- Name
- Acetamide
- InChI
- InChI=1S/C2H5NO/c1-2(3)4/h1H3,(H2,3,4)
- InChI Key
- DLFVBJFMPXGRIB-UHFFFAOYSA-N
- Formula
- C2H5NO
- SMILES
- CC(N)=O
- Mol. Weight (g/mol)
- 59.07
- CAS
- 60-35-5
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Acetamide (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Acetamide (1) - Liquid |
|---|---|
| 278.15 | 0.3087 |
| 283.15 | 0.3424 |
| 288.15 | 0.3709 |
| 293.15 | 0.4017 |
| 298.15 | 0.4431 |
| 303.15 | 0.4775 |
| 308.15 | 0.5149 |
| 313.15 | 0.5563 |
| 318.15 | 0.5913 |
| 323.15 | 0.6308 |
| 328.15 | 0.6773 |
| 333.15 | 0.7213 |
Mole fraction of Acetamide (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Acetamide (1) - Liquid |
|---|---|
| 278.15 | 0.3087 |
| 283.15 | 0.3424 |
| 288.15 | 0.3709 |
| 293.15 | 0.4017 |
| 298.15 | 0.4431 |
| 303.15 | 0.4775 |
| 308.15 | 0.5149 |
| 313.15 | 0.5563 |
| 318.15 | 0.5913 |
| 323.15 | 0.6308 |
| 328.15 | 0.6773 |
| 333.15 | 0.7213 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Initial molality of solute, mol/kg - Liquid | Final molality of solute, mol/kg - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
| 293.15 | 0.5999 | 0.2736 | 0.0060 |
| 293.15 | 0.7962 | 0.3608 | 0.0099 |
| 293.15 | 1.0007 | 0.4507 | 0.0170 |
| 293.15 | 1.1989 | 0.5367 | 0.0210 |
| 293.15 | 1.3991 | 0.6225 | 0.0254 |
| 293.15 | 1.5981 | 0.7068 | 0.0308 |
| 293.15 | 1.7995 | 0.7911 | 0.0377 |
| 293.15 | 1.9988 | 0.8735 | 0.0437 |
| 293.15 | 2.5014 | 1.0771 | 0.0581 |
| 293.15 | 2.9965 | 1.2718 | 0.0786 |
| 298.15 | 0.5918 | 0.2880 | 0.0058 |
| 298.15 | 0.7999 | 0.3952 | 0.0097 |
| 298.15 | 0.9989 | 0.4804 | 0.0130 |
| 298.15 | 1.125 | 0.5391 | 0.0180 |
| 298.15 | 1.397 | 0.6643 | 0.0232 |
| 298.15 | 1.5921 | 0.7528 | 0.0282 |
| 298.15 | 1.7916 | 0.8423 | 0.0340 |
| 298.15 | 2.0111 | 0.9603 | 0.0371 |
| 298.15 | 2.5037 | 1.1794 | 0.0515 |
| 298.15 | 2.9987 | 1.3633 | 0.0676 |
| 303.15 | 0.6059 | 0.3010 | 0.0039 |
| 303.15 | 0.7961 | 0.3933 | 0.0041 |
| 303.15 | 1.0029 | 0.4925 | 0.0078 |
| 303.15 | 1.2102 | 0.5909 | 0.0137 |
| 303.15 | 1.4056 | 0.6825 | 0.0163 |
| 303.15 | 1.6008 | 0.7731 | 0.0233 |
| 303.15 | 1.8035 | 0.8661 | 0.0275 |
| 303.15 | 1.9943 | 0.9527 | 0.0334 |
| 303.15 | 2.4947 | 1.1755 | 0.0485 |
| 303.15 | 3.0017 | 1.3951 | 0.0623 |
| 308.15 | 0.6000 | 0.2736 | 0.0010 |
| 308.15 | 0.8030 | 0.3639 | 0.0022 |
| 308.15 | 1.0024 | 0.4514 | 0.0058 |
| 308.15 | 1.1976 | 0.5362 | 0.0107 |
| 308.15 | 1.4047 | 0.6249 | 0.0166 |
| 308.15 | 1.5989 | 0.7072 | 0.0208 |
| 308.15 | 1.7975 | 0.7903 | 0.0286 |
