- Name
- Sulfur dioxide
- InChI
- InChI=1S/O2S/c1-3-2
- InChI Key
- RAHZWNYVWXNFOC-UHFFFAOYSA-N
- Formula
- O2S
- SMILES
- O=S=O
- Mol. Weight (g/mol)
- 64.06
- CAS
- 7446-09-5
- Name
- Butanedioic acid, dibutyl ester
- InChI
- InChI=1S/C12H22O4/c1-3-5-9-15-11(13)7-8-12(14)16-10-6-4-2/h3-10H2,1-2H3
- InChI Key
- YUXIBTJKHLUKBD-UHFFFAOYSA-N
- Formula
- C12H22O4
- SMILES
- CCCCOC(=O)CCC(=O)OCCCC
- Mol. Weight (g/mol)
- 230.30
- CAS
- 141-03-7
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Molality, mol/kg of Sulfur dioxide (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Molality, mol/kg of Sulfur dioxide (1) - Liquid |
| 293.15 | 3.60 | 0.1950 |
| 293.15 | 7.40 | 0.3930 |
| 293.15 | 10.00 | 0.5230 |
| 293.15 | 14.90 | 0.7780 |
| 293.15 | 19.90 | 1.024 |
| 293.15 | 30.10 | 1.527 |
| 293.15 | 40.00 | 2.003 |
| 293.15 | 50.00 | 2.485 |
| 293.15 | 59.80 | 2.956 |
| 293.15 | 69.70 | 3.44 |
| 293.15 | 80.10 | 3.946 |
| 293.15 | 90.00 | 4.45 |
| 293.15 | 99.30 | 4.939 |
| 293.15 | 109.20 | 5.482 |
| 293.15 | 119.00 | 6.026 |
| 303.15 | 3.60 | 0.1340 |
| 303.15 | 6.50 | 0.2400 |
| 303.15 | 9.70 | 0.3540 |
| 303.15 | 15.60 | 0.5750 |
| 303.15 | 19.30 | 0.7060 |
| 303.15 | 30.20 | 1.091 |
| 303.15 | 39.90 | 1.429 |
| 303.15 | 49.80 | 1.771 |
| 303.15 | 59.40 | 2.1 |
| 303.15 | 70.00 | 2.466 |
| 303.15 | 80.10 | 2.812 |
| 303.15 | 90.50 | 3.176 |
| 303.15 | 99.60 | 3.5 |
| 303.15 | 109.10 | 3.842 |
| 303.15 | 119.10 | 4.211 |
| 313.15 | 6.90 | 0.1720 |
| 313.15 | 11.40 | 0.2850 |
| 313.15 | 15.90 | 0.3980 |
| 313.15 | 20.00 | 0.4970 |
| 313.15 | 30.30 | 0.7490 |
| 313.15 | 40.40 | 0.9930 |
| 313.15 | 49.70 | 1.218 |
| 313.15 | 60.00 | 1.465 |
| 313.15 | 70.20 | 1.714 |
| 313.15 | 80.20 | 1.954 |
| 313.15 | 90.10 | 2.194 |
| 313.15 | 99.50 | 2.427 |
| 313.15 | 109.10 | 2.662 |
| 313.15 | 119.50 | 2.918 |
| 323.15 | 2.60 | 0.0480 |
| 323.15 | 6.90 | 0.1260 |
| 323.15 | 9.70 | 0.1770 |
| 323.15 | 14.90 | 0.2720 |
| 323.15 | 19.60 | 0.3570 |
| 323.15 | 29.40 | 0.5320 |
| 323.15 | 41.00 | 0.7380 |
| 323.15 | 50.00 | 0.8970 |
| 323.15 | 60.70 | 1.087 |
| 323.15 | 69.40 | 1.241 |
| 323.15 | 80.70 | 1.437 |
| 323.15 | 89.60 | 1.601 |
| 323.15 | 99.90 | 1.788 |
| 323.15 | 109.40 | 1.961 |
| 323.15 | 119.90 | 2.147 |
| 333.15 | 3.20 | 0.0460 |
| 333.15 | 6.40 | 0.0890 |
| 333.15 | 9.30 | 0.1280 |
| 333.15 | 15.00 | 0.2040 |
| 333.15 | 20.00 | 0.2760 |
| 333.15 | 30.50 | 0.4170 |
| 333.15 | 40.60 | 0.5540 |
| 333.15 | 50.30 | 0.6840 |
| 333.15 | 60.50 | 0.8230 |
| 333.15 | 69.30 | 0.9410 |
| 333.15 | 80.10 | 1.088 |
| 333.15 | 90.80 | 1.232 |
| 333.15 | 99.60 | 1.353 |
| 333.15 | 110.10 | 1.496 |
| 333.15 | 120.70 | 1.643 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.