChI
- InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3
- InChI Key
- KFZMGEQAYNKOFK-UHFFFAOYSA-N
- Formula
- C3H8O
- SMILES
- CC(C)O
- Mol. Weight (g/mol)
- 60.10
- CAS
- 67-63-0
- Name
- Tetrahydrofuran
- InChI
- InChI=1S/C4H8O/c1-2-4-5-3-1/h1-4H2
- InChI Key
- WYURNTSHIVDZCO-UHFFFAOYSA-N
- Formula
- C4H8O
- SMILES
- C1CCOC1
- Mol. Weight (g/mol)
- 72.11
- CAS
- 109-99-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line)
- ρl - Mass density, kg/m3
- csound,fluid - Speed of Sound, m/s
- γ - Surface tension liquid-gas, N/m
- Vapor Liquid Equilibrium at Constant Pressure (3)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Tetrahydrofuran (2) - Liquid | Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
| 0.0000 | 293.00 | 0.0021 |
| 0.0000 | 303.00 | 0.0015 |
| 0.0000 | 313.00 | 0.0011 |
| 0.0983 | 293.00 | 0.0016 |
| 0.0983 | 303.00 | 0.0011 |
| 0.0983 | 313.00 | 0.0009 |
| 0.2085 | 293.00 | 0.0013 |
| 0.2085 | 303.00 | 0.0009 |
| 0.2085 | 313.00 | 0.0007 |
| 0.2911 | 293.00 | 0.0011 |
| 0.2911 | 303.00 | 0.0007 |
| 0.2911 | 313.00 | 0.0006 |
| 0.3728 | 293.00 | 0.0009 |
| 0.3728 | 303.00 | 0.0006 |
| 0.3728 | 313.00 | 0.0005 |
| 0.5014 | 293.00 | 0.0008 |
| 0.5014 | 303.00 | 0.0006 |
| 0.5014 | 313.00 | 0.0005 |
| 0.5976 | 293.00 | 0.0007 |
| 0.5976 | 303.00 | 0.0005 |
| 0.5976 | 313.00 | 0.0005 |
| 0.7483 | 293.00 | 0.0006 |
| 0.7483 | 303.00 | 0.0005 |
| 0.7483 | 313.00 | 0.0004 |
| 0.8001 | 293.00 | 0.0006 |
| 0.8001 | 303.00 | 0.0005 |
| 0.8001 | 313.00 | 0.0004 |
| 0.8939 | 293.00 | 0.0005 |
| 0.8939 | 303.00 | 0.0004 |
| 0.8939 | 313.00 | 0.0004 |
| 1.0000 | 293.00 | 0.0005 |
| 1.0000 | 303.00 | 0.0004 |
| 1.0000 | 313.00 | 0.0004 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetrahydrofuran (2) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0000 | 0.0028 |
| 288.15 | 0.0500 | 0.0022 |
| 288.15 | 0.1000 | 0.0018 |
| 288.15 | 0.1500 | 0.0016 |
| 288.15 | 0.2001 | 0.0014 |
| 288.15 | 0.2500 | 0.0012 |
| 288.15 | 0.3000 | 0.0011 |
| 288.15 | 0.3500 | 0.0010 |
| 288.15 | 0.4000 | 0.0009 |
| 288.15 | 0.4500 | 0.0008 |
| 288.15 | 0.5000 | 0.0008 |
| 288.15 | 0.5500 | 0.0007 |
| 288.15 | 0.6000 | 0.0007 |
| 288.15 | 0.6500 | 0.0006 |
| 288.15 | 0.7000 | 0.0006 |
| 288.15 | 0.7500 | 0.0006 |
| 288.15 | 0.8000 | 0.0006 |
| 288.15 | 0.8500 | 0.0006 |
| 288.15 | 0.9000 | 0.0005 |
| 288.15 | 0.9500 | 0.0005 |
| 288.15 | 1.0000 | 0.0005 |
| 298.15 | 0.0000 | 0.0020 |
| 298.15 | 0.0500 | 0.0017 |
| 298.15 | 0.1000 | 0.0014 |
