- Name
- allo-L-isoleucine
- InChI
- InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)
- InChI Key
- AGPKZVBTJJNPAG-UHFFFAOYSA-N
- Formula
- C6H13NO2
- SMILES
- CCC(C)C(N)C(=O)O
- Mol. Weight (g/mol)
- 131.17
- CAS
- 3107-04-8
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mass ratio of solute to solvent (3)
- Cp,liquid - Molar heat capacity at constant pressure, J/K/mol
- η - Viscosity, Pa*s
- Molar enthalpy
- ρl - Mass density, kg/m3 (3)
- csound,fluid - Speed of Sound, m/s (2)
- Binary diffusion coefficient, m2/s (3)
Mass ratio of solute to solvent of allo-L-isoleucine (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mass ratio of solute to solvent of allo-L-isoleucine (1) - Liquid |
|---|---|
| 298.15 | 0.0336 |
| 323.15 | 0.0406 |
Mass fraction of allo-L-isoleucine (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mass fraction of allo-L-isoleucine (1) - Liquid |
|---|---|
| 298.15 | 0.0325 |
| 313.15 | 0.0358 |
| 333.15 | 0.0435 |
Molality, mol/kg of allo-L-isoleucine (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Molality, mol/kg of allo-L-isoleucine (1) - Liquid |
|---|---|
| 288.15 | 0.2951 |
| 293.15 | 0.3021 |
| 298.15 | 0.3087 |
| 303.15 | 0.3176 |
| 308.15 | 0.3262 |
| 313.15 | 0.3390 |
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational condition: Pressure, kPa = 350 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of allo-L-isoleucine (1) - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
| 278.15 | 0.0101 | 75.76 |
| 278.15 | 0.0204 | 75.82 |
| 278.15 | 0.0402 | 75.92 |
| 278.15 | 0.0799 | 76.13 |
| 278.15 | 0.1601 | 76.53 |
| 278.15 | 0.2125 | 76.80 |
| 283.15 | 0.0101 | 75.59 |
| 283.15 | 0.0204 | 75.65 |
| 283.15 | 0.0402 | 75.76 |
| 283.15 | 0.0799 | 75.97 |
| 283.15 | 0.1601 | 76.39 |
| 283.15 | 0.2125 | 76.67 |
| 288.15 | 0.0101 | 75.47 |
| 288.15 | 0.0204 | 75.54 |
| 288.15 | 0.0402 | 75.64 |
| 288.15 | 0.0799 | 75.86 |
| 288.15 | 0.1601 | 76.29 |
| 288.15 | 0.2125 | 76.58 |
| 293.15 | 0.0101 | 75.39 |
| 293.15 | 0.0204 | 75.46 |
| 293.15 | 0.0402 | 75.57 |
| 293.15 | 0.0799 | 75.79 |
| 293.15 | 0.1601 | 76.23 |
| 293.15 | 0.2125 | 76.52 |
| 298.15 | 0.0101 | 75.34 |
| 298.15 | 0.0204 | 75.41 |
| 298.15 | 0.0402 | 75.52 |
| 298.15 | 0.0799 | 75.75 |
| 298.15 | 0.1601 | 76.19 |
| 298.15 | 0.2125 | 76.49 |
| 303.15 | 0.0101 | 75.31 |
| 303.15 | 0.0204 | 75.38 |
| 303.15 | 0.0402 | 75.49 |
| 303.15 | 0.0799 | 75.72 |
| 303.15 | 0.1601 | 76.17 |
| 303.15 | 0.2125 | 76.47 |
| 308.15 | 0.0101 | 75.30 |
| 308.15 | 0.0204 | 75.36 |
| 308.15 | 0.0402 | 75.48 |
| 308.15 | 0.0799 | 75.71 |
| 308.15 | 0.1601 | 76.16 |
| 308.15 | 0.2125 | 76.47 |
| 313.15 | 0.0101 | 75.30 |
