- Name
- Naphthalene, 1,5-dinitro-
- InChI
- InChI=1S/C10H6N2O4/c13-11(14)9-5-1-3-7-8(9)4-2-6-10(7)12(15)16/h1-6H
- InChI Key
- ZUTCJXFCHHDFJS-UHFFFAOYSA-N
- Formula
- C10H6N2O4
- SMILES
-
O=[N+]([O-])c1cccc2c([N+](=O)[
O-])cccc12 - Mol. Weight (g/mol)
- 218.17
- CAS
- 605-71-0
- Name
- Naphthalene, 1,8-dinitro-
- InChI
- InChI=1S/C10H6N2O4/c13-11(14)8-5-1-3-7-4-2-6-9(10(7)8)12(15)16/h1-6H
- InChI Key
- AVCSMMMOCOTIHF-UHFFFAOYSA-N
- Formula
- C10H6N2O4
- SMILES
-
O=[N+]([O-])c1cccc2cccc([N+](=
O)[O-])c12 - Mol. Weight (g/mol)
- 218.17
- CAS
- 602-38-0
- Name
- 2-Pyrrolidinone, 1-methyl-
- InChI
- InChI=1S/C5H9NO/c1-6-4-2-3-5(6)7/h2-4H2,1H3
- InChI Key
- SECXISVLQFMRJM-UHFFFAOYSA-N
- Formula
- C5H9NO
- SMILES
- CN1CCCC1=O
- Mol. Weight (g/mol)
- 99.13
- CAS
- 872-50-4
Datasets
Mass fraction of Naphthalene, 1,8-dinitro- (2) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Naphthalene, 1,5-dinitro- (1) - Liquid | Mass fraction of Naphthalene, 1,8-dinitro- (2) - Liquid |
| 313.15 | 0.0000 | 0.2460 |
| 313.15 | 0.0063 | 0.2386 |
| 313.15 | 0.0152 | 0.2317 |
| 313.15 | 0.0230 | 0.2277 |
| 313.15 | 0.0272 | 0.2261 |
| 328.15 | 0.0000 | 0.2996 |
| 328.15 | 0.0125 | 0.2902 |
| 328.15 | 0.0223 | 0.2874 |
| 328.15 | 0.0293 | 0.2806 |
| 328.15 | 0.0399 | 0.2730 |
| 343.15 | 0.0000 | 0.3542 |
| 343.15 | 0.0066 | 0.3401 |
| 343.15 | 0.0208 | 0.3271 |
| 343.15 | 0.0381 | 0.3234 |
| 343.15 | 0.0620 | 0.3200 |
Mass fraction of Naphthalene, 1,5-dinitro- (1) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Naphthalene, 1,8-dinitro- (2) - Liquid | Mass fraction of Naphthalene, 1,5-dinitro- (1) - Liquid |
| 313.15 | 0.2261 | 0.0272 |
| 313.15 | 0.1991 | 0.0287 |
| 313.15 | 0.1743 | 0.0298 |
| 313.15 | 0.1413 | 0.0310 |
| 313.15 | 0.1061 | 0.0324 |
| 313.15 | 0.0548 | 0.0347 |
| 313.15 | 0.0000 | 0.0388 |
| 328.15 | 0.2730 | 0.0399 |
| 328.15 | 0.2269 | 0.0432 |
| 328.15 | 0.1927 | 0.0454 |
| 328.15 | 0.1565 | 0.0489 |
| 328.15 | 0.1167 | 0.0505 |
| 328.15 | 0.0528 | 0.0553 |
| 328.15 | 0.0000 | 0.0623 |
| 343.15 | 0.3200 | 0.0620 |
| 343.15 | 0.2815 | 0.0652 |
| 343.15 | 0.2415 | 0.0686 |
| 343.15 | 0.1891 | 0.0731 |
| 343.15 | 0.1112 | 0.0810 |
| 343.15 | 0.0551 | 0.0879 |
| 343.15 | 0.0000 | 0.0972 |
Mass fraction of Naphthalene, 1,8-dinitro- (2) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Temperature, K - Liquid | Mass fraction of Naphthalene, 1,8-dinitro- (2) - Liquid |
|---|---|
| 313.15 | 0.2261 |
| 328.15 | 0.2730 |
| 343.15 | 0.3200 |
Mass fraction of Naphthalene, 1,5-dinitro- (1) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Temperature, K - Liquid | Mass fraction of Naphthalene, 1,5-dinitro- (1) - Liquid |
|---|---|
| 313.15 | 0.0272 |
| 328.15 | 0.0399 |
| 343.15 | 0.0620 |
Mass fraction of Naphthalene, 1,8-dinitro- (2) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Naphthalene, 1,5-dinitro- (1) - Liquid | Mass fraction of Naphthalene, 1,8-dinitro- (2) - Liquid |
| 313.15 | 0.0000 | 0.2460 |
| 313.15 | 0.0063 | 0.2386 |
| 313.15 | 0.0152 | 0.2317 |
| 313.15 | 0.0230 | 0.2277 |
| 313.15 | 0.0272 | 0.2261 |
| 328.15 | 0.0000 | 0.2996 |
| 328.15 | 0.0125 | 0.2902 |
| 328.15 | 0.0223 | 0.2874 |
| 328.15 | 0.0293 | 0.2806 |
| 328.15 | 0.0399 | 0.2730 |
| 343.15 | 0.0000 | 0.3542 |
| 343.15 | 0.0066 | 0.3401 |
| 343.15 | 0.0208 | 0.3271 |
| 343.15 | 0.0381 | 0.3234 |
| 343.15 | 0.0620 | 0.3200 |
Mass fraction of Naphthalene, 1,5-dinitro- (1) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Naphthalene, 1,8-dinitro- (2) - Liquid | Mass fraction of Naphthalene, 1,5-dinitro- (1) - Liquid |
| 313.15 | 0.2261 | 0.0272 |
| 313.15 | 0.1991 | 0.0287 |
| 313.15 | 0.1743 | 0.0298 |
| 313.15 | 0.1413 | 0.0310 |
| 313.15 | 0.1061 | 0.0324 |
| 313.15 | 0.0548 | 0.0347 |
| 313.15 | 0.0000 | 0.0388 |
| 328.15 | 0.2730 | 0.0399 |
| 328.15 | 0.2269 | 0.0432 |
| 328.15 | 0.1927 | 0.0454 |
| 328.15 | 0.1565 | 0.0489 |
| 328.15 | 0.1167 | 0.0505 |
| 328.15 | 0.0528 | 0.0553 |
| 328.15 | 0.0000 | 0.0623 |
| 343.15 | 0.3200 | 0.0620 |
| 343.15 | 0.2815 | 0.0652 |
| 343.15 | 0.2415 | 0.0686 |
| 343.15 | 0.1891 | 0.0731 |
| 343.15 | 0.1112 | 0.0810 |
| 343.15 | 0.0551 | 0.0879 |
| 343.15 | 0.0000 | 0.0972 |
Mass fraction of Naphthalene, 1,8-dinitro- (2) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Temperature, K - Liquid | Mass fraction of Naphthalene, 1,8-dinitro- (2) - Liquid |
|---|---|
| 313.15 | 0.2261 |
| 328.15 | 0.2730 |
| 343.15 | 0.3200 |
Mass fraction of Naphthalene, 1,5-dinitro- (1) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Temperature, K - Liquid | Mass fraction of Naphthalene, 1,5-dinitro- (1) - Liquid |
|---|---|
| 313.15 | 0.0272 |
| 328.15 | 0.0399 |
| 343.15 | 0.0620 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.