| 308.15 | 1.9813 | 0.8663 | 0.0311 |
| 308.15 | 2.5006 | 1.0767 | 0.0456 |
| 308.15 | 3.0107 | 1.2773 | 0.0600 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Initial molality of solute, mol/kg - Liquid | Final molality of solute, mol/kg - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
| 0.1000 | 0.0507 | -0.0035 |
| 0.1500 | 0.0760 | -0.0037 |
| 0.1800 | 0.0912 | -0.0039 |
| 0.2000 | 0.1013 | -0.0040 |
| 0.2200 | 0.1114 | -0.0041 |
| 0.2500 | 0.1265 | -0.0043 |
| 0.2800 | 0.1416 | -0.0045 |
| 0.3000 | 0.1517 | -0.0046 |
| 0.3200 | 0.1617 | -0.0048 |
| 0.3500 | 0.1768 | -0.0051 |
| 0.3800 | 0.1919 | -0.0053 |
| 0.4000 | 0.2019 | -0.0055 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Initial molality of solute, mol/kg - Liquid | Final molality of solute, mol/kg - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
| 293.15 | 0.5999 | 0.2736 | 0.0060 |
| 293.15 | 0.7962 | 0.3608 | 0.0099 |
| 293.15 | 1.0007 | 0.4507 | 0.0170 |
| 293.15 | 1.1989 | 0.5367 | 0.0210 |
| 293.15 | 1.3991 | 0.6225 | 0.0254 |
| 293.15 | 1.5981 | 0.7068 | 0.0308 |
| 293.15 | 1.7995 | 0.7911 | 0.0377 |
| 293.15 | 1.9988 | 0.8735 | 0.0437 |
| 293.15 | 2.5014 | 1.0771 | 0.0581 |
| 293.15 | 2.9965 | 1.2718 | 0.0786 |
| 298.15 | 0.5918 | 0.2880 | 0.0058 |
| 298.15 | 0.7999 | 0.3952 | 0.0097 |
| 298.15 | 0.9989 | 0.4804 | 0.0130 |
| 298.15 | 1.125 | 0.5391 | 0.0180 |
| 298.15 | 1.397 | 0.6643 | 0.0232 |
| 298.15 | 1.5921 | 0.7528 | 0.0282 |
| 298.15 | 1.7916 | 0.8423 | 0.0340 |
| 298.15 | 2.0111 | 0.9603 | 0.0371 |
| 298.15 | 2.5037 | 1.1794 | 0.0515 |
| 298.15 | 2.9987 | 1.3633 | 0.0676 |
| 303.15 | 0.6059 | 0.3010 | 0.0039 |
| 303.15 | 0.7961 | 0.3933 | 0.0041 |
| 303.15 | 1.0029 | 0.4925 | 0.0078 |
| 303.15 | 1.2102 | 0.5909 | 0.0137 |
| 303.15 | 1.4056 | 0.6825 | 0.0163 |
| 303.15 | 1.6008 | 0.7731 | 0.0233 |
| 303.15 | 1.8035 | 0.8661 | 0.0275 |
| 303.15 | 1.9943 | 0.9527 | 0.0334 |
| 303.15 | 2.4947 | 1.1755 | 0.0485 |
| 303.15 | 3.0017 | 1.3951 | 0.0623 |
| 308.15 | 0.6000 | 0.2736 | 0.0010 |
| 308.15 | 0.8030 | 0.3639 | 0.0022 |
| 308.15 | 1.0024 | 0.4514 | 0.0058 |
| 308.15 | 1.1976 | 0.5362 | 0.0107 |
| 308.15 | 1.4047 | 0.6249 | 0.0166 |
| 308.15 | 1.5989 | 0.7072 | 0.0208 |
| 308.15 | 1.7975 | 0.7903 | 0.0286 |
| 308.15 | 1.9813 | 0.8663 | 0.0311 |
| 308.15 | 2.5006 | 1.0767 | 0.0456 |
| 308.15 | 3.0107 | 1.2773 | 0.0600 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Initial molality of solute, mol/kg - Liquid | Final molality of solute, mol/kg - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