| 313.15 | 0.0204 | 75.36 |
| 313.15 | 0.0402 | 75.48 |
| 313.15 | 0.0799 | 75.71 |
| 313.15 | 0.1601 | 76.17 |
| 313.15 | 0.2125 | 76.48 |
| 318.15 | 0.0101 | 75.32 |
| 318.15 | 0.0204 | 75.38 |
| 318.15 | 0.0402 | 75.49 |
| 318.15 | 0.0799 | 75.73 |
| 318.15 | 0.1601 | 76.19 |
| 318.15 | 0.2125 | 76.50 |
| 323.15 | 0.0101 | 75.34 |
| 323.15 | 0.0204 | 75.40 |
| 323.15 | 0.0402 | 75.52 |
| 323.15 | 0.0799 | 75.75 |
| 323.15 | 0.1601 | 76.21 |
| 323.15 | 0.2125 | 76.53 |
| 328.15 | 0.0101 | 75.37 |
| 328.15 | 0.0204 | 75.43 |
| 328.15 | 0.0402 | 75.55 |
| 328.15 | 0.0799 | 75.79 |
| 328.15 | 0.1601 | 76.25 |
| 328.15 | 0.2125 | 76.56 |
| 333.15 | 0.0101 | 75.41 |
| 333.15 | 0.0204 | 75.47 |
| 333.15 | 0.0402 | 75.59 |
| 333.15 | 0.0799 | 75.83 |
| 333.15 | 0.1601 | 76.29 |
| 333.15 | 0.2125 | 76.61 |
| 338.15 | 0.0101 | 75.46 |
| 338.15 | 0.0204 | 75.52 |
| 338.15 | 0.0402 | 75.64 |
| 338.15 | 0.0799 | 75.88 |
| 338.15 | 0.1601 | 76.35 |
| 338.15 | 0.2125 | 76.66 |
| 343.15 | 0.0101 | 75.52 |
| 343.15 | 0.0204 | 75.58 |
| 343.15 | 0.0402 | 75.70 |
| 343.15 | 0.0799 | 75.93 |
| 343.15 | 0.1601 | 76.41 |
| 343.15 | 0.2125 | 76.72 |
| 348.15 | 0.0101 | 75.59 |
| 348.15 | 0.0204 | 75.64 |
| 348.15 | 0.0402 | 75.76 |
| 348.15 | 0.0799 | 76.00 |
| 348.15 | 0.1601 | 76.48 |
| 348.15 | 0.2125 | 76.78 |
| 353.15 | 0.0101 | 75.66 |
| 353.15 | 0.0204 | 75.72 |
| 353.15 | 0.0402 | 75.84 |
| 353.15 | 0.0799 | 76.07 |
| 353.15 | 0.1601 | 76.55 |
| 353.15 | 0.2125 | 76.86 |
| 358.15 | 0.0101 | 75.74 |
| 358.15 | 0.0204 | 75.80 |
| 358.15 | 0.0402 | 75.92 |
| 358.15 | 0.0799 | 76.15 |
| 358.15 | 0.1601 | 76.63 |
| 358.15 | 0.2125 | 76.93 |
| 363.15 | 0.0101 | 75.83 |
| 363.15 | 0.0204 | 75.88 |
| 363.15 | 0.0402 | 76.00 |
| 363.15 | 0.0799 | 76.24 |
| 363.15 | 0.1601 | 76.72 |
| 363.15 | 0.2125 | 77.02 |
| 368.15 | 0.0101 | 75.93 |
| 368.15 | 0.0204 | 75.98 |
| 368.15 | 0.0402 | 76.10 |
| 368.15 | 0.0799 | 76.33 |
| 368.15 | 0.1601 | 76.81 |
| 368.15 | 0.2125 | 77.11 |
| 373.15 | 0.0101 | 76.03 |
| 373.15 | 0.0204 | 76.08 |
| 373.15 | 0.0402 | 76.20 |
| 373.15 | 0.0799 | 76.43 |
| 373.15 | 0.1601 | 76.91 |
| 373.15 | 0.2125 | 77.21 |
| 378.15 | 0.0101 | 76.14 |
| 378.15 | 0.0204 | 76.19 |
| 378.15 | 0.0402 | 76.31 |
| 378.15 | 0.0799 | 76.55 |
| 378.15 | 0.1601 | 77.02 |
| 378.15 | 0.2125 | 77.32 |
| 383.15 | 0.0101 | 76.25 |
| 383.15 | 0.0204 | 76.31 |
| 383.15 | 0.0402 | 76.43 |
| 383.15 | 0.0799 | 76.67 |
| 383.15 | 0.1601 | 77.13 |
| 383.15 | 0.2125 | 77.44 |
| 388.15 | 0.0101 | 76.38 |
| 388.15 | 0.0204 | 76.44 |
| 388.15 | 0.0402 | 76.56 |
| 388.15 | 0.0799 | 76.79 |
| 388.15 | 0.1601 | 77.25 |
| 388.15 | 0.2125 | 77.57 |
