- Name
- p-Xylene
- InChI
- InChI=1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3
- InChI Key
- URLKBWYHVLBVBO-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1ccc(C)cc1
- Mol. Weight (g/mol)
- 106.17
- CAS
- 106-42-3
- Name
- Carbonic acid, dimethyl ester
- InChI
- InChI=1S/C3H6O3/c1-5-3(4)6-2/h1-2H3
- InChI Key
- IEJIGPNLZYLLBP-UHFFFAOYSA-N
- Formula
- C3H6O3
- SMILES
- COC(=O)OC
- Mol. Weight (g/mol)
- 90.08
- CAS
- 616-38-6
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (2)
- Cp,liquid - Molar heat capacity at constant pressure, J/K/mol
- Excess molar enthalpy (molar enthalpy (2)
- n0 - Refractive index (Na D-line)
- ρl - Mass density, kg/m3
- γ - Surface tension liquid-gas, N/m
- Tboil(P) - Boiling temperature at pressure P, K (2)
Mole fraction of Carbonic acid, dimethyl ester (2) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Carbonic acid, dimethyl ester (2) - Liquid | Mole fraction of Carbonic acid, dimethyl ester (2) - Gas |
|---|---|
| 1.0000 | 1.0000 |
| 0.8276 | 0.9399 |
| 0.7037 | 0.8899 |
| 0.6075 | 0.8517 |
| 0.4878 | 0.7909 |
| 0.4007 | 0.7355 |
| 0.3192 | 0.6730 |
| 0.2637 | 0.6160 |
| 0.2102 | 0.5532 |
| 0.1608 | 0.4728 |
| 0.1197 | 0.3880 |
| 0.0897 | 0.3157 |
| 0.0675 | 0.2542 |
| 0.0429 | 0.1831 |
| 0.0240 | 0.1129 |
| 0.0000 | 0.0000 |
Mole fraction of p-Xylene (1) [ref]
Operational condition: Pressure, kPa = 93.13 (Gas)
| Mole fraction of p-Xylene (1) - Liquid | Mole fraction of p-Xylene (1) - Gas |
|---|---|
| 0.0000 | 0.0000 |
| 0.0551 | 0.0284 |
| 0.1334 | 0.0609 |
| 0.2270 | 0.0852 |
| 0.3045 | 0.1089 |
| 0.3575 | 0.1236 |
| 0.4678 | 0.1598 |
| 0.5688 | 0.1857 |
| 0.7372 | 0.2935 |
| 0.8416 | 0.4386 |
| 0.9369 | 0.6856 |
| 0.9749 | 0.8466 |
| 1.0000 | 1.0000 |
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Carbonic acid, dimethyl ester (2) - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
| 288.15 | 0.0000 | 178.86 |
| 288.15 | 0.0452 | 178.07 |
| 288.15 | 0.0969 | 177.32 |
| 288.15 | 0.2003 | 175.72 |
| 288.15 | 0.3136 | 173.97 |
| 288.15 | 0.4125 | 172.39 |
| 288.15 | 0.4946 | 171.06 |
| 288.15 | 0.5368 | 170.43 |
| 288.15 | 0.6528 | 168.55 |
| 288.15 | 0.8445 | 165.60 |
| 288.15 | 0.9000 | 164.89 |
| 288.15 | 1.0000 | 163.61 |
| 298.15 | 0.0000 | 182.56 |
| 298.15 | 0.0452 | 181.79 |
| 298.15 | 0.0969 | 180.82 |
| 298.15 | 0.2003 | 178.96 |
| 298.15 | 0.3136 | 176.99 |
| 298.15 | 0.4125 | 175.09 |
| 298.15 | 0.4946 | 173.56 |
| 298.15 | 0.5368 | 172.79 |
| 298.15 | 0.6528 | 170.61 |
| 298.15 | 0.8445 | 167.14 |
| 298.15 | 0.9000 | 166.25 |
| 298.15 | 1.0000 | 164.65 |
| 308.15 | 0.0000 | 186.15 |
| 308.15 | 0.0452 | 185.28 |
| 308.15 | 0.0969 | 184.22 |
| 308.15 | 0.2003 | 182.14 |
| 308.15 | 0.3136 | 179.84 |
| 308.15 | 0.4125 | 177.74 |
| 308.15 | 0.4946 | 176.04 |