| 0.1000 | 0.0507 | -0.0035 |
| 0.1500 | 0.0760 | -0.0037 |
| 0.1800 | 0.0912 | -0.0039 |
| 0.2000 | 0.1013 | -0.0040 |
| 0.2200 | 0.1114 | -0.0041 |
| 0.2500 | 0.1265 | -0.0043 |
| 0.2800 | 0.1416 | -0.0045 |
| 0.3000 | 0.1517 | -0.0046 |
| 0.3200 | 0.1617 | -0.0048 |
| 0.3500 | 0.1768 | -0.0051 |
| 0.3800 | 0.1919 | -0.0053 |
| 0.4000 | 0.2019 | -0.0055 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 75 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Acetamide (1) - Liquid | Mass density, kg/m3 - Liquid |
| 275.66 | 0.1020 | 1000.473 |
| 275.66 | 0.2015 | 1000.955 |
| 275.66 | 0.2995 | 1001.416 |
| 275.66 | 0.4032 | 1001.902 |
| 275.66 | 0.4848 | 1002.29 |
| 275.66 | 0.5945 | 1002.811 |
| 275.66 | 0.6875 | 1003.243 |
| 275.66 | 0.7747 | 1003.644 |
| 276.14 | 0.0968 | 1000.432 |
| 276.14 | 0.2023 | 1000.928 |
| 276.14 | 0.3049 | 1001.423 |
| 276.14 | 0.4077 | 1001.906 |
| 276.14 | 0.5003 | 1002.345 |
| 276.14 | 0.6016 | 1002.823 |
| 276.14 | 0.7037 | 1003.303 |
| 276.14 | 0.8092 | 1003.786 |
| 276.61 | 0.1016 | 1000.37 |
| 276.61 | 0.1972 | 1000.905 |
| 276.61 | 0.2990 | 1001.387 |
| 276.61 | 0.4078 | 1001.903 |
| 276.61 | 0.4957 | 1002.321 |
| 276.61 | 0.6048 | 1002.826 |
| 276.61 | 0.6858 | 1003.208 |
| 276.61 | 0.8092 | 1003.782 |
| 277.15 | 0.0968 | 1000.432 |
| 277.15 | 0.2023 | 1000.928 |
| 277.15 | 0.3049 | 1001.409 |
| 277.15 | 0.4077 | 1001.884 |
| 277.15 | 0.5003 | 1002.32 |
| 277.15 | 0.6016 | 1002.796 |
| 277.15 | 0.7037 | 1003.278 |
| 277.15 | 0.8092 | 1003.774 |
| 277.61 | 0.1016 | 1000.447 |
| 277.61 | 0.1972 | 1000.907 |
| 277.61 | 0.2990 | 1001.383 |
| 277.61 | 0.4078 | 1001.888 |
| 277.61 | 0.4957 | 1002.289 |
| 277.61 | 0.6048 | 1002.793 |
| 277.61 | 0.6858 | 1003.163 |
| 277.61 | 0.8092 | 1003.734 |
| 278.12 | 0.1016 | 1000.435 |
| 278.12 | 0.1972 | 1000.881 |
| 278.12 | 0.2990 | 1001.353 |
| 278.12 | 0.4078 | 1001.854 |
| 278.12 | 0.4957 | 1002.266 |
| 278.12 | 0.6048 | 1002.771 |
| 278.12 | 0.6858 | 1003.147 |
| 278.12 | 0.8092 | 1003.73 |
| 278.68 | 0.1020 | 1000.431 |
| 278.68 | 0.2015 | 1000.9 |
| 278.68 | 0.2995 | 1001.357 |
| 278.68 | 0.4032 | 1001.828 |
| 278.68 | 0.4848 | 1002.206 |
| 278.68 | 0.5945 | 1002.695 |
| 278.68 | 0.6875 | 1003.117 |
| 278.68 | 0.7747 | 1003.511 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetamide (1) - Liquid | Mass density, kg/m3 - Liquid |
| 278.15 | 0.0000 | 999.96 |
| 278.15 | 0.0045 | 1001.13 |
| 278.15 | 0.0070 | 1001.77 |
| 278.15 | 0.0126 | 1003.21 |
| 278.15 | 0.0221 | 1005.68 |
