- Name
- Sulfur dioxide
- InChI
- InChI=1S/O2S/c1-3-2
- InChI Key
- RAHZWNYVWXNFOC-UHFFFAOYSA-N
- Formula
- O2S
- SMILES
- O=S=O
- Mol. Weight (g/mol)
- 64.06
- CAS
- 7446-09-5
- Name
- Pentanoic acid, 4-oxo-, butyl ester
- InChI
- InChI=1S/C9H16O3/c1-3-4-7-12-9(11)6-5-8(2)10/h3-7H2,1-2H3
- InChI Key
- ISBWNEKJSSLXOD-UHFFFAOYSA-N
- Formula
- C9H16O3
- SMILES
- CCCCOC(=O)CCC(C)=O
- Mol. Weight (g/mol)
- 172.22
- CAS
- 2052-15-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Molality, mol/kg of Sulfur dioxide (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Molality, mol/kg of Sulfur dioxide (1) - Liquid |
| 293.15 | 3.20 | 0.2540 |
| 293.15 | 6.70 | 0.5020 |
| 293.15 | 10.00 | 0.7370 |
| 293.15 | 15.20 | 1.091 |
| 293.15 | 20.20 | 1.425 |
| 293.15 | 29.80 | 2.046 |
| 293.15 | 39.80 | 2.717 |
| 293.15 | 50.20 | 3.409 |
| 293.15 | 59.80 | 4.052 |
| 293.15 | 70.00 | 4.732 |
| 293.15 | 80.30 | 5.427 |
| 293.15 | 90.00 | 6.093 |
| 293.15 | 98.40 | 6.693 |
| 293.15 | 105.80 | 7.246 |
| 293.15 | 117.90 | 8.155 |
| 303.15 | 7.30 | 0.3780 |
| 303.15 | 10.20 | 0.5240 |
| 303.15 | 15.40 | 0.7810 |
| 303.15 | 20.30 | 1.017 |
| 303.15 | 30.20 | 1.497 |
| 303.15 | 40.20 | 1.961 |
| 303.15 | 50.10 | 2.427 |
| 303.15 | 60.70 | 2.914 |
| 303.15 | 71.00 | 3.391 |
| 303.15 | 80.90 | 3.87 |
| 303.15 | 91.10 | 4.356 |
| 303.15 | 100.90 | 4.859 |
| 303.15 | 110.30 | 5.345 |
| 303.15 | 120.40 | 5.855 |
| 313.15 | 3.40 | 0.1300 |
| 313.15 | 6.30 | 0.2360 |
| 313.15 | 9.50 | 0.3560 |
| 313.15 | 15.20 | 0.5680 |
| 313.15 | 20.40 | 0.7580 |
| 313.15 | 30.10 | 1.111 |
| 313.15 | 40.60 | 1.479 |
| 313.15 | 50.30 | 1.82 |
| 313.15 | 60.00 | 2.152 |
| 313.15 | 70.50 | 2.514 |
| 313.15 | 81.00 | 2.875 |
| 313.15 | 91.30 | 3.224 |
| 313.15 | 101.20 | 3.564 |
| 313.15 | 111.00 | 3.906 |
| 313.15 | 119.70 | 4.207 |
| 323.15 | 3.60 | 0.0970 |
| 323.15 | 7.30 | 0.1970 |
| 323.15 | 10.10 | 0.2760 |
| 323.15 | 19.60 | 0.5290 |
| 323.15 | 30.40 | 0.8160 |
| 323.15 | 41.10 | 1.094 |
| 323.15 | 51.90 | 1.374 |
| 323.15 | 60.10 | 1.586 |
| 323.15 | 69.90 | 1.834 |
| 323.15 | 80.50 | 2.107 |
| 323.15 | 90.60 | 2.364 |
| 323.15 | 99.90 | 2.6 |
| 323.15 | 110.60 | 2.871 |
| 323.15 | 121.10 | 3.136 |
| 333.15 | 3.80 | 0.0800 |
| 333.15 | 7.70 | 0.1630 |
| 333.15 | 11.40 | 0.2390 |
| 333.15 | 15.10 | 0.3110 |
| 333.15 | 20.60 | 0.4190 |
| 333.15 | 30.70 | 0.6230 |
| 333.15 | 40.20 | 0.8060 |
| 333.15 | 51.10 | 1.021 |
| 333.15 | 60.30 | 1.2 |
| 333.15 | 70.00 | 1.387 |
| 333.15 | 80.30 | 1.585 |
| 333.15 | 91.20 | 1.798 |
| 333.15 | 100.70 | 1.982 |
| 333.15 | 110.80 | 2.176 |
| 333.15 | 121.00 | 2.373 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.