- Name
- Pentanoic acid, 4-oxo-, ethyl ester
- InChI
- InChI=1S/C7H12O3/c1-3-10-7(9)5-4-6(2)8/h3-5H2,1-2H3
- InChI Key
- GMEONFUTDYJSNV-UHFFFAOYSA-N
- Formula
- C7H12O3
- SMILES
- CCOC(=O)CCC(C)=O
- Mol. Weight (g/mol)
- 144.17
- CAS
- 539-88-8
- Name
- Sulfur dioxide
- InChI
- InChI=1S/O2S/c1-3-2
- InChI Key
- RAHZWNYVWXNFOC-UHFFFAOYSA-N
- Formula
- O2S
- SMILES
- O=S=O
- Mol. Weight (g/mol)
- 64.06
- CAS
- 7446-09-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Molality, mol/kg of Sulfur dioxide (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Molality, mol/kg of Sulfur dioxide (2) - Liquid |
| 293.15 | 3.30 | 0.3480 |
| 293.15 | 6.30 | 0.6670 |
| 293.15 | 9.30 | 0.9690 |
| 293.15 | 15.30 | 1.545 |
| 293.15 | 21.70 | 2.137 |
| 293.15 | 30.20 | 2.885 |
| 293.15 | 40.40 | 3.75 |
| 293.15 | 49.50 | 4.5 |
| 293.15 | 60.10 | 5.387 |
| 293.15 | 69.90 | 6.196 |
| 293.15 | 79.20 | 6.975 |
| 293.15 | 88.80 | 7.799 |
| 293.15 | 100.60 | 8.842 |
| 293.15 | 110.30 | 9.736 |
| 293.15 | 119.70 | 10.634 |
| 303.15 | 8.90 | 0.6130 |
| 303.15 | 18.30 | 1.212 |
| 303.15 | 25.30 | 1.603 |
| 303.15 | 31.90 | 2.022 |
| 303.15 | 41.20 | 2.579 |
| 303.15 | 50.50 | 3.109 |
| 303.15 | 60.10 | 3.721 |
| 303.15 | 71.70 | 4.382 |
| 303.15 | 79.30 | 4.906 |
| 303.15 | 88.50 | 5.445 |
| 303.15 | 98.60 | 6.081 |
| 303.15 | 108.20 | 6.734 |
| 303.15 | 118.10 | 7.341 |
| 313.15 | 3.70 | 0.1790 |
| 313.15 | 6.30 | 0.3020 |
| 313.15 | 10.60 | 0.5090 |
| 313.15 | 15.00 | 0.7160 |
| 313.15 | 21.10 | 0.9860 |
| 313.15 | 31.10 | 1.437 |
| 313.15 | 40.50 | 1.846 |
| 313.15 | 50.00 | 2.25 |
| 313.15 | 60.10 | 2.677 |
| 313.15 | 70.30 | 3.1 |
| 313.15 | 80.10 | 3.509 |
| 313.15 | 90.10 | 3.923 |
| 313.15 | 100.20 | 4.346 |
| 313.15 | 110.30 | 4.766 |
| 313.15 | 120.00 | 5.17 |
| 323.15 | 3.10 | 0.1090 |
| 323.15 | 6.50 | 0.2300 |
| 323.15 | 9.60 | 0.3350 |
| 323.15 | 14.60 | 0.5050 |
| 323.15 | 20.50 | 0.6950 |
| 323.15 | 30.90 | 1.034 |
| 323.15 | 43.10 | 1.424 |
| 323.15 | 50.00 | 1.641 |
| 323.15 | 59.70 | 1.948 |
| 323.15 | 70.50 | 2.277 |
| 323.15 | 79.80 | 2.561 |
| 323.15 | 89.90 | 2.871 |
| 323.15 | 100.50 | 3.195 |
| 323.15 | 110.50 | 3.499 |
| 323.15 | 120.50 | 3.805 |
| 333.15 | 3.30 | 0.0870 |
| 333.15 | 6.90 | 0.1790 |
| 333.15 | 9.80 | 0.2520 |
| 333.15 | 14.90 | 0.3800 |
| 333.15 | 19.70 | 0.4990 |
| 333.15 | 30.60 | 0.7660 |
| 333.15 | 41.40 | 1.025 |
| 333.15 | 51.30 | 1.26 |
| 333.15 | 60.20 | 1.471 |
| 333.15 | 69.70 | 1.696 |
| 333.15 | 81.70 | 1.979 |
| 333.15 | 90.00 | 2.169 |
| 333.15 | 99.70 | 2.394 |
| 333.15 | 109.60 | 2.625 |
| 333.15 | 120.10 | 2.865 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.