- Name
- Nanofin
- InChI
- InChI=1S/C7H15N/c1-6-4-3-5-7(2)8-6/h6-8H,3-5H2,1-2H3
- InChI Key
- SDGKUVSVPIIUCF-UHFFFAOYSA-N
- Formula
- C7H15N
- SMILES
- CC1CCCC(C)N1
- Mol. Weight (g/mol)
- 113.20
- CAS
- 504-03-0
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Lower consolute composition: mole fraction
- Heat capacity at constant pressure per volume, J/K/m3 (2)
- Lower consolute temperature, K (2)
Lower consolute composition: mole fraction of Nanofin (1) [ref]
| Lower consolute composition: mole fraction of Nanofin (1) - Liquid mixture 1 |
|---|
| 0.0550 |
Heat capacity at constant pressure per volume, J/K/m3 [ref]
Operational condition: Mole fraction = 0.055 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Heat capacity at constant pressure per volume, J/K/m3 - Liquid mixture 1 |
|---|---|
| 264.00 | 4559000.00 |
| 264.47 | 4560000.00 |
| 264.95 | 4546000.00 |
| 265.42 | 4529000.00 |
| 265.90 | 4518000.00 |
| 266.37 | 4505000.00 |
| 266.84 | 4492000.00 |
| 267.32 | 4480000.00 |
| 267.79 | 4471000.00 |
| 268.26 | 4448000.00 |
| 268.74 | 4442000.00 |
| 269.21 | 4429000.00 |
| 269.68 | 4420000.00 |
| 270.16 | 4409000.00 |
| 270.63 | 4398000.00 |
| 271.10 | 4391000.00 |
| 271.58 | 4375000.00 |
| 272.05 | 4367000.00 |
| 272.52 | 4356000.00 |
| 273.00 | 4342000.00 |
| 273.47 | 4341000.00 |
| 273.94 | 4336000.00 |
| 274.42 | 4322000.00 |
| 274.89 | 4313000.00 |
| 275.36 | 4305000.00 |
| 275.84 | 4293000.00 |
| 276.31 | 4289000.00 |
| 276.78 | 4278000.00 |
| 277.25 | 4274000.00 |
| 277.73 | 4266000.00 |
| 278.20 | 4260000.00 |
| 278.68 | 4252000.00 |
| 279.15 | 4250000.00 |
| 279.62 | 4239000.00 |
| 280.10 | 4237000.00 |
| 280.57 | 4227000.00 |
| 281.04 | 4227000.00 |
| 281.51 | 4221000.00 |
| 281.99 | 4216000.00 |
| 282.46 | 4215000.00 |
| 282.94 | 4208000.00 |
| 283.41 | 4206000.00 |
| 283.88 | 4199000.00 |
| 284.36 | 4195000.00 |
| 284.83 | 4191000.00 |
| 285.30 | 4189000.00 |
| 285.77 | 4182000.00 |
| 286.25 | 4178000.00 |
| 286.72 | 4177000.00 |
| 287.19 | 4174000.00 |
| 287.67 | 4174000.00 |
| 288.14 | 4172000.00 |
| 288.61 | 4170000.00 |
| 289.09 | 4171000.00 |
| 289.56 | 4167000.00 |
| 290.03 | 4166000.00 |
| 290.51 | 4165000.00 |
| 290.98 | 4166000.00 |
| 291.45 | 4165000.00 |
| 291.93 | 4166000.00 |
| 292.60 | 4164000.00 |
| 292.81 | 4147000.00 |
| 293.02 | 4141000.00 |
| 293.23 | 4164000.00 |
| 293.45 | 4134000.00 |
| 293.66 | 4144000.00 |
| 293.87 | 4164000.00 |
| 294.08 | 4166000.00 |
| 294.30 | 4164000.00 |
| 294.51 | 4144000.00 |
| 294.72 | 4183000.00 |
| 294.93 | 4155000.00 |
| 295.14 | 4142000.00 |
| 295.36 | 4144000.00 |
| 295.57 | 4153000.00 |
| 295.78 | 4178000.00 |
| 295.99 | 4155000.00 |
| 296.20 | 4175000.00 |
| 296.42 | 4213000.00 |
| 296.63 | 4189000.00 |
| 296.84 | 4188000.00 |
| 297.06 | 4228000.00 |
| 297.27 | 4210000.00 |
| 297.48 | 4217000.00 |
| 297.69 | 4232000.00 |
| 297.90 | 4249000.00 |
| 298.12 | 4247000.00 |
| 298.33 | 4277000.00 |
| 298.54 | 4280000.00 |
| 298.75 | 4295000.00 |
| 298.96 | 4312000.00 |
| 299.18 | 4375000.00 |
| 299.39 | 4534000.00 |
Heat capacity at constant pressure per volume, J/K/m3 [ref]
Operational conditions:
- Pressure, kPa = 102.6 (Liquid)
- Mole fraction = 0.055 (Liquid)
| Temperature, K - Liquid | Heat capacity at constant pressure per volume, J/K/m3 - Liquid |
|---|---|
| 299.60 | 5314000.00 |
| 299.81 | 5077000.00 |
| 300.03 | 5010000.00 |
| 300.24 | 4873000.00 |
| 300.45 | 4815000.00 |
| 300.66 | 4801000.00 |
| 300.88 | 4772000.00 |
| 301.09 | 4785000.00 |
| 301.30 | 4742000.00 |
| 301.51 | 4632000.00 |
| 301.73 | 4641000.00 |
| 301.94 | 4672000.00 |
| 302.15 | 4625000.00 |
| 302.36 | 4675000.00 |
| 302.57 | 4597000.00 |
| 302.79 | 4600000.00 |
| 303.00 | 4544000.00 |
| 303.21 | 4578000.00 |
| 303.42 | 4592000.00 |
| 303.64 | 4555000.00 |
| 303.85 | 4564000.00 |
| 304.06 | 4532000.00 |
| 304.27 | 4520000.00 |
| 304.49 | 4530000.00 |
| 304.70 | 4519000.00 |
| 304.91 | 4468000.00 |
| 305.12 | 4514000.00 |
| 305.33 | 4463000.00 |
| 305.55 | 4423000.00 |
| 305.76 | 4443000.00 |
Lower consolute temperature, K [ref]
| Lower consolute temperature, K - Liquid mixture 1 |
|---|
| 299.48 |
Lower consolute temperature, K [ref]
| Lower consolute temperature, K - Liquid mixture 1 |
|---|
| 299.16 |