- Name
- Uridine
- InChI
- InChI=1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6?,7?,8-/m1/s1
- InChI Key
- DRTQHJPVMGBUCF-UHFFFAOYSA-N
- Formula
- C9H12N2O6
- SMILES
-
O=c1ccn(C2OC(CO)C(O)C2O)c(=O)[
nH]1 - Mol. Weight (g/mol)
- 244.20
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Molality, mol/kg
- η - Viscosity, Pa*s
- Apparent molar heat capacity, J/K/mol (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Molality, mol/kg [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Molality, mol/kg - Liquid |
| 298.39 | 101.30 | 2.557 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Uridine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0103 | 0.0011 |
| 288.15 | 0.0142 | 0.0011 |
| 288.15 | 0.0177 | 0.0011 |
| 288.15 | 0.0220 | 0.0011 |
| 288.15 | 0.0282 | 0.0012 |
| 288.15 | 0.0311 | 0.0012 |
| 298.15 | 0.0103 | 0.0009 |
| 298.15 | 0.0142 | 0.0009 |
| 298.15 | 0.0177 | 0.0009 |
| 298.15 | 0.0220 | 0.0009 |
| 298.15 | 0.0282 | 0.0009 |
| 298.15 | 0.0311 | 0.0009 |
| 308.15 | 0.0103 | 0.0007 |
| 308.15 | 0.0142 | 0.0007 |
| 308.15 | 0.0177 | 0.0007 |
| 308.15 | 0.0220 | 0.0007 |
| 308.15 | 0.0282 | 0.0007 |
| 308.15 | 0.0311 | 0.0007 |
| 318.15 | 0.0103 | 0.0006 |
| 318.15 | 0.0142 | 0.0006 |
| 318.15 | 0.0177 | 0.0006 |
| 318.15 | 0.0220 | 0.0006 |
| 318.15 | 0.0282 | 0.0006 |
| 318.15 | 0.0311 | 0.0006 |
Apparent molar heat capacity, J/K/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Molality, mol/kg of Uridine (1) - Liquid | Apparent molar heat capacity, J/K/mol - Liquid |
|---|---|
| 0.0320 | 388.6 |
| 0.0391 | 392.2 |
| 0.0451 | 389.0 |
| 0.0520 | 390.2 |
| 0.0650 | 392.8 |
| 0.0781 | 394.6 |
| 0.0909 | 393.0 |
| 0.1040 | 395.8 |
| 0.1169 | 396.3 |
| 0.1297 | 397.2 |
| 0.1419 | 397.4 |
| 0.1560 | 397.9 |
| 0.1691 | 399.7 |
| 0.1817 | 400.0 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational conditions:
- Initial molality of solute, mol/kg = 0.04 (Liquid)
- Pressure, kPa = 101.3 (Liquid)
- Final molality of solute, mol/kg = 0.0003916 (Liquid)
| Temperature, K - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
|---|---|
| 288.15 | 0.2120 |
| 298.15 | 0.2040 |
| 308.15 | 0.1930 |
| 318.15 | 0.1830 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Uridine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0155 | 1000.562 |
| 288.15 | 0.0211 | 1001.081 |
| 288.15 | 0.0315 | 1002.033 |
| 288.15 | 0.0377 | 1002.599 |
| 288.15 | 0.0393 | 1002.748 |
| 288.15 | 0.0509 | 1003.801 |
| 298.15 | 0.0135 | 998.273 |
| 298.15 | 0.0155 | 998.454 |
| 298.15 | 0.0205 | 998.91 |
| 298.15 | 0.0211 | 998.963 |
| 298.15 | 0.0315 | 999.896 |
| 298.15 | 0.0319 | 999.936 |
| 298.15 | 0.0377 | 1000.45 |
| 298.15 | 0.0393 | 1000.595 |
| 298.15 | 0.0435 | 1000.973 |
| 298.15 | 0.0509 | 1001.626 |
| 298.15 | 0.0510 | 1001.632 |
| 298.15 | 0.0577 | 1002.229 |
| 298.15 | 0.0722 | 1003.505 |
| 308.15 | 0.0155 | 995.447 |
| 308.15 | 0.0211 | 995.947 |
| 308.15 | 0.0315 | 996.863 |
| 308.15 | 0.0377 | 997.406 |
| 308.15 | 0.0393 | 997.548 |
