- Name
- N,N'-dibutyloxalamide
- InChI
- InChI=1S/C10H20N2O2/c1-3-5-7-11-9(13)10(14)12-8-6-4-2/h3-8H2,1-2H3,(H,11,13)(H,12,14)
- InChI Key
- YUUVWMFUVGZOHK-UHFFFAOYSA-N
- Formula
- C10H20N2O2
- SMILES
- CCCCNC(=O)C(=O)NCCCC
- Mol. Weight (g/mol)
- 200.28
- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of N,N'-dibutyloxalamide (1) - Fluid (supercritical or subcritical phases) | Mass density, kg/m3 - Fluid (supercritical or subcritical phases) |
| 313.00 | 9100.00 | 0.0003 | 517.19 |
| 313.00 | 9300.00 | 0.0005 | 556.08 |
| 313.00 | 9500.00 | 0.0008 | 584.52 |
| 313.00 | 9700.00 | 0.0011 | 606.4 |
| 313.00 | 9800.00 | 0.0013 | 615.65 |
| 323.00 | 10300.00 | 0.0002 | 423.74 |
| 323.00 | 10600.00 | 0.0003 | 460.74 |
| 323.00 | 10900.00 | 0.0005 | 495.1 |
| 323.00 | 11100.00 | 0.0007 | 515.81 |
| 323.00 | 11300.00 | 0.0009 | 534.61 |
| 333.00 | 11600.00 | 0.0003 | 405.21 |
| 333.00 | 12000.00 | 0.0005 | 436.26 |
| 333.00 | 12300.00 | 0.0007 | 458.89 |
| 333.00 | 12500.00 | 0.0009 | 473.43 |
| 333.00 | 12700.00 | 0.0011 | 487.42 |
| 343.00 | 12100.00 | 0.0004 | 352.31 |
| 343.00 | 12500.00 | 0.0005 | 374.67 |
| 343.00 | 12800.00 | 0.0006 | 391.64 |
| 343.00 | 13000.00 | 0.0008 | 402.95 |
| 343.00 | 13200.00 | 0.0009 | 414.22 |
| 353.00 | 12600.00 | 0.0004 | 322.59 |
| 353.00 | 13100.00 | 0.0005 | 344.33 |
| 353.00 | 13500.00 | 0.0007 | 362.01 |
| 353.00 | 13800.00 | 0.0008 | 375.36 |
| 353.00 | 14000.00 | 0.0010 | 384.26 |
Solid-liquid equilibrium temperature, K [ref]
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of N,N'-dibutyloxalamide (1) - Fluid (supercritical or subcritical phases) | Solid-liquid equilibrium temperature, K - Fluid (supercritical or subcritical phases) |
| 9100.00 | 0.0003 | 313.00 |
| 9300.00 | 0.0005 | 313.00 |
| 9500.00 | 0.0008 | 313.00 |
| 9700.00 | 0.0011 | 313.00 |
| 9800.00 | 0.0013 | 313.00 |
| 10300.00 | 0.0002 | 323.00 |
| 10600.00 | 0.0003 | 323.00 |
| 10900.00 | 0.0005 | 323.00 |
| 11100.00 | 0.0007 | 323.00 |
| 11300.00 | 0.0009 | 323.00 |
| 11600.00 | 0.0003 | 333.00 |
| 12000.00 | 0.0005 | 333.00 |
| 12100.00 | 0.0004 | 343.00 |
| 12300.00 | 0.0007 | 333.00 |
| 12500.00 | 0.0005 | 343.00 |
| 12500.00 | 0.0009 | 333.00 |
| 12600.00 | 0.0004 | 353.00 |
| 12700.00 | 0.0011 | 333.00 |
| 12800.00 | 0.0006 | 343.00 |
| 13000.00 | 0.0008 | 343.00 |
| 13100.00 | 0.0005 | 353.00 |
| 13200.00 | 0.0009 | 343.00 |
| 13500.00 | 0.0007 | 353.00 |
| 13800.00 | 0.0008 | 353.00 |
| 14000.00 | 0.0010 | 353.00 |