| 393.15 | 0.0101 | 76.51 |
| 393.15 | 0.0204 | 76.58 |
| 393.15 | 0.0402 | 76.70 |
| 393.15 | 0.0799 | 76.93 |
| 393.15 | 0.1601 | 77.38 |
| 393.15 | 0.2125 | 77.70 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of allo-L-isoleucine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0250 | 0.0009 |
| 298.15 | 0.0500 | 0.0009 |
| 298.15 | 0.0750 | 0.0009 |
| 298.15 | 0.0999 | 0.0009 |
| 298.15 | 0.1249 | 0.0009 |
| 298.15 | 0.1500 | 0.0010 |
| 303.15 | 0.0250 | 0.0008 |
| 303.15 | 0.0500 | 0.0008 |
| 303.15 | 0.0750 | 0.0008 |
| 303.15 | 0.0999 | 0.0008 |
| 303.15 | 0.1249 | 0.0008 |
| 303.15 | 0.1500 | 0.0009 |
| 308.15 | 0.0250 | 0.0007 |
| 308.15 | 0.0500 | 0.0007 |
| 308.15 | 0.0750 | 0.0007 |
| 308.15 | 0.0999 | 0.0008 |
| 308.15 | 0.1249 | 0.0008 |
| 308.15 | 0.1500 | 0.0008 |
| 313.15 | 0.0250 | 0.0007 |
| 313.15 | 0.0500 | 0.0007 |
| 313.15 | 0.0750 | 0.0007 |
| 313.15 | 0.0999 | 0.0007 |
| 313.15 | 0.1249 | 0.0007 |
| 313.15 | 0.1500 | 0.0007 |
| 318.15 | 0.0250 | 0.0006 |
| 318.15 | 0.0500 | 0.0006 |
| 318.15 | 0.0750 | 0.0006 |
| 318.15 | 0.0999 | 0.0006 |
| 318.15 | 0.1249 | 0.0006 |
| 318.15 | 0.1500 | 0.0006 |
Molar enthalpy of dilution, kJ/mol [ref]
| Fixed | Measured | |||
|---|---|---|---|---|
| Initial molality of solute, mol/kg - Liquid | Temperature, K - Liquid | Pressure, kPa - Liquid | Final molality of solute, mol/kg - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
| 0.0016 | 298.15 | 101.00 | 0.0008 | 0.5000 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of allo-L-isoleucine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0250 | 998.88 |
| 293.15 | 0.0500 | 999.5 |
| 293.15 | 0.0750 | 1000.1 |
| 293.15 | 0.0999 | 1000.68 |
| 293.15 | 0.1249 | 1001.24 |
| 293.15 | 0.1500 | 1001.78 |
| 298.15 | 0.0250 | 997.71 |
| 298.15 | 0.0500 | 998.33 |
| 298.15 | 0.0750 | 998.93 |
| 298.15 | 0.0999 | 999.51 |
| 298.15 | 0.1249 | 1000.07 |
| 298.15 | 0.1500 | 1000.61 |
| 303.15 | 0.0250 | 996.32 |
| 303.15 | 0.0500 | 996.94 |
| 303.15 | 0.0750 | 997.54 |
| 303.15 | 0.0999 | 998.12 |
| 303.15 | 0.1249 | 998.68 |
| 303.15 | 0.1500 | 999.22 |
| 308.15 | 0.0250 | 994.71 |
| 308.15 | 0.0500 | 995.34 |
| 308.15 | 0.0750 | 995.94 |
| 308.15 | 0.0999 | 996.52 |
| 308.15 | 0.1249 | 997.08 |
| 308.15 | 0.1500 | 997.62 |
| 313.15 | 0.0250 | 992.9 |
| 313.15 | 0.0500 | 993.52 |
| 313.15 | 0.0750 | 994.13 |
| 313.15 | 0.0999 | 994.71 |
| 313.15 | 0.1249 | 995.27 |
| 313.15 | 0.1500 | 995.82 |
| 318.15 | 0.0250 | 990.89 |
| 318.15 | 0.0500 | 991.52 |
| 318.15 | 0.0750 | 992.13 |
| 318.15 | 0.0999 | 992.72 |
| 318.15 | 0.1249 | 993.28 |
