- Name
- Formamide, N,N-dimethyl-
- InChI
- InChI=1S/C3H7NO/c1-4(2)3-5/h3H,1-2H3
- InChI Key
- ZMXDDKWLCZADIW-UHFFFAOYSA-N
- Formula
- C3H7NO
- SMILES
- CN(C)C=O
- Mol. Weight (g/mol)
- 73.09
- CAS
- 68-12-2
- Name
- 1-Octanol
- InChI
- InChI=1S/C8H18O/c1-2-3-4-5-6-7-8-9/h9H,2-8H2,1H3
- InChI Key
- KBPLFHHGFOOTCA-UHFFFAOYSA-N
- Formula
- C8H18O
- SMILES
- CCCCCCCCO
- Mol. Weight (g/mol)
- 130.23
- CAS
- 111-87-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- Partial molar enthalpy, kJ/mol (4)
- ρl - Mass density, kg/m3 (2)
- γ - Surface tension liquid-gas, N/m (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0077 |
| 298.15 | 0.2198 | 0.0041 |
| 298.15 | 0.3728 | 0.0026 |
| 298.15 | 0.5208 | 0.0018 |
| 298.15 | 0.6277 | 0.0014 |
| 298.15 | 0.7118 | 0.0012 |
| 298.15 | 0.7877 | 0.0011 |
| 298.15 | 0.8519 | 0.0010 |
| 298.15 | 0.9085 | 0.0009 |
| 298.15 | 0.9556 | 0.0009 |
| 298.15 | 1.0000 | 0.0008 |
| 303.15 | 0.0000 | 0.0064 |
| 303.15 | 0.2198 | 0.0032 |
| 303.15 | 0.3728 | 0.0020 |
| 303.15 | 0.5208 | 0.0014 |
| 303.15 | 0.6277 | 0.0011 |
| 303.15 | 0.7118 | 0.0009 |
| 303.15 | 0.7877 | 0.0009 |
| 303.15 | 0.8519 | 0.0008 |
| 303.15 | 0.9085 | 0.0008 |
| 303.15 | 0.9556 | 0.0008 |
| 303.15 | 1.0000 | 0.0008 |
| 308.15 | 0.0000 | 0.0054 |
| 308.15 | 0.2198 | 0.0027 |
| 308.15 | 0.3728 | 0.0016 |
| 308.15 | 0.5208 | 0.0011 |
| 308.15 | 0.6277 | 0.0009 |
| 308.15 | 0.7118 | 0.0008 |
| 308.15 | 0.7877 | 0.0008 |
| 308.15 | 0.8519 | 0.0007 |
| 308.15 | 0.9085 | 0.0007 |
| 308.15 | 0.9556 | 0.0007 |
| 308.15 | 1.0000 | 0.0007 |
| 313.15 | 0.0000 | 0.0046 |
| 313.15 | 0.2198 | 0.0022 |
| 313.15 | 0.3728 | 0.0014 |
| 313.15 | 0.5208 | 0.0009 |
| 313.15 | 0.6277 | 0.0008 |
| 313.15 | 0.7118 | 0.0007 |
| 313.15 | 0.7877 | 0.0007 |
| 313.15 | 0.8519 | 0.0007 |
| 313.15 | 0.9085 | 0.0007 |
| 313.15 | 0.9556 | 0.0007 |
| 313.15 | 1.0000 | 0.0007 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0077 |
| 298.15 | 0.2198 | 0.0041 |
| 298.15 | 0.3728 | 0.0026 |
| 298.15 | 0.5208 | 0.0018 |
| 298.15 | 0.6277 | 0.0014 |
| 298.15 | 0.7118 | 0.0012 |
| 298.15 | 0.7877 | 0.0011 |
| 298.15 | 0.8519 | 0.0010 |
| 298.15 | 0.9085 | 0.0009 |
| 298.15 | 0.9556 | 0.0009 |
| 298.15 | 1.0000 | 0.0008 |
| 303.15 | 0.0000 | 0.0064 |