| 298.15 | 0.1500 | 0.0012 |
| 298.15 | 0.2001 | 0.0011 |
| 298.15 | 0.2500 | 0.0010 |
| 298.15 | 0.3000 | 0.0009 |
| 298.15 | 0.3500 | 0.0008 |
| 298.15 | 0.4000 | 0.0008 |
| 298.15 | 0.4500 | 0.0007 |
| 298.15 | 0.5000 | 0.0007 |
| 298.15 | 0.5500 | 0.0006 |
| 298.15 | 0.6000 | 0.0006 |
| 298.15 | 0.6500 | 0.0006 |
| 298.15 | 0.7000 | 0.0005 |
| 298.15 | 0.7500 | 0.0005 |
| 298.15 | 0.8000 | 0.0005 |
| 298.15 | 0.8500 | 0.0005 |
| 298.15 | 0.9000 | 0.0005 |
| 298.15 | 0.9500 | 0.0005 |
| 298.15 | 1.0000 | 0.0005 |
| 308.15 | 0.0000 | 0.0015 |
| 308.15 | 0.0500 | 0.0013 |
| 308.15 | 0.1000 | 0.0011 |
| 308.15 | 0.1500 | 0.0010 |
| 308.15 | 0.2001 | 0.0009 |
| 308.15 | 0.2500 | 0.0008 |
| 308.15 | 0.3000 | 0.0008 |
| 308.15 | 0.3500 | 0.0007 |
| 308.15 | 0.4000 | 0.0006 |
| 308.15 | 0.4500 | 0.0006 |
| 308.15 | 0.5000 | 0.0006 |
| 308.15 | 0.5500 | 0.0005 |
| 308.15 | 0.6000 | 0.0005 |
| 308.15 | 0.6500 | 0.0005 |
| 308.15 | 0.7000 | 0.0005 |
| 308.15 | 0.7500 | 0.0005 |
| 308.15 | 0.8000 | 0.0005 |
| 308.15 | 0.8500 | 0.0005 |
| 308.15 | 0.9000 | 0.0004 |
| 308.15 | 0.9500 | 0.0004 |
| 308.15 | 1.0000 | 0.0004 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetrahydrofuran (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 288.15 | 0.0000 | 1.3793 |
| 288.15 | 0.0500 | 1.3808 |
| 288.15 | 0.1000 | 1.3823 |
| 288.15 | 0.1500 | 1.3838 |
| 288.15 | 0.2001 | 1.3852 |
| 288.15 | 0.2500 | 1.3866 |
| 288.15 | 0.3000 | 1.388 |
| 288.15 | 0.3500 | 1.3895 |
| 288.15 | 0.4000 | 1.3909 |
| 288.15 | 0.4500 | 1.3923 |
| 288.15 | 0.5000 | 1.3938 |
| 288.15 | 0.5500 | 1.3953 |
| 288.15 | 0.6000 | 1.3968 |
| 288.15 | 0.6500 | 1.3984 |
| 288.15 | 0.7000 | 1.4 |
| 288.15 | 0.7500 | 1.4015 |
| 288.15 | 0.8000 | 1.403 |
| 288.15 | 0.8500 | 1.4045 |
| 288.15 | 0.9000 | 1.4059 |
| 288.15 | 0.9500 | 1.4073 |
| 288.15 | 1.0000 | 1.4087 |
| 298.15 | 0.0000 | 1.3752 |
| 298.15 | 0.0500 | 1.3766 |
| 298.15 | 0.1000 | 1.378 |
| 298.15 | 0.1500 | 1.3795 |
| 298.15 | 0.2001 | 1.3809 |
| 298.15 | 0.2500 | 1.3823 |
| 298.15 | 0.3000 | 1.3837 |
| 298.15 | 0.3500 | 1.3852 |
| 298.15 | 0.4000 | 1.3867 |
| 298.15 | 0.4500 | 1.3882 |
| 298.15 | 0.5000 | 1.3897 |
| 298.15 | 0.5500 | 1.3912 |
| 298.15 | 0.6000 | 1.3927 |
| 298.15 | 0.6500 | 1.3942 |
| 298.15 | 0.7000 | 1.3958 |
| 298.15 | 0.7500 | 1.3974 |
| 298.15 | 0.8000 | 1.3989 |
| 298.15 | 0.8500 | 1.4004 |
| 298.15 | 0.9000 | 1.4019 |
| 298.15 | 0.9500 | 1.4034 |
| 298.15 | 1.0000 | 1.4049 |
| 308.15 | 0.0000 | 1.3706 |