| 308.15 | 0.0509 | 998.558 |
| 318.15 | 0.0155 | 991.615 |
| 318.15 | 0.0211 | 992.109 |
| 318.15 | 0.0315 | 993.015 |
| 318.15 | 0.0377 | 993.55 |
| 318.15 | 0.0393 | 993.691 |
| 318.15 | 0.0509 | 994.686 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Uridine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0200 | 1000.969 |
| 288.15 | 0.0251 | 1001.438 |
| 288.15 | 0.0321 | 1002.092 |
| 288.15 | 0.0389 | 1002.718 |
| 288.15 | 0.0472 | 1003.48 |
| 288.15 | 0.0529 | 1004.003 |
| 288.15 | 0.0610 | 1004.738 |
| 288.15 | 0.0630 | 1004.93 |
| 288.15 | 0.0732 | 1005.863 |
| 288.15 | 0.0811 | 1006.579 |
| 288.15 | 0.0856 | 1006.988 |
| 288.15 | 0.0953 | 1007.859 |
| 288.15 | 0.1086 | 1009.06 |
| 288.15 | 0.1226 | 1010.321 |
| 288.15 | 0.1361 | 1011.522 |
| 288.15 | 0.1514 | 1012.894 |
| 288.15 | 0.1646 | 1014.068 |
| 288.15 | 0.1772 | 1015.174 |
| 288.15 | 0.1879 | 1016.117 |
| 298.15 | 0.0200 | 998.874 |
| 298.15 | 0.0221 | 999.063 |
| 298.15 | 0.0282 | 999.615 |
| 298.15 | 0.0320 | 999.958 |
| 298.15 | 0.0391 | 1000.599 |
| 298.15 | 0.0451 | 1001.147 |
| 298.15 | 0.0470 | 1001.321 |
| 298.15 | 0.0520 | 1001.77 |
| 298.15 | 0.0649 | 1002.93 |
| 298.15 | 0.0650 | 1002.94 |
| 298.15 | 0.0781 | 1004.105 |
| 298.15 | 0.0909 | 1005.247 |
| 298.15 | 0.1040 | 1006.414 |
| 298.15 | 0.1169 | 1007.55 |
| 298.15 | 0.1297 | 1008.682 |
| 298.15 | 0.1419 | 1009.749 |
| 298.15 | 0.1560 | 1010.967 |
| 298.15 | 0.1691 | 1012.104 |
| 298.15 | 0.1817 | 1013.191 |
| 303.15 | 0.0261 | 998.01 |
| 303.15 | 0.0310 | 998.45 |
| 303.15 | 0.0399 | 999.255 |
| 303.15 | 0.0541 | 1000.521 |
| 303.15 | 0.0602 | 1001.068 |
| 303.15 | 0.0742 | 1002.314 |
| 303.15 | 0.0869 | 1003.433 |
| 303.15 | 0.0994 | 1004.535 |
| 303.15 | 0.1151 | 1005.917 |
| 303.15 | 0.1315 | 1007.338 |
| 303.15 | 0.1521 | 1009.126 |
| 303.15 | 0.1593 | 1009.749 |
| 303.15 | 0.1736 | 1010.977 |
| 313.15 | 0.0261 | 994.543 |
| 313.15 | 0.0310 | 994.974 |
| 313.15 | 0.0399 | 995.768 |
| 313.15 | 0.0500 | 996.65 |
| 313.15 | 0.0611 | 997.626 |
| 313.15 | 0.0659 | 998.051 |
| 313.15 | 0.0739 | 998.749 |
| 313.15 | 0.0881 | 999.989 |
| 313.15 | 0.0948 | 1000.565 |
| 313.15 | 0.1078 | 1001.695 |
| 313.15 | 0.1161 | 1002.406 |
| 313.15 | 0.1245 | 1003.133 |
| 313.15 | 0.1298 | 1003.594 |
| 313.15 | 0.1542 | 1005.682 |
Speed of sound, m/s [ref]
Operational condition: Temperature, K = 298.15 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Molality, mol/kg of Uridine (1) - Liquid | Speed of sound, m/s - Liquid |
| 10000.00 | 0.0993 | 1519.78 |
| 10000.00 | 0.0865 | 1518.98 |
| 10000.00 | 0.0762 | 1518.3 |
| 10000.00 | 0.0655 | 1517.63 |
| 10000.00 | 0.0540 | 1516.87 |
| 10000.00 | 0.0501 | 1516.59 |
| 10000.00 | 0.0434 | 1516.21 |
| 10000.00 | 0.0351 | 1515.66 |
| 10000.00 | 0.0270 | 1515.1 |
| 20000.00 | 0.0993 | 1536.6 |
| 20000.00 | 0.0865 | 1535.8 |
| 20000.00 | 0.0762 | 1535.12 |
| 20000.00 | 0.0655 | 1534.43 |
| 20000.00 | 0.0540 | 1533.63 |
| 20000.00 | 0.0501 | 1533.45 |
| 20000.00 | 0.0434 | 1532.96 |