| 303.15 | 0.2198 | 0.0032 |
| 303.15 | 0.3728 | 0.0020 |
| 303.15 | 0.5208 | 0.0014 |
| 303.15 | 0.6277 | 0.0011 |
| 303.15 | 0.7118 | 0.0009 |
| 303.15 | 0.7877 | 0.0009 |
| 303.15 | 0.8519 | 0.0008 |
| 303.15 | 0.9085 | 0.0008 |
| 303.15 | 0.9556 | 0.0008 |
| 303.15 | 1.0000 | 0.0008 |
| 308.15 | 0.0000 | 0.0054 |
| 308.15 | 0.2198 | 0.0027 |
| 308.15 | 0.3728 | 0.0016 |
| 308.15 | 0.5208 | 0.0011 |
| 308.15 | 0.6277 | 0.0009 |
| 308.15 | 0.7118 | 0.0008 |
| 308.15 | 0.7877 | 0.0008 |
| 308.15 | 0.8519 | 0.0007 |
| 308.15 | 0.9085 | 0.0007 |
| 308.15 | 0.9556 | 0.0007 |
| 308.15 | 1.0000 | 0.0007 |
| 313.15 | 0.0000 | 0.0046 |
| 313.15 | 0.2198 | 0.0022 |
| 313.15 | 0.3728 | 0.0014 |
| 313.15 | 0.5208 | 0.0009 |
| 313.15 | 0.6277 | 0.0008 |
| 313.15 | 0.7118 | 0.0007 |
| 313.15 | 0.7877 | 0.0007 |
| 313.15 | 0.8519 | 0.0007 |
| 313.15 | 0.9085 | 0.0007 |
| 313.15 | 0.9556 | 0.0007 |
| 313.15 | 1.0000 | 0.0007 |
Partial molar enthalpy, kJ/mol of Formamide, N,N-dimethyl- (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Partial molar enthalpy, kJ/mol of Formamide, N,N-dimethyl- (1) - Liquid |
| 298.15 | 0.0000 | 5.63 |
| 298.15 | 0.1013 | 4.5 |
| 298.15 | 0.2381 | 3.23 |
| 298.15 | 0.3517 | 2.31 |
| 298.15 | 0.4625 | 1.6 |
| 298.15 | 0.6210 | 0.9500 |
| 298.15 | 0.7626 | 0.4100 |
| 318.15 | 0.0000 | 5.1 |
| 318.15 | 0.0498 | 4.65 |
| 318.15 | 0.1115 | 4.2 |
| 318.15 | 0.2980 | 2.62 |
| 318.15 | 0.4940 | 1.37 |
| 318.15 | 0.6392 | 0.7600 |
| 318.15 | 0.7897 | 0.2800 |
Partial molar enthalpy, kJ/mol of 1-Octanol (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Partial molar enthalpy, kJ/mol of 1-Octanol (2) - Liquid |
| 298.15 | 0.1019 | 0.0200 |
| 298.15 | 0.2428 | 0.3600 |
| 298.15 | 0.3521 | 0.6100 |
| 298.15 | 0.4656 | 1.22 |
| 298.15 | 0.6219 | 1.96 |
| 298.15 | 0.7648 | 3.22 |
| 298.15 | 1.0000 | 6.5 |
| 318.15 | 0.1132 | 0.0500 |
| 318.15 | 0.2941 | 0.4500 |
| 318.15 | 0.4942 | 1.26 |
| 318.15 | 0.6821 | 2.36 |
| 318.15 | 0.7901 | 3.28 |
| 318.15 | 0.9904 | 6.18 |
| 318.15 | 1.0000 | 6.38 |
Partial molar enthalpy, kJ/mol of Formamide, N,N-dimethyl- (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Partial molar enthalpy, kJ/mol of Formamide, N,N-dimethyl- (1) - Liquid |
| 298.15 | 0.0000 | 5.63 |
| 298.15 | 0.1013 | 4.5 |
