- Name
- Pyridine, 2,6-dimethyl-
- InChI
- InChI=1S/C7H9N/c1-6-4-3-5-7(2)8-6/h3-5H,1-2H3
- InChI Key
- OISVCGZHLKNMSJ-UHFFFAOYSA-N
- Formula
- C7H9N
- SMILES
- Cc1cccc(C)n1
- Mol. Weight (g/mol)
- 107.16
- CAS
- 108-48-5
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Lower consolute composition: mole fraction
- Heat capacity at constant pressure per volume, J/K/m3 (2)
- Lower consolute temperature, K (2)
- η - Viscosity, Pa*s
- Excess molar enthalpy (molar enthalpy
- ρl - Mass density, kg/m3
Lower consolute composition: mole fraction of Pyridine, 2,6-dimethyl- (1) [ref]
| Lower consolute composition: mole fraction of Pyridine, 2,6-dimethyl- (1) - Liquid mixture 1 |
|---|
| 0.0660 |
Heat capacity at constant pressure per volume, J/K/m3 [ref]
Operational condition: Mole fraction = 0.066 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Heat capacity at constant pressure per volume, J/K/m3 - Liquid mixture 1 |
|---|---|
| 270.67 | 3943000.00 |
| 271.17 | 3939000.00 |
| 271.67 | 3932000.00 |
| 272.17 | 3933000.00 |
| 272.67 | 3929000.00 |
| 273.17 | 3934000.00 |
| 273.67 | 3928000.00 |
| 274.17 | 3930000.00 |
| 274.67 | 3924000.00 |
| 275.17 | 3925000.00 |
| 275.67 | 3922000.00 |
| 276.17 | 3920000.00 |
| 276.67 | 3918000.00 |
| 277.17 | 3918000.00 |
| 277.67 | 3919000.00 |
| 278.17 | 3918000.00 |
| 278.67 | 3916000.00 |
| 279.17 | 3913000.00 |
| 279.67 | 3916000.00 |
| 280.17 | 3914000.00 |
| 280.67 | 3914000.00 |
| 281.18 | 3913000.00 |
| 281.68 | 3910000.00 |
| 282.18 | 3910000.00 |
| 282.68 | 3907000.00 |
| 283.18 | 3907000.00 |
| 283.68 | 3904000.00 |
| 284.18 | 3907000.00 |
| 284.68 | 3905000.00 |
| 285.18 | 3909000.00 |
| 285.68 | 3905000.00 |
| 286.18 | 3903000.00 |
| 286.68 | 3907000.00 |
| 287.18 | 3907000.00 |
| 287.68 | 3910000.00 |
| 288.18 | 3913000.00 |
| 288.68 | 3913000.00 |
| 289.18 | 3912000.00 |
| 289.68 | 3912000.00 |
| 290.18 | 3910000.00 |
| 290.68 | 3913000.00 |
| 291.18 | 3912000.00 |
| 291.68 | 3913000.00 |
| 292.18 | 3916000.00 |
| 292.68 | 3917000.00 |
| 293.18 | 3915000.00 |
| 293.68 | 3911000.00 |
| 294.18 | 3914000.00 |
| 294.68 | 3914000.00 |
| 295.18 | 3913000.00 |
| 295.68 | 3912000.00 |
| 296.18 | 3913000.00 |
| 296.68 | 3912000.00 |
| 297.18 | 3914000.00 |
| 297.69 | 3914000.00 |
| 298.19 | 3918000.00 |
| 298.69 | 3919000.00 |
| 299.19 | 3916000.00 |
| 299.78 | 3918000.00 |
| 299.99 | 3916000.00 |
| 300.20 | 3912000.00 |
| 300.41 | 3920000.00 |
| 300.62 | 3927000.00 |
| 300.84 | 3944000.00 |
| 301.05 | 3932000.00 |
| 301.26 | 3930000.00 |
| 301.47 | 3942000.00 |
| 301.69 | 3950000.00 |
| 301.90 | 3947000.00 |
| 302.11 | 3945000.00 |
| 302.32 | 3932000.00 |
| 302.54 | 3934000.00 |
| 302.75 | 3933000.00 |
| 302.96 | 3962000.00 |
| 303.17 | 3969000.00 |
| 303.38 | 3938000.00 |
| 303.60 | 3938000.00 |
| 303.81 | 3935000.00 |
| 304.02 | 3948000.00 |
| 304.23 | 3973000.00 |
| 304.44 | 3963000.00 |
| 304.66 | 3960000.00 |
| 304.87 | 3953000.00 |
| 305.08 | 3960000.00 |
| 305.29 | 3975000.00 |
| 305.51 | 3976000.00 |
| 305.72 | 3956000.00 |
| 305.93 | 4006000.00 |
| 306.14 | 4011000.00 |
| 306.36 | 4082000.00 |
| 306.57 | 4075000.00 |
Heat capacity at constant pressure per volume, J/K/m3 [ref]
Operational conditions:
- Mole fraction = 0.066 (Liquid)
- Pressure, kPa = 102.6 (Liquid)
| Temperature, K - Liquid | Heat capacity at constant pressure per volume, J/K/m3 - Liquid |
|---|---|
| 306.78 | 4520000.00 |
| 306.99 | 4372000.00 |
| 307.20 | 4347000.00 |
| 307.42 | 4321000.00 |
| 307.63 | 4254000.00 |
| 307.84 | 4227000.00 |