| 308.15 | 0.5368 | 175.13 |
| 308.15 | 0.6528 | 172.04 |
| 308.15 | 0.8445 | 168.84 |
| 308.15 | 0.9000 | 167.79 |
| 308.15 | 1.0000 | 165.92 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 10200 (Liquid)
| Mole fraction of Carbonic acid, dimethyl ester (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0504 | 0.0668 |
| 0.1026 | 0.1883 |
| 0.1515 | 0.2930 |
| 0.2020 | 0.3560 |
| 0.2524 | 0.4402 |
| 0.3011 | 0.4981 |
| 0.3511 | 0.5725 |
| 0.4022 | 0.6134 |
| 0.4514 | 0.6357 |
| 0.5016 | 0.6402 |
| 0.5524 | 0.6377 |
| 0.6013 | 0.6207 |
| 0.6507 | 0.5976 |
| 0.7004 | 0.5521 |
| 0.7503 | 0.4891 |
| 0.8002 | 0.4324 |
| 0.8502 | 0.3468 |
| 0.9017 | 0.2350 |
| 0.9511 | 0.1074 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Carbonic acid, dimethyl ester (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0504 | 0.1233 |
| 0.1010 | 0.2271 |
| 0.1515 | 0.3502 |
| 0.2020 | 0.4284 |
| 0.2529 | 0.4991 |
| 0.3012 | 0.5552 |
| 0.3512 | 0.6066 |
| 0.4022 | 0.6419 |
| 0.4515 | 0.6633 |
| 0.5016 | 0.6740 |
| 0.5524 | 0.6702 |
| 0.6013 | 0.6517 |
| 0.6507 | 0.6227 |
| 0.7004 | 0.5812 |
| 0.7503 | 0.5231 |
| 0.8003 | 0.4558 |
| 0.8502 | 0.3679 |
| 0.9018 | 0.2598 |
| 0.9511 | 0.1381 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 93 (Liquid)
- Temperature, K = 293.15 (Liquid)
| Mole fraction of p-Xylene (1) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.0000 | 1.3687 |
| 0.0368 | 1.3752 |
| 0.0866 | 1.3835 |
| 0.1570 | 1.3946 |
| 0.2639 | 1.4106 |
| 0.3598 | 1.4241 |
| 0.4244 | 1.4326 |
| 0.5293 | 1.4457 |
| 0.6397 | 1.4586 |
| 0.7655 | 1.4724 |
| 0.8832 | 1.4848 |
| 0.9380 | 1.4898 |
| 1.0000 | 1.4956 |
Mass density, kg/m3 [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of Carbonic acid, dimethyl ester (2) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 100.00 | 0.0432 | 871.8 |
| 288.15 | 100.00 | 0.1950 | 894.2 |
| 288.15 | 100.00 | 0.3968 | 924.2 |
| 288.15 | 100.00 | 0.4933 | 944.9 |
| 288.15 | 100.00 | 0.5296 | 953.3 |
| 288.15 | 100.00 | 0.5993 | 968.4 |
| 288.15 | 100.00 | 0.7034 | 992.3 |
| 288.15 | 100.00 | 0.8023 | 1010.6 |
| 288.15 | 100.00 | 0.8921 | 1038.1 |
| 288.15 | 100.00 | 0.9478 | 1052.9 |
| 288.15 | 5000.00 | 0.0432 | 875.5 |
| 288.15 | 5000.00 | 0.1950 | 897.8 |
| 288.15 | 5000.00 | 0.3968 | 931.9 |
| 288.15 | 5000.00 | 0.4933 | 950.4 |
| 288.15 | 5000.00 | 0.5296 | 957.3 |
| 288.15 | 5000.00 | 0.5993 | 972.4 |
| 288.15 | 5000.00 | 0.7034 | 996.2 |
| 288.15 | 5000.00 | 0.8023 | 1014.9 |
| 288.15 | 5000.00 | 0.8921 | 1042.5 |
| 288.15 | 5000.00 | 0.9478 | 1057.2 |
| 288.15 | 10000.00 | 0.0432 | 879.1 |
| 288.15 | 10000.00 | 0.1950 | 901.3 |
| 288.15 | 10000.00 | 0.3968 | 935.7 |
| 288.15 | 10000.00 | 0.4933 | 954.1 |
| 288.15 | 10000.00 | 0.5296 | 961.2 |