| 298.15 | 0.2381 | 3.23 |
| 298.15 | 0.3517 | 2.31 |
| 298.15 | 0.4625 | 1.6 |
| 298.15 | 0.6210 | 0.9500 |
| 298.15 | 0.7626 | 0.4100 |
| 318.15 | 0.0000 | 5.1 |
| 318.15 | 0.0498 | 4.65 |
| 318.15 | 0.1115 | 4.2 |
| 318.15 | 0.2980 | 2.62 |
| 318.15 | 0.4940 | 1.37 |
| 318.15 | 0.6392 | 0.7600 |
| 318.15 | 0.7897 | 0.2800 |
Partial molar enthalpy, kJ/mol of 1-Octanol (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Partial molar enthalpy, kJ/mol of 1-Octanol (2) - Liquid |
| 298.15 | 0.1019 | 0.0200 |
| 298.15 | 0.2428 | 0.3600 |
| 298.15 | 0.3521 | 0.6100 |
| 298.15 | 0.4656 | 1.22 |
| 298.15 | 0.6219 | 1.96 |
| 298.15 | 0.7648 | 3.22 |
| 298.15 | 1.0000 | 6.5 |
| 318.15 | 0.1132 | 0.0500 |
| 318.15 | 0.2941 | 0.4500 |
| 318.15 | 0.4942 | 1.26 |
| 318.15 | 0.6821 | 2.36 |
| 318.15 | 0.7901 | 3.28 |
| 318.15 | 0.9904 | 6.18 |
| 318.15 | 1.0000 | 6.38 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 821.222 |
| 298.15 | 0.2198 | 835.186 |
| 298.15 | 0.3728 | 847.253 |
| 298.15 | 0.5208 | 861.646 |
| 298.15 | 0.6277 | 874.238 |
| 298.15 | 0.7118 | 885.914 |
| 298.15 | 0.7877 | 898.138 |
| 298.15 | 0.8519 | 909.952 |
| 298.15 | 0.9085 | 921.843 |
| 298.15 | 0.9556 | 932.914 |
| 298.15 | 1.0000 | 944.29 |
| 303.15 | 0.0000 | 818.209 |
| 303.15 | 0.2198 | 831.811 |
| 303.15 | 0.3728 | 843.584 |
| 303.15 | 0.5208 | 857.568 |
| 303.15 | 0.6277 | 869.964 |
| 303.15 | 0.7118 | 881.458 |
| 303.15 | 0.7877 | 893.435 |
| 303.15 | 0.8519 | 905.109 |
| 303.15 | 0.9085 | 916.796 |
| 303.15 | 0.9556 | 927.592 |
| 303.15 | 1.0000 | 939.047 |
| 308.15 | 0.0000 | 814.742 |
| 308.15 | 0.2198 | 828.086 |
| 308.15 | 0.3728 | 839.752 |
| 308.15 | 0.5208 | 853.623 |
| 308.15 | 0.6277 | 865.852 |
| 308.15 | 0.7118 | 877.239 |
| 308.15 | 0.7877 | 889.113 |
| 308.15 | 0.8519 | 900.709 |
| 308.15 | 0.9085 | 912.287 |
| 308.15 | 0.9556 | 923.224 |
| 308.15 | 1.0000 | 934.721 |
| 313.15 | 0.0000 | 810.629 |
| 313.15 | 0.2198 | 823.708 |
| 313.15 | 0.3728 | 835.263 |
| 313.15 | 0.5208 | 849.056 |
| 313.15 | 0.6277 | 861.125 |
| 313.15 | 0.7118 | 872.405 |
| 313.15 | 0.7877 | 884.137 |
| 313.15 | 0.8519 | 895.506 |
| 313.15 | 0.9085 | 907.01 |
| 313.15 | 0.9556 | 917.847 |
| 313.15 | 1.0000 | 929.478 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 821.222 |