| 308.15 | 0.0500 | 1.3719 |
| 308.15 | 0.1000 | 1.3733 |
| 308.15 | 0.1500 | 1.3746 |
| 308.15 | 0.2001 | 1.376 |
| 308.15 | 0.2500 | 1.3774 |
| 308.15 | 0.3000 | 1.3787 |
| 308.15 | 0.3500 | 1.3802 |
| 308.15 | 0.4000 | 1.3816 |
| 308.15 | 0.4500 | 1.3831 |
| 308.15 | 0.5000 | 1.3845 |
| 308.15 | 0.5500 | 1.386 |
| 308.15 | 0.6000 | 1.3875 |
| 308.15 | 0.6500 | 1.389 |
| 308.15 | 0.7000 | 1.3905 |
| 308.15 | 0.7500 | 1.392 |
| 308.15 | 0.8000 | 1.3935 |
| 308.15 | 0.8500 | 1.395 |
| 308.15 | 0.9000 | 1.3965 |
| 308.15 | 0.9500 | 1.398 |
| 308.15 | 1.0000 | 1.3995 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100.8 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetrahydrofuran (2) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 789.53 |
| 288.15 | 0.0500 | 794.84 |
| 288.15 | 0.1000 | 800.09 |
| 288.15 | 0.1500 | 805.28 |
| 288.15 | 0.2001 | 810.47 |
| 288.15 | 0.2500 | 815.62 |
| 288.15 | 0.3000 | 820.77 |
| 288.15 | 0.3500 | 825.9 |
| 288.15 | 0.4000 | 831.03 |
| 288.15 | 0.4500 | 836.15 |
| 288.15 | 0.5000 | 841.26 |
| 288.15 | 0.5500 | 846.4 |
| 288.15 | 0.6000 | 851.53 |
| 288.15 | 0.6500 | 856.68 |
| 288.15 | 0.7000 | 861.84 |
| 288.15 | 0.7500 | 867.01 |
| 288.15 | 0.8000 | 872.19 |
| 288.15 | 0.8500 | 877.41 |
| 288.15 | 0.9000 | 882.64 |
| 288.15 | 0.9500 | 887.78 |
| 288.15 | 1.0000 | 893.02 |
| 298.15 | 0.0000 | 781.16 |
| 298.15 | 0.0500 | 786.31 |
| 298.15 | 0.1000 | 791.35 |
| 298.15 | 0.1500 | 796.35 |
| 298.15 | 0.2001 | 801.35 |
| 298.15 | 0.2500 | 806.34 |
| 298.15 | 0.3000 | 811.33 |
| 298.15 | 0.3500 | 816.33 |
| 298.15 | 0.4000 | 821.31 |
| 298.15 | 0.4500 | 826.3 |
| 298.15 | 0.5000 | 831.29 |
| 298.15 | 0.5500 | 836.32 |
| 298.15 | 0.6000 | 841.35 |
| 298.15 | 0.6500 | 846.39 |
| 298.15 | 0.7000 | 851.45 |
| 298.15 | 0.7500 | 856.52 |
| 298.15 | 0.8000 | 861.66 |
| 298.15 | 0.8500 | 866.81 |
| 298.15 | 0.9000 | 872.02 |
| 298.15 | 0.9500 | 877.21 |
| 298.15 | 1.0000 | 882.37 |
| 308.15 | 0.0000 | 772.52 |
| 308.15 | 0.0500 | 777.45 |
| 308.15 | 0.1000 | 782.29 |
| 308.15 | 0.1500 | 787.13 |
| 308.15 | 0.2001 | 791.97 |
| 308.15 | 0.2500 | 796.83 |
| 308.15 | 0.3000 | 801.67 |
| 308.15 | 0.3500 | 806.53 |
| 308.15 | 0.4000 | 811.39 |
| 308.15 | 0.4500 | 816.28 |
| 308.15 | 0.5000 | 821.17 |
| 308.15 | 0.5500 | 826.06 |
| 308.15 | 0.6000 | 830.96 |
| 308.15 | 0.6500 | 835.86 |
| 308.15 | 0.7000 | 840.81 |
| 308.15 | 0.7500 | 845.8 |
| 308.15 | 0.8000 | 850.82 |
| 308.15 | 0.8500 | 855.87 |
| 308.15 | 0.9000 | 860.97 |