| 288.15 | 10000.00 | 0.5993 | 976.3 |
| 288.15 | 10000.00 | 0.7034 | 1000.3 |
| 288.15 | 10000.00 | 0.8023 | 1019.0 |
| 288.15 | 10000.00 | 0.8921 | 1046.6 |
| 288.15 | 10000.00 | 0.9478 | 1061.4 |
| 288.15 | 20000.00 | 0.0432 | 885.4 |
| 288.15 | 20000.00 | 0.1950 | 907.8 |
| 288.15 | 20000.00 | 0.3968 | 942.5 |
| 288.15 | 20000.00 | 0.4933 | 961.4 |
| 288.15 | 20000.00 | 0.5296 | 968.3 |
| 288.15 | 20000.00 | 0.5993 | 983.7 |
| 288.15 | 20000.00 | 0.7034 | 1007.8 |
| 288.15 | 20000.00 | 0.8023 | 1026.8 |
| 288.15 | 20000.00 | 0.8921 | 1054.5 |
| 288.15 | 20000.00 | 0.9478 | 1069.4 |
| 288.15 | 30000.00 | 0.0432 | 891.3 |
| 288.15 | 30000.00 | 0.1950 | 914.0 |
| 288.15 | 30000.00 | 0.3968 | 949.0 |
| 288.15 | 30000.00 | 0.4933 | 967.9 |
| 288.15 | 30000.00 | 0.5296 | 974.9 |
| 288.15 | 30000.00 | 0.5993 | 990.5 |
| 288.15 | 30000.00 | 0.7034 | 1014.7 |
| 288.15 | 30000.00 | 0.8023 | 1033.9 |
| 288.15 | 30000.00 | 0.8921 | 1061.5 |
| 288.15 | 30000.00 | 0.9478 | 1076.7 |
| 288.15 | 40000.00 | 0.0432 | 897.1 |
| 288.15 | 40000.00 | 0.1950 | 920.1 |
| 288.15 | 40000.00 | 0.3968 | 955.3 |
| 288.15 | 40000.00 | 0.4933 | 974.3 |
| 288.15 | 40000.00 | 0.5296 | 980.9 |
| 288.15 | 40000.00 | 0.5993 | 997.1 |
| 288.15 | 40000.00 | 0.7034 | 1021.4 |
| 288.15 | 40000.00 | 0.8023 | 1040.7 |
| 288.15 | 40000.00 | 0.8921 | 1068.7 |
| 288.15 | 40000.00 | 0.9478 | 1083.8 |
| 298.15 | 100.00 | 0.0432 | 863.0 |
| 298.15 | 100.00 | 0.1950 | 884.5 |
| 298.15 | 100.00 | 0.3968 | 917.8 |
| 298.15 | 100.00 | 0.4933 | 935.8 |
| 298.15 | 100.00 | 0.5296 | 942.5 |
| 298.15 | 100.00 | 0.5993 | 957.3 |
| 298.15 | 100.00 | 0.7034 | 980.5 |
| 298.15 | 100.00 | 0.8023 | 998.4 |
| 298.15 | 100.00 | 0.8921 | 1025.5 |
| 298.15 | 100.00 | 0.9478 | 1040.0 |
| 298.15 | 5000.00 | 0.0432 | 867.3 |
| 298.15 | 5000.00 | 0.1950 | 888.3 |
| 298.15 | 5000.00 | 0.3968 | 922.5 |
| 298.15 | 5000.00 | 0.4933 | 940.6 |
| 298.15 | 5000.00 | 0.5296 | 947.1 |
| 298.15 | 5000.00 | 0.5993 | 962.0 |
| 298.15 | 5000.00 | 0.7034 | 985.4 |
| 298.15 | 5000.00 | 0.8023 | 1003.4 |
| 298.15 | 5000.00 | 0.8921 | 1030.6 |
| 298.15 | 5000.00 | 0.9478 | 1044.9 |
| 298.15 | 10000.00 | 0.0432 | 870.4 |
| 298.15 | 10000.00 | 0.1950 | 892.1 |
| 298.15 | 10000.00 | 0.3968 | 925.8 |
| 298.15 | 10000.00 | 0.4933 | 944.0 |
| 298.15 | 10000.00 | 0.5296 | 950.7 |
| 298.15 | 10000.00 | 0.5993 | 965.7 |
| 298.15 | 10000.00 | 0.7034 | 989.1 |
| 298.15 | 10000.00 | 0.8023 | 1007.3 |
| 298.15 | 10000.00 | 0.8921 | 1034.7 |
| 298.15 | 10000.00 | 0.9478 | 1049.0 |
| 298.15 | 20000.00 | 0.0432 | 877.1 |
| 298.15 | 20000.00 | 0.1950 | 899.2 |
| 298.15 | 20000.00 | 0.3968 | 933.2 |
| 298.15 | 20000.00 | 0.4933 | 951.6 |
| 298.15 | 20000.00 | 0.5296 | 958.2 |
| 298.15 | 20000.00 | 0.5993 | 973.4 |