| 298.15 | 0.2198 | 835.186 |
| 298.15 | 0.3728 | 847.253 |
| 298.15 | 0.5208 | 861.646 |
| 298.15 | 0.6277 | 874.238 |
| 298.15 | 0.7118 | 885.914 |
| 298.15 | 0.7877 | 898.138 |
| 298.15 | 0.8519 | 909.952 |
| 298.15 | 0.9085 | 921.843 |
| 298.15 | 0.9556 | 932.914 |
| 298.15 | 1.0000 | 944.29 |
| 303.15 | 0.0000 | 818.209 |
| 303.15 | 0.2198 | 831.811 |
| 303.15 | 0.3728 | 843.584 |
| 303.15 | 0.5208 | 857.568 |
| 303.15 | 0.6277 | 869.964 |
| 303.15 | 0.7118 | 881.458 |
| 303.15 | 0.7877 | 893.435 |
| 303.15 | 0.8519 | 905.109 |
| 303.15 | 0.9085 | 916.796 |
| 303.15 | 0.9556 | 927.592 |
| 303.15 | 1.0000 | 939.047 |
| 308.15 | 0.0000 | 814.742 |
| 308.15 | 0.2198 | 828.086 |
| 308.15 | 0.3728 | 839.752 |
| 308.15 | 0.5208 | 853.623 |
| 308.15 | 0.6277 | 865.852 |
| 308.15 | 0.7118 | 877.239 |
| 308.15 | 0.7877 | 889.113 |
| 308.15 | 0.8519 | 900.709 |
| 308.15 | 0.9085 | 912.287 |
| 308.15 | 0.9556 | 923.224 |
| 308.15 | 1.0000 | 934.721 |
| 313.15 | 0.0000 | 810.629 |
| 313.15 | 0.2198 | 823.708 |
| 313.15 | 0.3728 | 835.263 |
| 313.15 | 0.5208 | 849.056 |
| 313.15 | 0.6277 | 861.125 |
| 313.15 | 0.7118 | 872.405 |
| 313.15 | 0.7877 | 884.137 |
| 313.15 | 0.8519 | 895.506 |
| 313.15 | 0.9085 | 907.01 |
| 313.15 | 0.9556 | 917.847 |
| 313.15 | 1.0000 | 929.478 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 298.15 | 0.0000 | 0.0275 |
| 298.15 | 0.2198 | 0.0281 |
| 298.15 | 0.3728 | 0.0284 |
| 298.15 | 0.5208 | 0.0288 |
| 298.15 | 0.6277 | 0.0294 |
| 298.15 | 0.7118 | 0.0301 |
| 298.15 | 0.7877 | 0.0310 |
| 298.15 | 0.8519 | 0.0321 |
| 298.15 | 0.9085 | 0.0331 |
| 298.15 | 0.9556 | 0.0341 |
| 298.15 | 1.0000 | 0.0352 |
| 303.15 | 0.0000 | 0.0264 |
| 303.15 | 0.2198 | 0.0270 |
| 303.15 | 0.3728 | 0.0272 |
| 303.15 | 0.5208 | 0.0276 |
| 303.15 | 0.6277 | 0.0282 |
| 303.15 | 0.7118 | 0.0289 |
| 303.15 | 0.7877 | 0.0299 |
| 303.15 | 0.8519 | 0.0309 |
| 303.15 | 0.9085 | 0.0320 |
| 303.15 | 0.9556 | 0.0330 |
| 303.15 | 1.0000 | 0.0341 |
| 308.15 | 0.0000 | 0.0254 |
| 308.15 | 0.2198 | 0.0260 |
| 308.15 | 0.3728 | 0.0262 |
| 308.15 | 0.5208 | 0.0265 |
| 308.15 | 0.6277 | 0.0271 |
| 308.15 | 0.7118 | 0.0278 |
| 308.15 | 0.7877 | 0.0287 |
| 308.15 | 0.8519 | 0.0298 |
| 308.15 | 0.9085 | 0.0309 |