| 278.15 | 0.0370 | 1009.47 |
| 278.15 | 0.0499 | 1012.61 |
| 278.15 | 0.0607 | 1015.11 |
| 278.15 | 0.0796 | 1019.24 |
| 278.15 | 0.0946 | 1022.32 |
| 278.15 | 0.1128 | 1025.82 |
| 278.15 | 0.1325 | 1029.34 |
| 278.15 | 0.1590 | 1033.54 |
| 278.15 | 0.1991 | 1038.57 |
| 278.15 | 0.2503 | 1043.75 |
| 288.15 | 0.0000 | 999.1 |
| 288.15 | 0.0045 | 1000.13 |
| 288.15 | 0.0070 | 1000.68 |
| 288.15 | 0.0126 | 1001.93 |
| 288.15 | 0.0221 | 1004.08 |
| 288.15 | 0.0370 | 1007.37 |
| 288.15 | 0.0499 | 1010.12 |
| 288.15 | 0.0607 | 1012.3 |
| 288.15 | 0.0796 | 1015.92 |
| 288.15 | 0.0946 | 1018.65 |
| 288.15 | 0.1128 | 1021.71 |
| 288.15 | 0.1325 | 1024.81 |
| 288.15 | 0.1590 | 1028.5 |
| 288.15 | 0.1991 | 1032.99 |
| 288.15 | 0.2503 | 1037.61 |
| 288.15 | 0.3039 | 1041.06 |
| 288.15 | 0.3456 | 1043.19 |
| 298.15 | 0.0000 | 997.04 |
| 298.15 | 0.0045 | 997.95 |
| 298.15 | 0.0070 | 998.45 |
| 298.15 | 0.0126 | 999.55 |
| 298.15 | 0.0221 | 1001.45 |
| 298.15 | 0.0370 | 1004.39 |
| 298.15 | 0.0499 | 1006.82 |
| 298.15 | 0.0607 | 1008.75 |
| 298.15 | 0.0796 | 1011.95 |
| 298.15 | 0.0946 | 1014.35 |
| 298.15 | 0.1128 | 1017.06 |
| 298.15 | 0.1325 | 1019.79 |
| 298.15 | 0.1590 | 1023.07 |
| 298.15 | 0.1991 | 1027.09 |
| 298.15 | 0.2503 | 1031.18 |
| 298.15 | 0.3039 | 1034.29 |
| 298.15 | 0.3456 | 1036.18 |
| 298.15 | 0.3875 | 1037.52 |
| 308.15 | 0.0000 | 994.03 |
| 308.15 | 0.0045 | 994.84 |
| 308.15 | 0.0070 | 995.28 |
| 308.15 | 0.0126 | 996.27 |
| 308.15 | 0.0221 | 997.97 |
| 308.15 | 0.0370 | 1000.6 |
| 308.15 | 0.0499 | 1002.79 |
| 308.15 | 0.0607 | 1004.54 |
| 308.15 | 0.0796 | 1007.37 |
| 308.15 | 0.0946 | 1009.49 |
| 308.15 | 0.1128 | 1011.89 |
| 308.15 | 0.1325 | 1014.32 |
| 308.15 | 0.1590 | 1017.25 |
| 308.15 | 0.1991 | 1020.83 |
| 308.15 | 0.2503 | 1024.52 |
| 308.15 | 0.3039 | 1027.28 |
| 308.15 | 0.3456 | 1028.97 |
| 308.15 | 0.3875 | 1030.2 |
| 323.15 | 0.0000 | 988.03 |
| 323.15 | 0.0045 | 988.72 |
| 323.15 | 0.0070 | 989.09 |
| 323.15 | 0.0126 | 989.94 |
| 323.15 | 0.0221 | 991.4 |
| 323.15 | 0.0370 | 993.65 |
| 323.15 | 0.0499 | 995.48 |
| 323.15 | 0.0607 | 996.95 |
| 323.15 | 0.0796 | 999.36 |
| 323.15 | 0.0946 | 1001.16 |
| 323.15 | 0.1128 | 1003.22 |
| 323.15 | 0.1325 | 1005.31 |
| 323.15 | 0.1590 | 1007.78 |
| 323.15 | 0.1991 | 1010.87 |
| 323.15 | 0.2503 | 1013.96 |
| 323.15 | 0.3039 | 1016.34 |
| 323.15 | 0.3456 | 1017.76 |
| 323.15 | 0.3875 | 1018.81 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 75 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Acetamide (1) - Liquid | Mass density, kg/m3 - Liquid |