| 298.15 | 20000.00 | 0.7034 | 997.0 |
| 298.15 | 20000.00 | 0.8023 | 1015.5 |
| 298.15 | 20000.00 | 0.8921 | 1042.9 |
| 298.15 | 20000.00 | 0.9478 | 1057.5 |
| 298.15 | 30000.00 | 0.0432 | 883.4 |
| 298.15 | 30000.00 | 0.1950 | 905.5 |
| 298.15 | 30000.00 | 0.3968 | 939.9 |
| 298.15 | 30000.00 | 0.4933 | 958.7 |
| 298.15 | 30000.00 | 0.5296 | 965.4 |
| 298.15 | 30000.00 | 0.5993 | 980.5 |
| 298.15 | 30000.00 | 0.7034 | 1004.4 |
| 298.15 | 30000.00 | 0.8023 | 1022.7 |
| 298.15 | 30000.00 | 0.8921 | 1050.6 |
| 298.15 | 30000.00 | 0.9478 | 1065.0 |
| 298.15 | 40000.00 | 0.0432 | 889.1 |
| 298.15 | 40000.00 | 0.1950 | 911.7 |
| 298.15 | 40000.00 | 0.3968 | 946.5 |
| 298.15 | 40000.00 | 0.4933 | 965.1 |
| 298.15 | 40000.00 | 0.5296 | 972.0 |
| 298.15 | 40000.00 | 0.5993 | 987.3 |
| 298.15 | 40000.00 | 0.7034 | 1011.2 |
| 298.15 | 40000.00 | 0.8023 | 1030.1 |
| 298.15 | 40000.00 | 0.8921 | 1057.9 |
| 298.15 | 40000.00 | 0.9478 | 1072.7 |
| 308.15 | 100.00 | 0.0432 | 854.3 |
| 308.15 | 100.00 | 0.1950 | 875.2 |
| 308.15 | 100.00 | 0.3968 | 907.6 |
| 308.15 | 100.00 | 0.4933 | 925.2 |
| 308.15 | 100.00 | 0.5296 | 931.7 |
| 308.15 | 100.00 | 0.5993 | 946.3 |
| 308.15 | 100.00 | 0.7034 | 969.0 |
| 308.15 | 100.00 | 0.8023 | 986.4 |
| 308.15 | 100.00 | 0.8921 | 1013.1 |
| 308.15 | 100.00 | 0.9478 | 1027.2 |
| 308.15 | 5000.00 | 0.0432 | 858.1 |
| 308.15 | 5000.00 | 0.1950 | 879.3 |
| 308.15 | 5000.00 | 0.3968 | 912.1 |
| 308.15 | 5000.00 | 0.4933 | 929.7 |
| 308.15 | 5000.00 | 0.5296 | 936.2 |
| 308.15 | 5000.00 | 0.5993 | 950.8 |
| 308.15 | 5000.00 | 0.7034 | 973.7 |
| 308.15 | 5000.00 | 0.8023 | 991.0 |
| 308.15 | 5000.00 | 0.8921 | 1018.0 |
| 308.15 | 5000.00 | 0.9478 | 1032.1 |
| 308.15 | 10000.00 | 0.0432 | 862.0 |
| 308.15 | 10000.00 | 0.1950 | 883.3 |
| 308.15 | 10000.00 | 0.3968 | 916.2 |
| 308.15 | 10000.00 | 0.4933 | 934.1 |
| 308.15 | 10000.00 | 0.5296 | 940.4 |
| 308.15 | 10000.00 | 0.5993 | 955.2 |
| 308.15 | 10000.00 | 0.7034 | 978.2 |
| 308.15 | 10000.00 | 0.8023 | 995.6 |
| 308.15 | 10000.00 | 0.8921 | 1022.7 |
| 308.15 | 10000.00 | 0.9478 | 1036.8 |
| 308.15 | 20000.00 | 0.0432 | 869.1 |
| 308.15 | 20000.00 | 0.1950 | 890.7 |
| 308.15 | 20000.00 | 0.3968 | 924.0 |
| 308.15 | 20000.00 | 0.4933 | 941.8 |
| 308.15 | 20000.00 | 0.5296 | 948.4 |
| 308.15 | 20000.00 | 0.5993 | 958.3 |
| 308.15 | 20000.00 | 0.7034 | 986.4 |
| 308.15 | 20000.00 | 0.8023 | 1004.4 |
| 308.15 | 20000.00 | 0.8921 | 1031.5 |
| 308.15 | 20000.00 | 0.9478 | 1045.7 |
| 308.15 | 30000.00 | 0.0432 | 875.7 |
| 308.15 | 30000.00 | 0.1950 | 897.5 |
| 308.15 | 30000.00 | 0.3968 | 931.2 |
| 308.15 | 30000.00 | 0.4933 | 949.4 |
| 308.15 | 30000.00 | 0.5296 | 956.0 |
| 308.15 | 30000.00 | 0.5993 | 970.9 |
| 308.15 | 30000.00 | 0.7034 | 994.2 |