| 318.15 | 0.1500 | 993.83 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 350 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of allo-L-isoleucine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 278.15 | 0.0101 | 1000.38 |
| 278.15 | 0.0204 | 1000.77 |
| 278.15 | 0.0402 | 1001.21 |
| 278.15 | 0.0799 | 1001.99 |
| 278.15 | 0.1601 | 1004.48 |
| 278.15 | 0.2125 | 1005.41 |
| 283.15 | 0.0101 | 1000.06 |
| 283.15 | 0.0204 | 1000.5 |
| 283.15 | 0.0402 | 1000.9 |
| 283.15 | 0.0799 | 1001.64 |
| 283.15 | 0.1601 | 1004.11 |
| 283.15 | 0.2125 | 1004.96 |
| 288.15 | 0.0101 | 999.45 |
| 288.15 | 0.0204 | 999.91 |
| 288.15 | 0.0402 | 1000.3 |
| 288.15 | 0.0799 | 1001.02 |
| 288.15 | 0.1601 | 1003.45 |
| 288.15 | 0.2125 | 1004.21 |
| 298.15 | 0.0101 | 997.37 |
| 298.15 | 0.0204 | 997.85 |
| 298.15 | 0.0402 | 998.2 |
| 298.15 | 0.0799 | 998.88 |
| 298.15 | 0.1601 | 1001.24 |
| 298.15 | 0.2125 | 1001.91 |
| 308.15 | 0.0101 | 994.35 |
| 308.15 | 0.0204 | 994.8 |
| 308.15 | 0.0402 | 995.15 |
| 308.15 | 0.0799 | 995.89 |
| 308.15 | 0.1601 | 998.12 |
| 308.15 | 0.2125 | 998.69 |
| 318.15 | 0.0101 | 990.51 |
| 318.15 | 0.0204 | 990.93 |
| 318.15 | 0.0402 | 991.31 |
| 318.15 | 0.0799 | 992.12 |
| 318.15 | 0.1601 | 994.2 |
| 318.15 | 0.2125 | 994.76 |
| 328.15 | 0.0101 | 985.99 |
| 328.15 | 0.0204 | 986.41 |
| 328.15 | 0.0402 | 986.78 |
| 328.15 | 0.0799 | 987.63 |
| 328.15 | 0.1601 | 989.64 |
| 328.15 | 0.2125 | 990.22 |
| 338.15 | 0.0101 | 980.86 |
| 338.15 | 0.0204 | 981.24 |
| 338.15 | 0.0402 | 981.65 |
| 338.15 | 0.0799 | 982.54 |
| 338.15 | 0.1601 | 984.44 |
| 338.15 | 0.2125 | 985.05 |
| 348.15 | 0.0101 | 975.14 |
| 348.15 | 0.0204 | 975.49 |
| 348.15 | 0.0402 | 975.92 |
| 348.15 | 0.0799 | 976.83 |
| 348.15 | 0.1601 | 978.7 |
| 348.15 | 0.2125 | 979.4 |
| 358.15 | 0.0101 | 968.97 |
| 358.15 | 0.0204 | 969.26 |
| 358.15 | 0.0402 | 969.7 |
| 358.15 | 0.0799 | 970.67 |
| 358.15 | 0.1601 | 972.46 |
| 358.15 | 0.2125 | 973.24 |
| 368.15 | 0.0101 | 962.2 |
| 368.15 | 0.0204 | 962.55 |
| 368.15 | 0.0402 | 962.98 |
| 368.15 | 0.0799 | 964.02 |
| 368.15 | 0.1601 | 965.73 |
| 368.15 | 0.2125 | 966.55 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of allo-L-isoleucine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0100 | 999.73 |
| 293.15 | 0.0100 | 998.55 |
| 298.15 | 0.0100 | 997.39 |
| 303.15 | 0.0100 | 996.0 |
| 308.15 | 0.0100 | 994.4 |
| 313.15 | 0.0100 | 992.58 |
| 318.15 | 0.0100 | 990.58 |
| 323.15 | 0.0100 | 988.3 |
| 288.15 | 0.0200 | 999.95 |
| 293.15 | 0.0200 | 998.78 |
| 298.15 | 0.0200 | 997.62 |
| 303.15 | 0.0200 | 996.24 |
| 308.15 | 0.0200 | 994.64 |
| 313.15 | 0.0200 | 992.82 |
| 318.15 | 0.0200 | 990.81 |
| 323.15 | 0.0200 | 988.56 |