| 308.15 | 0.9500 | 866.17 |
| 308.15 | 1.0000 | 871.33 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Tetrahydrofuran (2) - Liquid | Temperature, K - Liquid | Speed of sound, m/s - Liquid |
| 0.0000 | 293.00 | 1140.0 |
| 0.0000 | 303.00 | 1114.0 |
| 0.0000 | 313.00 | 1085.0 |
| 0.0983 | 293.00 | 1151.0 |
| 0.0983 | 303.00 | 1123.0 |
| 0.0983 | 313.00 | 1093.0 |
| 0.2085 | 293.00 | 1165.0 |
| 0.2085 | 303.00 | 1136.0 |
| 0.2085 | 313.00 | 1103.0 |
| 0.2911 | 293.00 | 1176.0 |
| 0.2911 | 303.00 | 1145.0 |
| 0.2911 | 313.00 | 1110.0 |
| 0.3728 | 293.00 | 1187.0 |
| 0.3728 | 303.00 | 1155.0 |
| 0.3728 | 313.00 | 1118.0 |
| 0.5014 | 293.00 | 1206.0 |
| 0.5014 | 303.00 | 1170.0 |
| 0.5014 | 313.00 | 1131.0 |
| 0.5976 | 293.00 | 1222.0 |
| 0.5976 | 303.00 | 1183.0 |
| 0.5976 | 313.00 | 1142.0 |
| 0.7483 | 293.00 | 1248.0 |
| 0.7483 | 303.00 | 1207.0 |
| 0.7483 | 313.00 | 1162.0 |
| 0.8001 | 293.00 | 1258.0 |
| 0.8001 | 303.00 | 1216.0 |
| 0.8001 | 313.00 | 1170.0 |
| 0.8939 | 293.00 | 1278.0 |
| 0.8939 | 303.00 | 1232.0 |
| 0.8939 | 313.00 | 1185.0 |
| 1.0000 | 293.00 | 1302.0 |
| 1.0000 | 303.00 | 1254.0 |
| 1.0000 | 313.00 | 1202.0 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetrahydrofuran (2) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 288.15 | 0.0000 | 0.0217 |
| 288.15 | 0.0500 | 0.0222 |
| 288.15 | 0.1000 | 0.0225 |
| 288.15 | 0.1500 | 0.0228 |
| 288.15 | 0.2001 | 0.0231 |
| 288.15 | 0.2500 | 0.0234 |
| 288.15 | 0.3000 | 0.0237 |
| 288.15 | 0.3500 | 0.0239 |
| 288.15 | 0.4000 | 0.0242 |
| 288.15 | 0.4500 | 0.0245 |
| 288.15 | 0.5000 | 0.0248 |
| 288.15 | 0.5500 | 0.0251 |
| 288.15 | 0.6000 | 0.0255 |
| 288.15 | 0.6500 | 0.0258 |
| 288.15 | 0.7000 | 0.0262 |
| 288.15 | 0.7500 | 0.0265 |
| 288.15 | 0.8000 | 0.0269 |
| 288.15 | 0.8500 | 0.0272 |
| 288.15 | 0.9000 | 0.0276 |
| 288.15 | 0.9500 | 0.0280 |
| 288.15 | 1.0000 | 0.0284 |
| 298.15 | 0.0000 | 0.0209 |
| 298.15 | 0.0500 | 0.0213 |
| 298.15 | 0.1000 | 0.0216 |
| 298.15 | 0.1500 | 0.0220 |
| 298.15 | 0.2001 | 0.0222 |
| 298.15 | 0.2500 | 0.0225 |
| 298.15 | 0.3000 | 0.0227 |
| 298.15 | 0.3500 | 0.0230 |
| 298.15 | 0.4000 | 0.0232 |
| 298.15 | 0.4500 | 0.0235 |
| 298.15 | 0.5000 | 0.0238 |
| 298.15 | 0.5500 | 0.0240 |
| 298.15 | 0.6000 | 0.0243 |
| 298.15 | 0.6500 | 0.0246 |
| 298.15 | 0.7000 | 0.0250 |
| 298.15 | 0.7500 | 0.0253 |
| 298.15 | 0.8000 | 0.0256 |
| 298.15 | 0.8500 | 0.0260 |
| 298.15 | 0.9000 | 0.0263 |
| 298.15 | 0.9500 | 0.0266 |
| 298.15 | 1.0000 | 0.0270 |