| 275.66 | 0.1020 | 1000.473 |
| 275.66 | 0.2015 | 1000.955 |
| 275.66 | 0.2995 | 1001.416 |
| 275.66 | 0.4032 | 1001.902 |
| 275.66 | 0.4848 | 1002.29 |
| 275.66 | 0.5945 | 1002.811 |
| 275.66 | 0.6875 | 1003.243 |
| 275.66 | 0.7747 | 1003.644 |
| 276.14 | 0.0968 | 1000.432 |
| 276.14 | 0.2023 | 1000.928 |
| 276.14 | 0.3049 | 1001.423 |
| 276.14 | 0.4077 | 1001.906 |
| 276.14 | 0.5003 | 1002.345 |
| 276.14 | 0.6016 | 1002.823 |
| 276.14 | 0.7037 | 1003.303 |
| 276.14 | 0.8092 | 1003.786 |
| 276.61 | 0.1016 | 1000.37 |
| 276.61 | 0.1972 | 1000.905 |
| 276.61 | 0.2990 | 1001.387 |
| 276.61 | 0.4078 | 1001.903 |
| 276.61 | 0.4957 | 1002.321 |
| 276.61 | 0.6048 | 1002.826 |
| 276.61 | 0.6858 | 1003.208 |
| 276.61 | 0.8092 | 1003.782 |
| 277.15 | 0.0968 | 1000.432 |
| 277.15 | 0.2023 | 1000.928 |
| 277.15 | 0.3049 | 1001.409 |
| 277.15 | 0.4077 | 1001.884 |
| 277.15 | 0.5003 | 1002.32 |
| 277.15 | 0.6016 | 1002.796 |
| 277.15 | 0.7037 | 1003.278 |
| 277.15 | 0.8092 | 1003.774 |
| 277.61 | 0.1016 | 1000.447 |
| 277.61 | 0.1972 | 1000.907 |
| 277.61 | 0.2990 | 1001.383 |
| 277.61 | 0.4078 | 1001.888 |
| 277.61 | 0.4957 | 1002.289 |
| 277.61 | 0.6048 | 1002.793 |
| 277.61 | 0.6858 | 1003.163 |
| 277.61 | 0.8092 | 1003.734 |
| 278.12 | 0.1016 | 1000.435 |
| 278.12 | 0.1972 | 1000.881 |
| 278.12 | 0.2990 | 1001.353 |
| 278.12 | 0.4078 | 1001.854 |
| 278.12 | 0.4957 | 1002.266 |
| 278.12 | 0.6048 | 1002.771 |
| 278.12 | 0.6858 | 1003.147 |
| 278.12 | 0.8092 | 1003.73 |
| 278.68 | 0.1020 | 1000.431 |
| 278.68 | 0.2015 | 1000.9 |
| 278.68 | 0.2995 | 1001.357 |
| 278.68 | 0.4032 | 1001.828 |
| 278.68 | 0.4848 | 1002.206 |
| 278.68 | 0.5945 | 1002.695 |
| 278.68 | 0.6875 | 1003.117 |
| 278.68 | 0.7747 | 1003.511 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetamide (1) - Liquid | Mass density, kg/m3 - Liquid |
| 278.15 | 0.0000 | 999.96 |
| 278.15 | 0.0045 | 1001.13 |
| 278.15 | 0.0070 | 1001.77 |
| 278.15 | 0.0126 | 1003.21 |
| 278.15 | 0.0221 | 1005.68 |
| 278.15 | 0.0370 | 1009.47 |
| 278.15 | 0.0499 | 1012.61 |
| 278.15 | 0.0607 | 1015.11 |
| 278.15 | 0.0796 | 1019.24 |
| 278.15 | 0.0946 | 1022.32 |
| 278.15 | 0.1128 | 1025.82 |
| 278.15 | 0.1325 | 1029.34 |
| 278.15 | 0.1590 | 1033.54 |
| 278.15 | 0.1991 | 1038.57 |
| 278.15 | 0.2503 | 1043.75 |
| 288.15 | 0.0000 | 999.1 |
| 288.15 | 0.0045 | 1000.13 |
| 288.15 | 0.0070 | 1000.68 |
| 288.15 | 0.0126 | 1001.93 |
| 288.15 | 0.0221 | 1004.08 |
| 288.15 | 0.0370 | 1007.37 |
| 288.15 | 0.0499 | 1010.12 |