| 20000.00 | 0.0351 | 1532.41 |
| 20000.00 | 0.0270 | 1531.88 |
| 40000.00 | 0.0993 | 1570.3 |
| 40000.00 | 0.0865 | 1569.47 |
| 40000.00 | 0.0762 | 1568.81 |
| 40000.00 | 0.0655 | 1568.11 |
| 40000.00 | 0.0540 | 1567.32 |
| 40000.00 | 0.0501 | 1567.02 |
| 40000.00 | 0.0434 | 1566.61 |
| 40000.00 | 0.0351 | 1566.02 |
| 40000.00 | 0.0270 | 1565.47 |
| 60000.00 | 0.0993 | 1603.82 |
| 60000.00 | 0.0865 | 1602.98 |
| 60000.00 | 0.0762 | 1602.27 |
| 60000.00 | 0.0655 | 1601.61 |
| 60000.00 | 0.0540 | 1600.78 |
| 60000.00 | 0.0501 | 1600.5 |
| 60000.00 | 0.0434 | 1600.09 |
| 60000.00 | 0.0351 | 1599.5 |
| 60000.00 | 0.0270 | 1598.97 |
| 80000.00 | 0.0993 | 1637.11 |
| 80000.00 | 0.0865 | 1636.29 |
| 80000.00 | 0.0762 | 1635.63 |
| 80000.00 | 0.0655 | 1634.94 |
| 80000.00 | 0.0540 | 1634.14 |
| 80000.00 | 0.0501 | 1633.88 |
| 80000.00 | 0.0434 | 1633.45 |
| 80000.00 | 0.0351 | 1632.85 |
| 80000.00 | 0.0270 | 1632.3 |
| 100000.00 | 0.0993 | 1670.19 |
| 100000.00 | 0.0865 | 1669.38 |
| 100000.00 | 0.0762 | 1668.69 |
| 100000.00 | 0.0655 | 1668.03 |
| 100000.00 | 0.0540 | 1667.3 |
| 100000.00 | 0.0501 | 1666.99 |
| 100000.00 | 0.0434 | 1666.6 |
| 100000.00 | 0.0351 | 1666.01 |
| 100000.00 | 0.0270 | 1665.5 |
| 120000.00 | 0.0993 | 1703.01 |
| 120000.00 | 0.0865 | 1702.16 |
| 120000.00 | 0.0762 | 1701.51 |
| 120000.00 | 0.0655 | 1700.81 |
| 120000.00 | 0.0540 | 1700.06 |
| 120000.00 | 0.0501 | 1699.77 |
| 120000.00 | 0.0434 | 1699.35 |
| 120000.00 | 0.0351 | 1698.84 |
| 120000.00 | 0.0270 | 1698.27 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Molality, mol/kg of Uridine (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0151 | 1497.676 |
| 0.0160 | 1497.734 |
| 0.0195 | 1497.961 |
| 0.0208 | 1498.057 |
| 0.0245 | 1498.293 |
| 0.0280 | 1498.52 |
| 0.0352 | 1498.988 |
| 0.0401 | 1499.3 |
| 0.0464 | 1499.715 |
| 0.0590 | 1500.52 |
| 0.0723 | 1501.38 |
| 0.0855 | 1502.214 |
| 0.0986 | 1503.048 |
| 0.1109 | 1503.822 |
Sources
- Saturation molalities and standard molar enthalpies of solution of cytidine(cr), hypoxanthine(cr), thymidine(cr), thymine(cr), uridine(cr), and xanthine(cr) in H2O(l)
- The partial molar volumes at T = (288.15 to 313.15) K, and the partial molar heat capacities and expansions at T = 298.15 K of cytidine, uridine, and adenosine in aqueous solution
- Volumetric properties of the nucleosides adenosine, cytidine, and uridine in aqueous solution at T=298.15K and P=(10 to120)MPa
- Volumetric studies on nucleic acid bases and nucleosides in aqueous guanidine hydrochloride solutions at T = (288.15 to 318.15) K and at atmospheric pressure
- Solvation behavior of some nucleic acid bases and nucleosides in water and in aqueous guanidine hydrochloride solutions: Viscometric, calorimetric and spectroscopic approach
- Partial Molar Isentropic and Isothermal Compressions of the Nucleosides Adenosine, Cytidine, and Uridine in Aqueous Solution at 298.15 K
Note: These property values are available through the Cheméo API. A free account gives you an access key.