| 288.15 | 0.0350 | 1000.25 |
| 293.15 | 0.0350 | 999.14 |
| 298.15 | 0.0350 | 997.97 |
| 303.15 | 0.0350 | 996.58 |
| 308.15 | 0.0350 | 994.98 |
| 313.15 | 0.0350 | 993.17 |
| 318.15 | 0.0350 | 991.16 |
| 323.15 | 0.0350 | 989.05 |
| 288.15 | 0.0500 | 1000.61 |
| 293.15 | 0.0500 | 999.49 |
| 298.15 | 0.0500 | 998.32 |
| 303.15 | 0.0500 | 996.93 |
| 308.15 | 0.0500 | 995.33 |
| 313.15 | 0.0500 | 993.52 |
| 318.15 | 0.0500 | 991.52 |
| 323.15 | 0.0500 | 989.5 |
| 288.15 | 0.0750 | 1001.22 |
| 293.15 | 0.0750 | 1000.08 |
| 298.15 | 0.0750 | 998.9 |
| 303.15 | 0.0750 | 997.51 |
| 308.15 | 0.0750 | 995.92 |
| 313.15 | 0.0750 | 994.1 |
| 318.15 | 0.0750 | 992.1 |
| 323.15 | 0.0750 | 990.19 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of allo-L-isoleucine (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0250 | 1497.2 |
| 298.15 | 0.0500 | 1497.9 |
| 298.15 | 0.0750 | 1499.0 |
| 298.15 | 0.0999 | 1500.5 |
| 298.15 | 0.1249 | 1502.4 |
| 298.15 | 0.1500 | 1504.7 |
| 303.15 | 0.0250 | 1508.7 |
| 303.15 | 0.0500 | 1509.4 |
| 303.15 | 0.0750 | 1510.5 |
| 303.15 | 0.0999 | 1512.0 |
| 303.15 | 0.1249 | 1513.9 |
| 303.15 | 0.1500 | 1516.2 |
| 308.15 | 0.0250 | 1520.1 |
| 308.15 | 0.0500 | 1520.7 |
| 308.15 | 0.0750 | 1521.8 |
| 308.15 | 0.0999 | 1523.3 |
| 308.15 | 0.1249 | 1525.1 |
| 308.15 | 0.1500 | 1527.4 |
| 313.15 | 0.0250 | 1527.0 |
| 313.15 | 0.0500 | 1527.7 |
| 313.15 | 0.0750 | 1528.7 |
| 313.15 | 0.0999 | 1530.2 |
| 313.15 | 0.1249 | 1532.0 |
| 313.15 | 0.1500 | 1534.2 |
| 318.15 | 0.0250 | 1533.2 |
| 318.15 | 0.0500 | 1533.8 |
| 318.15 | 0.0750 | 1534.8 |
| 318.15 | 0.0999 | 1536.2 |
| 318.15 | 0.1249 | 1538.0 |
| 318.15 | 0.1500 | 1540.1 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of allo-L-isoleucine (1) - Liquid | Speed of sound, m/s - Liquid |
| 288.15 | 0.0100 | 1471.2 |
| 293.15 | 0.0100 | 1483.5 |
| 298.15 | 0.0100 | 1495.6 |
| 303.15 | 0.0100 | 1507.1 |
| 308.15 | 0.0100 | 1518.5 |
| 313.15 | 0.0100 | 1525.5 |
| 318.15 | 0.0100 | 1531.7 |
| 323.15 | 0.0100 | 1537.7 |
| 288.15 | 0.0200 | 1472.1 |
| 293.15 | 0.0200 | 1484.0 |
| 298.15 | 0.0200 | 1496.2 |
| 303.15 | 0.0200 | 1507.7 |
| 308.15 | 0.0200 | 1519.1 |
| 313.15 | 0.0200 | 1526.1 |
| 318.15 | 0.0200 | 1532.3 |
| 323.15 | 0.0200 | 1538.4 |
| 288.15 | 0.0350 | 1473.4 |
| 293.15 | 0.0350 | 1485.0 |
| 298.15 | 0.0350 | 1497.1 |
| 303.15 | 0.0350 | 1508.6 |
| 308.15 | 0.0350 | 1520.0 |
| 313.15 | 0.0350 | 1526.9 |
| 318.15 | 0.0350 | 1533.1 |
| 323.15 | 0.0350 | 1539.3 |
| 288.15 | 0.0500 | 1474.8 |
| 293.15 | 0.0500 | 1486.1 |
| 298.15 | 0.0500 | 1498.0 |
| 303.15 | 0.0500 | 1509.5 |
| 308.15 | 0.0500 | 1520.9 |
| 313.15 | 0.0500 | 1527.8 |