| 308.05 | 4182000.00 |
| 308.27 | 4223000.00 |
| 308.48 | 4199000.00 |
| 308.69 | 4189000.00 |
| 308.90 | 4170000.00 |
| 309.12 | 4188000.00 |
| 309.33 | 4206000.00 |
| 309.54 | 4165000.00 |
| 309.75 | 4175000.00 |
| 309.96 | 4206000.00 |
| 310.18 | 4189000.00 |
| 310.39 | 4172000.00 |
| 310.60 | 4170000.00 |
| 310.81 | 4154000.00 |
| 311.03 | 4103000.00 |
| 311.24 | 4121000.00 |
| 311.45 | 4142000.00 |
| 311.66 | 4101000.00 |
| 311.88 | 4141000.00 |
| 312.09 | 4083000.00 |
| 312.30 | 4117000.00 |
| 312.51 | 4078000.00 |
| 312.73 | 4100000.00 |
Lower consolute temperature, K [ref]
| Lower consolute temperature, K - Liquid mixture 1 |
|---|
| 306.66 |
Lower consolute temperature, K [ref]
| Lower consolute temperature, K - Liquid mixture 1 |
|---|
| 306.39 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Pyridine, 2,6-dimethyl- (1) - Liquid | Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
| 0.0297 | 292.65 | 0.0018 |
| 0.0297 | 298.15 | 0.0016 |
| 0.0297 | 302.02 | 0.0014 |
| 0.0501 | 292.76 | 0.0025 |
| 0.0501 | 298.21 | 0.0021 |
| 0.0501 | 303.17 | 0.0019 |
| 0.0602 | 292.71 | 0.0028 |
| 0.0602 | 298.19 | 0.0024 |
| 0.0602 | 303.05 | 0.0022 |
| 0.1001 | 292.73 | 0.0038 |
| 0.1001 | 298.20 | 0.0031 |
| 0.1001 | 303.08 | 0.0027 |
| 0.2004 | 292.73 | 0.0055 |
| 0.2004 | 298.23 | 0.0043 |
| 0.2004 | 303.02 | 0.0035 |
| 0.3006 | 292.69 | 0.0055 |
| 0.3006 | 298.12 | 0.0044 |
| 0.3006 | 303.17 | 0.0035 |
| 0.3981 | 292.89 | 0.0046 |
| 0.3981 | 298.17 | 0.0037 |
| 0.3981 | 303.19 | 0.0031 |
| 0.3981 | 308.21 | 0.0026 |
| 0.3981 | 313.31 | 0.0022 |
| 0.3981 | 318.34 | 0.0019 |
| 0.5008 | 292.75 | 0.0034 |
| 0.5008 | 298.16 | 0.0028 |
| 0.5008 | 303.19 | 0.0025 |
| 0.5008 | 308.18 | 0.0021 |
| 0.5008 | 313.25 | 0.0018 |
| 0.5008 | 318.30 | 0.0016 |
| 0.6510 | 292.79 | 0.0021 |
| 0.6510 | 298.20 | 0.0018 |
| 0.6510 | 303.26 | 0.0016 |
| 0.6510 | 308.26 | 0.0014 |
| 0.6510 | 313.32 | 0.0013 |
| 0.6510 | 318.37 | 0.0011 |
| 0.7887 | 292.79 | 0.0011 |
| 0.7887 | 298.19 | 0.0010 |
| 0.7887 | 303.23 | 0.0010 |
| 0.7887 | 308.23 | 0.0009 |
| 0.7887 | 313.34 | 0.0008 |
| 0.7887 | 318.36 | 0.0008 |
| 1.0000 | 292.65 | 0.0009 |
| 1.0000 | 298.20 | 0.0008 |
| 1.0000 | 303.24 | 0.0008 |
| 1.0000 | 308.26 | 0.0007 |
| 1.0000 | 313.34 | 0.0007 |
| 1.0000 | 318.39 | 0.0006 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Pyridine, 2,6-dimethyl- (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0008 | -0.0116 |
| 0.0008 | -0.0117 |
| 0.0015 | -0.0237 |
| 0.0015 | -0.0237 |
| 0.0023 | -0.0358 |
| 0.0023 | -0.0360 |
| 0.0031 | -0.0481 |
| 0.0031 | -0.0481 |
| 0.0038 | -0.0604 |
| 0.0039 | -0.0603 |
| 0.0046 | -0.0724 |
| 0.0046 | -0.0724 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Pyridine, 2,6-dimethyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0008 | 996.946 |
| 0.0008 | 996.945 |
| 0.0015 | 996.862 |
| 0.0015 | 996.861 |
| 0.0023 | 996.792 |
| 0.0023 | 996.791 |
| 0.0031 | 996.732 |
| 0.0031 | 996.734 |
| 0.0038 | 996.685 |
| 0.0039 | 996.684 |
| 0.0046 | 996.644 |
| 0.0046 | 996.644 |
Sources
- Viscosity of Associated Mixtures Approximated by the Grunberg-Nissan Model
- Measurements of heat capacities and turbidities for binary mixtures {water + 2,6-dimethylpyridine} and {water, or heavy water + 2,6-dimethylpiperidine} in the critical regions
- Determination of Infinite Dilution Partial Molar Excess Enthalpies and Volumes for Some Ionic Liquid Precursors in Water and Methanol Using Tandem Flow Mixing Calorimetry and Vibrating-Tube Densimetry