- Name
- 2-Propanol, 2-methyl-
- InChI
- InChI=1S/C4H10O/c1-4(2,3)5/h5H,1-3H3
- InChI Key
- DKGAVHZHDRPRBM-UHFFFAOYSA-N
- Formula
- C4H10O
- SMILES
- CC(C)(C)O
- Mol. Weight (g/mol)
- 74.12
- CAS
- 75-65-0
- Name
- Dimethyl Sulfoxide
- InChI
- InChI=1S/C2H6OS/c1-4(2)3/h1-2H3
- InChI Key
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N
- Formula
- C2H6OS
- SMILES
- CS(C)=O
- Mol. Weight (g/mol)
- 78.13
- CAS
- 67-68-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Propanol, 2-methyl- (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 298.15 | 0.0183 | 0.0392 |
| 298.15 | 0.0361 | 0.0369 |
| 298.15 | 0.0695 | 0.0342 |
| 298.15 | 0.1008 | 0.0324 |
| 298.15 | 0.1301 | 0.0310 |
| 298.15 | 0.1832 | 0.0292 |
| 298.15 | 0.2302 | 0.0281 |
| 298.15 | 0.3096 | 0.0263 |
| 298.15 | 0.4022 | 0.0250 |
| 298.15 | 0.4928 | 0.0237 |
| 298.15 | 0.5736 | 0.0229 |
| 298.15 | 0.6322 | 0.0222 |
| 298.15 | 0.6767 | 0.0217 |
| 298.15 | 0.7115 | 0.0215 |
| 298.15 | 0.8511 | 0.0206 |
| 308.15 | 0.0183 | 0.0383 |
| 308.15 | 0.0361 | 0.0360 |
| 308.15 | 0.0695 | 0.0334 |
| 308.15 | 0.1008 | 0.0315 |
| 308.15 | 0.1301 | 0.0302 |
| 308.15 | 0.1832 | 0.0284 |
| 308.15 | 0.2302 | 0.0272 |
| 308.15 | 0.3096 | 0.0255 |
| 308.15 | 0.4022 | 0.0242 |
| 308.15 | 0.4928 | 0.0230 |
| 308.15 | 0.5736 | 0.0220 |
| 308.15 | 0.6322 | 0.0214 |
| 308.15 | 0.6767 | 0.0210 |
| 308.15 | 0.7115 | 0.0208 |
| 308.15 | 0.8511 | 0.0199 |
| 318.15 | 0.0183 | 0.0376 |
| 318.15 | 0.0361 | 0.0353 |
| 318.15 | 0.0695 | 0.0327 |
| 318.15 | 0.1008 | 0.0308 |
| 318.15 | 0.1301 | 0.0295 |
| 318.15 | 0.1832 | 0.0277 |
| 318.15 | 0.2302 | 0.0265 |
| 318.15 | 0.3096 | 0.0250 |
| 318.15 | 0.4022 | 0.0237 |
| 318.15 | 0.4928 | 0.0224 |
| 318.15 | 0.5736 | 0.0214 |
| 318.15 | 0.6322 | 0.0209 |
| 318.15 | 0.6767 | 0.0205 |
| 318.15 | 0.7115 | 0.0202 |
| 318.15 | 0.8511 | 0.0190 |
| 328.15 | 0.0183 | 0.0365 |
| 328.15 | 0.0361 | 0.0343 |
| 328.15 | 0.0695 | 0.0317 |
| 328.15 | 0.1008 | 0.0299 |
| 328.15 | 0.1301 | 0.0285 |
| 328.15 | 0.1832 | 0.0268 |
| 328.15 | 0.2302 | 0.0257 |
| 328.15 | 0.3096 | 0.0242 |
| 328.15 | 0.4022 | 0.0229 |
| 328.15 | 0.4928 | 0.0216 |
| 328.15 | 0.5736 | 0.0206 |
| 328.15 | 0.6322 | 0.0201 |
| 328.15 | 0.6767 | 0.0197 |
| 328.15 | 0.7115 | 0.0194 |
| 328.15 | 0.8511 | 0.0183 |
| 298.15 | 0.0000 | 0.0423 |
| 308.15 | 0.0000 | 0.0412 |
| 318.15 | 0.0000 | 0.0401 |
| 328.15 | 0.0000 | 0.0389 |
| 298.15 | 1.0000 | 0.0200 |
| 308.15 | 1.0000 | 0.0193 |
| 318.15 | 1.0000 | 0.0183 |
| 328.15 | 1.0000 | 0.0176 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.