| 308.15 | 30000.00 | 0.8023 | 1012.2 |
| 308.15 | 30000.00 | 0.8921 | 1039.7 |
| 308.15 | 30000.00 | 0.9478 | 1054.0 |
| 308.15 | 40000.00 | 0.0432 | 881.7 |
| 308.15 | 40000.00 | 0.1950 | 904.0 |
| 308.15 | 40000.00 | 0.3968 | 937.9 |
| 308.15 | 40000.00 | 0.4933 | 956.3 |
| 308.15 | 40000.00 | 0.5296 | 963.0 |
| 308.15 | 40000.00 | 0.5993 | 978.1 |
| 308.15 | 40000.00 | 0.7034 | 1001.5 |
| 308.15 | 40000.00 | 0.8023 | 1019.8 |
| 308.15 | 40000.00 | 0.8921 | 1047.4 |
| 308.15 | 40000.00 | 0.9478 | 1061.7 |
Surface tension liquid-gas, N/m [ref]
Operational condition: Temperature, K = 308.15 (Liquid)
| Mole fraction of Carbonic acid, dimethyl ester (2) - Liquid | Surface tension liquid-gas, N/m - Liquid |
|---|---|
| 0.0503 | 0.0262 |
| 0.1937 | 0.0260 |
| 0.2988 | 0.0258 |
| 0.4013 | 0.0258 |
| 0.5016 | 0.0257 |
| 0.6032 | 0.0257 |
| 0.7029 | 0.0257 |
| 0.7964 | 0.0257 |
| 0.8945 | 0.0260 |
| 0.9442 | 0.0261 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Carbonic acid, dimethyl ester (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 1.0000 | 363.35 |
| 0.8276 | 366.65 |
| 0.7037 | 370.05 |
| 0.6075 | 372.95 |
| 0.4878 | 377.25 |
| 0.4007 | 380.65 |
| 0.3192 | 384.45 |
| 0.2637 | 387.65 |
| 0.2102 | 391.05 |
| 0.1608 | 394.65 |
| 0.1197 | 398.25 |
| 0.0897 | 401.05 |
| 0.0675 | 403.25 |
| 0.0429 | 405.65 |
| 0.0240 | 407.95 |
| 0.0000 | 411.45 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 93.13 (Gas)
| Mole fraction of p-Xylene (1) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 360.73 |
| 0.0551 | 361.49 |
| 0.1334 | 362.26 |
| 0.2270 | 363.55 |
| 0.3045 | 364.62 |
| 0.3575 | 365.49 |
| 0.4678 | 367.65 |
| 0.5688 | 369.75 |
| 0.7372 | 376.35 |
| 0.8416 | 384.79 |
| 0.9369 | 396.71 |
| 0.9749 | 403.24 |
| 1.0000 | 408.37 |
Sources
- Isobaric molar heat capacities of the ternary system dimethyl carbonate + p-xylene + n-decane
- Experimental and Nitta-Chao model prediction of high pressure density of p-xylene with dialkyl carbonates or n-alkanes
- Vapour-liquid equilibrium measurements and extractive distillation process design for separation of azeotropic mixture (dimethyl carbonate + ethanol)
- Isobaric Vapor Liquid Equilibrium Data for the Binary Systems of Dimethyl Carbonate with Xylene Isomers at 93.13 kPa
- Excess Molar Entalpies of Dimethyl Carbonate with o-Xylene, m-Xylene, p-Xylene, Ethylbenzene, or Ethyl Benzoate at 298.15 K
- Excess Molar Enthalpies for Dimethyl Carbonate with o-Xylene, m-Xylene, p-Xylene, Ethylbenzene or Ethyl Benzoate at 298.15 K and 10.2 MPa
- Surface Tension of Dialkyl Carbonates + (Alkanes or 1,4-Dimethylbenzene) and 1,4-Dimethylbenzene + Alkanes Binary Mixtures at T = 308.15 K
Note: These property values are available through the Cheméo API. A free account gives you an access key.