| 308.15 | 0.0000 | 0.0202 |
| 308.15 | 0.0500 | 0.0206 |
| 308.15 | 0.1000 | 0.0209 |
| 308.15 | 0.1500 | 0.0212 |
| 308.15 | 0.2001 | 0.0215 |
| 308.15 | 0.2500 | 0.0217 |
| 308.15 | 0.3000 | 0.0220 |
| 308.15 | 0.3500 | 0.0222 |
| 308.15 | 0.4000 | 0.0225 |
| 308.15 | 0.4500 | 0.0227 |
| 308.15 | 0.5000 | 0.0229 |
| 308.15 | 0.5500 | 0.0232 |
| 308.15 | 0.6000 | 0.0235 |
| 308.15 | 0.6500 | 0.0238 |
| 308.15 | 0.7000 | 0.0241 |
| 308.15 | 0.7500 | 0.0244 |
| 308.15 | 0.8000 | 0.0247 |
| 308.15 | 0.8500 | 0.0250 |
| 308.15 | 0.9000 | 0.0253 |
| 308.15 | 0.9500 | 0.0256 |
| 308.15 | 1.0000 | 0.0260 |
Vapor Liquid Equilibrium at Constant Pressure [ref]
Operational condition: Pressure, kPa = 101.33 (VLE)
| Fixed | Measured | |
|---|---|---|
| T [K] - VLE | x1[mol/mol] of Tetrahydrofuran (2) - Liquid | y1[mol/mol] of Tetrahydrofuran (2) - Vapour |
| 355.38 | 0.0000 | 0.0000 |
| 353.88 | 0.0500 | 0.1050 |
| 352.55 | 0.1000 | 0.1957 |
| 350.33 | 0.2000 | 0.3460 |
| 348.45 | 0.3000 | 0.4650 |
| 346.69 | 0.4000 | 0.5651 |
| 345.0 | 0.5000 | 0.6510 |
| 343.49 | 0.6000 | 0.7279 |
| 342.17 | 0.7000 | 0.7991 |
| 341.0 | 0.8000 | 0.8672 |
| 339.89 | 0.9000 | 0.9336 |
| 339.39 | 0.9500 | 0.9667 |
| 338.88 | 1.0000 | 1.0000 |
Vapor Liquid Equilibrium at Constant Pressure [ref]
Operational condition: Pressure, kPa = 79.9 (VLE)
| x1[mol/mol] of Tetrahydrofuran (2) - Liquid | y1[mol/mol] of Tetrahydrofuran (2) - Vapour |
|---|---|
| 0.9550 | 0.9699 |
| 0.9800 | 0.9866 |
| 0.9850 | 0.9900 |
| 0.9900 | 0.9933 |
| 0.9950 | 0.9967 |
| 0.9980 | 0.9987 |
| 0.9999 | 0.9999 |
| 1.0000 | 1.0000 |
Vapor Liquid Equilibrium at Constant Pressure [ref]
Operational condition: Pressure, kPa = 101.33 (VLE)
| T [K] - VLE | x1[mol/mol] of Tetrahydrofuran (2) - Liquid |
|---|---|
| 354.95 | 0.0000 |
| 353.95 | 0.0500 |
| 352.85 | 0.1000 |
| 350.65 | 0.2000 |
| 348.55 | 0.3000 |
| 346.55 | 0.4000 |
| 344.75 | 0.5000 |
| 343.35 | 0.6000 |
| 342.15 | 0.7000 |
| 340.95 | 0.8000 |
| 339.95 | 0.9000 |
| 339.45 | 0.9500 |
| 338.95 | 1.0000 |
Sources
- Dortmund Data Bank Vapor-Liquid Equilibrium Data
- Ultrasonic velocity, viscosity and excess properties of binary mixture of tetrahydrofuran with 1-propanol and 2-propanol
- Densities, Viscosities, Refractive Indexes, and Surface Tensions for Binary and Ternary Mixtures of Tetrahydofuran, 2-Propanol, and 2,2,4-Trimethylpentane
Note: These property values are available through the Cheméo API. A free account gives you an access key.