| 288.15 | 0.0607 | 1012.3 |
| 288.15 | 0.0796 | 1015.92 |
| 288.15 | 0.0946 | 1018.65 |
| 288.15 | 0.1128 | 1021.71 |
| 288.15 | 0.1325 | 1024.81 |
| 288.15 | 0.1590 | 1028.5 |
| 288.15 | 0.1991 | 1032.99 |
| 288.15 | 0.2503 | 1037.61 |
| 288.15 | 0.3039 | 1041.06 |
| 288.15 | 0.3456 | 1043.19 |
| 298.15 | 0.0000 | 997.04 |
| 298.15 | 0.0045 | 997.95 |
| 298.15 | 0.0070 | 998.45 |
| 298.15 | 0.0126 | 999.55 |
| 298.15 | 0.0221 | 1001.45 |
| 298.15 | 0.0370 | 1004.39 |
| 298.15 | 0.0499 | 1006.82 |
| 298.15 | 0.0607 | 1008.75 |
| 298.15 | 0.0796 | 1011.95 |
| 298.15 | 0.0946 | 1014.35 |
| 298.15 | 0.1128 | 1017.06 |
| 298.15 | 0.1325 | 1019.79 |
| 298.15 | 0.1590 | 1023.07 |
| 298.15 | 0.1991 | 1027.09 |
| 298.15 | 0.2503 | 1031.18 |
| 298.15 | 0.3039 | 1034.29 |
| 298.15 | 0.3456 | 1036.18 |
| 298.15 | 0.3875 | 1037.52 |
| 308.15 | 0.0000 | 994.03 |
| 308.15 | 0.0045 | 994.84 |
| 308.15 | 0.0070 | 995.28 |
| 308.15 | 0.0126 | 996.27 |
| 308.15 | 0.0221 | 997.97 |
| 308.15 | 0.0370 | 1000.6 |
| 308.15 | 0.0499 | 1002.79 |
| 308.15 | 0.0607 | 1004.54 |
| 308.15 | 0.0796 | 1007.37 |
| 308.15 | 0.0946 | 1009.49 |
| 308.15 | 0.1128 | 1011.89 |
| 308.15 | 0.1325 | 1014.32 |
| 308.15 | 0.1590 | 1017.25 |
| 308.15 | 0.1991 | 1020.83 |
| 308.15 | 0.2503 | 1024.52 |
| 308.15 | 0.3039 | 1027.28 |
| 308.15 | 0.3456 | 1028.97 |
| 308.15 | 0.3875 | 1030.2 |
| 323.15 | 0.0000 | 988.03 |
| 323.15 | 0.0045 | 988.72 |
| 323.15 | 0.0070 | 989.09 |
| 323.15 | 0.0126 | 989.94 |
| 323.15 | 0.0221 | 991.4 |
| 323.15 | 0.0370 | 993.65 |
| 323.15 | 0.0499 | 995.48 |
| 323.15 | 0.0607 | 996.95 |
| 323.15 | 0.0796 | 999.36 |
| 323.15 | 0.0946 | 1001.16 |
| 323.15 | 0.1128 | 1003.22 |
| 323.15 | 0.1325 | 1005.31 |
| 323.15 | 0.1590 | 1007.78 |
| 323.15 | 0.1991 | 1010.87 |
| 323.15 | 0.2503 | 1013.96 |
| 323.15 | 0.3039 | 1016.34 |
| 323.15 | 0.3456 | 1017.76 |
| 323.15 | 0.3875 | 1018.81 |
Sources
- Influence of aliphatic amides on the temperature of maximum density of water
- The (p-Vm-T-x) properties of {water (1) + acetamide (2)} mixtures in the range 278.15-323.15 K and 0.10-100 MPa
- Enthalpy of dilution of aliphatic amides in aqueous solutions at temperatures between 293.15K and 308.15K
- Enthalpies of Dilution of Acetamide and N,N-Dimethylformamide in Aqueous Sodium Chloride Solutions at 298.15 K
- Solubility of Acetamide, Propionamide, and Butyramide in Water at Temperatures between (278.15 and 333.15) K
Note: These property values are available through the Cheméo API. A free account gives you an access key.