| 318.15 | 0.0500 | 1533.9 |
| 323.15 | 0.0500 | 1540.0 |
| 288.15 | 0.0750 | 1475.9 |
| 293.15 | 0.0750 | 1487.4 |
| 298.15 | 0.0750 | 1499.5 |
| 303.15 | 0.0750 | 1511.0 |
| 308.15 | 0.0750 | 1522.3 |
| 313.15 | 0.0750 | 1529.3 |
| 318.15 | 0.0750 | 1535.3 |
| 323.15 | 0.0750 | 1541.1 |
Binary diffusion coefficient, m2/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Binary diffusion coefficient, m2/s - Liquid |
|---|---|
| 293.20 | 0.0000 |
| 298.20 | 0.0000 |
| 303.20 | 0.0000 |
| 313.20 | 0.0000 |
| 323.20 | 0.0000 |
| 333.20 | 0.0000 |
Binary diffusion coefficient, m2/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Binary diffusion coefficient, m2/s - Liquid |
|---|---|
| 293.20 | 0.0000 |
| 298.20 | 0.0000 |
| 303.20 | 0.0000 |
| 313.20 | 0.0000 |
| 323.20 | 0.0000 |
| 333.20 | 0.0000 |
Binary diffusion coefficient, m2/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298 (Liquid)
| Amount concentration (molarity), mol/dm3 of allo-L-isoleucine (1) - Liquid | Binary diffusion coefficient, m2/s - Liquid |
|---|---|
| 0.0101 | 0.0000 |
| 0.0203 | 0.0000 |
| 0.0301 | 0.0000 |
| 0.0399 | 0.0000 |
| 0.0500 | 0.0000 |
Sources
- KCl effect on the solubility of five different amino acids in water
- Solubility of l-serine, l-threonine and l-isoleucine in aqueous aliphatic alcohol solutions
- Thermodynamics of proton dissociations from aqueous threonine and isoleucine at temperatures from (278.15 to 393.15) K, molalities from (0.01 to 1.0) mol * kg-1, and at the pressure 0.35 MPa: Apparent molar heat capacities and apparent molar volumes of zwitterionic, protonated cationic, and deprotonated anionic forms
- Study of the interactions of PAMAM-NH2 G4 dendrimer with selected natural amino acids in aqueous solutions
- Study of (solute + solute) and (solute + solvent) interactions of homologous series of some .alpha.-amino acids in aqueous-streptomycin sulfate solutions at different temperatures by using physicochemical methods
- Expliciting the {Ciprofloxacin Hydrochloride + (Glycine/l-Isoleucine)} Interactions in Aqueous Solution over the Temperature range T = 288.15-323.15 K and at Pressure p = 1 x 105 Pa: Volumetric, Acoustic, Calorimetric, and Absorption studies
- Electrolytic Effect on the Solubility and Solvation Thermodynamics of l-Serine and l-Isoleucine in Aqueous Media
- Studies on the Diffusion Coefficients of Amino Acids in Aqueous Solutions
- Infinite Dilution Binary Diffusion Coefficients of Several r-Amino Acids in Water over a Temperature Range from (293.2 to 333.2) K with the Taylor Dispersion Technique
Note: These property values are available through the Cheméo API. A free account gives you an access key.