| 308.15 | 0.9556 | 0.0319 |
| 308.15 | 1.0000 | 0.0330 |
| 313.15 | 0.0000 | 0.0244 |
| 313.15 | 0.2198 | 0.0249 |
| 313.15 | 0.3728 | 0.0251 |
| 313.15 | 0.5208 | 0.0254 |
| 313.15 | 0.6277 | 0.0260 |
| 313.15 | 0.7118 | 0.0267 |
| 313.15 | 0.7877 | 0.0277 |
| 313.15 | 0.8519 | 0.0287 |
| 313.15 | 0.9085 | 0.0298 |
| 313.15 | 0.9556 | 0.0309 |
| 313.15 | 1.0000 | 0.0320 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 298.15 | 0.0000 | 0.0275 |
| 298.15 | 0.2198 | 0.0281 |
| 298.15 | 0.3728 | 0.0284 |
| 298.15 | 0.5208 | 0.0288 |
| 298.15 | 0.6277 | 0.0294 |
| 298.15 | 0.7118 | 0.0301 |
| 298.15 | 0.7877 | 0.0310 |
| 298.15 | 0.8519 | 0.0321 |
| 298.15 | 0.9085 | 0.0331 |
| 298.15 | 0.9556 | 0.0341 |
| 298.15 | 1.0000 | 0.0352 |
| 303.15 | 0.0000 | 0.0264 |
| 303.15 | 0.2198 | 0.0270 |
| 303.15 | 0.3728 | 0.0272 |
| 303.15 | 0.5208 | 0.0276 |
| 303.15 | 0.6277 | 0.0282 |
| 303.15 | 0.7118 | 0.0289 |
| 303.15 | 0.7877 | 0.0299 |
| 303.15 | 0.8519 | 0.0309 |
| 303.15 | 0.9085 | 0.0320 |
| 303.15 | 0.9556 | 0.0330 |
| 303.15 | 1.0000 | 0.0341 |
| 308.15 | 0.0000 | 0.0254 |
| 308.15 | 0.2198 | 0.0260 |
| 308.15 | 0.3728 | 0.0262 |
| 308.15 | 0.5208 | 0.0265 |
| 308.15 | 0.6277 | 0.0271 |
| 308.15 | 0.7118 | 0.0278 |
| 308.15 | 0.7877 | 0.0287 |
| 308.15 | 0.8519 | 0.0298 |
| 308.15 | 0.9085 | 0.0309 |
| 308.15 | 0.9556 | 0.0319 |
| 308.15 | 1.0000 | 0.0330 |
| 313.15 | 0.0000 | 0.0244 |
| 313.15 | 0.2198 | 0.0249 |
| 313.15 | 0.3728 | 0.0251 |
| 313.15 | 0.5208 | 0.0254 |
| 313.15 | 0.6277 | 0.0260 |
| 313.15 | 0.7118 | 0.0267 |
| 313.15 | 0.7877 | 0.0277 |
| 313.15 | 0.8519 | 0.0287 |
| 313.15 | 0.9085 | 0.0298 |
| 313.15 | 0.9556 | 0.0309 |
| 313.15 | 1.0000 | 0.0320 |
Sources
- Physico-chemical properties of binary mixtures of N,N-dimethylformamide with 1-octanol, 1-nonanol and 1-decanol at different temperatures
- Effect of temperature and chain length on the viscosity and surface tension of binary systems of N,N-dimethylformamide with 1-octanol, 1-nonanol and 1-decanol
- Solvation of the photodynamic therapy agent in the model lipid protein system: The evidence of porphyrin preferential solvation by apolar environment
Note: These property values are available through the Cheméo API. A free account gives you an access key.